diff options
Diffstat (limited to 'nixpkgs/maintainers')
17 files changed, 2442 insertions, 826 deletions
diff --git a/nixpkgs/maintainers/maintainer-list.nix b/nixpkgs/maintainers/maintainer-list.nix index 25c5bd078e51..be0cfb4930ca 100644 --- a/nixpkgs/maintainers/maintainer-list.nix +++ b/nixpkgs/maintainers/maintainer-list.nix @@ -10,7 +10,6 @@ github = "GithubUsername"; githubId = your-github-id; keys = [{ - longkeyid = "rsa2048/0x0123456789ABCDEF"; fingerprint = "AAAA BBBB CCCC DDDD EEEE FFFF 0000 1111 2222 3333"; }]; }; @@ -24,7 +23,7 @@ - `matrix` is your Matrix user ID, - `github` is your GitHub handle (as it appears in the URL of your profile page, `https://github.com/<userhandle>`), - `githubId` is your GitHub user ID, which can be found at `https://api.github.com/users/<userhandle>`, - - `keys` is a list of your PGP/GPG key IDs and fingerprints. + - `keys` is a list of your PGP/GPG key fingerprints. `handle == github` is strongly preferred whenever `github` is an acceptable attribute name and is short and convenient. @@ -39,14 +38,18 @@ To get the required PGP/GPG values for a key run ```shell - gpg --keyid-format 0xlong --fingerprint <email> | head -n 2 + gpg --fingerprint <email> | head -n 2 ``` !!! Note that PGP/GPG values stored here are for informational purposes only, don't use this file as a source of truth. More fields may be added in the future, however, in order to comply with GDPR this file should stay as minimal as possible. - Please keep the list alphabetically sorted. + When editing this file: + * keep the list alphabetically sorted + * test the validity of the format with: + nix-build lib/tests/maintainers.nix + See `./scripts/check-maintainer-github-handles.sh` for an example on how to work with this data. */ { @@ -63,7 +66,6 @@ github = "0x4A6F"; githubId = 9675338; keys = [{ - longkeyid = "rsa8192/0x87027528B006D66D"; fingerprint = "F466 A548 AD3F C1F1 8C88 4576 8702 7528 B006 D66D"; }]; }; @@ -73,10 +75,22 @@ github = "0xbe7a"; githubId = 6232980; keys = [{ - longkeyid = "rsa4096/0x6510870A77F49A99"; fingerprint = "2536 9E86 1AA5 9EB7 4C47 B138 6510 870A 77F4 9A99"; }]; }; + _0xC45 = { + email = "jason@0xc45.com"; + name = "Jason Vigil"; + github = "0xC45"; + githubId = 56617252; + matrix = "@oxc45:matrix.org"; + }; + _0xd61 = { + email = "dgl@degit.co"; + name = "Daniel Glinka"; + github = "0xd61"; + githubId = 8351869; + }; _1000101 = { email = "b1000101@pm.me"; github = "1000101"; @@ -89,6 +103,12 @@ github = "1000teslas"; githubId = 47207223; }; + _2gn = { + name = "Hiram Tanner"; + email = "101851090+2gn@users.noreply.github.com"; + github = "2gn"; + githubId = 101851090; + }; _3699n = { email = "nicholas@nvk.pm"; github = "3699n"; @@ -125,6 +145,12 @@ githubId = 241628; name = "Adam Russell"; }; + aacebedo = { + email = "alexandre@acebedo.fr"; + github = "aacebedo"; + githubId = 1217680; + name = "Alexandre Acebedo"; + }; aadibajpai = { email = "hello@aadibajpai.com"; github = "aadibajpai"; @@ -182,7 +208,6 @@ githubId = 2255192; name = "Ashish SHUKLA"; keys = [{ - longkeyid = "rsa4096/0xC746CFA9E74FA4B0"; fingerprint = "F682 CDCC 39DC 0FEA E116 20B6 C746 CFA9 E74F A4B0"; }]; }; @@ -200,7 +225,7 @@ }; abigailbuccaneer = { email = "abigailbuccaneer@gmail.com"; - github = "abigailbuccaneer"; + github = "AbigailBuccaneer"; githubId = 908758; name = "Abigail Bunyan"; }; @@ -322,7 +347,7 @@ }; aethelz = { email = "aethelz@protonmail.com"; - github = "aethelz"; + github = "eugenezastrogin"; githubId = 10677343; name = "Eugene"; }; @@ -380,12 +405,24 @@ githubId = 209175; name = "Alesya Huzik"; }; + aidalgol = { + email = "aidalgol+nixpkgs@fastmail.net"; + github = "aidalgol"; + githubId = 2313201; + name = "Aidan Gauland"; + }; aij = { email = "aij+git@mrph.org"; github = "aij"; githubId = 4732885; name = "Ivan Jager"; }; + aiotter = { + email = "git@aiotter.com"; + github = "aiotter"; + githubId = 37664775; + name = "Yuto Oguchi"; + }; airwoodix = { email = "airwoodix@posteo.me"; github = "airwoodix"; @@ -453,6 +490,12 @@ githubId = 20405311; name = "Aksh Gupta"; }; + alapshin = { + email = "alapshin@fastmail.com"; + github = "alapshin"; + githubId = 321946; + name = "Andrei Lapshin"; + }; albakham = { email = "dev@geber.ga"; github = "albakham"; @@ -504,24 +547,40 @@ alexnortung = { name = "alexnortung"; email = "alex_nortung@live.dk"; - github = "alexnortung"; + github = "Alexnortung"; githubId = 1552267; }; + alexshpilkin = { + email = "ashpilkin@gmail.com"; + github = "alexshpilkin"; + githubId = 1010468; + keys = [{ + fingerprint = "B595 D74D 6615 C010 469F 5A13 73E9 AA11 4B3A 894B"; + }]; + matrix = "@alexshpilkin:matrix.org"; + name = "Alexander Shpilkin"; + }; alexvorobiev = { email = "alexander.vorobiev@gmail.com"; github = "alexvorobiev"; githubId = 782180; name = "Alex Vorobiev"; }; - alex-eyre = { + alexeyre = { email = "A.Eyre@sms.ed.ac.uk"; - github = "alex-eyre"; + github = "alexeyre"; githubId = 38869148; name = "Alex Eyre"; }; + algram = { + email = "aliasgram@gmail.com"; + github = "Algram"; + githubId = 5053729; + name = "Alias Gram"; + }; alibabzo = { email = "alistair.bill@gmail.com"; - github = "alibabzo"; + github = "alistairbill"; githubId = 2822871; name = "Alistair Bill"; }; @@ -531,16 +590,18 @@ githubId = 36147; name = "Alireza Meskin"; }; + alkasm = { + email = "alexreynolds00@gmail.com"; + github = "alkasm"; + githubId = 9651002; + name = "Alexander Reynolds"; + }; alkeryn = { email = "plbraundev@gmail.com"; github = "Alkeryn"; githubId = 11599075; name = "Pierre-Louis Braun"; }; - all = { - email = "nix-commits@lists.science.uu.nl"; - name = "Nix Committers"; - }; allonsy = { email = "linuxbash8@gmail.com"; github = "allonsy"; @@ -553,7 +614,6 @@ github = "AluisioASG"; githubId = 1904165; keys = [{ - longkeyid = "rsa4096/0x9FAA63E097506D9D"; fingerprint = "7FDB 17B3 C29B 5BA6 E5A9 8BB2 9FAA 63E0 9750 6D9D"; }]; }; @@ -563,6 +623,12 @@ githubId = 60479013; name = "Alma Cemerlic"; }; + alternateved = { + email = "alternateved@pm.me"; + github = "alternateved"; + githubId = 45176912; + name = "Tomasz Hołubowicz"; + }; alunduil = { email = "alunduil@gmail.com"; github = "alunduil"; @@ -571,11 +637,10 @@ }; alva = { email = "alva@skogen.is"; - github = "fjallarefur"; + github = "illfygli"; githubId = 42881386; name = "Alva"; keys = [{ - longkeyid = "ed25519/0xF53E323342F7A6D3"; fingerprint = "B422 CFB1 C9EF 73F7 E1E2 698D F53E 3233 42F7 A6D3A"; }]; }; @@ -585,7 +650,6 @@ githubId = 74795488; name = "Alexandra Hollmeier"; keys = [{ - longkeyid = "rsa3072/0x87D1AADCD25B8DEE"; fingerprint = "1F73 8879 5E5A 3DFC E2B3 FA32 87D1 AADC D25B 8DEE"; }]; }; @@ -597,7 +661,7 @@ }; amar1729 = { email = "amar.paul16@gmail.com"; - github = "amar1729"; + github = "Amar1729"; githubId = 15623522; name = "Amar Paul"; }; @@ -619,13 +683,19 @@ githubId = 2626481; name = "Ambroz Bizjak"; }; + amesgen = { + email = "amesgen@amesgen.de"; + github = "amesgen"; + githubId = 15369874; + name = "Alexander Esgen"; + matrix = "@amesgen:amesgen.de"; + }; ametrine = { name = "Matilde Ametrine"; email = "matilde@diffyq.xyz"; github = "matilde-ametrine"; githubId = 90799677; keys = [{ - longkeyid = "rsa3072/0x07EE1FFCA58A11C5"; fingerprint = "7931 EB4E 4712 D7BE 04F8 6D34 07EE 1FFC A58A 11C5"; }]; }; @@ -653,7 +723,6 @@ github = "notbandali"; githubId = 1254858; keys = [{ - longkeyid = "rsa4096/0xA21A020248816103"; fingerprint = "BE62 7373 8E61 6D6D 1B3A 08E8 A21A 0202 4881 6103"; }]; }; @@ -665,10 +734,22 @@ }; amorsillo = { email = "andrew.morsillo@gmail.com"; - github = "AndrewMorsillo"; + github = "evelant"; githubId = 858965; name = "Andrew Morsillo"; }; + an-empty-string = { + name = "Tris Emmy Wilson"; + email = "tris@tris.fyi"; + github = "an-empty-string"; + githubId = 681716; + }; + AnatolyPopov = { + email = "aipopov@live.ru"; + github = "AnatolyPopov"; + githubId = 2312534; + name = "Anatolii Popov"; + }; andehen = { email = "git@andehen.net"; github = "andehen"; @@ -771,13 +852,22 @@ githubId = 11699655; name = "Stanislas Lange"; }; + AngryAnt = { + name = "Emil Johansen"; + email = "git@eej.dk"; + matrix = "@angryant:envs.net"; + github = "AngryAnt"; + githubId = 102513; + keys = [{ + fingerprint = "B7B7 582E 564E 789B FCB8 71AB 0C6D FE2F B234 534A"; + }]; + }; anhdle14 = { name = "Le Anh Duc"; email = "anhdle14@icloud.com"; github = "anhdle14"; githubId = 9645992; keys = [{ - longkeyid = "rsa4096/0x0299AFF9ECBB5169"; fingerprint = "AA4B 8EC3 F971 D350 482E 4E20 0299 AFF9 ECBB 5169"; }]; }; @@ -787,6 +877,15 @@ githubId = 1771266; name = "Vo Anh Duy"; }; + Anillc = { + name = "Anillc"; + email = "i@anillc.cn"; + github = "Anillc"; + githubId = 23411248; + keys = [{ + fingerprint = "6141 1E4F FE10 CE7B 2E14 CD76 0BE8 A88F 47B2 145C"; + }]; + }; anirrudh = { email = "anik597@gmail.com"; github = "anirrudh"; @@ -811,12 +910,35 @@ githubId = 661909; name = "Antonio Nuno Monteiro"; }; + anoa = { + matrix = "@andrewm:amorgan.xyz"; + email = "andrew@amorgan.xyz"; + github = "anoadragon453"; + githubId = 1342360; + name = "Andrew Morgan"; + }; anpryl = { email = "anpryl@gmail.com"; github = "anpryl"; githubId = 5327697; name = "Anatolii Prylutskyi"; }; + anselmschueler = { + email = "mail@anselmschueler.com"; + github = "schuelermine"; + githubId = 48802534; + name = "Anselm Schüler"; + matrix = "@schuelermine:matrix.org"; + }; + anthonyroussel = { + email = "anthony@roussel.dev"; + github = "anthonyroussel"; + githubId = 220084; + name = "Anthony Roussel"; + keys = [{ + fingerprint = "472D 368A F107 F443 F3A5 C712 9DC4 987B 1A55 E75E"; + }]; + }; antoinerg = { email = "roygobeil.antoine@gmail.com"; github = "antoinerg"; @@ -865,7 +987,6 @@ githubId = 17154507; name = "Lein Matsumaru"; keys = [{ - longkeyid = "rsa4096/0xAAA50652F0479205"; fingerprint = "BF8B F725 DA30 E53E 7F11 4ED8 AAA5 0652 F047 9205"; }]; }; @@ -941,6 +1062,12 @@ githubId = 1118815; name = "Vikram Narayanan"; }; + armeenm = { + email = "mahdianarmeen@gmail.com"; + github = "armeenm"; + githubId = 29145250; + name = "Armeen Mahdian"; + }; armijnhemel = { email = "armijn@tjaldur.nl"; github = "armijnhemel"; @@ -961,13 +1088,13 @@ }; arnoutkroeze = { email = "nixpkgs@arnoutkroeze.nl"; - github = "arnoutkroeze"; + github = "ArnoutKroeze"; githubId = 37151054; name = "Arnout Kroeze"; }; arobyn = { email = "shados@shados.net"; - github = "shados"; + github = "Shados"; githubId = 338268; name = "Alexei Robyn"; }; @@ -977,7 +1104,6 @@ githubId = 1226638; name = "Artemis Tosini"; keys = [{ - longkeyid = "rsa4096/0x4FDC96F161E7BA8A"; fingerprint = "3D2B B230 F9FA F0C5 1832 46DD 4FDC 96F1 61E7 BA8A"; }]; }; @@ -1037,8 +1163,8 @@ name = "Kirill Boltaev"; }; ashley = { - email = "personavinny@protonmail.com"; - github = "paranoidcat"; + email = "ashley@kira64.xyz"; + github = "kira64xyz"; githubId = 84152630; name = "Ashley Chiara"; }; @@ -1072,7 +1198,6 @@ githubId = 192147; name = "aszlig"; keys = [{ - longkeyid = "ed25519/0x684089CE67EBB691"; fingerprint = "DD52 6BC7 767D BA28 16C0 95E5 6840 89CE 67EB B691"; }]; }; @@ -1102,16 +1227,28 @@ }; atnnn = { email = "etienne@atnnn.com"; - github = "atnnn"; + github = "AtnNn"; githubId = 706854; name = "Etienne Laurin"; }; + atry = { + name = "Bo Yang"; + email = "atry@fb.com"; + github = "Atry"; + githubId = 601530; + }; attila-lendvai = { name = "Attila Lendvai"; email = "attila@lendvai.name"; github = "attila-lendvai"; githubId = 840345; }; + auchter = { + name = "Michael Auchter"; + email = "a@phire.org"; + github = "auchter"; + githubId = 1190483; + }; auntie = { email = "auntieNeo@gmail.com"; github = "auntieNeo"; @@ -1132,10 +1269,16 @@ }; avaq = { email = "nixpkgs@account.avaq.it"; - github = "avaq"; + github = "Avaq"; githubId = 1217745; name = "Aldwin Vlasblom"; }; + aveltras = { + email = "romain.viallard@outlook.fr"; + github = "aveltras"; + githubId = 790607; + name = "Romain Viallard"; + }; avery = { email = "averyl+nixos@protonmail.com"; github = "AveryLychee"; @@ -1160,7 +1303,6 @@ githubId = 5110816; name = "avitex"; keys = [{ - longkeyid = "rsa4096/0x8B366C443CABE942"; fingerprint = "271E 136C 178E 06FA EA4E B854 8B36 6C44 3CAB E942"; }]; }; @@ -1191,7 +1333,7 @@ artturin = { email = "artturin@artturin.com"; matrix = "@artturin:matrix.org"; - github = "artturin"; + github = "Artturin"; githubId = 56650223; name = "Artturi N"; }; @@ -1202,13 +1344,12 @@ github = "azahi"; githubId = 22211000; keys = [{ - longkeyid = "rsa4096/0xC8C6BDDB3847F72B"; fingerprint = "2688 0377 C31D 9E81 9BDF 83A8 C8C6 BDDB 3847 F72B"; }]; }; ayazhafiz = { email = "ayaz.hafiz.1@gmail.com"; - github = "ayazhafiz"; + github = "hafiz"; githubId = 262763; name = "Ayaz Hafiz"; }; @@ -1218,13 +1359,18 @@ githubId = 9315; name = "Zhong Jianxin"; }; + a-kenji = { + email = "aks.kenji@protonmail.com"; + github = "a-kenji"; + githubId = 65275785; + name = "Alexander Kenji Berthold"; + }; b4dm4n = { email = "fabianm88@gmail.com"; github = "B4dM4n"; githubId = 448169; name = "Fabian Möller"; keys = [{ - longkeyid = "rsa4096/0x754B5C0963C42C5"; fingerprint = "6309 E212 29D4 DA30 AF24 BDED 754B 5C09 63C4 2C50"; }]; }; @@ -1234,7 +1380,6 @@ githubId = 12128029; name = "Bastien Rivière"; keys = [{ - longkeyid = "rsa4096/0xF202AD3B6EDF4BD1"; fingerprint = "2F85 B362 B274 0012 37E2 81EE F202 AD3B 6EDF 4BD1"; }]; }; @@ -1244,7 +1389,6 @@ github = "babbaj"; githubId = 12820770; keys = [{ - longkeyid = "rsa4096/0xF044309848A07CAC"; fingerprint = "6FBC A462 4EAF C69C A7C4 98C1 F044 3098 48A0 7CAC"; }]; }; @@ -1267,10 +1411,6 @@ githubId = 35324; name = "Badi' Abdul-Wahid"; }; - balajisivaraman = { - email = "sivaraman.balaji@gmail.com"; - name = "Balaji Sivaraman"; - }; balodja = { email = "balodja@gmail.com"; github = "balodja"; @@ -1291,7 +1431,7 @@ }; bandresen = { email = "bandresen@gmail.com"; - github = "bandresen"; + github = "bennyandresen"; githubId = 80325; name = "Benjamin Andresen"; }; @@ -1325,7 +1465,6 @@ githubId = 17708295; name = "Wanderson Ferreira"; keys = [{ - longkeyid = "rsa4096/0x56840A614DBE37AE"; fingerprint = "A3E1 C409 B705 50B3 BF41 492B 5684 0A61 4DBE 37AE"; }]; }; @@ -1354,6 +1493,12 @@ githubId = 916366; name = "Brandon Elam Barker"; }; + bbenno = { + email = "nix@bbenno.com"; + github = "bbenno"; + githubId = 32938211; + name = "Benno Bielmeier"; + }; bbigras = { email = "bigras.bruno@gmail.com"; github = "bbigras"; @@ -1378,6 +1523,12 @@ githubId = 164148; name = "Ben Darwin"; }; + bdd = { + email = "bdd@mindcast.org"; + github = "bdd"; + githubId = 11135; + name = "Berk D. Demir"; + }; bdesham = { email = "benjamin@esham.io"; github = "bdesham"; @@ -1427,7 +1578,6 @@ github = "bertof"; githubId = 9915675; keys = [{ - longkeyid = "rsa4096/0xFE98AE5EC52B1056"; fingerprint = "17C5 1EF9 C0FE 2EB2 FE56 BB53 FE98 AE5E C52B 1056"; }]; }; @@ -1480,6 +1630,12 @@ githubId = 410028; name = "Tobias Bergkvist"; }; + berryp = { + email = "berryphillips@gmail.com"; + github = "berryp"; + githubId = 19911; + name = "Berry Phillips"; + }; betaboon = { email = "betaboon@0x80.ninja"; github = "betaboon"; @@ -1528,15 +1684,23 @@ githubId = 13324165; name = "Bill Ewanick"; }; + billhuang = { + email = "bill.huang2001@gmail.com"; + github = "BillHuang2001"; + githubId = 11801831; + name = "Bill Huang"; + }; binarin = { email = "binarin@binarin.ru"; github = "binarin"; githubId = 185443; name = "Alexey Lebedeff"; }; - bjg = { - email = "bjg@gnu.org"; - name = "Brian Gough"; + binsky = { + email = "timo@binsky.org"; + github = "binsky08"; + githubId = 30630233; + name = "Timo Triebensky"; }; bjornfor = { email = "bjorn.forsman@gmail.com"; @@ -1569,12 +1733,6 @@ githubId = 37907; name = "Julian Stecklina"; }; - bloomvdomino = { - name = "Laura Fäßler"; - email = "0x@ytex.de"; - github = "bloomvdomino"; - githubId = 33204710; - }; bluescreen303 = { email = "mathijs@bluescreen303.nl"; github = "bluescreen303"; @@ -1624,6 +1782,16 @@ githubId = 50839; name = "Brian Jones"; }; + booklearner = { + name = "booklearner"; + email = "booklearner@proton.me"; + matrix = "@booklearner:matrix.org"; + github = "booklearner"; + githubId = 103979114; + keys = [{ + fingerprint = "17C7 95D4 871C 2F87 83C8 053D 0C61 C4E5 907F 76C8"; + }]; + }; bootstrap-prime = { email = "bootstrap.prime@gmail.com"; github = "bootstrap-prime"; @@ -1642,7 +1810,6 @@ githubId = 71049646; name = "Zack A"; keys = [{ - longkeyid = "rsa4096/0x6310C97DE31D1545"; fingerprint = "E8D7 5C19 9F65 269B 439D F77B 6310 C97D E31D 1545"; }]; }; @@ -1672,7 +1839,7 @@ }; brainrape = { email = "martonboros@gmail.com"; - github = "brainrape"; + github = "brainrake"; githubId = 302429; name = "Marton Boros"; }; @@ -1712,7 +1879,6 @@ githubId = 12615679; name = "Oleksii Filonenko"; keys = [{ - longkeyid = "rsa3072/0xA1BC8428323ECFE8"; fingerprint = "F549 3B7F 9372 5578 FDD3 D0B8 A1BC 8428 323E CFE8"; }]; }; @@ -1752,7 +1918,6 @@ githubId = 4763746; name = "Billy Rhoades"; keys = [{ - longkeyid = "rsa4096/0x8AE74787A4B7C07E"; fingerprint = "BF4FCB85C69989B4ED95BF938AE74787A4B7C07E"; }]; }; @@ -1794,6 +1959,12 @@ githubId = 7214361; name = "Roman Gerasimenko"; }; + builditluc = { + email = "builditluc@icloud.com"; + github = "Builditluc"; + githubId = 37375448; + name = "Buildit"; + }; bburdette = { email = "bburdette@protonmail.com"; github = "bburdette"; @@ -1845,11 +2016,9 @@ # compare with https://keybase.io/cab404 { fingerprint = "1BB96810926F4E715DEF567E6BA7C26C3FDF7BB3"; - longkeyid = "rsa3072/0xCBDECF658C38079E"; } { fingerprint = "1EBC648C64D6045463013B3EB7EFFC271D55DB8A"; - longkeyid = "ed25519/0xB7EFFC271D55DB8A"; } ]; }; @@ -1871,9 +2040,15 @@ githubId = 7435854; name = "Victor Calvert"; }; + cameronfyfe = { + email = "cameron.j.fyfe@gmail.com"; + github = "cameronfyfe"; + githubId = 21013281; + name = "Cameron Fyfe"; + }; cameronnemo = { email = "cnemo@tutanota.com"; - github = "cameronnemo"; + github = "CameronNemo"; githubId = 3212452; name = "Cameron Nemo"; }; @@ -1931,6 +2106,12 @@ githubId = 1945; name = "Casey Rodarmor"; }; + catap = { + email = "kirill@korins.ky"; + github = "catap"; + githubId = 37775; + name = "Kirill A. Korinsky"; + }; catern = { email = "sbaugh@catern.com"; github = "catern"; @@ -1962,7 +2143,6 @@ githubId = 109908; name = "Carsten Burstedde"; keys = [{ - longkeyid = "rsa2048/0x0704CD9E550A6BCD"; fingerprint = "1127 A432 6524 BF02 737B 544E 0704 CD9E 550A 6BCD"; }]; }; @@ -2016,11 +2196,9 @@ name = "Constantine Evans"; keys = [ { - longkeyid = "rsa4096/0xB67DB1D20A93A9F9"; fingerprint = "32B1 6EE7 DBA5 16DE 526E 4C5A B67D B1D2 0A93 A9F9"; } { - longkeyid = "rsa4096/0x1A1D58B86AE2AABD"; fingerprint = "669C 1D24 5A87 DB34 6BE4 3216 1A1D 58B8 6AE2 AABD"; } ]; @@ -2043,6 +2221,12 @@ githubId = 8228888; name = "Charlie Hanley"; }; + charlesbaynham = { + email = "charlesbaynham@gmail.com"; + github = "charlesbaynham"; + githubId = 4397637; + name = "Charles Baynham"; + }; CharlesHD = { email = "charleshdespointes@gmail.com"; github = "CharlesHD"; @@ -2055,10 +2239,6 @@ githubId = 89596; name = "Florian Friesdorf"; }; - chattered = { - email = "me@philscotted.com"; - name = "Phil Scott"; - }; chekoopa = { email = "chekoopa@mail.ru"; github = "chekoopa"; @@ -2083,19 +2263,12 @@ githubId = 18648043; name = "Daniel Cartwright"; }; - chiiruno = { - email = "okinan@protonmail.com"; - github = "chiiruno"; - githubId = 30435868; - name = "Okina Matara"; - }; Chili-Man = { email = "dr.elhombrechile@gmail.com"; name = "Diego Rodriguez"; github = "Chili-Man"; githubId = 631802; keys = [{ - longkeyid = "rsa4096/0xE0EBAD78F0190BD9"; fingerprint = "099E 3F97 FA08 3D47 8C75 EBEC E0EB AD78 F019 0BD9"; }]; }; @@ -2149,10 +2322,16 @@ }; chrisjefferson = { email = "chris@bubblescope.net"; - github = "chrisjefferson"; + github = "ChrisJefferson"; githubId = 811527; name = "Christopher Jefferson"; }; + chrispattison = { + email = "chpattison@gmail.com"; + github = "ChrisPattison"; + githubId = 641627; + name = "Chris Pattison"; + }; chrispickard = { email = "chrispickard9@gmail.com"; github = "chrispickard"; @@ -2171,7 +2350,6 @@ githubId = 13007345; name = "Christian Harke"; keys = [{ - longkeyid = "rsa4096/0x830A9728630966F4"; fingerprint = "4EBB 30F1 E89A 541A A7F2 52BE 830A 9728 6309 66F4"; }]; }; @@ -2194,7 +2372,6 @@ github = "chuangzhu"; githubId = 31200881; keys = [{ - longkeyid = "rsa4096/E838CED81CFFD3F9"; fingerprint = "5D03 A5E6 0754 A3E3 CA57 5037 E838 CED8 1CFF D3F9"; }]; }; @@ -2217,6 +2394,12 @@ githubId = 3956062; name = "Simon Lackerbauer"; }; + cimm = { + email = "8k9ft8m5gv@astil.be"; + github = "cimm"; + githubId = 68112; + name = "Simon"; + }; cirno-999 = { email = "reverene@protonmail.com"; github = "cirno-999"; @@ -2225,11 +2408,10 @@ }; citadelcore = { email = "alex@arctarus.co.uk"; - github = "citadelcore"; + github = "CitadelCore"; githubId = 5567402; name = "Alex Zero"; keys = [{ - longkeyid = "rsa4096/0xA51550EDB450302C"; fingerprint = "A0AA 4646 B8F6 9D45 4553 5A88 A515 50ED B450 302C"; }]; }; @@ -2256,10 +2438,10 @@ github = "ckiee"; githubId = 25263210; keys = [{ - longkeyid = "rsa4096/0x13E79449C0525215"; fingerprint = "539F 0655 4D35 38A5 429A E253 13E7 9449 C052 5215"; }]; name = "ckie"; + matrix = "@ckie:ckie.dev"; }; clkamp = { email = "c@lkamp.de"; @@ -2310,13 +2492,12 @@ githubId = 23741; name = "Casey Marshall"; keys = [{ - longkeyid = "rsa3072/0x6DEC2758ACD5A973"; fingerprint = "6B78 7E5F B493 FA4F D009 5D10 6DEC 2758 ACD5 A973"; }]; }; cmcdragonkai = { email = "roger.qiu@matrix.ai"; - github = "cmcdragonkai"; + github = "CMCDragonkai"; githubId = 640797; name = "Roger Qiu"; }; @@ -2326,6 +2507,12 @@ githubId = 20808761; name = "cmfwyp"; }; + cmm = { + email = "repo@cmm.kakpryg.net"; + github = "cmm"; + githubId = 718298; + name = "Michael Livshin"; + }; cobbal = { email = "andrew.cobb@gmail.com"; github = "cobbal"; @@ -2395,10 +2582,16 @@ github = "cole-h"; githubId = 28582702; keys = [{ - longkeyid = "rsa4096/0xB37E0F2371016A4C"; fingerprint = "68B8 0D57 B2E5 4AC3 EC1F 49B0 B37E 0F23 7101 6A4C"; }]; }; + colinsane = { + name = "Colin Sane"; + email = "colin@uninsane.org"; + matrix = "@colin:uninsane.org"; + github = "uninsane"; + githubId = 106709944; + }; collares = { email = "mauricio@collares.org"; github = "collares"; @@ -2438,7 +2631,7 @@ congee = { email = "changshengwu@pm.me"; matrix = "@congeec:matrix.org"; - github = "congee"; + github = "Congee"; name = "Changsheng Wu"; githubId = 2083950; }; @@ -2462,11 +2655,9 @@ name = "Corban Raun"; keys = [ { - longkeyid = "rsa4096/0xA697A56F1F151189"; fingerprint = "6607 0B24 8CE5 64ED 22CE 0950 A697 A56F 1F15 1189"; } { - longkeyid = "ed25519/0x230F4AC153F90F29"; fingerprint = "D8CB 816A B678 A4E6 1EC7 5325 230F 4AC1 53F9 0F29"; } ]; @@ -2489,10 +2680,15 @@ githubId = 292650; name = "Daniel McCarney"; keys = [{ - longkeyid = "rsa2048/0x08FB2BFC470E75B4"; fingerprint = "8026 D24A A966 BF9C D3CD CB3C 08FB 2BFC 470E 75B4"; }]; }; + Crafter = { + email = "crafter@crafter.rocks"; + github = "Craftzman7"; + githubId = 70068692; + name = "Crafter"; + }; craigem = { email = "craige@mcwhirter.io"; github = "craigem"; @@ -2513,7 +2709,7 @@ }; creator54 = { email = "hi.creator54@gmail.com"; - github = "creator54"; + github = "Creator54"; githubId = 34543609; name = "creator54"; }; @@ -2530,7 +2726,6 @@ githubId = 2440581; name = "Carl Richard Theodor Schneider"; keys = [{ - longkeyid = "rsa4096/0x45BCC1E2709B1788"; fingerprint = "2017 E152 BB81 5C16 955C E612 45BC C1E2 709B 1788"; }]; }; @@ -2570,7 +2765,6 @@ githubId = 389387; name = "Serg Nesterov"; keys = [{ - longkeyid = "rsa4096/0x1512F6EB84AECC8C"; fingerprint = "6E7D BA30 DB5D BA60 693C 3BE3 1512 F6EB 84AE CC8C"; }]; }; @@ -2593,11 +2787,9 @@ name = "Ștefan D. Mihăilă"; keys = [ { - longkeyid = "rsa4096/6E68A39BF16A3ECB"; fingerprint = "CBC9 C7CC 51F0 4A61 3901 C723 6E68 A39B F16A 3ECB"; } { - longkeyid = "rsa4096/6220AD7846220A52"; fingerprint = "7EAB 1447 5BBA 7DDE 7092 7276 6220 AD78 4622 0A52"; } ]; @@ -2615,7 +2807,6 @@ githubId = 43349662; name = "Dima"; keys = [{ - longkeyid = "rsa4096/BAB1D15FB7B4D4CE"; fingerprint = "1C4E F4FE 7F8E D8B7 1E88 CCDF BAB1 D15F B7B4 D4CE"; }]; }; @@ -2631,7 +2822,6 @@ github = "dadada"; githubId = 7216772; keys = [{ - longkeyid = "ed25519/0xEEB8D1CE62C4DFEA"; fingerprint = "D68C 8469 5C08 7E0F 733A 28D0 EEB8 D1CE 62C4 DFEA"; }]; }; @@ -2647,6 +2837,15 @@ githubId = 16895361; name = "Deniz Alp Durmaz"; }; + DAlperin = { + email = "git@dov.dev"; + github = "DAlperin"; + githubId = 16063713; + name = "Dov Alperin"; + keys = [{ + fingerprint = "4EED 5096 B925 86FA 1101 6673 7F2C 07B9 1B52 BB61"; + }]; + }; DamienCassou = { email = "damien@cassou.me"; github = "DamienCassou"; @@ -2659,6 +2858,15 @@ githubId = 743057; name = "Danylo Hlynskyi"; }; + danc86 = { + name = "Dan Callaghan"; + email = "djc@djc.id.au"; + github = "danc86"; + githubId = 398575; + keys = [{ + fingerprint = "1C56 01F1 D70A B56F EABB 6BC0 26B5 AA2F DAF2 F30A"; + }]; + }; dancek = { email = "hannu.hartikainen@gmail.com"; github = "dancek"; @@ -2684,12 +2892,6 @@ githubId = 24708079; name = "Dan Eads"; }; - danharaj = { - email = "dan@obsidian.systems"; - github = "danharaj"; - githubId = 23366017; - name = "Dan Haraj"; - }; danielbarter = { email = "danielbarter@gmail.com"; github = "danielbarter"; @@ -2711,11 +2913,10 @@ danth = { name = "Daniel Thwaites"; email = "danthwaites30@btinternet.com"; - matrix = "@danth:matrix.org"; + matrix = "@danth:pwak.org"; github = "danth"; githubId = 28959268; keys = [{ - longkeyid = "rsa3072/0xD8AFC4BF05670F9D"; fingerprint = "4779 D1D5 3C97 2EAE 34A5 ED3D D8AF C4BF 0567 0F9D"; }]; }; @@ -2750,7 +2951,6 @@ github = "dasisdormax"; githubId = 3714905; keys = [{ - longkeyid = "rsa4096/0x02BA0D4480CA6C44"; fingerprint = "E59B A198 61B0 A9ED C1FA 3FB2 02BA 0D44 80CA 6C44"; }]; name = "Maximilian Wende"; @@ -2761,10 +2961,6 @@ githubId = 7589338; name = "Daniel Șerbănescu"; }; - dasuxullebt = { - email = "christoph.senjak@googlemail.com"; - name = "Christoph-Simon Senjak"; - }; datafoo = { email = "34766150+datafoo@users.noreply.github.com"; github = "datafoo"; @@ -2809,12 +3005,11 @@ name = "David Rusu"; }; davidtwco = { - email = "nix@david.davidtw.co"; + email = "david@davidtw.co"; github = "davidtwco"; githubId = 1295100; name = "David Wood"; keys = [{ - longkeyid = "rsa4096/0x01760B4F9F53F154"; fingerprint = "5B08 313C 6853 E5BF FA91 A817 0176 0B4F 9F53 F154"; }]; }; @@ -2842,7 +3037,6 @@ githubId = 7545665; name = "David Birks"; keys = [{ - longkeyid = "ed25519/0xBB999F83D9A19A36"; fingerprint = "B26F 9AD8 DA20 3392 EF87 C61A BB99 9F83 D9A1 9A36"; }]; }; @@ -2873,10 +3067,9 @@ dearrude = { name = "Ebrahim Nejati"; email = "dearrude@tfwno.gf"; - github = "dearrude"; + github = "DearRude"; githubId = 30749142; keys = [{ - longkeyid = "rsa4096/19151E03BF2CF012"; fingerprint = "4E35 F2E5 2132 D654 E815 A672 DB2C BC24 2868 6000"; }]; }; @@ -2912,6 +3105,8 @@ }; delta = { email = "d4delta@outlook.fr"; + github = "D4Delta"; + githubId = 12224254; name = "Delta"; }; deltadelta = { @@ -2986,6 +3181,13 @@ githubId = 1311761; name = "Didier J. Devroye"; }; + desttinghim = { + email = "opensource@louispearson.work"; + matrix = "@desttinghim:matrix.org"; + github = "desttinghim"; + githubId = 10042482; + name = "Louis Pearson"; + }; devhell = { email = ''"^"@regexmail.net''; github = "devhell"; @@ -2998,6 +3200,12 @@ githubId = 17111639; name = "Devin Singh"; }; + devusb = { + email = "mhelton@devusb.us"; + github = "devusb"; + githubId = 4951663; + name = "Morgan Helton"; + }; dezgeg = { email = "tuomas.tynkkynen@iki.fi"; github = "dezgeg"; @@ -3048,7 +3256,7 @@ }; diegolelis = { email = "diego.o.lelis@gmail.com"; - github = "diegolelis"; + github = "DiegoLelis"; githubId = 8404455; name = "Diego Lelis"; }; @@ -3060,7 +3268,7 @@ }; diffumist = { email = "git@diffumist.me"; - github = "diffumist"; + github = "Diffumist"; githubId = 32810399; name = "Diffumist"; }; @@ -3102,7 +3310,7 @@ }; dizfer = { email = "david@izquierdofernandez.com"; - github = "dizfer"; + github = "DIzFer"; githubId = 8852888; name = "David Izquierdo"; }; @@ -3215,7 +3423,6 @@ githubId = 16120; name = "Misha Gusarov"; keys = [{ - longkeyid = "rsa4096/0x9D20F6503E338888"; fingerprint = "A8DF 1326 9E5D 9A38 E57C FAC2 9D20 F650 3E33 8888"; }]; }; @@ -3237,7 +3444,6 @@ githubId = 1965950; name = "Tobias Stenzel"; keys = [{ - longkeyid = "rsa2048/0x78C7DD40DF23FB16"; fingerprint = "4749 0887 CF3B 85A1 6355 C671 78C7 DD40 DF23 FB16"; }]; }; @@ -3265,10 +3471,6 @@ githubId = 6199462; name = "Dmytro Rets"; }; - drewkett = { - email = "burkett.andrew@gmail.com"; - name = "Andrew Burkett"; - }; drewrisinger = { email = "drisinger+nixpkgs@gmail.com"; github = "drewrisinger"; @@ -3281,7 +3483,6 @@ githubId = 92106371; name = "Dr Perceptron"; keys = [{ - longkeyid = "rsa4096/0x95EB6DFF26D1CEB0"; fingerprint = "7E38 89D9 B1A8 B381 C8DE A15F 95EB 6DFF 26D1 CEB0"; }]; }; @@ -3292,7 +3493,6 @@ github = "drupol"; githubId = 252042; keys = [{ - longkeyid = "ed25519/0x0AAF2901E8040715"; fingerprint = "85F3 72DF 4AF3 EF13 ED34 72A3 0AAF 2901 E804 0715"; }]; }; @@ -3314,7 +3514,6 @@ github = "dschrempf"; githubId = 5596239; keys = [{ - longkeyid = "rsa2048/0x875F2BCF163F1B29"; fingerprint = "62BC E2BD 49DF ECC7 35C7 E153 875F 2BCF 163F 1B29"; }]; }; @@ -3330,17 +3529,21 @@ githubId = 817330; name = "Will Dietz"; keys = [{ - longkeyid = "rsa4096/0xFD42C7D0D41494C8"; fingerprint = "389A 78CB CD88 5E0C 4701 DEB9 FD42 C7D0 D414 94C8"; }]; }; + dukc = { + email = "ajieskola@gmail.com"; + github = "dukc"; + githubId = 24233408; + name = "Ate Eskola"; + }; dump_stack = { email = "root@dumpstack.io"; github = "jollheef"; githubId = 1749762; name = "Mikhail Klementev"; keys = [{ - longkeyid = "rsa4096/0x1525585D1B43C62A"; fingerprint = "5DD7 C6F6 0630 F08E DAE7 4711 1525 585D 1B43 C62A"; }]; }; @@ -3377,7 +3580,7 @@ }; e-user = { email = "nixos@sodosopa.io"; - github = "e-user"; + github = "outergod"; githubId = 93086; name = "Alexander Kahl"; }; @@ -3405,7 +3608,7 @@ githubId = 424946; name = "James Earl Douglas"; }; - earvstedt = { + erikarvstedt = { email = "erik.arvstedt@gmail.com"; matrix = "@erikarvstedt:matrix.org"; github = "erikarvstedt"; @@ -3418,7 +3621,6 @@ githubId = 20522234; name = "Daniel Ebbert"; keys = [{ - longkeyid = "rsa2048/0x47BC155927CBB9C7"; fingerprint = "E765 FCA3 D9BF 7FDB 856E AD73 47BC 1559 27CB B9C7"; }]; }; @@ -3458,9 +3660,15 @@ github = "edlimerkaj"; githubId = 71988351; }; + elliottslaughter = { + name = "Elliott Slaughter"; + email = "elliottslaughter@gmail.com"; + github = "elliottslaughter"; + githubId = 3129; + }; emantor = { email = "rouven+nixos@czerwinskis.de"; - github = "emantor"; + github = "Emantor"; githubId = 934284; name = "Rouven Czerwinski"; }; @@ -3545,7 +3753,7 @@ ekleog = { email = "leo@gaspard.io"; matrix = "@leo:gaspard.ninja"; - github = "ekleog"; + github = "Ekleog"; githubId = 411447; name = "Leo Gaspard"; }; @@ -3573,6 +3781,12 @@ githubId = 103082; name = "Ed Brindley"; }; + elizagamedev = { + email = "eliza@eliza.sh"; + github = "elizagamedev"; + githubId = 4576666; + name = "Eliza Velasquez"; + }; elliot = { email = "hack00mind@gmail.com"; github = "Eliot00"; @@ -3598,6 +3812,12 @@ githubId = 1897147; name = "Elijah Caine"; }; + Elinvention = { + email = "elia@elinvention.ovh"; + github = "Elinvention"; + githubId = 5737945; + name = "Elia Argentieri"; + }; elitak = { email = "elitak@gmail.com"; github = "elitak"; @@ -3622,29 +3842,18 @@ githubId = 2536303; name = "Enno Lohmeier"; }; - elseym = { - email = "elseym@me.com"; - github = "elseym"; - githubId = 907478; - name = "Simon Waibl"; - }; elvishjerricco = { email = "elvishjerricco@gmail.com"; github = "ElvishJerricco"; githubId = 1365692; name = "Will Fancher"; }; - elyhaka = { - email = "elyhaka@protonmail.com"; - github = "Elyhaka"; - githubId = 57923898; - name = "Elyhaka"; - }; - em0lar = { - email = "nix@em0lar.dev"; - github = "em0lar"; - githubId = 11006031; - name = "Leo Maroni"; + emmabastas = { + email = "emma.bastas@protonmail.com"; + matrix = "@emmabastas:matrix.org"; + github = "emmabastas"; + githubId = 22533224; + name = "Emma Bastås"; }; emmanuelrosa = { email = "emmanuelrosa@protonmail.com"; @@ -3695,10 +3904,6 @@ githubId = 5085029; name = "Emanuele Peruffo"; }; - epitrochoid = { - email = "mpcervin@uncg.edu"; - name = "Mabry Cervin"; - }; equirosa = { email = "eduardo@eduardoquiros.com"; github = "equirosa"; @@ -3723,7 +3928,6 @@ githubId = 2663216; name = "Alexandre Iooss"; keys = [{ - longkeyid = "rsa4096/0x6C79278F3FCDCC02"; fingerprint = "2D37 1AD2 7E2B BC77 97E1 B759 6C79 278F 3FCD CC02"; }]; }; @@ -3755,7 +3959,7 @@ ericson2314 = { email = "John.Ericson@Obsidian.Systems"; matrix = "@ericson2314:matrix.org"; - github = "ericson2314"; + github = "Ericson2314"; githubId = 1055245; name = "John Ericson"; }; @@ -3765,7 +3969,6 @@ githubId = 11532355; name = "Kerstin Humm"; keys = [{ - longkeyid = "rsa4096/0x40293358C7B9326B"; fingerprint = "F178 B4B4 6165 6D1B 7C15 B55D 4029 3358 C7B9 326B"; }]; }; @@ -3795,7 +3998,7 @@ }; ersin = { email = "me@ersinakinci.com"; - github = "earksiinni"; + github = "DesertDevErsin"; githubId = 5427394; name = "Ersin Akinci"; }; @@ -3817,17 +4020,12 @@ githubId = 2544204; name = "Erik Skytthe"; }; - Esteth = { - email = "adam.copp@gmail.com"; - name = "Adam Copp"; - }; ethancedwards8 = { email = "ethan@ethancedwards.com"; github = "ethancedwards8"; githubId = 60861925; name = "Ethan Carter Edwards"; keys = [{ - longkeyid = "rsa4096/0xF93DDAFA26EF2458"; fingerprint = "0E69 0F46 3457 D812 3387 C978 F93D DAFA 26EF 2458"; }]; }; @@ -3837,6 +4035,13 @@ githubId = 222467; name = "Dmitry Ivanov"; }; + ethindp = { + name = "Ethin Probst"; + email = "harlydavidsen@gmail.com"; + matrix = "@ethindp:the-gdn.net"; + github = "ethindp"; + githubId = 8030501; + }; Etjean = { email = "et.jean@outlook.fr"; github = "Etjean"; @@ -3850,7 +4055,6 @@ githubId = 461970; name = "Elis Hirwing"; keys = [{ - longkeyid = "rsa4096/0xD57EFA625C9A925F"; fingerprint = "67FE 98F2 8C44 CF22 1828 E12F D57E FA62 5C9A 925F"; }]; }; @@ -3867,7 +4071,6 @@ github = "evalexpr"; githubId = 23485511; keys = [{ - longkeyid = "rsa4096/0x2D1D402E17763DD6"; fingerprint = "8129 5B85 9C5A F703 C2F4 1E29 2D1D 402E 1776 3DD6"; }]; }; @@ -3916,7 +4119,7 @@ }; exfalso = { email = "0slemi0@gmail.com"; - github = "exfalso"; + github = "exFalso"; githubId = 1042674; name = "Andras Slemmer"; }; @@ -3939,7 +4142,6 @@ githubId = 857308; name = "Ellie Hermaszewska"; keys = [{ - longkeyid = "rsa4096/0xC8116E3A0C1CA76A"; fingerprint = "FC1D 3E4F CBCA 80DF E870 6397 C811 6E3A 0C1C A76A"; }]; }; @@ -3975,7 +4177,6 @@ github = "fabaff"; githubId = 116184; keys = [{ - longkeyid = "dsa1024/0xE23CD2DD36A4397F"; fingerprint = "2F6C 930F D3C4 7E38 6AFA 4EB4 E23C D2DD 36A4 397F"; }]; }; @@ -3991,7 +4192,6 @@ githubId = 368799; name = "Fabian Hauser"; keys = [{ - longkeyid = "rsa4096/0x8A52A140BEBF7D2C"; fingerprint = "50B7 11F4 3DFD 2018 DCE6 E8D0 8A52 A140 BEBF 7D2C"; }]; }; @@ -4045,7 +4245,7 @@ }; fedx-sudo = { email = "fedx-sudo@pm.me"; - github = "Fedx-sudo"; + github = "FedX-sudo"; githubId = 66258975; name = "Fedx sudo"; matrix = "fedx:matrix.org"; @@ -4073,11 +4273,16 @@ matrix = "@felschr:matrix.org"; github = "felschr"; githubId = 3314323; - name = "Felix Tenley"; - keys = [{ - longkeyid = "ed25519/0x910ACB9F6BD26F58"; - fingerprint = "6AB3 7A28 5420 9A41 82D9 0068 910A CB9F 6BD2 6F58"; - }]; + name = "Felix Schröter"; + keys = [ + { + # historical + fingerprint = "6AB3 7A28 5420 9A41 82D9 0068 910A CB9F 6BD2 6F58"; + } + { + fingerprint = "7E08 6842 0934 AA1D 6821 1F2A 671E 39E6 744C 807D"; + } + ]; }; ffinkdevs = { email = "fink@h0st.space"; @@ -4135,10 +4340,16 @@ githubId = 6499211; name = "Sebastian Neubauer"; keys = [{ - longkeyid = "rsa4096/0xECC755EE583C1672"; fingerprint = "2F93 661D AC17 EA98 A104 F780 ECC7 55EE 583C 1672"; }]; }; + fleaz = { + email = "mail@felixbreidenstein.de"; + matrix = "@fleaz:rainbownerds.de"; + github = "fleaz"; + githubId = 2489598; + name = "Felix Breidenstein"; + }; flexagoon = { email = "flexagoon@pm.me"; github = "flexagoon"; @@ -4211,15 +4422,30 @@ githubId = 405105; name = "Dustin Frisch"; }; + foo-dogsquared = { + email = "foo.dogsquared@gmail.com"; + github = "foo-dogsquared"; + githubId = 34962634; + name = "Gabriel Arazas"; + }; + foolnotion = { + email = "bogdan.burlacu@pm.me"; + github = "foolnotion"; + githubId = 844222; + name = "Bogdan Burlacu"; + keys = [{ + fingerprint = "B722 6464 838F 8BDB 2BEA C8C8 5B0E FDDF BA81 6105"; + }]; + }; forkk = { email = "forkk@forkk.net"; - github = "forkk"; + github = "Forkk"; githubId = 1300078; name = "Andrew Okin"; }; fornever = { email = "friedrich@fornever.me"; - github = "fornever"; + github = "ForNeVeR"; githubId = 92793; name = "Friedrich von Never"; }; @@ -4236,7 +4462,6 @@ githubId = 114159; name = "Franz Pletz"; keys = [{ - longkeyid = "rsa4096/0x846FDED7792617B4"; fingerprint = "8A39 615D CE78 AF08 2E23 F303 846F DED7 7926 17B4"; }]; }; @@ -4255,13 +4480,13 @@ }; freax13 = { email = "erbse.13@gmx.de"; - github = "freax13"; + github = "Freax13"; githubId = 14952658; name = "Tom Dohrmann"; }; fredeb = { email = "im@fredeb.dev"; - github = "fredeeb"; + github = "FredeEB"; githubId = 7551358; name = "Frede Emil"; }; @@ -4279,7 +4504,7 @@ }; fridh = { email = "fridh@fridh.nl"; - github = "fridh"; + github = "FRidh"; githubId = 2129135; name = "Frederik Rietdijk"; }; @@ -4337,10 +4562,6 @@ githubId = 36706276; name = "Fufezan Mihai"; }; - funfunctor = { - email = "eocallaghan@alterapraxis.com"; - name = "Edward O'Callaghan"; - }; fusion809 = { email = "brentonhorne77@gmail.com"; github = "fusion809"; @@ -4349,26 +4570,16 @@ }; fuuzetsu = { email = "fuuzetsu@fuuzetsu.co.uk"; - github = "fuuzetsu"; + github = "Fuuzetsu"; githubId = 893115; name = "Mateusz Kowalczyk"; }; - fuwa = { - email = "echowss@gmail.com"; - github = "fuwa0529"; - githubId = 40521440; - name = "Haruka Akiyama"; - }; fuzen = { email = "me@fuzen.cafe"; - github = "fuzen-py"; + github = "Fuzen-py"; githubId = 17859309; name = "Fuzen"; }; - fuzzy-id = { - email = "hacking+nixos@babibo.de"; - name = "Thomas Bach"; - }; fxfactorial = { email = "edgar.factorial@gmail.com"; github = "fxfactorial"; @@ -4383,7 +4594,7 @@ }; Gabriel439 = { email = "Gabriel439@gmail.com"; - github = "Gabriel439"; + github = "Gabriella439"; githubId = 1313787; name = "Gabriel Gonzalez"; }; @@ -4393,10 +4604,15 @@ githubId = 1883533; name = "Florian Brandes"; keys = [{ - longkeyid = "rsa4096/0xBBB3E40E53797FD9"; fingerprint = "0200 3EF8 8D2B CF2D 8F00 FFDC BBB3 E40E 5379 7FD9"; }]; }; + GaetanLepage = { + email = "gaetan@glepage.com"; + github = "GaetanLepage"; + githubId = 33058747; + name = "Gaetan Lepage"; + }; gal_bolle = { email = "florent.becker@ens-lyon.org"; github = "FlorentBecker"; @@ -4405,7 +4621,7 @@ }; galagora = { email = "lightningstrikeiv@gmail.com"; - github = "galagora"; + github = "Galagora"; githubId = 45048741; name = "Alwanga Oyango"; }; @@ -4451,6 +4667,12 @@ githubId = 37017396; name = "gbtb"; }; + gdinh = { + email = "nix@contact.dinh.ai"; + github = "gdinh"; + githubId = 34658064; + name = "Grace Dinh"; + }; gebner = { email = "gebner@gebner.org"; github = "gebner"; @@ -4463,7 +4685,6 @@ github = "genofire"; githubId = 6905586; keys = [{ - longkeyid = "rsa4096/0xFC83907C125BC2BC"; fingerprint = "386E D1BF 848A BB4A 6B4A 3C45 FC83 907C 125B C2BC"; }]; }; @@ -4479,7 +4700,6 @@ githubId = 19374; name = "George Shammas"; keys = [{ - longkeyid = "rsa4096/0x82BB70D541AE2DB4"; fingerprint = "D0CF 440A A703 E0F9 73CB A078 82BB 70D5 41AE 2DB4"; }]; }; @@ -4498,10 +4718,16 @@ ggpeti = { email = "ggpeti@gmail.com"; matrix = "@ggpeti:ggpeti.com"; - github = "ggpeti"; + github = "ggPeti"; githubId = 3217744; name = "Peter Ferenczy"; }; + ghostbuster91 = { + name = "Kasper Kondzielski"; + email = "kghost0@gmail.com"; + github = "ghostbuster91"; + githubId = 5662622; + }; ghuntley = { email = "ghuntley@ghuntley.com"; github = "ghuntley"; @@ -4546,7 +4772,7 @@ }; glenns = { email = "glenn.searby@gmail.com"; - github = "glenns"; + github = "GlennS"; githubId = 615606; name = "Glenn Searby"; }; @@ -4556,7 +4782,6 @@ github = "glittershark"; githubId = 1481027; keys = [{ - longkeyid = "rsa2048/0x44EF5B5E861C09A7"; fingerprint = "0F11 A989 879E 8BBB FDC1 E236 44EF 5B5E 861C 09A7"; }]; }; @@ -4608,17 +4833,15 @@ github = "gordiasdot"; githubId = 94724133; keys = [{ - longkeyid = "ed25519/0x5D47284830FAA4FA"; fingerprint = "C006 B8A0 0618 F3B6 E0E4 2ECD 5D47 2848 30FA A4FA"; }]; }; govanify = { name = "Gauvain 'GovanifY' Roussel-Tarbouriech"; email = "gauvain@govanify.com"; - github = "govanify"; + github = "GovanifY"; githubId = 6375438; keys = [{ - longkeyid = "rsa4096/0xDE62E1E2A6145556"; fingerprint = "5214 2D39 A7CE F8FA 872B CA7F DE62 E1E2 A614 5556"; }]; }; @@ -4628,7 +4851,6 @@ github = "gpanders"; githubId = 8965202; keys = [{ - longkeyid = "rsa2048/0x56E93C2FB6B08BDB"; fingerprint = "B9D5 0EDF E95E ECD0 C135 00A9 56E9 3C2F B6B0 8BDB"; }]; }; @@ -4656,13 +4878,18 @@ githubId = 4656860; name = "Gaute Ravndal"; }; + graysonhead = { + email = "grayson@graysonhead.net"; + github = "graysonhead"; + githubId = 6179496; + name = "Grayson Head"; + }; grburst = { email = "GRBurst@protonmail.com"; github = "GRBurst"; githubId = 4647221; name = "GRBurst"; keys = [{ - longkeyid = "rsa4096/0x797F623868CD00C2"; fingerprint = "7FC7 98AB 390E 1646 ED4D 8F1F 797F 6238 68CD 00C2"; }]; }; @@ -4684,6 +4911,12 @@ githubId = 201997; name = "Eric Seidel"; }; + grindhold = { + name = "grindhold"; + email = "grindhold+nix@skarphed.org"; + github = "grindhold"; + githubId = 2592640; + }; gspia = { email = "iahogsp@gmail.com"; github = "gspia"; @@ -4702,6 +4935,12 @@ githubId = 343415; name = "Greg Roodt"; }; + grnnja = { + email = "grnnja@gmail.com"; + github = "grnnja"; + githubId = 31556469; + name = "Prem Netsuwan"; + }; gruve-p = { email = "groestlcoin@gmail.com"; github = "gruve-p"; @@ -4775,6 +5014,12 @@ githubId = 1498782; name = "Jesse Haber-Kucharsky"; }; + hamburger1984 = { + email = "hamburger1984@gmail.com"; + github = "hamburger1984"; + githubId = 438976; + name = "Andreas Krohn"; + }; hamhut1066 = { email = "github@hamhut1066.com"; github = "moredhel"; @@ -4783,7 +5028,7 @@ }; hanemile = { email = "mail@emile.space"; - github = "hanemile"; + github = "HanEmile"; githubId = 22756350; name = "Emile Hansmaennel"; }; @@ -4795,14 +5040,19 @@ }; HaoZeke = { email = "r95g10@gmail.com"; - github = "haozeke"; + github = "HaoZeke"; githubId = 4336207; name = "Rohit Goswami"; keys = [{ - longkeyid = "rsa4096/0x9CCCE36402CB49A6"; fingerprint = "74B1 F67D 8E43 A94A 7554 0768 9CCC E364 02CB 49A6"; }]; }; + happyalu = { + email = "alok@parlikar.com"; + github = "happyalu"; + githubId = 231523; + name = "Alok Parlikar"; + }; happysalada = { email = "raphael@megzari.com"; matrix = "@happysalada:matrix.org"; @@ -4822,7 +5072,6 @@ githubId = 1422583; name = "Martin Hardselius"; keys = [{ - longkeyid = "rsa4096/0x03A6E6F786936619"; fingerprint = "3F35 E4CA CBF4 2DE1 2E90 53E5 03A6 E6F7 8693 6619"; }]; }; @@ -4834,7 +5083,7 @@ }; havvy = { email = "ryan.havvy@gmail.com"; - github = "havvy"; + github = "Havvy"; githubId = 731722; name = "Ryan Scheel"; }; @@ -4869,7 +5118,6 @@ github = "hdhog"; githubId = 386666; keys = [{ - longkeyid = "rsa496/952EACB76703BA63"; fingerprint = "A25F 6321 AAB4 4151 4085 9924 952E ACB7 6703 BA63"; }]; }; @@ -4887,7 +5135,7 @@ }; heel = { email = "parizhskiy@gmail.com"; - github = "heel"; + github = "HeeL"; githubId = 287769; name = "Sergii Paryzhskyi"; }; @@ -4897,6 +5145,12 @@ githubId = 2405974; name = "Sébastian Méric de Bellefon"; }; + helium = { + email = "helium.dev@tuta.io"; + github = "helium18"; + githubId = 86223025; + name = "helium"; + }; henkkalkwater = { email = "chris+nixpkgs@netsoj.nl"; github = "HenkKalkwater"; @@ -4941,6 +5195,12 @@ githubId = 222664; name = "Matthew Leach"; }; + hexchen = { + email = "nix@lilwit.ch"; + github = "hexchen"; + githubId = 41522204; + name = "hexchen"; + }; hh = { email = "hh@m-labs.hk"; github = "HarryMakes"; @@ -4953,6 +5213,12 @@ githubId = 3656888; name = "hhm"; }; + hhydraa = { + email = "hcurfman@keemail.me"; + github = "hhydraa"; + githubId = 58676303; + name = "hhydraa"; + }; higebu = { name = "Yuya Kusakabe"; email = "yuya.kusakabe@gmail.com"; @@ -4965,10 +5231,6 @@ github = "hiljusti"; githubId = 17605298; }; - hinton = { - email = "t@larkery.com"; - name = "Tom Hinton"; - }; hirenashah = { email = "hiren@hiren.io"; github = "hirenashah"; @@ -4981,7 +5243,6 @@ githubId = 4025991; name = "Valentin Boettcher"; keys = [{ - longkeyid = "rsa2048/0xC22D4DE4D7B32D19"; fingerprint = "45A9 9917 578C D629 9F5F B5B4 C22D 4DE4 D7B3 2D19"; }]; }; @@ -4997,14 +5258,13 @@ github = "hkjn"; githubId = 287215; keys = [{ - longkeyid = "rsa4096/0x03EFBF839A5FDC15"; fingerprint = "D618 7A03 A40A 3D56 62F5 4B46 03EF BF83 9A5F DC15"; }]; }; hleboulanger = { email = "hleboulanger@protonmail.com"; name = "Harold Leboulanger"; - github = "thbkrhsw"; + github = "thbkrshw"; githubId = 33122; }; hlolli = { @@ -5013,13 +5273,22 @@ githubId = 6074754; name = "Hlodver Sigurdsson"; }; + huantian = { + name = "David Li"; + email = "davidtianli@gmail.com"; + matrix = "@huantian:huantian.dev"; + github = "huantianad"; + githubId = 20760920; + keys = [{ + fingerprint = "731A 7A05 AD8B 3AE5 956A C227 4A03 18E0 4E55 5DE5"; + }]; + }; hugoreeves = { email = "hugo@hugoreeves.com"; - github = "hugoreeves"; + github = "HugoReeves"; githubId = 20039091; name = "Hugo Reeves"; keys = [{ - longkeyid = "rsa4096/0x49FA39F8A7F735F9"; fingerprint = "78C2 E81C 828A 420B 269A EBC1 49FA 39F8 A7F7 35F9"; }]; }; @@ -5062,7 +5331,7 @@ hoverbear = { email = "operator+nix@hoverbear.org"; matrix = "@hoverbear:matrix.org"; - github = "hoverbear"; + github = "Hoverbear"; githubId = 130903; name = "Ana Hobden"; }; @@ -5102,6 +5371,12 @@ githubId = 39689; name = "Hugo Tavares Reis"; }; + hufman = { + email = "hufman@gmail.com"; + github = "hufman"; + githubId = 1592375; + name = "Walter Huf"; + }; hugolgst = { email = "hugo.lageneste@pm.me"; github = "hugolgst"; @@ -5126,7 +5401,6 @@ github = "hyshka"; githubId = 2090758; keys = [{ - longkeyid = "rsa2048/0xDB2D93D1BFAAA6EA"; fingerprint = "24F4 1925 28C4 8797 E539 F247 DB2D 93D1 BFAA A6EA"; }]; }; @@ -5154,14 +5428,13 @@ githubId = 18238046; name = "Iago Manoel Brito"; keys = [{ - longkeyid = "rsa4096/0x35D39F9A9A1BC8DA"; fingerprint = "DF90 9D58 BEE4 E73A 1B8C 5AF3 35D3 9F9A 9A1B C8DA"; }]; }; iammrinal0 = { email = "nixpkgs@mrinalpurohit.in"; matrix = "@iammrinal0:nixos.dev"; - github = "iammrinal0"; + github = "iAmMrinal0"; githubId = 890062; name = "Mrinal"; }; @@ -5183,6 +5456,15 @@ githubId = 1031119; name = "Ian-Woo Kim"; }; + ibizaman = { + email = "ibizapeanut@gmail.com"; + github = "ibizaman"; + githubId = 1044950; + name = "Pierre Penninckx"; + keys = [{ + fingerprint = "A01F 10C6 7176 B2AE 2A34 1A56 D4C5 C37E 6031 A3FE"; + }]; + }; iblech = { email = "iblech@speicherleck.de"; github = "iblech"; @@ -5239,6 +5521,13 @@ githubId = 40234257; name = "ilkecan bozdogan"; }; + not-my-segfault = { + email = "michal@tar.black"; + matrix = "@michal:tar.black"; + github = "not-my-segfault"; + githubId = 30374463; + name = "Michal S."; + }; illegalprime = { email = "themichaeleden@gmail.com"; github = "illegalprime"; @@ -5289,7 +5578,7 @@ }; imgabe = { email = "gabrielpmonte@hotmail.com"; - github = "imgabe"; + github = "ImGabe"; githubId = 24387926; name = "Gabriel Pereira"; }; @@ -5306,6 +5595,12 @@ githubId = 510202; name = "Ismaël Bouya"; }; + imsofi = { + email = "sofi+git@mailbox.org"; + github = "imsofi"; + githubId = 20756843; + name = "Sofi"; + }; imuli = { email = "i@imu.li"; github = "imuli"; @@ -5318,6 +5613,12 @@ githubId = 37965; name = "Léo Stefanesco"; }; + infinidoge = { + name = "Infinidoge"; + email = "infinidoge@inx.moe"; + github = "Infinidoge"; + githubId = 22727114; + }; infinisil = { email = "contact@infinisil.com"; matrix = "@infinisil:matrix.org"; @@ -5325,7 +5626,6 @@ githubId = 20525370; name = "Silvan Mosberger"; keys = [{ - longkeyid = "rsa4096/0x422E9EDAE0157170"; fingerprint = "6C2B 55D4 4E04 8266 6B7D DA1A 422E 9EDA E015 7170"; }]; }; @@ -5342,7 +5642,6 @@ github = "IreneKnapp"; githubId = 157678; keys = [{ - longkeyid = "rsa4096/0xDBF252AFFB2619FD"; fingerprint = "E864 BDFA AB55 36FD C905 5195 DBF2 52AF FB26 19FD"; }]; }; @@ -5355,10 +5654,9 @@ isgy = { name = "isgy"; email = "isgy@teiyg.com"; - github = "isgy"; + github = "tgys"; githubId = 13622947; keys = [{ - longkeyid = "rsa4096/0xD3E1B013B4631293"; fingerprint = "1412 816B A9FA F62F D051 1975 D3E1 B013 B463 1293"; }]; }; @@ -5389,6 +5687,8 @@ }; ivan-tkatchev = { email = "tkatchev@gmail.com"; + github = "ivan-tkatchev"; + githubId = 650601; name = "Ivan Tkatchev"; }; ivanbrennan = { @@ -5397,7 +5697,6 @@ githubId = 1672874; name = "Ivan Brennan"; keys = [{ - longkeyid = "rsa4096/0x79C3C47DC652EA54"; fingerprint = "7311 2700 AB4F 4CDF C68C F6A5 79C3 C47D C652 EA54"; }]; }; @@ -5407,7 +5706,6 @@ githubId = 75213; name = "Ivan Kovnatsky"; keys = [{ - longkeyid = "rsa4096/0x3A33FA4C82ED674F"; fingerprint = "6BD3 7248 30BD 941E 9180 C1A3 3A33 FA4C 82ED 674F"; }]; }; @@ -5417,6 +5715,12 @@ githubId = 41924494; name = "Ivar"; }; + iwanb = { + email = "tracnar@gmail.com"; + github = "iwanb"; + githubId = 4035835; + name = "Iwan"; + }; ixmatus = { email = "parnell@digitalmentat.com"; github = "ixmatus"; @@ -5431,7 +5735,7 @@ }; izorkin = { email = "Izorkin@gmail.com"; - github = "izorkin"; + github = "Izorkin"; githubId = 26877687; name = "Yurii Izorkin"; }; @@ -5561,6 +5865,12 @@ githubId = 488556; name = "Javier Aguirre"; }; + jayesh-bhoot = { + name = "Jayesh Bhoot"; + email = "jayesh@bhoot.sh"; + github = "jayesh-bhoot"; + githubId = 1915507; + }; jb55 = { email = "jb55@jb55.com"; github = "jb55"; @@ -5593,7 +5903,7 @@ githubId = 35612334; }; jceb = { - name = "jceb"; + name = "Jan Christoph Ebersbach"; email = "jceb@e-jc.de"; github = "jceb"; githubId = 101593; @@ -5610,7 +5920,6 @@ githubId = 1235045; name = "Jichao Ouyang"; keys = [{ - longkeyid = "rsa2048/0xDA8B833B52604E63"; fingerprint = "A506 C38D 5CC8 47D0 DF01 134A DA8B 833B 5260 4E63"; }]; }; @@ -5634,10 +5943,9 @@ }; jdanek = { email = "jdanek@redhat.com"; - github = "jdanekrh"; + github = "jirkadanek"; githubId = 17877663; keys = [{ - longkeyid = "ed25519/0x69275CADF15D872E"; fingerprint = "D4A6 F051 AD58 2E7C BCED 5439 6927 5CAD F15D 872E"; }]; name = "Jiri Daněk"; @@ -5686,7 +5994,7 @@ }; jefflabonte = { email = "grimsleepless@protonmail.com"; - github = "jefflabonte"; + github = "JeffLabonte"; githubId = 9425955; name = "Jean-François Labonté"; }; @@ -5710,7 +6018,7 @@ }; jeschli = { email = "jeschli@gmail.com"; - github = "Jeschli"; + github = "0mbi"; githubId = 10786794; name = "Markus Hihn"; }; @@ -5720,6 +6028,12 @@ githubId = 1667473; name = "Jethro Kuan"; }; + jevy = { + email = "jevin@quickjack.ca"; + github = "jevy"; + githubId = 110620; + name = "Jevin Maltais"; + }; jfb = { email = "james@yamtime.com"; github = "tftio"; @@ -5732,7 +6046,6 @@ githubId = 3001; name = "Jean-Francois Chevrette"; keys = [{ - longkeyid = "rsa4096/0x67A0585801290DC6"; fingerprint = "B612 96A9 498E EECD D5E9 C0F0 67A0 5858 0129 0DC6"; }]; }; @@ -5755,7 +6068,6 @@ github = "jfroche"; githubId = 207369; keys = [{ - longkeyid = "dsa1024/0xD1D09DE169EA19A0"; fingerprint = "7EB1 C02A B62B B464 6D7C E4AE D1D0 9DE1 69EA 19A0"; }]; }; @@ -5801,6 +6113,12 @@ githubId = 2502736; name = "James Hillyerd"; }; + jiegec = { + name = "Jiajie Chen"; + email = "c@jia.je"; + github = "jiegec"; + githubId = 6127678; + }; jiehong = { email = "nixos@majiehong.com"; github = "Jiehong"; @@ -5876,12 +6194,10 @@ keys = [ # GitHub signing key { - longkeyid = "rsa4096/0xDC7AE56AE98E02D7"; fingerprint = "EC08 7AA3 DEAD A972 F015 6371 DC7A E56A E98E 02D7"; } # Email encryption { - longkeyid = "ed25519/0x197F9A632D139E30"; fingerprint = "816D 23F5 E672 EC58 7674 4A73 197F 9A63 2D13 9E30"; } ]; @@ -5928,9 +6244,15 @@ githubId = 60272884; name = "Jonathan Jeppener-Haltenhoff"; }; + jocelynthode = { + email = "jocelyn.thode@gmail.com"; + github = "jocelynthode"; + githubId = 3967312; + name = "Jocelyn Thode"; + }; joelancaster = { email = "joe.a.lancas@gmail.com"; - github = "joelancaster"; + github = "JoeLancaster"; githubId = 16760945; name = "Joe Lancaster"; }; @@ -5946,10 +6268,6 @@ githubId = 336631; name = "Joel Moberg"; }; - joelteon = { - email = "me@joelt.io"; - name = "Joel Taylor"; - }; joepie91 = { email = "admin@cryto.net"; matrix = "@joepie91:pixie.town"; @@ -5977,7 +6295,7 @@ }; johnazoidberg = { email = "git@danielschaefer.me"; - github = "johnazoidberg"; + github = "JohnAZoidberg"; githubId = 5307138; name = "Daniel Schäfer"; }; @@ -5989,7 +6307,7 @@ }; johnmh = { email = "johnmh@openblox.org"; - github = "johnmh"; + github = "JohnMH"; githubId = 2576152; name = "John M. Harris, Jr."; }; @@ -6018,7 +6336,6 @@ github = "jojosch"; githubId = 327488; keys = [{ - longkeyid = "ed25519/059093B1A278BCD0"; fingerprint = "7249 70E6 A661 D84E 8B47 678A 0590 93B1 A278 BCD0"; }]; }; @@ -6028,7 +6345,6 @@ githubId = 1252547; keys = [{ # compare with https://keybase.io/joko - longkeyid = "rsa2048/0x85EAE7D9DF56C5CA"; fingerprint = "B154 A8F9 0610 DB45 0CA8 CF39 85EA E7D9 DF56 C5CA"; }]; name = "Ioannis Koutras"; @@ -6051,6 +6367,12 @@ githubId = 1843676; name = "Jonathan Reeve"; }; + jonnybolton = { + email = "jonnybolton@gmail.com"; + github = "jonnybolton"; + githubId = 8580434; + name = "Jonny Bolton"; + }; jonringer = { email = "jonringer117@gmail.com"; matrix = "@jonringer:matrix.org"; @@ -6076,6 +6398,12 @@ github = "JoshuaFern"; githubId = 4300747; }; + joshvanl = { + email = " me@joshvanl.dev "; + github = "joshvanl"; + githubId = 15893072; + name = "Josh van Leeuwen"; + }; jpas = { name = "Jarrod Pas"; email = "jarrod@jarrodpas.com"; @@ -6130,13 +6458,6 @@ githubId = 3267697; name = "Joshua Potter"; }; - jschievink = { - email = "jonasschievink@gmail.com"; - matrix = "@jschievink:matrix.org"; - github = "jonas-schievink"; - githubId = 1786438; - name = "Jonas Schievink"; - }; jshcmpbll = { email = "me@joshuadcampbell.com"; github = "jshcmpbll"; @@ -6156,13 +6477,25 @@ github = "jsierles"; githubId = 82; }; + jsimonetti = { + email = "jeroen+nixpkgs@simonetti.nl"; + matrix = "@jeroen:simonetti.nl"; + name = "Jeroen Simonetti"; + github = "jsimonetti"; + githubId = 5478838; + }; + jsoo1 = { + email = "jsoo1@asu.edu"; + github = "jsoo1"; + name = "John Soo"; + githubId = 10039785; + }; jtcoolen = { email = "jtcoolen@pm.me"; name = "Julien Coolen"; github = "jtcoolen"; githubId = 54635632; keys = [{ - longkeyid = "rsa4096/0x19642151C218F6F5"; fingerprint = "4C68 56EE DFDA 20FB 77E8 9169 1964 2151 C218 F6F5"; }]; }; @@ -6191,6 +6524,13 @@ githubId = 1189739; name = "Julio Borja Barra"; }; + jugendhacker = { + name = "j.r"; + email = "j.r@jugendhacker.de"; + github = "jugendhacker"; + githubId = 12773748; + matrix = "@j.r:chaos.jetzt"; + }; juliendehos = { email = "dehos@lisic.univ-littoral.fr"; github = "juliendehos"; @@ -6245,7 +6585,6 @@ githubId = 1529052; name = "Jan van Brügge"; keys = [{ - longkeyid = "rsa4096/0x366572BE7D6C78A2"; fingerprint = "3513 5CE5 77AD 711F 3825 9A99 3665 72BE 7D6C 78A2"; }]; }; @@ -6267,10 +6606,6 @@ githubId = 46386452; name = "Jeroen Wijenbergh"; }; - jwilberding = { - email = "jwilberding@afiniate.com"; - name = "Jordan Wilberding"; - }; jwoudenberg = { email = "nixpkgs@jasperwoudenberg.com"; github = "jwoudenberg"; @@ -6289,7 +6624,6 @@ githubId = 63786778; name = "Joel"; keys = [{ - longkeyid = "rsa4096/18550BD205E9EF64"; fingerprint = "9148 DC9E F4D5 3EB6 A30E 8EF0 1855 0BD2 05E9 EF64"; }]; }; @@ -6305,6 +6639,12 @@ githubId = 66669; name = "Jeff Zellner"; }; + k3a = { + email = "git+nix@catmail.app"; + name = "Mario Hros"; + github = "k3a"; + githubId = 966992; + }; k4leg = { name = "k4leg"; email = "python.bogdan@gmail.com"; @@ -6321,16 +6661,15 @@ kaction = { name = "Dmitry Bogatov"; email = "KAction@disroot.org"; - github = "kaction"; + github = "KAction"; githubId = 44864956; keys = [{ - longkeyid = "ed25519/0x749FD4DFA2E94236"; fingerprint = "3F87 0A7C A7B4 3731 2F13 6083 749F D4DF A2E9 4236"; }]; }; kaiha = { email = "kai.harries@gmail.com"; - github = "kaiha"; + github = "KaiHa"; githubId = 6544084; name = "Kai Harries"; }; @@ -6353,7 +6692,6 @@ github = "kamadorueda"; githubId = 47480384; keys = [{ - longkeyid = "rsa4096/0x04D0CEAF916A9A40"; fingerprint = "2BE3 BAFD 793E A349 ED1F F00F 04D0 CEAF 916A 9A40"; }]; }; @@ -6389,6 +6727,8 @@ }; karolchmist = { email = "info+nix@chmist.com"; + github = "karolchmist"; + githubId = 1927188; name = "karolchmist"; }; kayhide = { @@ -6409,28 +6749,58 @@ githubId = 37185887; name = "Calvin Kim"; }; + keksbg = { + email = "keksbg@riseup.net"; + name = "Stella"; + github = "keksbg"; + githubId = 10682187; + keys = [{ + fingerprint = "AB42 1F18 5A19 A160 AD77 9885 3D6D CA5B 6F2C 2A7A"; + }]; + }; keldu = { email = "mail@keldu.de"; github = "keldu"; githubId = 15373888; name = "Claudius Holeksa"; }; + ken-matsui = { + email = "nix@kmatsui.me"; + github = "ken-matsui"; + githubId = 26405363; + name = "Ken Matsui"; + keys = [{ + fingerprint = "3611 8CD3 6DE8 3334 B44A DDE4 1033 60B3 298E E433"; + }]; + }; kennyballou = { email = "kb@devnulllabs.io"; github = "kennyballou"; githubId = 2186188; name = "Kenny Ballou"; keys = [{ - longkeyid = "rsa4096/0xB0CAA28A02958308"; fingerprint = "932F 3E8E 1C0F 4A98 95D7 B8B8 B0CA A28A 0295 8308"; }]; }; + kenran = { + email = "johannes.maier@mailbox.org"; + github = "kenranunderscore"; + githubId = 5188977; + matrix = "@kenran_:matrix.org"; + name = "Johannes Maier"; + }; kentjames = { email = "jameschristopherkent@gmail.com"; - github = "kentjames"; + github = "KentJames"; githubId = 2029444; name = "James Kent"; }; + kephasp = { + email = "pierre@nothos.net"; + github = "kephas"; + githubId = 762421; + name = "Pierre Thierry"; + }; ketzacoatl = { email = "ketzacoatl@protonmail.com"; github = "ketzacoatl"; @@ -6456,6 +6826,13 @@ githubId = 8211181; name = "Kevin Kandlbinder"; }; + kfears = { + email = "kfearsoff@gmail.com"; + github = "KFearsoff"; + githubId = 66781795; + matrix = "@kfears:matrix.org"; + name = "KFears"; + }; kfollesdal = { email = "kfollesdal@gmail.com"; github = "kfollesdal"; @@ -6464,7 +6841,7 @@ }; kho-dialga = { email = "ivandashenyou@gmail.com"; - github = "kho-dialga"; + github = "Kho-Dialga"; githubId = 55767703; name = "Iván Brito"; }; @@ -6476,11 +6853,10 @@ }; khushraj = { email = "khushraj.rathod@gmail.com"; - github = "KhushrajRathod"; + github = "khrj"; githubId = 44947946; name = "Khushraj Rathod"; keys = [{ - longkeyid = "rsa2048/0xB77B2A40E7702F19"; fingerprint = "1988 3FD8 EA2E B4EC 0A93 1E22 B77B 2A40 E770 2F19"; }]; }; @@ -6508,6 +6884,12 @@ githubId = 845652; name = "Kier Davis"; }; + kilimnik = { + email = "mail@kilimnik.de"; + github = "kilimnik"; + githubId = 5883283; + name = "Daniel Kilimnik"; + }; killercup = { email = "killercup@gmail.com"; github = "killercup"; @@ -6564,13 +6946,12 @@ name = "Jim Fowler"; }; kittywitch = { - email = "kat@kittywit.ch"; + email = "kat@inskip.me"; github = "kittywitch"; githubId = 67870215; - name = "kat witch"; + name = "Kat Inskip"; keys = [{ - longkeyid = "rsa4096/0x7248991EFA8EFBEE"; - fingerprint = "01F5 0A29 D4AA 9117 5A11 BDB1 7248 991E FA8E FBEE"; + fingerprint = "9CC6 44B5 69CD A59B C874 C4C9 E8DD E3ED 1C90 F3A0"; }]; }; kiwi = { @@ -6579,7 +6960,6 @@ githubId = 35715; name = "Robert Djubek"; keys = [{ - longkeyid = "rsa4096/0x156C88A5B0A04B2A"; fingerprint = "8992 44FC D291 5CA2 0A97 802C 156C 88A5 B0A0 4B2A"; }]; }; @@ -6595,10 +6975,6 @@ github = "kjeremy"; githubId = 4325700; }; - kkallio = { - email = "tierpluspluslists@gmail.com"; - name = "Karn Kallio"; - }; klden = { name = "Kenzyme Le"; email = "kl@kenzymele.com"; @@ -6615,10 +6991,9 @@ email = "me@kloenk.dev"; matrix = "@kloenk:petabyte.dev"; name = "Finn Behrens"; - github = "kloenk"; + github = "Kloenk"; githubId = 12898828; keys = [{ - longkeyid = "ed25519/0xB92445CFC9546F9D"; fingerprint = "6881 5A95 D715 D429 659B 48A4 B924 45CF C954 6F9D"; }]; }; @@ -6709,7 +7084,7 @@ }; kovirobi = { email = "kovirobi@gmail.com"; - github = "kovirobi"; + github = "KoviRobi"; githubId = 1903418; name = "Kovacsics Robert"; }; @@ -6763,7 +7138,7 @@ }; kristian-brucaj = { email = "kbrucaj@gmail.com"; - github = "kristian-brucaj"; + github = "Kristian-Brucaj"; githubId = 8893110; name = "Kristian Brucaj"; }; @@ -6791,12 +7166,6 @@ githubId = 99639; name = "Pawel Kruszewski"; }; - ktosiek = { - email = "tomasz.kontusz@gmail.com"; - github = "ktosiek"; - githubId = 278013; - name = "Tomasz Kontusz"; - }; kubukoz = { email = "kubukoz@gmail.com"; github = "kubukoz"; @@ -6815,13 +7184,6 @@ githubId = 449813; name = "Roman Kuznetsov"; }; - kvark = { - name = "Dzmitry Malyshau"; - email = "kvark@fastmail.com"; - matrix = "@kvark:matrix.org"; - github = "kvark"; - githubId = 107301; - }; kwohlfahrt = { email = "kai.wohlfahrt@gmail.com"; github = "kwohlfahrt"; @@ -6830,11 +7192,10 @@ }; kyleondy = { email = "kyle@ondy.org"; - github = "kyleondy"; + github = "KyleOndy"; githubId = 1640900; name = "Kyle Ondy"; keys = [{ - longkeyid = "rsa4096/0xDB0E3C33491F91C9"; fingerprint = "3C79 9D26 057B 64E6 D907 B0AC DB0E 3C33 491F 91C9"; }]; }; @@ -6846,7 +7207,6 @@ githubId = 6677292; keys = [{ - longkeyid = "rsa4096/81A1540948162372"; fingerprint = "5A9A 1C9B 2369 8049 3B48 CF5B 81A1 5409 4816 2372"; }]; }; @@ -6856,7 +7216,6 @@ github = "L-as"; githubId = 22075344; keys = [{ - longkeyid = "rsa2048/0xAC458A7D1087D025"; fingerprint = "A093 EA17 F450 D4D1 60A0 1194 AC45 8A7D 1087 D025"; }]; name = "Las Safin"; @@ -6873,7 +7232,6 @@ github = "CertainLach"; githubId = 6235312; keys = [{ - longkeyid = "rsa3072/40B5D6948143175F"; fingerprint = "323C 95B5 DBF7 2D74 8570 C0B7 40B5 D694 8143 175F"; }]; name = "Yaroslav Bolyukin"; @@ -6910,24 +7268,11 @@ }; lassulus = { email = "lassulus@gmail.com"; - matrix = "@lassulus:nixos.dev"; + matrix = "@lassulus:lassul.us"; github = "Lassulus"; githubId = 621759; name = "Lassulus"; }; - lattfein = { - email = "lattfein@gmail.com"; - # Their GitHub account was deleted. - # - # See: https://github.com/NixOS/nixpkgs/pull/69007 where this - # was added but is now owned by a ghost. - # - # Possibly the username lattfein (currently github ID 56827487) is - # owned by the same person, but we should confirm before adding - # the GitHub name or ID back. - # github = "lattfein"; - name = "Koki Yasuno"; - }; layus = { email = "layus.on@gmail.com"; github = "layus"; @@ -7009,7 +7354,7 @@ }; leemachin = { email = "me@mrl.ee"; - github = "leemachin"; + github = "leemeichin"; githubId = 736291; name = "Lee Machin"; }; @@ -7019,6 +7364,13 @@ githubId = 4158274; name = "Michiel Leenaars"; }; + logo = { + email = "logo4poop@protonmail.com"; + matrix = "@logo4poop:matrix.org"; + github = "logo4poop"; + githubId = 24994565; + name = "Isaac Silverstein"; + }; lom = { email = "legendofmiracles@protonmail.com"; matrix = "@legendofmiracles:matrix.org"; @@ -7026,18 +7378,16 @@ githubId = 30902201; name = "legendofmiracles"; keys = [{ - longkeyid = "rsa4096/0x19B082B3DEFE5451"; fingerprint = "CC50 F82C 985D 2679 0703 AF15 19B0 82B3 DEFE 5451"; }]; }; leixb = { email = "abone9999+nixpkgs@gmail.com"; matrix = "@leix_b:matrix.org"; - github = "LeixB"; + github = "Leixb"; githubId = 17183803; name = "Aleix Boné"; keys = [{ - longkeyid = "rsa4096/0xFC035BB2BB28E15D"; fingerprint = "63D3 F436 EDE8 7E1F 1292 24AF FC03 5BB2 BB28 E15D"; }]; }; @@ -7048,10 +7398,20 @@ name = "Daniel Kuehn"; }; leo60228 = { - email = "iakornfeld@gmail.com"; + email = "leo@60228.dev"; + matrix = "@leo60228:matrix.org"; github = "leo60228"; githubId = 8355305; name = "leo60228"; + keys = [{ + fingerprint = "5BE4 98D5 1C24 2CCD C21A 4604 AC6F 4BA0 78E6 7833"; + }]; + }; + leona = { + email = "nix@leona.is"; + github = "leona-ya"; + githubId = 11006031; + name = "Leona Maroni"; }; leonardoce = { email = "leonardo.cecchi@gmail.com"; @@ -7096,7 +7456,6 @@ github = "LEXUGE"; githubId = 13804737; keys = [{ - longkeyid = "rsa4096/0xAE53B4C2E58EDD45"; fingerprint = "7FE2 113A A08B 695A C8B8 DDE6 AE53 B4C2 E58E DD45"; }]; }; @@ -7130,6 +7489,13 @@ githubId = 1769386; name = "Liam Diprose"; }; + libjared = { + email = "jared@perrycode.com"; + github = "libjared"; + githubId = 3746656; + matrix = "@libjared:matrix.org"; + name = "Jared Perry"; + }; liff = { email = "liff@iki.fi"; github = "liff"; @@ -7160,6 +7526,13 @@ githubId = 714; name = "Lily Ballard"; }; + lilyinstarlight = { + email = "lily@lily.flowers"; + matrix = "@lily:lily.flowers"; + github = "lilyinstarlight"; + githubId = 298109; + name = "Lily Foster"; + }; limeytexan = { email = "limeytexan@gmail.com"; github = "limeytexan"; @@ -7172,6 +7545,16 @@ githubId = 667272; name = "Lincoln Lee"; }; + linj = { + name = "Lin Jian"; + email = "me@linj.tech"; + matrix = "@me:linj.tech"; + github = "jian-lin"; + githubId = 75130626; + keys = [{ + fingerprint = "80EE AAD8 43F9 3097 24B5 3D7E 27E9 7B91 E63A 7FF8"; + }]; + }; linquize = { email = "linquize@yahoo.com.hk"; github = "linquize"; @@ -7196,7 +7579,6 @@ githubId = 3964494; name = "Lev Livnev"; keys = [{ - longkeyid = "rsa2048/0x68FF81E6A7850F49"; fingerprint = "74F5 E5CC 19D3 B5CB 608F 6124 68FF 81E6 A785 0F49"; }]; }; @@ -7206,7 +7588,6 @@ github = "lourkeur"; githubId = 15657735; keys = [{ - longkeyid = "ed25519/0xDFE1D4A017337E2A"; fingerprint = "5B93 9CFA E8FC 4D8F E07A 3AEA DFE1 D4A0 1733 7E2A"; }]; }; @@ -7222,6 +7603,16 @@ githubId = 22085373; name = "Luis Hebendanz"; }; + luizribeiro = { + email = "nixpkgs@l9o.dev"; + matrix = "@luizribeiro:matrix.org"; + name = "Luiz Ribeiro"; + github = "luizribeiro"; + githubId = 112069; + keys = [{ + fingerprint = "97A0 AE5E 03F3 499B 7D7A 65C6 76A4 1432 37EF 5817"; + }]; + }; lunarequest = { email = "nullarequest@vivlaid.net"; github = "Lunarequest"; @@ -7248,7 +7639,7 @@ }; lnl7 = { email = "daiderd@gmail.com"; - github = "lnl7"; + github = "LnL7"; githubId = 689294; name = "Daiderd Jordan"; }; @@ -7277,7 +7668,6 @@ githubId = 25434434; name = "Jan Schmitt"; keys = [{ - longkeyid = "dsa2048/0xA2BC3C6F14351991"; fingerprint = "1763 9903 2D7C 5B82 5D5A 0EAD A2BC 3C6F 1435 1991"; }]; }; @@ -7288,7 +7678,7 @@ name = "Anthony Lodi"; }; loicreynier = { - email = "loic@loireynier.fr"; + email = "loic@loicreynier.fr"; github = "loicreynier"; githubId = 88983487; name = "Loïc Reynier"; @@ -7313,7 +7703,7 @@ }; louisdk1 = { email = "louis@louis.dk"; - github = "louisdk1"; + github = "LouisDK1"; githubId = 4969294; name = "Louis Tim Larsen"; }; @@ -7330,7 +7720,6 @@ githubId = 7243783; name = "Bernardo Meurer"; keys = [{ - longkeyid = "rsa4096/0xF4C0D53B8D14C246"; fingerprint = "F193 7596 57D5 6DA4 CCD4 786B F4C0 D53B 8D14 C246"; }]; }; @@ -7352,10 +7741,6 @@ githubId = 1597330; name = "Leonardo Romor"; }; - lrworth = { - email = "luke@worth.id.au"; - name = "Luke Worth"; - }; lschuermann = { email = "leon.git@is.currently.online"; matrix = "@leons:is.currently.online"; @@ -7411,7 +7796,6 @@ github = "Luflosi"; githubId = 15217907; keys = [{ - longkeyid = "rsa4096/0x6F987CCF224D20B9"; fingerprint = "66D1 3048 2B5F 2069 81A6 6B83 6F98 7CCF 224D 20B9"; }]; }; @@ -7465,12 +7849,12 @@ githubId = 13547699; name = "Corin Hoad"; keys = [{ - longkeyid = "rsa2048/0x6A37DF9483188492"; fingerprint = "BA3A 5886 AE6D 526E 20B4 57D6 6A37 DF94 8318 8492"; }]; }; lux = { email = "lux@lux.name"; + github = "luxferresum"; githubId = 1208273; matrix = "@lux:ontheblueplanet.com"; name = "Lux"; @@ -7495,14 +7879,10 @@ }; lynty = { email = "ltdong93+nix@gmail.com"; - github = "lynty"; + github = "Lynty"; githubId = 39707188; name = "Lynn Dong"; }; - lyt = { - email = "wheatdoge@gmail.com"; - name = "Tim Liou"; - }; m00wl = { name = "Moritz Lumme"; email = "moritz.lumme@gmail.com"; @@ -7515,14 +7895,10 @@ githubId = 3044438; name = "Lucas Savva"; }; - m3tti = { - email = "mathaeus.peter.sander@gmail.com"; - name = "Mathaeus Sander"; - }; ma27 = { email = "maximilian@mbosch.me"; matrix = "@ma27:nicht-so.sexy"; - github = "ma27"; + github = "Ma27"; githubId = 6025220; name = "Maximilian Bosch"; }; @@ -7568,6 +7944,12 @@ githubId = 7645711; name = "Bart Brouns"; }; + magnouvean = { + email = "rg0zjsyh@anonaddy.me"; + github = "magnouvean"; + githubId = 85435692; + name = "Maxwell Berg"; + }; mahe = { email = "matthias.mh.herrmann@gmail.com"; github = "2chilled"; @@ -7580,6 +7962,18 @@ githubId = 31056089; name = "Tom Ho"; }; + majewsky = { + email = "majewsky@gmx.net"; + github = "majewsky"; + githubId = 24696; + name = "Stefan Majewsky"; + }; + majiir = { + email = "majiir@nabaal.net"; + github = "Majiir"; + githubId = 963511; + name = "Majiir Paktu"; + }; makefu = { email = "makefu@syntax-fehler.de"; github = "makefu"; @@ -7632,7 +8026,7 @@ }; marcweber = { email = "marco-oweber@gmx.de"; - github = "marcweber"; + github = "MarcWeber"; githubId = 34086; name = "Marc Weber"; }; @@ -7660,9 +8054,11 @@ githubId = 26470037; name = "Markus Kowalewski"; }; - markWot = { - email = "markus@wotringer.de"; - name = "Markus Wotringer"; + mariaa144 = { + email = "speechguard_intensivist@aleeas.com"; + github = "mariaa144"; + githubId = 105451387; + name = "Maria"; }; marijanp = { name = "Marijan Petričević"; @@ -7682,6 +8078,12 @@ githubId = 65531; name = "Mario Rodas"; }; + marsupialgutz = { + email = "mars@possums.xyz"; + github = "marsupialgutz"; + githubId = 33522919; + name = "Marshall Arruda"; + }; martijnvermaat = { email = "martijn@vermaat.name"; github = "martijnvermaat"; @@ -7712,7 +8114,6 @@ githubId = 2551444; name = "Marcial Gaißert"; keys = [{ - longkeyid = "rsa2048/0xB629036BE399EEE9"; fingerprint = "B573 5118 0375 A872 FBBF 7770 B629 036B E399 EEE9"; }]; }; @@ -7736,7 +8137,7 @@ }; mathnerd314 = { email = "mathnerd314.gph+hs@gmail.com"; - github = "mathnerd314"; + github = "Mathnerd314"; githubId = 322214; name = "Mathnerd314"; }; @@ -7746,6 +8147,12 @@ githubId = 1711539; name = "matklad"; }; + matrss = { + name = "Matthias Riße"; + email = "matthias.risze@t-online.de"; + github = "matrss"; + githubId = 9308656; + }; matt-snider = { email = "matt.snider@protonmail.com"; github = "matt-snider"; @@ -7764,6 +8171,12 @@ githubId = 19036; name = "Matthew Bauer"; }; + matthiasbenaets = { + email = "matthias.benaets@gmail.com"; + github = "MatthiasBenaets"; + githubId = 89214559; + name = "Matthias Benaets"; + }; matthiasbeyer = { email = "mail@beyermatthias.de"; matrix = "@musicmatze:beyermatthi.as"; @@ -7771,6 +8184,15 @@ githubId = 427866; name = "Matthias Beyer"; }; + MatthieuBarthel = { + email = "matthieu@imatt.ch"; + name = "Matthieu Barthel"; + github = "MatthieuBarthel"; + githubId = 435534; + keys = [{ + fingerprint = "80EB 0F2B 484A BB80 7BEF 4145 BA23 F10E AADC 2E26"; + }]; + }; matthuszagh = { email = "huszaghmatt@gmail.com"; github = "matthuszagh"; @@ -7789,7 +8211,6 @@ githubId = 26559841; name = "Matthew Penner"; keys = [{ - longkeyid = "ed25519/0x31311906AD4CF6D6"; fingerprint = "5118 F1CC B7B0 6C17 4DD1 5267 3131 1906 AD4C F6D6"; }]; }; @@ -7811,7 +8232,6 @@ githubId = 19580458; name = "Max Niederman"; keys = [{ - longkeyid = "rsa3072/0x9AED881481D8444E"; fingerprint = "1DE4 424D BF77 1192 5DC4 CF5E 9AED 8814 81D8 444E"; }]; }; @@ -7935,7 +8355,6 @@ githubId = 13689192; name = "Nguyễn Gia Phong"; keys = [{ - longkeyid = "rsa3072/0x27148B2C06A2224B"; fingerprint = "E90E 11B8 0493 343B 6132 E394 2714 8B2C 06A2 224B"; }]; }; @@ -7951,6 +8370,12 @@ githubId = 1377571; name = "Matthew S. Daiter"; }; + mdarocha = { + email = "marek@mdarocha.pl"; + github = "mdarocha"; + githubId = 11572618; + name = "Marek Darocha"; + }; mdevlamynck = { email = "matthias.devlamynck@mailoo.org"; github = "mdevlamynck"; @@ -7963,7 +8388,6 @@ githubId = 1926905; name = "Matt Layher"; keys = [{ - longkeyid = "rsa2048/0x77BFE531397EDE94"; fingerprint = "D709 03C8 0BE9 ACDC 14F0 3BFB 77BF E531 397E DE94"; }]; }; @@ -7985,12 +8409,6 @@ githubId = 1788114; name = "Meghea Iulian"; }; - mehandes = { - email = "niewskici@gmail.com"; - github = "mehandes"; - githubId = 32581276; - name = "Matt Deming"; - }; meisternu = { email = "meister@krutt.org"; github = "meisternu"; @@ -8011,14 +8429,10 @@ }; melkor333 = { email = "samuel@ton-kunst.ch"; - github = "melkor333"; + github = "Melkor333"; githubId = 6412377; name = "Samuel Ruprecht"; }; - metabar = { - email = "softs@metabarcoding.org"; - name = "Celine Mercier"; - }; kira-bruneau = { email = "kira.bruneau@pm.me"; name = "Kira Bruneau"; @@ -8079,15 +8493,29 @@ githubId = 20536514; name = "Magdalena Haselsteiner"; }; + mh182 = { + email = "mh182@chello.at"; + github = "mh182"; + githubId = 9980864; + name = "Max Hofer"; + }; + miangraham = { + email = "miangraham@users.noreply.github.com"; + github = "miangraham"; + githubId = 704580; + name = "M. Ian Graham"; + keys = [{ + fingerprint = "8CE3 2906 516F C4D8 D373 308A E189 648A 55F5 9A9F"; + }]; + }; mic92 = { email = "joerg@thalheim.io"; matrix = "@mic92:nixos.dev"; - github = "mic92"; + github = "Mic92"; githubId = 96200; name = "Jörg Thalheim"; keys = [{ # compare with https://keybase.io/Mic92 - longkeyid = "rsa4096/0x003F2096411B5F92"; fingerprint = "3DEE 1C55 6E1C 3DC5 54F5 875A 003F 2096 411B 5F92"; }]; }; @@ -8140,7 +8568,6 @@ githubId = 7343721; name = "midchildan"; keys = [{ - longkeyid = "rsa4096/0x186A1EDAC5C63F83"; fingerprint = "FEF0 AE2D 5449 3482 5F06 40AA 186A 1EDA C5C6 3F83"; }]; }; @@ -8174,7 +8601,6 @@ githubId = 3490861; name = "Mark Vainomaa"; keys = [{ - longkeyid = "rsa4096/0xDA015B05B5A11B22"; fingerprint = "DB43 2895 CF68 F0CE D4B7 EF60 DA01 5B05 B5A1 1B22"; }]; }; @@ -8186,7 +8612,7 @@ }; milesbreslin = { email = "milesbreslin@gmail.com"; - github = "milesbreslin"; + github = "MilesBreslin"; githubId = 38543128; name = "Miles Breslin"; }; @@ -8208,10 +8634,6 @@ githubId = 5378535; name = "Milo Gertjejansen"; }; - miltador = { - email = "miltador@yandex.ua"; - name = "Vasiliy Solovey"; - }; mimame = { email = "miguel.madrid.mencia@gmail.com"; github = "mimame"; @@ -8230,10 +8652,19 @@ githubId = 1200507; name = "Rémi Nicole"; keys = [{ - longkeyid = "rsa2048/0xFEA888C9F5D64F62"; fingerprint = "3196 83D3 9A1B 4DE1 3DC2 51FD FEA8 88C9 F5D6 4F62"; }]; }; + minion3665 = { + name = "Skyler Grey"; + email = "skyler3665@gmail.com"; + matrix = "@minion3665:matrix.org"; + github = "Minion3665"; + githubId = 34243578; + keys = [{ + fingerprint = "D520 AC8D 7C96 9212 5B2B BD3A 1AFD 1025 6B3C 714D"; + }]; + }; mir06 = { email = "armin.leuprecht@uni-graz.at"; github = "mir06"; @@ -8252,6 +8683,16 @@ githubId = 1776903; name = "Andrew Abbott"; }; + misterio77 = { + email = "eu@misterio.me"; + github = "Misterio77"; + githubId = 5727578; + matrix = "@misterio:matrix.org"; + name = "Gabriel Fontes"; + keys = [{ + fingerprint = "7088 C742 1873 E0DB 97FF 17C2 245C AB70 B4C2 25E9"; + }]; + }; mitchmindtree = { email = "mail@mitchellnordine.com"; github = "mitchmindtree"; @@ -8288,7 +8729,6 @@ githubId = 7753506; name = "Michał Krzysztof Feiler"; keys = [{ - longkeyid = "rsa4096/0xE35C2D7C2C6AC724"; fingerprint = "1E36 9940 CC7E 01C4 CFE8 F20A E35C 2D7C 2C6A C724"; }]; }; @@ -8305,7 +8745,6 @@ githubId = 7735145; name = "Maciej Krüger"; keys = [{ - longkeyid = "rsa4096/0x0D948CE19CF49C5F"; fingerprint = "E90C BA34 55B3 6236 740C 038F 0D94 8CE1 9CF4 9C5F"; }]; }; @@ -8335,7 +8774,7 @@ }; mmesch = { email = "mmesch@noreply.github.com"; - github = "mmesch"; + github = "MMesch"; githubId = 2597803; name = "Matthias Meschede"; }; @@ -8388,10 +8827,16 @@ github = "mohe2015"; githubId = 13287984; keys = [{ - longkeyid = "rsa4096/0x6794D45A488C2EDE"; fingerprint = "1248 D3E1 1D11 4A85 75C9 8934 6794 D45A 488C 2EDE"; }]; }; + monaaraj = { + name = "Mon Aaraj"; + email = "owo69uwu69@gmail.com"; + matrix = "@mon:tchncs.de"; + github = "MonAaraj"; + githubId = 46468162; + }; monsieurp = { email = "monsieurp@gentoo.org"; github = "monsieurp"; @@ -8412,11 +8857,10 @@ }; moredread = { email = "code@apb.name"; - github = "moredread"; + github = "Moredread"; githubId = 100848; name = "André-Patrick Bubel"; keys = [{ - longkeyid = "rsa8192/0x118CE7C424B45728"; fingerprint = "4412 38AD CAD3 228D 876C 5455 118C E7C4 24B4 5728"; }]; }; @@ -8440,13 +8884,13 @@ }; mothsart = { email = "jerem.ferry@gmail.com"; - github = "mothsart"; + github = "mothsART"; githubId = 10601196; name = "Jérémie Ferry"; }; mounium = { email = "muoniurn@gmail.com"; - github = "mounium"; + github = "Mounium"; githubId = 20026143; name = "Katona László"; }; @@ -8498,17 +8942,6 @@ githubId = 3073833; name = "Massimo Redaelli"; }; - mrhedgehog = { - name = "Mr Hedgehog"; - email = "hedgehog@mrhedgehog.xyz"; - matrix = "@mrhedgehog:jupiterbroadcasting.com"; - github = "ModdedGamers"; - githubId = 35778371; - keys = [{ - longkeyid = "rsa4096/0x7D5107866B1C6752"; - fingerprint = "38A0 29B0 4A7E 4C13 A4BB 86C8 7D51 0786 6B1C 6752"; - }]; - }; mrkkrp = { email = "markkarpov92@gmail.com"; github = "mrkkrp"; @@ -8527,14 +8960,6 @@ githubId = 839693; name = "Ingolf Wanger"; }; - msackman = { - email = "matthew@wellquite.org"; - name = "Matthew Sackman"; - }; - mschneider = { - email = "markus.schneider.sic+nix@gmail.com"; - name = "Markus Schneider"; - }; mschristiansen = { email = "mikkel@rheosystems.com"; github = "mschristiansen"; @@ -8549,11 +8974,10 @@ }; msfjarvis = { github = "msfjarvis"; - githubId = 3348378; + githubId = 13348378; name = "Harsh Shandilya"; email = "nixos@msfjarvis.dev"; keys = [{ - longkeyid = "rsa4096/0xB7843F823355E9B9"; fingerprint = "8F87 050B 0F9C B841 1515 7399 B784 3F82 3355 E9B9"; }]; }; @@ -8629,22 +9053,16 @@ githubId = 220262; name = "Ion Mudreac"; }; - muflax = { - email = "mail@muflax.com"; - github = "muflax"; - githubId = 69918; - name = "Stefan Dorn"; - }; multun = { email = "victor.collod@epita.fr"; github = "multun"; githubId = 5047140; name = "Victor Collod"; }; - musfay = { - email = "musfay@protonmail.com"; - github = "musfay"; - githubId = 33374965; + muscaln = { + email = "muscaln@protonmail.com"; + github = "muscaln"; + githubId = 96225281; name = "Mustafa Çalışkan"; }; mupdt = { @@ -8660,7 +9078,6 @@ github = "mvisonneau"; githubId = 1761583; keys = [{ - longkeyid = "rsa4096/0x150D6F0AE9198D24"; fingerprint = "EC63 0CEA E8BC 5EE5 5C58 F2E3 150D 6F0A E919 8D24"; }]; }; @@ -8685,7 +9102,7 @@ }; myrl = { email = "myrl.0xf@gmail.com"; - github = "myrl"; + github = "Myrl"; githubId = 9636071; name = "Myrl Hex"; }; @@ -8697,7 +9114,7 @@ }; nadrieril = { email = "nadrieril@gmail.com"; - github = "nadrieril"; + github = "Nadrieril"; githubId = 6783654; name = "Nadrieril Feneanar"; }; @@ -8719,14 +9136,9 @@ githubId = 35005234; name = "Nasir Hussain"; keys = [{ - longkeyid = "rsa4096/0xD8126E559CE7C35D"; fingerprint = "7A10 AB8E 0BEC 566B 090C 9BE3 D812 6E55 9CE7 C35D"; }]; }; - Nate-Devv = { - email = "natedevv@gmail.com"; - name = "Nathan Moore"; - }; nathanruiz = { email = "nathanruiz@protonmail.com"; github = "nathanruiz"; @@ -8745,6 +9157,15 @@ githubId = 818502; name = "Nathan Yong"; }; + natsukium = { + email = "nixpkgs@natsukium.com"; + github = "natsukium"; + githubId = 25083790; + name = "Tomoya Otabi"; + keys = [{ + fingerprint = "3D14 6004 004C F882 D519 6CD4 9EA4 5A31 DB99 4C53"; + }]; + }; natto1784 = { email = "natto@weirdnatto.in"; github = "natto1784"; @@ -8758,7 +9179,6 @@ github = "nazarewk"; githubId = 3494992; keys = [{ - longkeyid = "rsa4096/0x916D8B67241892AE"; fingerprint = "4BFF 0614 03A2 47F0 AA0B 4BC4 916D 8B67 2418 92AE"; }]; }; @@ -8781,8 +9201,7 @@ githubId = 4323933; name = "Naïm Favier"; keys = [{ - longkeyid = "rsa2048/0x49B07322580B7EE2"; - fingerprint = "51A0 705E 7DD2 3CBC 5EAA B43E 49B0 7322 580B 7EE2"; + fingerprint = "F3EB 4BBB 4E71 99BC 299C D4E9 95AF CE82 1190 8325"; }]; }; nckx = { @@ -8803,6 +9222,24 @@ githubId = 3747396; name = "Nathan Isom"; }; + necrophcodr = { + email = "nc@scalehost.eu"; + github = "necrophcodr"; + githubId = 575887; + name = "Steffen Rytter Postas"; + }; + neilmayhew = { + email = "nix@neil.mayhew.name"; + github = "neilmayhew"; + githubId = 166791; + name = "Neil Mayhew"; + }; + nek0 = { + email = "nek0@nek0.eu"; + github = "nek0"; + githubId = 1859691; + name = "Amedeo Molnár"; + }; nelsonjeppesen = { email = "nix@jeppesen.io"; github = "NelsonJeppesen"; @@ -8823,7 +9260,7 @@ }; nequissimus = { email = "tim@nequissimus.com"; - github = "nequissimus"; + github = "NeQuissimus"; githubId = 628342; name = "Tim Steinbach"; }; @@ -8836,8 +9273,18 @@ nessdoor = { name = "Tomas Antonio Lopez"; email = "entropy.overseer@protonmail.com"; + github = "nessdoor"; githubId = 25993494; }; + netali = { + name = "Jennifer Graul"; + email = "me@netali.de"; + github = "NetaliDev"; + githubId = 15304894; + keys = [{ + fingerprint = "F729 2594 6F58 0B05 8FB3 F271 9C55 E636 426B 40A9"; + }]; + }; netcrns = { email = "jason.wing@gmx.de"; github = "netcrns"; @@ -8874,9 +9321,11 @@ githubId = 6391776; name = "Nikita Voloboev"; }; - nfjinjing = { - email = "nfjinjing@gmail.com"; - name = "Jinjing Wang"; + ngiger = { + email = "niklaus.giger@member.fsf.org"; + github = "ngiger"; + githubId = 265800; + name = "Niklaus Giger"; }; nh2 = { email = "mail@nh2.me"; @@ -8897,7 +9346,6 @@ githubId = 77309427; name = "Nicolás Kennedy"; keys = [{ - longkeyid = "rsa4096/0xC061089EFEBF7A35"; fingerprint = "7BC1 77D9 C222 B1DC FB2F 0484 C061 089E FEBF 7A35"; }]; }; @@ -8915,7 +9363,7 @@ }; nickhu = { email = "me@nickhu.co.uk"; - github = "nickhu"; + github = "NickHu"; githubId = 450276; name = "Nick Hu"; }; @@ -8943,7 +9391,6 @@ githubId = 23580910; name = "Jakub Kądziołka"; keys = [{ - longkeyid = "rsa4096/0xE315A75846131564"; fingerprint = "E576 BFB2 CF6E B13D F571 33B9 E315 A758 4613 1564"; }]; }; @@ -8974,7 +9421,7 @@ ninjatrappeur = { email = "felix@alternativebit.fr"; matrix = "@ninjatrappeur:matrix.org"; - github = "ninjatrappeur"; + github = "NinjaTrappeur"; githubId = 1219785; name = "Félix Baylac-Jacqué"; }; @@ -8984,7 +9431,6 @@ githubId = 354934; name = "Pontus Stenetorp"; keys = [{ - longkeyid = "rsa4096/0xD430287500E6483C"; fingerprint = "0966 2F9F 3FDA C22B C22E 4CE1 D430 2875 00E6 483C"; }]; }; @@ -9000,7 +9446,6 @@ github = "NKJe"; githubId = 1102306; keys = [{ - longkeyid = "nistp256/0xDE3BADFECD31A89D"; fingerprint = "B956 C6A4 22AF 86A0 8F77 A8CA DE3B ADFE CD31 A89D"; }]; }; @@ -9012,7 +9457,7 @@ }; nkpvk = { email = "niko.pavlinek@gmail.com"; - github = "nkpvk"; + github = "npavlinek"; githubId = 16385648; name = "Niko Pavlinek"; }; @@ -9022,7 +9467,6 @@ githubId = 45737139; name = "nixbitcoindev"; keys = [{ - longkeyid = "rsa4096/0xDD11F9AD5308B3BA"; fingerprint = "577A 3452 7F3E 2A85 E80F E164 DD11 F9AD 5308 B3BA"; }]; }; @@ -9094,6 +9538,12 @@ githubId = 40049608; name = "Andy Chun"; }; + nook = { + name = "Tom Nook"; + email = "0xnook@protonmail.com"; + github = "0xnook"; + githubId = 88323754; + }; noreferences = { email = "norkus@norkus.net"; github = "jozuas"; @@ -9108,7 +9558,7 @@ }; notthemessiah = { email = "brian.cohen.88@gmail.com"; - github = "notthemessiah"; + github = "NOTtheMessiah"; githubId = 2946283; name = "Brian Cohen"; }; @@ -9143,9 +9593,11 @@ githubId = 20391; name = "Nahum Shalman"; }; - nslqqq = { - email = "nslqqq@gmail.com"; - name = "Nikita Mikhailov"; + nsnelson = { + email = "noah.snelson@protonmail.com"; + github = "peeley"; + githubId = 30942198; + name = "Noah Snelson"; }; nthorne = { email = "notrupertthorne@gmail.com"; @@ -9203,7 +9655,6 @@ name = "nzbr"; matrix = "@nzbr:nzbr.de"; keys = [{ - longkeyid = "rsa2048/0x6C78B50B97A42F8A"; fingerprint = "BF3A 3EE6 3144 2C5F C9FB 39A7 6C78 B50B 97A4 2F8A"; }]; }; @@ -9232,10 +9683,18 @@ githubId = 1260687; name = "Felix C. Stegerman"; keys = [{ - longkeyid = "rsa4096/0x2F9607F09B360F2D"; fingerprint = "D5E4 A51D F8D2 55B9 FAC6 A9BB 2F96 07F0 9B36 0F2D"; }]; }; + ocfox = { + email = "i@ocfox.me"; + github = "ocfox"; + githubId = 47410251; + name = "ocfox"; + keys = [{ + fingerprint = "939E F8A5 CED8 7F50 5BB5 B2D0 24BC 2738 5F70 234F"; + }]; + }; odi = { email = "oliver.dunkl@gmail.com"; github = "odi"; @@ -9260,10 +9719,6 @@ githubId = 7249506; name = "oida"; }; - okasu = { - email = "oka.sux@gmail.com"; - name = "Okasu"; - }; olcai = { email = "dev@timan.info"; github = "olcai"; @@ -9288,6 +9743,12 @@ githubId = 1237862; name = "Ollie Bunting"; }; + oluceps = { + email = "nixos@oluceps.uk"; + github = "oluceps"; + githubId = 35628088; + name = "oluceps"; + }; olynch = { email = "owen@olynch.me"; github = "olynch"; @@ -9308,7 +9769,7 @@ }; omnipotententity = { email = "omnipotententity@gmail.com"; - github = "omnipotententity"; + github = "OmnipotentEntity"; githubId = 1538622; name = "Michael Reilly"; }; @@ -9330,6 +9791,12 @@ githubId = 757752; name = "Jonas Heinrich"; }; + onthestairs = { + email = "austinplatt@gmail.com"; + github = "onthestairs"; + githubId = 915970; + name = "Austin Platt"; + }; ony = { name = "Mykola Orliuk"; email = "virkony@gmail.com"; @@ -9374,7 +9841,7 @@ }; oro = { email = "marco@orovecchia.at"; - github = "oro"; + github = "Oro"; githubId = 357005; name = "Marco Orovecchia"; }; @@ -9390,6 +9857,12 @@ githubId = 25278; name = "Otavio Salvador"; }; + otini = { + name = "Olivier Nicole"; + email = "olivier@chnik.fr"; + github = "OlivierNicole"; + githubId = 14031333; + }; otwieracz = { email = "slawek@otwiera.cz"; github = "otwieracz"; @@ -9402,8 +9875,7 @@ githubId = 14816024; name = "oxalica"; keys = [{ - longkeyid = "rsa4096/0xCED392DE0C483D00"; - fingerprint = "5CB0 E9E5 D5D5 71F5 7F54 0FEA CED3 92DE 0C48 3D00"; + fingerprint = "F90F FD6D 585C 2BA1 F13D E8A9 7571 654C F88E 31C2"; }]; }; oxij = { @@ -9412,7 +9884,6 @@ githubId = 391919; name = "Jan Malakhovski"; keys = [{ - longkeyid = "rsa2048/0x0E6CA66E5C557AA8"; fingerprint = "514B B966 B46E 3565 0508 86E8 0E6C A66E 5C55 7AA8"; }]; }; @@ -9422,7 +9893,6 @@ githubId = 8402811; name = "Alvar Penning"; keys = [{ - longkeyid = "rsa4096/0xF32A45637FA25E31"; fingerprint = "EB14 4E67 E57D 27E2 B5A4 CD8C F32A 4563 7FA2 5E31"; }]; }; @@ -9440,7 +9910,7 @@ }; pablovsky = { email = "dealberapablo07@gmail.com"; - github = "pablo1107"; + github = "Pablo1107"; githubId = 17091659; name = "Pablo Andres Dealbera"; }; @@ -9490,7 +9960,7 @@ }; panaeon = { email = "vitalii.voloshyn@gmail.com"; - github = "panaeon"; + github = "PanAeon"; githubId = 686076; name = "Vitalii Voloshyn"; }; @@ -9500,18 +9970,24 @@ githubId = 1788628; name = "pandaman"; }; + panicgh = { + email = "nbenes.gh@xandea.de"; + github = "panicgh"; + githubId = 79252025; + name = "Nicolas Benes"; + }; paperdigits = { email = "mica@silentumbrella.com"; github = "paperdigits"; githubId = 71795; name = "Mica Semrick"; }; - papojari = { - email = "papojari-git.ovoid@aleeas.com"; + annaaurora = { + email = "anna@annaaurora.eu"; matrix = "@papojari:artemislena.eu"; - github = "papojari"; + github = "auroraanna"; githubId = 81317317; - name = "papojari"; + name = "Anna Aurora"; }; paraseba = { email = "paraseba@gmail.com"; @@ -9521,10 +9997,16 @@ }; parasrah = { email = "nixos@parasrah.com"; - github = "parasrah"; + github = "Parasrah"; githubId = 14935550; name = "Brad Pfannmuller"; }; + parras = { + email = "c@philipp-arras.de"; + github = "phiadaarr"; + githubId = 33826198; + name = "Philipp Arras"; + }; pashashocky = { email = "pashashocky@gmail.com"; github = "pashashocky"; @@ -9543,16 +10025,27 @@ githubId = 6931743; name = "pasqui23"; }; + patricksjackson = { + email = "patrick@jackson.dev"; + github = "patricksjackson"; + githubId = 160646; + name = "Patrick Jackson"; + }; patryk27 = { email = "pwychowaniec@pm.me"; github = "Patryk27"; githubId = 3395477; name = "Patryk Wychowaniec"; keys = [{ - longkeyid = "rsa4096/0xF62547D075E09767"; fingerprint = "196A BFEC 6A1D D1EC 7594 F8D1 F625 47D0 75E0 9767"; }]; }; + patryk4815 = { + email = "patryk.sondej@gmail.com"; + github = "patryk4815"; + githubId = 3074260; + name = "Patryk Sondej"; + }; patternspandemic = { email = "patternspandemic@live.com"; github = "patternspandemic"; @@ -9561,7 +10054,7 @@ }; payas = { email = "relekarpayas@gmail.com"; - github = "payasrelekar"; + github = "bhankas"; githubId = 24254289; name = "Payas Relekar"; }; @@ -9595,12 +10088,24 @@ githubId = 6498458; name = "pebble kite"; }; + pbsds = { + name = "Peder Bergebakken Sundt"; + email = "pbsds@hotmail.com"; + github = "pbsds"; + githubId = 140964; + }; pcarrier = { email = "pc@rrier.ca"; github = "pcarrier"; githubId = 8641; name = "Pierre Carrier"; }; + pedrohlc = { + email = "root@pedrohlc.com"; + github = "PedroHLC"; + githubId = 1368952; + name = "Pedro Lara Campos"; + }; penguwin = { email = "penguwin@penguwin.eu"; github = "penguwin"; @@ -9625,13 +10130,6 @@ githubId = 152312; name = "Periklis Tsirakidis"; }; - petabyteboy = { - email = "milan@petabyte.dev"; - matrix = "@milan:petabyte.dev"; - github = "petabyteboy"; - githubId = 3250809; - name = "Milan Pässler"; - }; petercommand = { email = "petercommand@gmail.com"; github = "petercommand"; @@ -9681,6 +10179,27 @@ githubId = 645664; name = "Philippe Hürlimann"; }; + phaer = { + name = "Paul Haerle"; + email = "nix@phaer.org"; + + matrix = "@phaer:matrix.org"; + github = "phaer"; + githubId = 101753; + keys = [{ + fingerprint = "5D69 CF04 B7BC 2BC1 A567 9267 00BC F29B 3208 0700"; + }]; + }; + phfroidmont = { + name = "Paul-Henri Froidmont"; + email = "nix.contact-j9dw4d@froidmont.org"; + + github = "phfroidmont"; + githubId = 8150907; + keys = [{ + fingerprint = "3AC6 F170 F011 33CE 393B CD94 BE94 8AFD 7E78 73BE"; + }]; + }; philandstuff = { email = "philip.g.potter@gmail.com"; github = "philandstuff"; @@ -9744,7 +10263,7 @@ }; pierrer = { email = "pierrer@pi3r.be"; - github = "pierrer"; + github = "PierreR"; githubId = 93115; name = "Pierre Radermecker"; }; @@ -9766,7 +10285,6 @@ githubId = 1576660; name = "Jelle Besseling"; keys = [{ - longkeyid = "rsa4096/0x9712452E8BE3372E"; fingerprint = "A3A3 65AE 16ED A7A0 C29C 88F1 9712 452E 8BE3 372E"; }]; }; @@ -9776,14 +10294,9 @@ githubId = 1719781; name = "Pablo Ovelleiro Corral"; keys = [{ - longkeyid = "rsa4096/0x823A6154426408D3"; fingerprint = "D03B 218C AE77 1F77 D7F9 20D9 823A 6154 4264 08D3"; }]; }; - piotr = { - email = "ppietrasa@gmail.com"; - name = "Piotr Pietraszkiewicz"; - }; pjbarnoy = { email = "pjbarnoy@gmail.com"; github = "pjbarnoy"; @@ -9804,7 +10317,7 @@ }; pkmx = { email = "pkmx.tw@gmail.com"; - github = "pkmx"; + github = "PkmX"; githubId = 610615; name = "Chih-Mao Chen"; }; @@ -9814,7 +10327,6 @@ github = "plabadens"; githubId = 4303706; keys = [{ - longkeyid = "rsa2048/0xF55814E4D6874375"; fingerprint = "B00F E582 FD3F 0732 EA48 3937 F558 14E4 D687 4375"; }]; }; @@ -9854,7 +10366,6 @@ githubId = 898922; name = "Philipp Menke"; keys = [{ - longkeyid = "rsa4096/0xEB7F2D4CCBE23B69"; fingerprint = "ED54 5EFD 64B6 B5AA EC61 8C16 EB7F 2D4C CBE2 3B69"; }]; }; @@ -9890,7 +10401,7 @@ }; pneumaticat = { email = "kevin@potatofrom.space"; - github = "pneumaticat"; + github = "kliu128"; githubId = 11365056; name = "Kevin Liu"; }; @@ -9906,10 +10417,27 @@ githubId = 46154511; name = "Kevin Mullins"; keys = [{ - longkeyid = "rsa4096/361820A45DB41E9A"; fingerprint = "2CD2 B030 BD22 32EF DF5A 008A 3618 20A4 5DB4 1E9A"; }]; }; + podocarp = { + email = "xdjiaxd@gmail.com"; + github = "podocarp"; + githubId = 10473184; + name = "Jia Xiaodong"; + }; + pogobanane = { + email = "mail@peter-okelmann.de"; + github = "pogobanane"; + githubId = 38314551; + name = "Peter Okelmann"; + }; + polarmutex = { + email = "brian@brianryall.xyz"; + github = "polarmutex"; + githubId = 115141; + name = "Brian Ryall"; + }; polendri = { email = "paul@ijj.li"; github = "polendri"; @@ -9928,6 +10456,12 @@ githubId = 81340136; name = "polykernel"; }; + poelzi = { + email = "nix@poelzi.org"; + github = "poelzi"; + githubId = 66107; + name = "Daniel Poelzleithner"; + }; polyrod = { email = "dc1mdp@gmail.com"; github = "polyrod"; @@ -9936,7 +10470,7 @@ }; pombeirp = { email = "nix@endgr.33mail.com"; - github = "PombeirP"; + github = "pedropombeiro"; githubId = 138074; name = "Pedro Pombeiro"; }; @@ -9946,7 +10480,6 @@ githubId = 53291983; name = "Poscat Tarski"; keys = [{ - longkeyid = "rsa4096/2D2595A00D08ACE0"; fingerprint = "48AD DE10 F27B AFB4 7BB0 CCAF 2D25 95A0 0D08 ACE0"; }]; }; @@ -9974,7 +10507,6 @@ githubId = 9904569; name = "Pradyuman Vig"; keys = [{ - longkeyid = "rsa4096/4F74D5361C4CA31E"; fingerprint = "240B 57DE 4271 2480 7CE3 EAC8 4F74 D536 1C4C A31E"; }]; }; @@ -10004,15 +10536,21 @@ name = "Michael Weiss"; keys = [ { - longkeyid = "ed25519/0x130826A6C2A389FD"; # Git only + # Git only fingerprint = "86A7 4A55 07D0 58D1 322E 37FD 1308 26A6 C2A3 89FD"; } { - longkeyid = "rsa3072/0xBCA9943DD1DF4C04"; # Email, etc. + # Email, etc. fingerprint = "AF85 991C C950 49A2 4205 1933 BCA9 943D D1DF 4C04"; } ]; }; + ProducerMatt = { + name = "Matthew Pherigo"; + email = "ProducerMatt42@gmail.com"; + github = "ProducerMatt"; + githubId = 58014742; + }; Profpatsch = { email = "mail@profpatsch.de"; github = "Profpatsch"; @@ -10027,7 +10565,7 @@ }; progval = { email = "progval+nix@progval.net"; - github = "ProgVal"; + github = "progval"; githubId = 406946; name = "Valentin Lorentz"; }; @@ -10049,7 +10587,6 @@ githubId = 42201; name = "Pavol Rusnak"; keys = [{ - longkeyid = "rsa4096/0x91F3B339B9A02A3D"; fingerprint = "86E6 792F C27B FD47 8860 C110 91F3 B339 B9A0 2A3D"; }]; }; @@ -10147,7 +10684,7 @@ }; peelz = { email = "peelz.dev+nixpkgs@gmail.com"; - github = "louistakepillz"; + github = "notpeelz"; githubId = 920910; name = "peelz"; }; @@ -10169,9 +10706,15 @@ githubId = 115877; name = "Kenny Shen"; }; + quag = { + email = "quaggy@gmail.com"; + github = "quag"; + githubId = 35086; + name = "Jonathan Wright"; + }; queezle = { email = "git@queezle.net"; - github = "qzle"; + github = "queezle42"; githubId = 1024891; name = "Jens Nolte"; }; @@ -10187,7 +10730,6 @@ githubId = 2768870; name = "Alyssa Ross"; keys = [{ - longkeyid = "rsa4096/736CCDF9EF51BD97"; fingerprint = "7573 56D7 79BB B888 773E 415E 736C CDF9 EF51 BD97"; }]; }; @@ -10244,13 +10786,13 @@ ralith = { email = "ben.e.saunders@gmail.com"; matrix = "@ralith:ralith.com"; - github = "ralith"; + github = "Ralith"; githubId = 104558; name = "Benjamin Saunders"; }; ramkromberg = { email = "ramkromberg@mail.com"; - github = "ramkromberg"; + github = "RamKromberg"; githubId = 14829269; name = "Ram Kromberg"; }; @@ -10284,10 +10826,6 @@ githubId = 25647735; name = "Victor Freire"; }; - ravloony = { - email = "ravloony@gmail.com"; - name = "Tom Macdonald"; - }; rawkode = { email = "david.andrew.mckay@gmail.com"; github = "rawkode"; @@ -10296,7 +10834,7 @@ }; razvan = { email = "razvan.panda@gmail.com"; - github = "razvan-panda"; + github = "razvan-flavius-panda"; githubId = 1758708; name = "Răzvan Flavius Panda"; }; @@ -10318,7 +10856,6 @@ github = "rbreslow"; githubId = 1774125; keys = [{ - longkeyid = "ed25519/0xA0D32ACCA38B88ED"; fingerprint = "B5B7 BCA0 EE6F F31E 263A 69E3 A0D3 2ACC A38B 88ED"; }]; }; @@ -10349,7 +10886,6 @@ keys = [ # compare with https://keybase.io/reckenrode { - longkeyid = "ed25519/0xFBF19A982CCE0048"; fingerprint = "01D7 5486 3A6D 64EA AC77 0D26 FBF1 9A98 2CCE 0048"; } ]; @@ -10378,9 +10914,15 @@ githubId = 1142322; name = "Martin Lavoie"; }; + regadas = { + email = "oss@regadas.email"; + name = "Filipe Regadas"; + github = "regadas"; + githubId = 163899; + }; regnat = { email = "regnat@regnat.ovh"; - github = "regnat"; + github = "thufschmitt"; githubId = 7226587; name = "Théophane Hufschmitt"; }; @@ -10432,7 +10974,6 @@ github = "revol-xut"; githubId = 32239737; keys = [{ - longkeyid = "rsa4096/B966009D57E69CC6"; fingerprint = "91EB E870 1639 1323 642A 6803 B966 009D 57E6 9CC6"; }]; }; @@ -10480,7 +11021,7 @@ }; rhoriguchi = { email = "ryan.horiguchi@gmail.com"; - github = "rhoriguchi "; + github = "rhoriguchi"; githubId = 6047658; name = "Ryan Horiguchi"; }; @@ -10560,11 +11101,9 @@ githubId = 18313093; keys = [ { - longkeyid = "rsa4096/0xF6FD87B15C263EC9"; fingerprint = "8A0E 6A7C 08AB B9DE 67DE 2A13 F6FD 87B1 5C26 3EC9"; } { - longkeyid = "ed25519/0xBBB7A6801DF1E03F"; fingerprint = "C0A7 A9BB 115B C857 4D75 EA99 BBB7 A680 1DF1 E03F"; } ]; @@ -10619,7 +11158,6 @@ githubId = 2817565; name = "Michele Guerini Rocco"; keys = [{ - longkeyid = "ed25519/0xBFBAF4C975F76450"; fingerprint = "92B2 904F D293 C94D C4C9 3E6B BFBA F4C9 75F7 6450"; }]; }; @@ -10704,7 +11242,7 @@ }; ronanmacf = { email = "macfhlar@tcd.ie"; - github = "ronanmacf"; + github = "RonanMacF"; githubId = 25930627; name = "Ronan Mac Fhlannchadha"; }; @@ -10721,7 +11259,6 @@ githubId = 3621083; name = "Roosembert (Roosemberth) Palacios"; keys = [{ - longkeyid = "rsa2048/0xCAAAECE5C2242BB7"; fingerprint = "78D9 1871 D059 663B 6117 7532 CAAA ECE5 C224 2BB7"; }]; }; @@ -10731,7 +11268,6 @@ github = "rople380"; githubId = 55679162; keys = [{ - longkeyid = "rsa2048/0x8526B7574A536236"; fingerprint = "1401 1B63 393D 16C1 AA9C C521 8526 B757 4A53 6236"; }]; }; @@ -10892,7 +11428,6 @@ githubId = 798147; name = "Robert Helgesson"; keys = [{ - longkeyid = "rsa4096/0x3573356C25C424D4"; fingerprint = "36CA CF52 D098 CC0E 78FB 0CB1 3573 356C 25C4 24D4"; }]; }; @@ -10904,11 +11439,10 @@ }; rytone = { email = "max@ryt.one"; - github = "rytone"; + github = "rastertail"; githubId = 8082305; name = "Maxwell Beck"; keys = [{ - longkeyid = "rsa2048/0xBB3EFA303760A0DB"; fingerprint = "D260 79E3 C2BC 2E43 905B D057 BB3E FA30 3760 A0DB"; }]; }; @@ -10932,7 +11466,6 @@ github = "sagikazarmark"; githubId = 1226384; keys = [{ - longkeyid = "rsa4096/0xF251ADDC9D041C7E"; fingerprint = "E628 C811 6FB8 1657 F706 4EA4 F251 ADDC 9D04 1C7E"; }]; }; @@ -10966,7 +11499,6 @@ githubId = 1349989; name = "samlich"; keys = [{ - longkeyid = "rsa4096/B1568953B1939F1C"; fingerprint = "AE8C 0836 FDF6 3FFC 9580 C588 B156 8953 B193 9F1C"; }]; }; @@ -10989,28 +11521,27 @@ githubId = 132835; name = "Samuel Dionne-Riel"; }; - samuelgrf = { - email = "s@muel.gr"; - github = "samuelgrf"; - githubId = 67663538; - name = "Samuel Gräfenstein"; - keys = [ - { - longkeyid = "rsa4096/0xDE75F92E318123F0"; - fingerprint = "6F2E 2A90 423C 8111 BFF2 895E DE75 F92E 3181 23F0"; - } - { - longkeyid = "rsa4096/0xEF76A063F15C63C8"; - fingerprint = "FF24 5832 8FAF 4660 18C6 186E EF76 A063 F15C 63C8"; - } - ]; - }; samuelrivas = { email = "samuelrivas@gmail.com"; github = "samuelrivas"; githubId = 107703; name = "Samuel Rivas"; }; + samw = { + email = "sam@wlcx.cc"; + github = "wlcx"; + githubId = 3065381; + name = "Sam Willcocks"; + }; + samyak = { + name = "Samyak Sarnayak"; + email = "samyak201@gmail.com"; + github = "Samyak2"; + githubId = 34161949; + keys = [{ + fingerprint = "155C F413 0129 C058 9A5F 5524 3658 73F2 F0C6 153B"; + }]; + }; sander = { email = "s.vanderburg@tudelft.nl"; github = "svanderburg"; @@ -11113,9 +11644,14 @@ githubId = 5104601; name = "schnusch"; }; - schristo = { - email = "schristopher@konputa.com"; - name = "Scott Christopher"; + sciencentistguy = { + email = "jamie@quigley.xyz"; + name = "Jamie Quigley"; + github = "Sciencentistguy"; + githubId = 4983935; + keys = [{ + fingerprint = "30BB FF3F AB0B BB3E 0435 F83C 8E8F F66E 2AE8 D970"; + }]; }; scode = { email = "peter.schuller@infidyne.com"; @@ -11123,6 +11659,12 @@ githubId = 59476; name = "Peter Schuller"; }; + scoder12 = { + name = "Spencer Pogorzelski"; + email = "34356756+Scoder12@users.noreply.github.com"; + github = "Scoder12"; + githubId = 34356756; + }; scolobb = { email = "sivanov@colimite.fr"; github = "scolobb"; @@ -11138,7 +11680,7 @@ Scriptkiddi = { email = "nixos@scriptkiddi.de"; matrix = "@fritz.otlinghaus:helsinki-systems.de"; - github = "scriptkiddi"; + github = "Scriptkiddi"; githubId = 3598650; name = "Fritz Otlinghaus"; }; @@ -11187,7 +11729,7 @@ }; sebtm = { email = "mail@sebastian-sellmeier.de"; - github = "sebtm"; + github = "SebTM"; githubId = 17243347; name = "Sebastian Sellmeier"; }; @@ -11227,6 +11769,12 @@ githubId = 307899; name = "Gurkan Gur"; }; + serge = { + email = "sb@canva.com"; + github = "serge-belov"; + githubId = 38824235; + name = "Serge Belov"; + }; sersorrel = { email = "ash@sorrel.sh"; github = "sersorrel"; @@ -11239,7 +11787,6 @@ githubId = 51969817; name = "Serval"; keys = [{ - longkeyid = "rsa4096/0x4A2AAAA382F8294C"; fingerprint = "A317 37B3 693C 921B 480C C629 4A2A AAA3 82F8 294C"; }]; }; @@ -11249,13 +11796,12 @@ github = "seylerius"; githubId = 1145981; keys = [{ - longkeyid = "rsa4096/0xDC26B921A9E9DBDE"; fingerprint = "7246 B6E1 ABB9 9A48 4395 FD11 DC26 B921 A9E9 DBDE"; }]; }; sfrijters = { email = "sfrijters@gmail.com"; - github = "sfrijters"; + github = "SFrijters"; githubId = 918365; name = "Stefan Frijters"; }; @@ -11271,6 +11817,19 @@ githubId = 1151264; name = "Sebastian Graf"; }; + shadaj = { + email = "shadaj@users.noreply.github.com"; + github = "shadaj"; + githubId = 543055; + name = "Shadaj Laddad"; + }; + shadowrz = { + email = "shadowrz+nixpkgs@disroot.org"; + matrix = "@ShadowRZ:matrixim.cc"; + github = "ShadowRZ"; + githubId = 23130178; + name = "夜坂雅"; + }; shahrukh330 = { email = "shahrukh330@gmail.com"; github = "shahrukh330"; @@ -11300,20 +11859,19 @@ github = "shanesveller"; githubId = 831; keys = [{ - longkeyid = "rsa4096/0x9210C218023C15CD"; fingerprint = "F83C 407C ADC4 5A0F 1F2F 44E8 9210 C218 023C 15CD"; }]; name = "Shane Sveller"; }; shawndellysse = { email = "sdellysse@gmail.com"; - github = "shawndellysse"; + github = "sdellysse"; githubId = 293035; name = "Shawn Dellysse"; }; shawn8901 = { email = "shawn8901@googlemail.com"; - github = "shawn8901"; + github = "Shawn8901"; githubId = 12239057; name = "Shawn8901"; }; @@ -11359,7 +11917,6 @@ github = "shiryel"; githubId = 35617139; keys = [{ - longkeyid = "ed25519/0xC4041EA6B32633DE"; fingerprint = "AB63 4CD9 3322 BD42 6231 F764 C404 1EA6 B326 33DE"; }]; }; @@ -11399,7 +11956,6 @@ github = "Shrimpram"; githubId = 67710369; keys = [{ - longkeyid = "rsa4096/0x163B16EE76ED24CE"; fingerprint = "EA88 EA07 26E9 6CBF 6365 3966 163B 16EE 76ED 24CE"; }]; }; @@ -11439,16 +11995,21 @@ githubId = 688044; name = "Nikolay Korotkiy"; keys = [{ - longkeyid = "rsa2048/0xD1DE6D7F693663A5"; fingerprint = "ADF4 C13D 0E36 1240 BD01 9B51 D1DE 6D7F 6936 63A5"; }]; }; simarra = { name = "simarra"; email = "loic.martel@protonmail.com"; - github = "simarra"; + github = "Simarra"; githubId = 14372987; }; + simoneruffini = { + email = "simone.ruffini@tutanota.com"; + github = "simoneruffini"; + githubId = 50401154; + name = "Simone Ruffini"; + }; simonchatts = { email = "code@chatts.net"; github = "simonchatts"; @@ -11467,6 +12028,12 @@ githubId = 2770647; name = "Simon Vandel Sillesen"; }; + sir4ur0n = { + email = "sir4ur0n@users.noreply.github.com"; + github = "sir4ur0n"; + githubId = 1204125; + name = "sir4ur0n"; + }; siraben = { email = "bensiraphob@gmail.com"; matrix = "@siraben:matrix.org"; @@ -11480,13 +12047,12 @@ githubId = 23038812; name = "Sirio Balmelli"; keys = [{ - longkeyid = "ed25519/0xF72C4A887F9A24CA"; fingerprint = "B234 EFD4 2B42 FE81 EE4D 7627 F72C 4A88 7F9A 24CA"; }]; }; sirseruju = { email = "sir.seruju@yandex.ru"; - github = "sirseruju"; + github = "SirSeruju"; githubId = 74881555; name = "Fofanov Sergey"; }; @@ -11520,20 +12086,12 @@ githubId = 158321; name = "Stewart Mackenzie"; }; - sjourdois = { - email = "sjourdois@gmail.com"; - name = "Stéphane ‘kwisatz’ Jourdois"; - }; skeidel = { email = "svenkeidel@gmail.com"; github = "svenkeidel"; githubId = 266500; name = "Sven Keidel"; }; - skrzyp = { - email = "jot.skrzyp@gmail.com"; - name = "Jakub Skrzypnik"; - }; skykanin = { email = "skykanin@users.noreply.github.com"; github = "skykanin"; @@ -11555,11 +12113,10 @@ }; smakarov = { email = "setser200018@gmail.com"; - github = "setser"; + github = "SeTSeR"; githubId = 12733495; name = "Sergey Makarov"; keys = [{ - longkeyid = "rsa2048/6AA23A1193B7064B"; fingerprint = "6F8A 18AE 4101 103F 3C54 24B9 6AA2 3A11 93B7 064B"; }]; }; @@ -11575,7 +12132,6 @@ githubId = 95471; name = "Sébastien Maret"; keys = [{ - longkeyid = "rsa4096/0x86E30E5A0F5FC59C"; fingerprint = "4242 834C D401 86EF 8281 4093 86E3 0E5A 0F5F C59C"; }]; }; @@ -11600,7 +12156,7 @@ }; sna = { email = "abouzahra.9@wright.edu"; - github = "s-na"; + github = "S-NA"; githubId = 20214715; name = "S. Nordin Abouzahra"; }; @@ -11610,6 +12166,12 @@ githubId = 602439; name = "Serguei Narojnyi"; }; + snapdgn = { + email = "snapdgn@proton.me"; + name = "Nitish Kumar"; + github = "snapdgn"; + githubId = 85608760; + }; snicket2100 = { email = "57048005+snicket2100@users.noreply.github.com"; github = "snicket2100"; @@ -11630,7 +12192,7 @@ }; sohalt = { email = "nixos@sohalt.net"; - github = "sohalt"; + github = "Sohalt"; githubId = 2157287; name = "sohalt"; }; @@ -11641,6 +12203,12 @@ githubId = 26806; name = "Scott Olson"; }; + somasis = { + email = "kylie@somas.is"; + github = "somasis"; + githubId = 264788; + name = "Kylie McClain"; + }; SomeoneSerge = { email = "sergei.kozlukov@aalto.fi"; matrix = "@ss:someonex.net"; @@ -11648,16 +12216,6 @@ githubId = 9720532; name = "Sergei K"; }; - sondr3 = { - email = "nilsen.sondre@gmail.com"; - github = "sondr3"; - githubId = 2280539; - name = "Sondre Nilsen"; - keys = [{ - longkeyid = "ed25519/0x25676BCBFFAD76B1"; - fingerprint = "0EC3 FA89 EFBA B421 F82E 40B0 2567 6BCB FFAD 76B1"; - }]; - }; sophrosyne = { email = "joshuaortiz@tutanota.com"; github = "sophrosyne97"; @@ -11720,11 +12278,17 @@ name = "Spencer Whitt"; }; squalus = { - email = "squalus@tuta.io"; + email = "squalus@squalus.net"; github = "squalus"; githubId = 36899624; name = "squalus"; }; + squarepear = { + email = "contact@jeffreyharmon.dev"; + github = "SquarePear"; + githubId = 16364318; + name = "Jeffrey Harmon"; + }; srapenne = { email = "solene@perso.pw"; github = "rapenne-s"; @@ -11739,7 +12303,7 @@ }; srgom = { email = "srgom@users.noreply.github.com"; - github = "srgom"; + github = "SRGOM"; githubId = 8103619; name = "SRGOM"; }; @@ -11758,14 +12322,14 @@ }; sstef = { email = "stephane@nix.frozenid.net"; - github = "fkstef"; + github = "haskelious"; githubId = 8668915; name = "Stephane Schitter"; }; staccato = { name = "staccato"; email = "moveq@riseup.net"; - github = "staccato"; + github = "braaandon"; githubId = 86573128; }; stackshadow = { @@ -11774,6 +12338,12 @@ githubId = 7512804; name = "Martin Langlotz"; }; + stargate01 = { + email = "christoph.honal@web.de"; + github = "StarGate01"; + githubId = 6362238; + name = "Christoph Honal"; + }; steamwalker = { email = "steamwalker@xs4all.nl"; github = "steamwalker"; @@ -11787,10 +12357,10 @@ name = "Steve Elliott"; }; stehessel = { - email = "stephan@stehessel.de"; - github = "stehessel"; - githubId = 55607356; - name = "Stephan Heßelmann"; + email = "stephan@stehessel.de"; + github = "stehessel"; + githubId = 55607356; + name = "Stephan Heßelmann"; }; steinybot = { name = "Jason Pickens"; @@ -11799,7 +12369,6 @@ github = "steinybot"; githubId = 4659562; keys = [{ - longkeyid = "ed25519/0x21DE1CAE59762A0F"; fingerprint = "2709 1DEC CC42 4635 4299 569C 21DE 1CAE 5976 2A0F"; }]; }; @@ -11846,7 +12415,6 @@ github = "steshaw"; githubId = 45735; keys = [{ - longkeyid = "rsa4096/0x1D9A17DFD23DCB91"; fingerprint = "0AFE 77F7 474D 1596 EE55 7A29 1D9A 17DF D23D CB91"; }]; }; @@ -11864,13 +12432,13 @@ }; stevebob = { email = "stephen@sherra.tt"; - github = "stevebob"; + github = "gridbugs"; githubId = 417118; name = "Stephen Sherratt"; }; steveej = { email = "mail@stefanjunker.de"; - github = "steveej"; + github = "steveeJ"; githubId = 1181362; name = "Stefan Junker"; }; @@ -11904,6 +12472,18 @@ githubId = 1694705; name = "Sam Stites"; }; + strager = { + email = "strager.nds@gmail.com"; + github = "strager"; + githubId = 48666; + name = "Matthew \"strager\" Glazar"; + }; + strikerlulu = { + email = "strikerlulu7@gmail.com"; + github = "strikerlulu"; + githubId = 38893265; + name = "StrikerLulu"; + }; stumoss = { email = "samoss@gmail.com"; github = "stumoss"; @@ -11928,6 +12508,12 @@ githubId = 12984845; name = "Subhrajyoti Sen"; }; + sudosubin = { + email = "sudosubin@gmail.com"; + github = "sudosubin"; + githubId = 32478597; + name = "Subin Kim"; + }; suhr = { email = "suhr@i2pmail.org"; github = "suhr"; @@ -11984,6 +12570,12 @@ githubId = 1040871; name = "Mathis Antony"; }; + sven-of-cord = { + email = "sven@cord.com"; + github = "sven-of-cord"; + githubId = 98333944; + name = "Sven Over"; + }; svend = { email = "svend@svends.net"; github = "svend"; @@ -12053,7 +12645,7 @@ }; szczyp = { email = "qb@szczyp.com"; - github = "szczyp"; + github = "Szczyp"; githubId = 203195; name = "Szczyp"; }; @@ -12081,7 +12673,6 @@ githubId = 4098453; name = "Tadeo Kondrak"; keys = [{ - longkeyid = "ed25519/0xFBE607FCC49516D3"; fingerprint = "0F2B C0C7 E77C 5B42 AC5B 4C18 FBE6 07FC C495 16D3"; }]; }; @@ -12115,7 +12706,6 @@ githubId = 94917129; name = "taikx4"; keys = [{ - longkeyid = "ed25519/0xCCD52C7B37BB837E"; fingerprint = "6B02 8103 C4E5 F68C D77C 9E54 CCD5 2C7B 37BB 837E"; }]; }; @@ -12206,6 +12796,15 @@ githubId = 66133083; name = "Tomas Bravo"; }; + tchekda = { + email = "contact@tchekda.fr"; + github = "Tchekda"; + githubId = 23559888; + keys = [{ + fingerprint = "44CE A8DD 3B31 49CD 6246 9D8F D0A0 07ED A4EA DA0F"; + }]; + name = "David Tchekachev"; + }; tckmn = { email = "andy@tck.mn"; github = "tckmn"; @@ -12230,6 +12829,12 @@ githubId = 139251; name = "Tom Hunger"; }; + tejasag = { + name = "Tejas Agarwal"; + email = "tejasagarwalbly@gmail.com"; + github = "tejasag"; + githubId = 67542663; + }; telotortium = { email = "rirelan@gmail.com"; github = "telotortium"; @@ -12278,6 +12883,16 @@ githubId = 886074; name = "Matthieu Coudron"; }; + teutat3s = { + email = "teutates@mailbox.org"; + matrix = "@teutat3s:pub.solar"; + github = "teutat3s"; + githubId = 10206665; + name = "teutat3s"; + keys = [{ + fingerprint = "81A1 1C61 F413 8C84 9139 A4FA 18DA E600 A6BB E705"; + }]; + }; tex = { email = "milan.svoboda@centrum.cz"; github = "tex"; @@ -12334,7 +12949,6 @@ github = "thblt"; githubId = 2453136; keys = [{ - longkeyid = "rsa4096/0x63A44817A52EAB7B"; fingerprint = "D2A2 F0A1 E7A8 5E6F B711 DEE5 63A4 4817 A52E AB7B"; }]; }; @@ -12362,6 +12976,16 @@ githubId = 8547242; name = "Stefan Rohrbacher"; }; + thehedgeh0g = { + name = "The Hedgehog"; + email = "hedgehog@mrhedgehog.xyz"; + matrix = "@mrhedgehog:jupiterbroadcasting.com"; + github = "theHedgehog0"; + githubId = 35778371; + keys = [{ + fingerprint = "38A0 29B0 4A7E 4C13 A4BB 86C8 7D51 0786 6B1C 6752"; + }]; + }; thelegy = { email = "mail+nixos@0jb.de"; github = "thelegy"; @@ -12376,10 +13000,9 @@ }; thesola10 = { email = "me@thesola.io"; - github = "thesola10"; + github = "Thesola10"; githubId = 7287268; keys = [{ - longkeyid = "rsa4096/0x89245619BEBB95BA"; fingerprint = "1D05 13A6 1AC4 0D8D C6D6 5F2C 8924 5619 BEBB 95BA"; }]; name = "Karim Vergnes"; @@ -12395,6 +13018,13 @@ github = "thiagokokada"; githubId = 844343; name = "Thiago K. Okada"; + matrix = "@k0kada:matrix.org"; + }; + thibaultlemaire = { + email = "thibault.lemaire@protonmail.com"; + github = "ThibaultLemaire"; + githubId = 21345269; + name = "Thibault Lemaire"; }; thibautmarty = { email = "github@thibautmarty.fr"; @@ -12451,7 +13081,6 @@ githubId = 11243138; name = "Chinmay D. Pai"; keys = [{ - longkeyid = "rsa4096/0x75507BE256F40CED"; fingerprint = "7F3E EEAA EE66 93CC 8782 042A 7550 7BE2 56F4 0CED"; }]; }; @@ -12528,10 +13157,15 @@ githubId = 5722198; name = "Thomas Kerber"; keys = [{ - longkeyid = "rsa4096/0x8489B911F9ED617B"; fingerprint = "556A 403F B0A2 D423 F656 3424 8489 B911 F9ED 617B"; }]; }; + tljuniper = { + email = "tljuniper1@gmail.com"; + github = "tljuniper"; + githubId = 48209000; + name = "Anna Gillert"; + }; tmarkovski = { email = "tmarkovski@gmail.com"; github = "tmarkovski"; @@ -12564,7 +13198,6 @@ githubId = 561087; name = "toastal"; keys = [{ - longkeyid = "ed25519/5CCE6F1466D47C9E"; fingerprint = "7944 74B7 D236 DAB9 C9EF E7F9 5CCE 6F14 66D4 7C9E"; }]; }; @@ -12611,12 +13244,25 @@ githubId = 61303; name = "Tom Fitzhenry"; }; + tomhoule = { + email = "secondary+nixpkgs@tomhoule.com"; + github = "tomhoule"; + githubId = 13155277; + name = "Tom Houle"; + }; tomsmeets = { email = "tom.tsmeets@gmail.com"; - github = "tomsmeets"; + github = "TomSmeets"; githubId = 6740669; name = "Tom Smeets"; }; + tomsiewert = { + email = "tom@siewert.io"; + matrix = "@tom:frickel.earth"; + github = "tomsiewert"; + githubId = 8794235; + name = "Tom Siewert"; + }; toonn = { email = "nixpkgs@toonn.io"; matrix = "@toonn:matrix.org"; @@ -12642,6 +13288,13 @@ githubId = 90456; name = "Rebecca (Bex) Kelly"; }; + tpw_rules = { + name = "Thomas Watson"; + email = "twatson52@icloud.com"; + matrix = "@tpw_rules:matrix.org"; + github = "tpwrules"; + githubId = 208010; + }; travisbhartwell = { email = "nafai@travishartwell.net"; github = "travisbhartwell"; @@ -12650,7 +13303,7 @@ }; travisdavis-ops = { email = "travisdavismedia@gmail.com"; - github = "travisdavis-ops"; + github = "TravisDavis-ops"; githubId = 52011418; name = "Travis Davis"; }; @@ -12720,10 +13373,6 @@ githubId = 15064765; name = "tshaynik"; }; - tstrobel = { - email = "4ZKTUB6TEP74PYJOPWIR013S2AV29YUBW5F9ZH2F4D5UMJUJ6S@hash.domains"; - name = "Thomas Strobel"; - }; ttuegel = { email = "ttuegel@mailbox.org"; github = "ttuegel"; @@ -12748,7 +13397,6 @@ githubId = 722482; name = "Denny Schäfer"; keys = [{ - longkeyid = "rsa4096/0xB057455D1E567270"; fingerprint = "C752 0E49 4D92 1740 D263 C467 B057 455D 1E56 7270"; }]; }; @@ -12772,7 +13420,7 @@ }; tvorog = { email = "marszaripov@gmail.com"; - github = "tvorog"; + github = "TvoroG"; githubId = 1325161; name = "Marsel Zaripov"; }; @@ -12794,7 +13442,6 @@ github = "twhitehead"; githubId = 787843; keys = [{ - longkeyid = "rsa2048/0x594258F0389D2802"; fingerprint = "E631 8869 586F 99B4 F6E6 D785 5942 58F0 389D 2802"; }]; }; @@ -12834,7 +13481,6 @@ github = "unclechu"; githubId = 799353; keys = [{ - longkeyid = "rsa4096/0xD276FF7467007335"; fingerprint = "EE59 5E29 BB5B F2B3 5ED2 3F1C D276 FF74 6700 7335"; }]; }; @@ -12864,6 +13510,15 @@ githubId = 619015; name = "Svintsov Dmitry"; }; + urandom = { + email = "colin@urandom.co.uk"; + github = "arnottcr"; + githubId = 2526260; + keys = [{ + fingerprint = "04A3 A2C6 0042 784A AEA7 D051 0447 A663 F7F3 E236"; + }]; + name = "Colin Arnott"; + }; urbas = { email = "matej.urbas@gmail.com"; github = "urbas"; @@ -12934,7 +13589,7 @@ valodim = { email = "look@my.amazin.horse"; matrix = "@Valodim:stratum0.org"; - github = "valodim"; + github = "Valodim"; githubId = 27813; name = "Vincent Breitmoser"; }; @@ -12950,7 +13605,6 @@ githubId = 25173827; name = "Vanilla"; keys = [{ - longkeyid = "rsa4096/0x3750028ED04FA42E"; fingerprint = "2649 340C C909 F821 D251 6714 3750 028E D04F A42E"; }]; }; @@ -12998,7 +13652,6 @@ github = "vcunat"; githubId = 1785925; keys = [{ - longkeyid = "rsa4096/0xE747DF1F9575A3AA"; fingerprint = "B600 6460 B60A 80E7 8206 2449 E747 DF1F 9575 A3AA"; }]; }; @@ -13014,7 +13667,6 @@ github = "veehaitch"; githubId = 15069839; keys = [{ - longkeyid = "rsa4096/0x874BD6F916FAA742"; fingerprint = "4D23 ECDF 880D CADF 5ECA 4458 874B D6F9 16FA A742"; }]; }; @@ -13060,7 +13712,6 @@ githubId = 7953163; name = "Vika Shleina"; keys = [{ - longkeyid = "rsa2048/0x4F62CD07CE64796A"; fingerprint = "B3C0 DA1A C18B 82E8 CA8B B1D1 4F62 CD07 CE64 796A"; }]; }; @@ -13070,7 +13721,6 @@ githubId = 631446; name = "Vincent Bernat"; keys = [{ - longkeyid = "rsa4096/0x95A42FE8353525F9"; fingerprint = "AEF2 3487 66F3 71C6 89A7 3600 95A4 2FE8 3535 25F9"; }]; }; @@ -13080,6 +13730,12 @@ githubId = 118959; name = "VinyMeuh"; }; + virchau13 = { + email = "virchau13@hexular.net"; + github = "virchau13"; + githubId = 16955157; + name = "Vir Chaudhury"; + }; viraptor = { email = "nix@viraptor.info"; github = "viraptor"; @@ -13116,6 +13772,12 @@ githubId = 1771332; name = "László Vaskó"; }; + vlinkz = { + email = "vmfuentes64@gmail.com"; + github = "vlinkz"; + githubId = 20145996; + name = "Victor Fuentes"; + }; vlstill = { email = "xstill@fi.muni.cz"; github = "vlstill"; @@ -13153,12 +13815,6 @@ githubId = 5604643; name = "Mikhail Volkhov"; }; - volth = { - email = "jaroslavas@volth.com"; - github = "volth"; - githubId = 508305; - name = "Jaroslavas Pocepko"; - }; vonfry = { email = "nixos@vonfry.name"; github = "Vonfry"; @@ -13167,6 +13823,8 @@ }; vq = { email = "vq@erq.se"; + github = "vq"; + githubId = 230381; name = "Daniel Nilsson"; }; vrinek = { @@ -13183,7 +13841,7 @@ }; vskilet = { email = "victor@sene.ovh"; - github = "vskilet"; + github = "Vskilet"; githubId = 7677567; name = "Victor SENE"; }; @@ -13211,7 +13869,6 @@ github = "wackbyte"; githubId = 29505620; keys = [{ - longkeyid = "rsa4096/0x937F2AE5CCEFBF59"; fingerprint = "E595 7FE4 FEF6 714B 1AD3 1483 937F 2AE5 CCEF BF59"; }]; }; @@ -13221,7 +13878,6 @@ github = "wakira"; githubId = 2338339; keys = [{ - longkeyid = "rsa4096/0x8C9B0A8FC0C0D862"; fingerprint = "47F7 009E 3AE3 1DA7 988E 12E1 8C9B 0A8F C0C0 D862"; }]; }; @@ -13249,9 +13905,15 @@ github = "wdavidw"; githubId = 46896; }; - wedens = { - email = "kirill.wedens@gmail.com"; - name = "wedens"; + WeebSorceress = { + name = "WeebSorceress"; + email = "hello@weebsorceress.anonaddy.me"; + matrix = "@weebsorceress:matrix.org"; + github = "WeebSorceress"; + githubId = 106774777; + keys = [{ + fingerprint = "659A 9BC3 F904 EC24 1461 2EFE 7F57 3443 17F0 FA43"; + }]; }; wegank = { name = "Weijia Wang"; @@ -13271,7 +13933,6 @@ githubId = 16267532; name = "Han Verstraete"; keys = [{ - longkeyid = "rsa4096/0x11F7BAEA856743FF"; fingerprint = "2145 955E 3F5E 0C95 3458 41B5 11F7 BAEA 8567 43FF"; }]; }; @@ -13305,30 +13966,21 @@ github = "wildsebastian"; githubId = 1215623; keys = [{ - longkeyid = "rsa4096/0x366A2940479A06FC"; fingerprint = "DA03 D6C6 3F58 E796 AD26 E99B 366A 2940 479A 06FC"; }]; }; willibutz = { email = "willibutz@posteo.de"; - github = "willibutz"; + github = "WilliButz"; githubId = 20464732; name = "Willi Butz"; }; - willtim = { - email = "tim.williams.public@gmail.com"; - name = "Tim Philip Williams"; - }; willcohen = { email = "willcohen@users.noreply.github.com"; github = "willcohen"; githubId = 5185341; name = "Will Cohen"; }; - winden = { - email = "windenntw@gmail.com"; - name = "Antonio Vargas Gonzalez"; - }; winpat = { email = "patrickwinter@posteo.ch"; github = "winpat"; @@ -13408,8 +14060,8 @@ name = "Andrei Pampu"; }; wolfangaukang = { - email = "liquid.query960@4wrd.cc"; - github = "wolfangaukang"; + email = "clone.gleeful135+nixpkgs@anonaddy.me"; + github = "WolfangAukang"; githubId = 8378365; name = "P. R. d. O."; }; @@ -13425,12 +14077,27 @@ githubId = 28888242; name = "WORLDofPEACE"; }; + wozeparrot = { + email = "wozeparrot@gmail.com"; + github = "wozeparrot"; + githubId = 25372613; + name = "Woze Parrot"; + }; wr0belj = { name = "Jakub Wróbel"; email = "wrobel.jakub@protonmail.com"; github = "wr0belj"; githubId = 40501814; }; + wrmilling = { + name = "Winston R. Milling"; + email = "Winston@Milli.ng"; + github = "WRMilling"; + githubId = 6162814; + keys = [{ + fingerprint = "21E1 6B8D 2EE8 7530 6A6C 9968 D830 77B9 9F8C 6643"; + }]; + }; wscott = { email = "wsc9tt@gmail.com"; github = "wscott"; @@ -13461,9 +14128,16 @@ github = "wunderbrick"; githubId = 52174714; }; + wyndon = { + email = "72203260+wyndon@users.noreply.github.com"; + matrix = "@wyndon:envs.net"; + github = "wyndon"; + githubId = 72203260; + name = "wyndon"; + }; wyvie = { email = "elijahrum@gmail.com"; - github = "wyvie"; + github = "alicerum"; githubId = 3992240; name = "Elijah Rum"; }; @@ -13537,7 +14211,7 @@ }; xnwdd = { email = "nwdd+nixos@no.team"; - github = "xnwdd"; + github = "xNWDD"; githubId = 3028542; name = "Guillermo NWDD"; }; @@ -13565,6 +14239,12 @@ githubId = 1962985; name = "Vincenzo Mantova"; }; + xyenon = { + name = "XYenon"; + email = "i@xyenon.bid"; + github = "XYenon"; + githubId = 20698483; + }; xzfc = { email = "xzfcpw@gmail.com"; github = "xzfc"; @@ -13620,6 +14300,12 @@ githubId = 5978566; name = "Yves-Stan Le Cornec"; }; + ylh = { + email = "nixpkgs@ylh.io"; + github = "ylh"; + githubId = 9125590; + name = "Yestin L. Harrison"; + }; ylwghst = { email = "ylwghst@onionmail.info"; github = "ylwghst"; @@ -13647,7 +14333,7 @@ yorickvp = { email = "yorickvanpelt@gmail.com"; matrix = "@yorickvp:matrix.org"; - github = "yorickvp"; + github = "yorickvP"; githubId = 647076; name = "Yorick van Pelt"; }; @@ -13669,12 +14355,24 @@ githubId = 7040031; name = "Yannik Sander"; }; + yureien = { + email = "contact@sohamsen.me"; + github = "Yureien"; + githubId = 17357089; + name = "Soham Sen"; + }; yuriaisaka = { email = "yuri.aisaka+nix@gmail.com"; github = "yuriaisaka"; githubId = 687198; name = "Yuri Aisaka"; }; + yurkobb = { + name = "Yury Bulka"; + email = "setthemfree@privacyrequired.com"; + github = "yurkobb"; + githubId = 479389; + }; yurrriq = { email = "eric@ericb.me"; github = "yurrriq"; @@ -13687,7 +14385,6 @@ githubId = 24368641; name = "Guillaume Pagnoux"; keys = [{ - longkeyid = "rsa4096/0xEC5065899AEAAF4C"; fingerprint = "85F8 E850 F8F2 F823 F934 535B EC50 6589 9AEA AF4C"; }]; }; @@ -13705,7 +14402,6 @@ githubId = 19897088; name = "Yusuf Bera Ertan"; keys = [{ - longkeyid = "rsa2048/0x61807181F60EFCB2"; fingerprint = "9270 66BD 8125 A45B 4AC4 0326 6180 7181 F60E FCB2"; }]; }; @@ -13715,7 +14411,6 @@ githubId = 86538850; name = "Yuu Yin"; keys = [{ - longkeyid = "rsa4096/0x416F303B43C20AC3"; fingerprint = "9F19 3AE8 AA25 647F FC31 46B5 416F 303B 43C2 0AC3"; }]; }; @@ -13775,7 +14470,7 @@ }; zauberpony = { email = "elmar@athmer.org"; - github = "zauberpony"; + github = "elmarx"; githubId = 250877; name = "Elmar Athmer"; }; @@ -13785,17 +14480,19 @@ githubId = 6191421; name = "Edward d'Albon"; }; - zef = { - email = "zef@zef.me"; - name = "Zef Hemel"; + zebreus = { + matrix = "@lennart:cicen.net"; + email = "lennarteichhorn+nixpkgs@gmail.com"; + github = "Zebreus"; + githubId = 1557253; + name = "Lennart Eichhorn"; }; zeratax = { email = "mail@zera.tax"; - github = "ZerataX"; + github = "zeratax"; githubId = 5024958; name = "Jona Abdinghoff"; keys = [{ - longkeyid = "rsa4096/0x8333735E784DF9D4"; fingerprint = "44F7 B797 9D3A 27B1 89E0 841E 8333 735E 784D F9D4"; }]; }; @@ -13916,7 +14613,7 @@ }; rakesh4g = { email = "rakeshgupta4u@gmail.com"; - github = "rakesh4g"; + github = "Rakesh4G"; githubId = 50867187; name = "Rakesh Gupta"; }; @@ -13946,7 +14643,7 @@ }; matthewcroughan = { email = "matt@croughan.sh"; - github = "matthewcroughan"; + github = "MatthewCroughan"; githubId = 26458780; name = "Matthew Croughan"; }; @@ -13980,7 +14677,6 @@ github = "ymatsiuk"; githubId = 24990891; keys = [{ - longkeyid = "rsa4096/0x61302290298601AA"; fingerprint = "7BB8 84B5 74DA FDB1 E194 ED21 6130 2290 2986 01AA"; }]; }; @@ -14020,6 +14716,12 @@ github = "deifactor"; githubId = 30192992; }; + deinferno = { + name = "deinferno"; + email = "14363193+deinferno@users.noreply.github.com"; + github = "deinferno"; + githubId = 14363193; + }; fzakaria = { name = "Farid Zakaria"; email = "farid.m.zakaria@gmail.com"; @@ -14046,7 +14748,6 @@ github = "hmenke"; githubId = 1903556; keys = [{ - longkeyid = "rsa4096/0xD65C9AFB4C224DA3"; fingerprint = "F1C5 760E 45B9 9A44 72E9 6BFB D65C 9AFB 4C22 4DA3"; }]; }; @@ -14056,7 +14757,6 @@ github = "berbiche"; githubId = 20448408; keys = [{ - longkeyid = "rsa4096/0xB461292445C6E696"; fingerprint = "D446 E58D 87A0 31C7 EC15 88D7 B461 2924 45C6 E696"; }]; }; @@ -14078,7 +14778,6 @@ github = "starcraft66"; githubId = 1858154; keys = [{ - longkeyid = "rsa4096/0x9D98CDACFF04FD78"; fingerprint = "8597 4506 EC69 5392 0443 0805 9D98 CDAC FF04 FD78"; }]; }; @@ -14110,10 +14809,9 @@ name = "Josh Hoffer"; email = "jhoffer@sansorgan.es"; matrix = "@princemachiavelli:matrix.org"; - github = "princemachiavelli"; + github = "Princemachiavelli"; githubId = 2730968; keys = [{ - longkeyid = "ed25519/0x83124F97A318EA18"; fingerprint = "DD54 130B ABEC B65C 1F6B 2A38 8312 4F97 A318 EA18"; }]; }; @@ -14123,7 +14821,6 @@ github = "ydlr"; githubId = 58453832; keys = [{ - longkeyid = "rsa4096/0x43AB44130A29AD9D"; fingerprint = "FD0A C425 9EF5 4084 F99F 9B47 2ACC 9749 7C68 FAD4"; }]; }; @@ -14133,7 +14830,6 @@ github = "vs49688"; githubId = 4423262; keys = [{ - longkeyid = "rsa4096/0x68616B2D8AC4DCC5"; fingerprint = "61AE D40F 368B 6F26 9DAE 3892 6861 6B2D 8AC4 DCC5"; }]; }; @@ -14143,13 +14839,18 @@ github = "zbioe"; githubId = 7332055; }; + zendo = { + name = "zendo"; + email = "linzway@qq.com"; + github = "zendo"; + githubId = 348013; + }; zenithal = { name = "zenithal"; email = "i@zenithal.me"; github = "ZenithalHourlyRate"; githubId = 19512674; keys = [{ - longkeyid = "rsa4096/0x87E17EEF9B18B6C9"; fingerprint = "1127 F188 280A E312 3619 3329 87E1 7EEF 9B18 B6C9"; }]; }; @@ -14166,7 +14867,6 @@ name = "Zoey de Souza Pessanha"; email = "zoey.spessanha@outlook.com"; keys = [{ - longkeyid = "rsa4096/0x1E1E889CDBD6A315"; fingerprint = "EAA1 51DB 472B 0122 109A CB17 1E1E 889C DBD6 A315"; }]; }; @@ -14182,7 +14882,6 @@ github = "zseri"; githubId = 1618343; keys = [{ - longkeyid = "rsa4096/0x229E63AE5644A96D"; fingerprint = "7AFB C595 0D3A 77BD B00F 947B 229E 63AE 5644 A96D"; }]; }; @@ -14235,7 +14934,6 @@ githubId = 68368; matrix = "@qbit:tapenet.org"; keys = [{ - longkeyid = "rsa4096/0x1F81112D62A9ADCE"; fingerprint = "3586 3350 BFEA C101 DB1A 4AF0 1F81 112D 62A9 ADCE"; }]; }; @@ -14251,4 +14949,84 @@ github = "nigelgbanks"; githubId = 487373; }; + zanculmarktum = { + name = "Azure Zanculmarktum"; + email = "zanculmarktum@gmail.com"; + github = "zanculmarktum"; + githubId = 16958511; + }; + kuwii = { + name = "kuwii"; + email = "kuwii.someone@gmail.com"; + github = "kuwii"; + githubId = 10705175; + }; + melias122 = { + name = "Martin Elias"; + email = "martin+nixpkgs@elias.sx"; + github = "melias122"; + githubId = 1027766; + }; + bryanhonof = { + name = "Bryan Honof"; + email = "bryanhonof@gmail.com"; + github = "bryanhonof"; + githubId = 5932804; + }; + bbenne10 = { + email = "Bryan.Bennett@protonmail.com"; + matrix = "@bryan.bennett:matrix.org"; + github = "bbenne10"; + githubId = 687376; + name = "Bryan Bennett"; + keys = [{ + # compare with https://keybase.io/bbenne10 + fingerprint = "41EA 00B4 00F9 6970 1CB2 D3AF EF90 E3E9 8B8F 5C0B"; + }]; + }; + snpschaaf = { + email = "philipe.schaaf@secunet.com"; + name = "Philippe Schaaf"; + github = "snpschaaf"; + githubId = 105843013; + }; + SohamG = { + email = "sohamg2@gmail.com"; + name = "Soham S Gumaste"; + github = "SohamG"; + githubId = 7116239; + keys = [{ + fingerprint = "E067 520F 5EF2 C175 3F60 50C0 BA46 725F 6A26 7442"; + }]; + }; + jali-clarke = { + email = "jinnah.ali-clarke@outlook.com"; + name = "Jinnah Ali-Clarke"; + github = "jali-clarke"; + githubId = 17733984; + }; + npatsakula = { + email = "nikita.patsakula@gmail.com"; + name = "Patsakula Nikita"; + github = "npatsakula"; + githubId = 23001619; + }; + dfithian = { + email = "daniel.m.fithian@gmail.com"; + name = "Daniel Fithian"; + github = "dfithian"; + githubId = 8409320; + }; + nikstur = { + email = "nikstur@outlook.com"; + name = "nikstur"; + github = "nikstur"; + githubId = 61635709; + }; + yisuidenghua = { + email = "bileiner@gmail.com"; + name = "Milena Yisui"; + github = "yisuidenghua"; + githubId = 102890144; + }; } diff --git a/nixpkgs/maintainers/scripts/dep-licenses.sh b/nixpkgs/maintainers/scripts/dep-licenses.sh index 28ad22c334fc..816dcf6d7f76 100755 --- a/nixpkgs/maintainers/scripts/dep-licenses.sh +++ b/nixpkgs/maintainers/scripts/dep-licenses.sh @@ -9,7 +9,7 @@ tmp=$(mktemp --tmpdir -d nixpkgs-dep-license.XXXXXX) exitHandler() { exitCode=$? rm -rf "$tmp" - exit $exitCode + return $exitCode } trap "exitHandler" EXIT diff --git a/nixpkgs/maintainers/scripts/feature-freeze-teams.pl b/nixpkgs/maintainers/scripts/feature-freeze-teams.pl new file mode 100755 index 000000000000..eb37150befe3 --- /dev/null +++ b/nixpkgs/maintainers/scripts/feature-freeze-teams.pl @@ -0,0 +1,98 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i perl -p perl -p perlPackages.JSON perlPackages.LWPUserAgent perlPackages.LWPProtocolHttps perlPackages.TermReadKey + +# This script generates a list of teams to ping for the Feature Freeze announcement on Discourse. +# It's intended to be used by Release Managers before creating such posts. +# +# The script interactively reads a GitHub username and a corresponding GitHub Personal Access token. +# This is required to access the GitHub Teams API so the token needs at least the read:org privilege. + +## no critic (InputOutput::RequireCheckedSyscalls, InputOutput::ProhibitBacktickOperators) +use strict; +use warnings; +use Carp; +use Cwd 'abs_path'; +use File::Basename; +use JSON qw(decode_json); +use LWP::UserAgent; +use Term::ReadKey qw(ReadLine ReadMode); + +sub github_team_members { + my ($team_name, $username, $token) = @_; + my @ret; + + my $req = HTTP::Request->new('GET', "https://api.github.com/orgs/NixOS/teams/$team_name/members", [ 'Accept' => 'application/vnd.github.v3+json' ]); + $req->authorization_basic($username, $token); + my $response = LWP::UserAgent->new->request($req); + + if ($response->is_success) { + my $content = decode_json($response->decoded_content); + foreach (@{$content}) { + push @ret, $_->{'login'}; + } + } else { + print {*STDERR} "!! Requesting members of GitHub Team '$team_name' failed: $response->status_line"; + } + + return \@ret; +} + +# Read GitHub credentials +print {*STDERR} 'GitHub username: '; +my $github_user = ReadLine(0); +ReadMode('noecho'); +print {*STDERR} 'GitHub personal access token (no echo): '; +my $github_token = ReadLine(0); +ReadMode('restore'); +print {*STDERR} "\n"; +chomp $github_user; +chomp $github_token; + +# Read nix output +my $nix_version = `nix --version`; +my $out; +my $lib_path = abs_path(dirname(__FILE__)) . '../../../lib'; +if ($nix_version =~ m/2[.]3[.]/msx) { + $out = `nix eval --json '(import $lib_path).teams'` || croak 'nix eval failed'; +} else { + $out = `nix --extra-experimental-features nix-command eval --json --impure --expr '(import $lib_path).teams'` || croak('nix eval failed'); +} +my $data = decode_json($out); + +# Process teams +print {*STDERR} "\n"; +while (my ($team_nix_key, $team_config) = each %{$data}) { + # Ignore teams that don't want to be or can't be pinged + if (not defined $team_config->{enableFeatureFreezePing} or not $team_config->{enableFeatureFreezePing}) { + next; + } + if (not defined $team_config->{shortName}) { + print {*STDERR} "!! The team with the nix key '$team_nix_key' has no shortName set - ignoring"; + next; + } + # Team name + print {*STDERR} "$team_config->{shortName}:"; + # GitHub Teams + my @github_members; + if (defined $team_config->{githubTeams}) { + foreach (@{$team_config->{githubTeams}}) { + print {*STDERR} " \@NixOS/${_}"; + push @github_members, @{github_team_members($_, $github_user, $github_token)}; + } + } + my %github_members = map { $_ => 1 } @github_members; + # Members + if (defined $team_config->{members}) { + foreach (@{$team_config->{members}}) { + my %user = %{$_}; + my $github_handle = $user{'github'}; + # Ensure we don't ping team members twice (as team member and directly) + if (defined $github_members{$github_handle}) { + next; + } + print {*STDERR} " \@$github_handle"; + } + } + + print {*STDERR} "\n"; +} diff --git a/nixpkgs/maintainers/scripts/fetch-kde-qt.sh b/nixpkgs/maintainers/scripts/fetch-kde-qt.sh index 22d78151978b..9e2348fda707 100755 --- a/nixpkgs/maintainers/scripts/fetch-kde-qt.sh +++ b/nixpkgs/maintainers/scripts/fetch-kde-qt.sh @@ -2,30 +2,159 @@ #! nix-shell -i bash -p coreutils findutils gnused nix wget set -efuo pipefail +export LC_COLLATE=C # fix sort order -SRCS= -if [ -d "$1" ]; then - SRCS="$(pwd)/$1/srcs.nix" - . "$1/fetch.sh" +# parse files and folders from https://download.kde.org/ and https://download.qt.io/ +# you can override this function in fetch.sh +function PARSE_INDEX() { + cat "$1" | grep -o -E -e '\s+href="[^"]+\.tar\.xz"' -e '\s+href="[-_a-zA-Z0-9]+/"' | cut -d'"' -f2 | sort | uniq +} + +if [ $# != 1 ]; then + echo "example use:" >&2 + echo "cd nixpkgs/" >&2 + echo "./maintainers/scripts/fetch-kde-qt.sh pkgs/development/libraries/qt-5/5.12" >&2 + exit 1 +fi + +if ! echo "$1" | grep -q '^pkgs/'; then + echo "error: path argument must start with pkgs/" >&2 + exit 1 +fi + +# need absolute path for the pushd-popd block +if [ -f "$1" ]; then + echo "ok: using fetchfile $1" + fetchfilerel="$1" + fetchfile="$(readlink -f "$fetchfilerel")" # resolve absolute path + basedir="$(dirname "$fetchfile")" + basedirrel="$(dirname "$fetchfilerel")" +elif [ -d "$1" ]; then + echo "ok: using basedir $1" + basedirrel="$1" + basedir="$(readlink -f "$basedirrel")" # resolve absolute path + if ! [ -d "$basedir" ]; then + basedir="$(dirname "$basedir")" + fi + fetchfile="$basedir/fetch.sh" else - SRCS="$(pwd)/$(dirname $1)/srcs.nix" - . "$1" + echo 'error: $1 must be file or dir' >&2 + exit 1 fi -tmp=$(mktemp -d) +pkgname=$(basename "$basedir") +SRCS="$basedir/srcs.nix" +srcsrel="$basedirrel/srcs.nix" + +source "$fetchfile" + +if [ -n "$WGET_ARGS" ]; then # old format + BASE_URL="${WGET_ARGS[0]}" # convert to new format + # validate + if ! echo "$BASE_URL" | grep -q -E '^(http|https|ftp)://'; then + printf 'error: from WGET_ARGS, converted invalid BASE_URL: %q\n' "$BASE_URL" >&2 + exit 1 + fi + printf 'ok: from WGET_ARGS, converted BASE_URL: %q\n' "$BASE_URL" +elif [ -n "$BASE_URL" ]; then # new format + : +else + echo "error: fetch.sh must set either WGET_ARGS or BASE_URL" >&2 + exit 1 +fi + +tmptpl=tmp.fetch-kde-qt.$pkgname.XXXXXXXXXX + +tmp=$(mktemp -d $tmptpl) pushd $tmp >/dev/null -wget -nH -r -c --no-parent "${WGET_ARGS[@]}" >/dev/null +echo "tempdir is $tmp" + +wgetargs='--quiet --show-progress' +#wgetargs='' # debug + +dirlist="$BASE_URL" +filelist="" +base_url_len=${#BASE_URL} -csv=$(mktemp) -find . -type f | while read src; do +clean_urls() { + # // -> / + sed -E 's,//+,/,g' | sed -E 's,^(http|https|ftp):/,&/,' +} + +while [ -n "$dirlist" ] +do + for dirurl in $dirlist + do + echo "fetching index.html from $dirurl" + relpath=$(echo "./${dirurl:$base_url_len}" | clean_urls) + mkdir -p "$relpath" + indexfile=$(echo "$relpath/index.html" | clean_urls) + wget $wgetargs -O "$indexfile" "$dirurl" + echo "parsing $indexfile" + filedirlist="$(PARSE_INDEX "$indexfile")" + filelist_next="$(echo "$filedirlist" | grep '\.tar\.xz$' | while read file; do echo "$dirurl/$file"; done)" + filelist_next="$(echo "$filelist_next" | clean_urls)" + [ -n "$filelist" ] && filelist+=$'\n' + filelist+="$filelist_next" + dirlist="$(echo "$filedirlist" | grep -v '\.tar\.xz$' | while read dir; do echo "$dirurl/$dir"; done || true)" + dirlist="$(echo "$dirlist" | clean_urls)" + done +done + +filecount=$(echo "$filelist" | wc -l) + +if [ -z "$filelist" ] +then + echo "error: no files parsed from $tmp/index.html" + exit 1 +fi + +echo "parsed $filecount tar.xz files:"; echo "$filelist" + +# most time is spent here +echo "fetching $filecount sha256 files ..." +urllist="$(echo "$filelist" | while read file; do echo "$file.sha256"; done)" +# wget -r: keep directory structure +echo "$urllist" | xargs wget $wgetargs -nH -r -c --no-parent && { + actual=$(find . -type f -name '*.sha256' | wc -l) + echo "fetching $filecount sha256 files done: got $actual files" +} || { + # workaround: in rare cases, the server does not provide the sha256 files + # for example when the release is just a few hours old + # and the servers are not yet fully synced + actual=$(find . -type f -name '*.sha256' | wc -l) + echo "fetching $filecount sha256 files failed: got only $actual files" + + # TODO fetch only missing tar.xz files + echo "fetching $filecount tar.xz files ..." + urllist="$(echo "$filelist" | while read file; do echo "$BASE_URL/$file"; done)" + echo "$urllist" | xargs wget $wgetargs -nH -r -c --no-parent + + echo "generating sha256 files ..." + find . -type f -name '*.tar.xz' | while read src; do + name=$(basename "$src") + sha256=$(sha256sum "$src" | cut -d' ' -f1) + echo "$sha256 $name" >"$src.sha256" + done +} + +csv=$(mktemp $tmptpl.csv) +echo "writing temporary file $csv ..." +find . -type f -name '*.sha256' | while read sha256file; do + src="${sha256file%.*}" # remove extension + sha256=$(cat $sha256file | cut -d' ' -f1) # base16 + sha256=$(nix-hash --type sha256 --to-base32 $sha256) # Sanitize file name filename=$(basename "$src" | tr '@' '_') nameVersion="${filename%.tar.*}" name=$(echo "$nameVersion" | sed -e 's,-[[:digit:]].*,,' | sed -e 's,-opensource-src$,,' | sed -e 's,-everywhere-src$,,') version=$(echo "$nameVersion" | sed -e 's,^\([[:alpha:]][[:alnum:]]*-\)\+,,') - echo "$name,$version,$src,$filename" >>$csv + echo "$name,$version,$src,$filename,$sha256" >>$csv done +files_before=$(grep -c 'src = ' "$SRCS") + +echo "writing output file $SRCS ..." cat >"$SRCS" <<EOF # DO NOT EDIT! This file is generated automatically. # Command: $0 $@ @@ -39,8 +168,8 @@ gawk -F , "{ print \$1 }" $csv | sort | uniq | while read name; do latestVersion=$(echo "$versions" | sort -rV | head -n 1) src=$(gawk -F , "/^$name,$latestVersion,/ { print \$3 }" $csv) filename=$(gawk -F , "/^$name,$latestVersion,/ { print \$4 }" $csv) + sha256=$(gawk -F , "/^$name,$latestVersion,/ { print \$5 }" $csv) url="${src:2}" - sha256=$(nix-hash --type sha256 --base32 --flat "$src") cat >>"$SRCS" <<EOF $name = { version = "$latestVersion"; @@ -55,6 +184,13 @@ done echo "}" >>"$SRCS" +files_after=$(grep -c 'src = ' "$SRCS") +echo "files before: $files_before" +echo "files after: $files_after" + +echo "compare:" +echo "git diff $srcsrel" + popd >/dev/null rm -fr $tmp >/dev/null diff --git a/nixpkgs/maintainers/scripts/fix-maintainers.pl b/nixpkgs/maintainers/scripts/fix-maintainers.pl new file mode 100755 index 000000000000..81f6450c5faf --- /dev/null +++ b/nixpkgs/maintainers/scripts/fix-maintainers.pl @@ -0,0 +1,52 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i perl -p perl -p perlPackages.LWP -p perlPackages.LWPProtocolHttps -p perlPackages.LWPUserAgent -p perlPackages.JSON -p perlPackages.PathTiny +use LWP::UserAgent; +use JSON; +use Path::Tiny; +use strict; +use warnings; + +my $maintainers_list_nix = "../maintainer-list.nix"; +my $maintainers_json = from_json(`nix-instantiate --json --eval --expr 'builtins.fromJSON (builtins.toJSON (import $maintainers_list_nix))'`); + +STDOUT->autoflush(1); + +my $ua = LWP::UserAgent->new(); + +keys %$maintainers_json; # reset the internal iterator so a prior each() doesn't affect the loop +while(my($k, $v) = each %$maintainers_json) { + my $current_user = %$v{'github'}; + if (!defined $current_user) { + print "$k has no github handle\n"; + next; + } + my $github_id = %$v{'githubId'}; + if (!defined $github_id) { + print "$k has no githubId\n"; + next; + } + my $url = 'https://api.github.com/user/' . $github_id; + my $resp = $ua->get( + $url, + "Authorization" => "Token $ENV{GH_TOKEN}" + ); + + if ($resp->header("X-RateLimit-Remaining") == 0) { + my $ratelimit_reset = $resp->header("X-RateLimit-Reset"); + print "Request limit exceeded, waiting until " . scalar localtime $ratelimit_reset . "\n"; + sleep($ratelimit_reset - time() + 5); + } + if ($resp->code != 200) { + print $current_user . " likely deleted their github account\n"; + next; + } + my $resp_json = from_json($resp->content); + my $api_user = %$resp_json{"login"}; + if ($current_user ne $api_user) { + print $current_user . " is now known on github as " . $api_user . ". Editing maintainer-list.nix…\n"; + my $file = path($maintainers_list_nix); + my $data = $file->slurp_utf8; + $data =~ s/github = "$current_user";$/github = "$api_user";/m; + $file->spew_utf8($data); + } +} diff --git a/nixpkgs/maintainers/scripts/haskell/hydra-report.hs b/nixpkgs/maintainers/scripts/haskell/hydra-report.hs index 360b9f2058de..f7e5f573982d 100755 --- a/nixpkgs/maintainers/scripts/haskell/hydra-report.hs +++ b/nixpkgs/maintainers/scripts/haskell/hydra-report.hs @@ -20,14 +20,12 @@ Because step 1) is quite expensive and takes roughly ~5 minutes the result is ca {-# LANGUAGE DerivingStrategies #-} {-# LANGUAGE DuplicateRecordFields #-} {-# LANGUAGE LambdaCase #-} -{-# LANGUAGE MultiWayIf #-} {-# LANGUAGE NamedFieldPuns #-} {-# LANGUAGE OverloadedStrings #-} {-# LANGUAGE ScopedTypeVariables #-} {-# LANGUAGE TupleSections #-} -{-# OPTIONS_GHC -Wall #-} {-# LANGUAGE ViewPatterns #-} -{-# LANGUAGE TupleSections #-} +{-# OPTIONS_GHC -Wall #-} import Control.Monad (forM_, (<=<)) import Control.Monad.Trans (MonadIO (liftIO)) @@ -453,8 +451,8 @@ printBuildSummary showBuild (name, entry) = printJob id name (summaryBuilds entry, Text.pack (if summaryReverseDeps entry > 0 then " :arrow_heading_up: " <> show (summaryUnbrokenReverseDeps entry) <>" | "<> show (summaryReverseDeps entry) else "")) showMaintainedBuild (name, (table, maintainers)) = printJob id name (table, Text.intercalate " " (fmap ("@" <>) (toList maintainers))) tldr = case (errors, warnings) of - ([],[]) -> [":green_circle: **Ready to merge**"] - ([],_) -> [":yellow_circle: **Potential issues**"] + ([],[]) -> [":green_circle: **Ready to merge** (if there are no [evaluation errors](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates))"] + ([],_) -> [":yellow_circle: **Potential issues** (and possibly [evaluation errors](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates))"] _ -> [":red_circle: **Branch not mergeable**"] warnings = if' (Unfinished > maybe Success worstState maintainedJob) "`maintained` jobset failed." <> diff --git a/nixpkgs/maintainers/scripts/haskell/maintained-broken-pkgs.nix b/nixpkgs/maintainers/scripts/haskell/maintained-broken-pkgs.nix new file mode 100644 index 000000000000..7416bfa46ee0 --- /dev/null +++ b/nixpkgs/maintainers/scripts/haskell/maintained-broken-pkgs.nix @@ -0,0 +1,22 @@ +let + nixpkgs = import ../../..; + inherit (nixpkgs {}) haskellPackages lib; + maintainedPkgs = lib.filterAttrs ( + _: v: builtins.length (v.meta.maintainers or []) > 0 + ) haskellPackages; + brokenPkgs = lib.filterAttrs (_: v: v.meta.broken) maintainedPkgs; + transitiveBrokenPkgs = lib.filterAttrs + (_: v: !(builtins.tryEval (v.outPath or null)).success && !v.meta.broken) + maintainedPkgs; + infoList = pkgs: lib.concatStringsSep "\n" (lib.mapAttrsToList (name: drv: "${name} ${(builtins.elemAt drv.meta.maintainers 0).github}") pkgs); +in { + report = '' + BROKEN: + ${infoList brokenPkgs} + + TRANSITIVE BROKEN: + ${infoList transitiveBrokenPkgs} + ''; + transitiveErrors = + builtins.attrValues transitiveBrokenPkgs; +} diff --git a/nixpkgs/maintainers/scripts/haskell/merge-and-open-pr.sh b/nixpkgs/maintainers/scripts/haskell/merge-and-open-pr.sh index 18db1da0f2a5..9e6ebafaccc8 100755 --- a/nixpkgs/maintainers/scripts/haskell/merge-and-open-pr.sh +++ b/nixpkgs/maintainers/scripts/haskell/merge-and-open-pr.sh @@ -99,7 +99,7 @@ This PR is the regular merge of the \`haskell-updates\` branch into \`master\`. This branch is being continually built and tested by hydra at https://hydra.nixos.org/jobset/nixpkgs/haskell-updates. You may be able to find an up-to-date Hydra build report at [cdepillabout/nix-haskell-updates-status](https://github.com/cdepillabout/nix-haskell-updates-status). -We roughly aim to merge these \`haskell-updates\` PRs at least once every two weeks. See the @NixOS/haskell [team calendar](https://cloud.maralorn.de/apps/calendar/p/Mw5WLnzsP7fC4Zky) for who is currently in charge of this branch. +We roughly aim to merge these \`haskell-updates\` PRs at least once every two weeks. See the @NixOS/haskell [team calendar](https://cloud.maralorn.de/apps/calendar/p/H6migHmKX7xHoTFa) for who is currently in charge of this branch. ### haskellPackages Workflow Summary diff --git a/nixpkgs/maintainers/scripts/haskell/update-stackage.sh b/nixpkgs/maintainers/scripts/haskell/update-stackage.sh index ecf38dc4b900..4da9f6d28c2f 100755 --- a/nixpkgs/maintainers/scripts/haskell/update-stackage.sh +++ b/nixpkgs/maintainers/scripts/haskell/update-stackage.sh @@ -1,26 +1,38 @@ #! /usr/bin/env nix-shell #! nix-shell -i bash -p nix curl jq nix-prefetch-github git gnused gnugrep -I nixpkgs=. +# shellcheck shell=bash set -eu -o pipefail -tmpfile=$(mktemp "update-stackage.XXXXXXX") -# shellcheck disable=SC2064 +# Stackage solver to use, LTS or Nightly +# (should be capitalized like the display name) +SOLVER=LTS +TMP_TEMPLATE=update-stackage.XXXXXXX +readonly SOLVER +readonly TMP_TEMPLATE + +toLower() { + printf "%s" "$1" | tr '[:upper:]' '[:lower:]' +} + +tmpfile=$(mktemp "$TMP_TEMPLATE") +tmpfile_new=$(mktemp "$TMP_TEMPLATE") stackage_config="pkgs/development/haskell-modules/configuration-hackage2nix/stackage.yaml" -trap "rm ${tmpfile} ${tmpfile}.new" 0 -touch "$tmpfile" "$tmpfile.new" # Creating files here so that trap creates no errors. +trap 'rm "${tmpfile}" "${tmpfile_new}"' 0 +touch "$tmpfile" "$tmpfile_new" # Creating files here so that trap creates no errors. -curl -L -s "https://stackage.org/lts/cabal.config" >"$tmpfile" -old_version=$(grep "# Stackage" $stackage_config | sed -E 's/.*([0-9]{2}\.[0-9]+)/\1/') -version=$(sed -rn "s/^--.*http:..(www.)?stackage.org.snapshot.lts-//p" "$tmpfile") +curl -L -s "https://stackage.org/$(toLower "$SOLVER")/cabal.config" >"$tmpfile" +old_version=$(grep '^# Stackage' $stackage_config | sed -e 's/.\+ \([A-Za-z]\+ [0-9.-]\+\)$/\1/g') +version="$SOLVER $(sed -rn "s/^--.*http:..(www.)?stackage.org.snapshot.$(toLower "$SOLVER")-//p" "$tmpfile")" if [[ "$old_version" == "$version" ]]; then echo "No new stackage version" exit 0 # Nothing to do fi -echo "Updating Stackage LTS from $old_version to $version." +echo "Updating Stackage from $old_version to $version." # Create a simple yaml version of the file. sed -r \ @@ -30,10 +42,10 @@ sed -r \ -e 's|,$||' \ -e '/installed$/d' \ -e '/^$/d' \ - < "${tmpfile}" | sort --ignore-case >"${tmpfile}.new" + < "${tmpfile}" | sort --ignore-case >"${tmpfile_new}" cat > $stackage_config << EOF -# Stackage LTS $version +# Stackage $version # This file is auto-generated by # maintainers/scripts/haskell/update-stackage.sh default-package-overrides: @@ -45,12 +57,13 @@ sed -r \ -e '/ distribution-nixpkgs /d' \ -e '/ jailbreak-cabal /d' \ -e '/ language-nix /d' \ - < "${tmpfile}.new" >> $stackage_config + -e '/ cabal-install /d' \ + < "${tmpfile_new}" >> $stackage_config if [[ "${1:-}" == "--do-commit" ]]; then git add $stackage_config git commit -F - << EOF -haskellPackages: stackage-lts $old_version -> $version +haskellPackages: stackage $old_version -> $version This commit has been generated by maintainers/scripts/haskell/update-stackage.sh EOF diff --git a/nixpkgs/maintainers/scripts/luarocks-config.lua b/nixpkgs/maintainers/scripts/luarocks-config.lua index 89e74c00ea8e..f7ac9f9e4ba6 100644 --- a/nixpkgs/maintainers/scripts/luarocks-config.lua +++ b/nixpkgs/maintainers/scripts/luarocks-config.lua @@ -1,4 +1,8 @@ + +-- default of luarocks listed at src/luarocks/core/cfg.lua +-- keep this list synced with pkgs/build-support/fetchurl/mirrors.nix rocks_servers = { - "https://luarocks.org" + "https://luarocks.org", + "https://raw.githubusercontent.com/rocks-moonscript-org/moonrocks-mirror/master/" } version_check_on_fail = false diff --git a/nixpkgs/maintainers/scripts/luarocks-packages.csv b/nixpkgs/maintainers/scripts/luarocks-packages.csv index bdda8020a3da..e41e8a162546 100644 --- a/nixpkgs/maintainers/scripts/luarocks-packages.csv +++ b/nixpkgs/maintainers/scripts/luarocks-packages.csv @@ -6,6 +6,7 @@ basexx,https://github.com/teto/basexx.git,,,,, binaryheap,https://github.com/Tieske/binaryheap.lua,,,,,vcunat busted,,,,,, cassowary,,,,,,marsam alerque +cldr,,,,,,alerque compat53,,,,0.7-1,,vcunat cosmo,,,,,,marsam coxpcall,,,,1.17.0-1,, @@ -14,6 +15,7 @@ cyrussasl,https://github.com/JorjBauer/lua-cyrussasl.git,,,,, digestif,https://github.com/astoff/digestif.git,,,0.2-1,lua5_3, dkjson,,,,,, fifo,,,,,, +fluent,,,,,,alerque gitsigns.nvim,https://github.com/lewis6991/gitsigns.nvim.git,,,,lua5_1, http,,,,0.3-0,,vcunat inspect,,,,,, @@ -22,6 +24,9 @@ ldoc,https://github.com/stevedonovan/LDoc.git,,,,, lgi,,,,,, linenoise,https://github.com/hoelzro/lua-linenoise.git,,,,, ljsyscall,,,,,lua5_1,lblasc +lmathx,,,,,lua5_3,alexshpilkin +lmpfrlib,,,,,lua5_3,alexshpilkin +loadkit,,,,,,alerque lpeg,,,,,,vyp lpeg_patterns,,,,,, lpeglabel,,,,,, @@ -34,11 +39,13 @@ lua-cmsgpack,,,,,, lua-iconv,,,,,, lua-lsp,,,,,, lua-messagepack,,,,,, +lua-protobuf,,,,,,lockejan lua-resty-http,,,,,, lua-resty-jwt,,,,,, lua-resty-openidc,,,,,, lua-resty-openssl,,,,,, lua-resty-session,,,,,, +lua-subprocess,https://github.com/0x0ade/lua-subprocess,,,,lua5_1,scoder12 lua-term,,,,,, lua-toml,,,,,, lua-zlib,,,,,,koral @@ -52,7 +59,7 @@ luadbi-postgresql,,,,,, luadbi-sqlite3,,,,,, luaepnf,,,,,, luaevent,,,,,, -luaexpat,,,,1.3.0-1,,arobyn flosse +luaexpat,,,,1.4.1-1,,arobyn flosse luaffi,,,http://luarocks.org/dev,,, luafilesystem,,,,1.7.0-2,,flosse lualogging,,,,,, @@ -64,6 +71,8 @@ luasocket,,,,,, luasql-sqlite3,,,,,,vyp luassert,,,,,, luasystem,,,,,, +luaunbound,,,,, +luaunit,,,,,,lockejan luautf8,,,,,,pstn luazip,,,,,, lua-yajl,,,,,,pstn @@ -80,7 +89,10 @@ plenary.nvim,https://github.com/nvim-lua/plenary.nvim.git,,,,lua5_1, rapidjson,https://github.com/xpol/lua-rapidjson.git,,,,, readline,,,,,, say,https://github.com/Olivine-Labs/say.git,,,,, +serpent,,,,,,lockejan +sqlite,,,,,, std._debug,https://github.com/lua-stdlib/_debug.git,,,,, std.normalize,https://github.com/lua-stdlib/normalize.git,,,,, stdlib,,,,41.2.2,,vyp +tl,,,,,,mephistophiles vstruct,https://github.com/ToxicFrog/vstruct.git,,,,, diff --git a/nixpkgs/maintainers/scripts/mdize-module.sh b/nixpkgs/maintainers/scripts/mdize-module.sh new file mode 100755 index 000000000000..e2d2e5467aa9 --- /dev/null +++ b/nixpkgs/maintainers/scripts/mdize-module.sh @@ -0,0 +1,83 @@ +#! /usr/bin/env nix-shell +#! nix-shell -I nixpkgs=. -i bash -p delta jq perl + +set -euo pipefail +shopt -s inherit_errexit + +cat <<'EOF' +This script attempts to automatically convert option descriptions from +DocBook syntax to markdown. Naturally this process is incomplete and +imperfect, so any changes generated by this script MUST be reviewed. + +Possible problems include: incorrectly replaced tags, badly formatted +markdown, DocBook tags this script doesn't recognize remaining in the +output and crashing the docs build, incorrect escaping of markdown +metacharacters, incorrect unescaping of XML entities—and the list goes on. + +Always review the generated changes! + +Some known limitations: + - Does not transform literalDocBook items + - Replacements can occur in non-option code, such as string literals + + +EOF + + + +build-options-json() { + nix-build --no-out-link --expr ' + let + sys = import ./nixos/default.nix { + configuration = {}; + }; + in + [ + sys.config.system.build.manual.optionsJSON + ] + ' +} + + + +git diff --quiet || { + echo "Worktree is dirty. Please stash or commit first." + exit 1 +} + +echo "Building options.json ..." +old_options=$(build-options-json) + +echo "Applying replacements ..." +perl -pi -e ' + BEGIN { + undef $/; + } + + s,<literal>([^`]*?)</literal>,`$1`,smg; + s,<replaceable>([^»]*?)</replaceable>,«$1»,smg; + s,<filename>([^`]*?)</filename>,{file}`$1`,smg; + s,<option>([^`]*?)</option>,{option}`$1`,smg; + s,<code>([^`]*?)</code>,`$1`,smg; + s,<command>([^`]*?)</command>,{command}`$1`,smg; + s,<link xlink:href="(.+?)" ?/>,<$1>,smg; + s,<link xlink:href="(.+?)">(.*?)</link>,[$2]($1),smg; + s,<package>([^`]*?)</package>,`$1`,smg; + s,<emphasis>([^*]*?)</emphasis>,*$1*,smg; + s,<citerefentry>\s* + <refentrytitle>\s*(.*?)\s*</refentrytitle>\s* + <manvolnum>\s*(.*?)\s*</manvolnum>\s* + </citerefentry>,{manpage}`$1($2)`,smgx; + s,^( +description =),\1 lib.mdDoc,smg; +' "$@" + +echo "Building options.json again ..." +new_options=$(build-options-json) + + +! cmp -s {$old_options,$new_options}/share/doc/nixos/options.json && { + diff -U10 \ + <(jq . <$old_options/share/doc/nixos/options.json) \ + <(jq . <$new_options/share/doc/nixos/options.json) \ + | delta +} diff --git a/nixpkgs/maintainers/scripts/patchelf-hints.sh b/nixpkgs/maintainers/scripts/patchelf-hints.sh index 5fdfc15dc232..802ecab0f0a1 100755 --- a/nixpkgs/maintainers/scripts/patchelf-hints.sh +++ b/nixpkgs/maintainers/scripts/patchelf-hints.sh @@ -61,7 +61,7 @@ for bin in $(find $binaryDist -executable -type f) :; do uniq; ) - if test "$names" = "glibc"; then names="stdenv.glibc"; fi + if test "$names" = "glibc"; then names="glibc"; fi if echo $names | grep -c "gcc" &> /dev/null; then names="stdenv.cc.cc"; fi if test $lib != $libPath; then diff --git a/nixpkgs/maintainers/scripts/pluginupdate.py b/nixpkgs/maintainers/scripts/pluginupdate.py index 017e3ac758ac..55eda3c7d45d 100644 --- a/nixpkgs/maintainers/scripts/pluginupdate.py +++ b/nixpkgs/maintainers/scripts/pluginupdate.py @@ -8,6 +8,7 @@ # $ nix run nixpkgs.python3Packages.flake8 -c flake8 --ignore E501,E265 update.py import argparse +import csv import functools import http import json @@ -28,7 +29,7 @@ from pathlib import Path from typing import Dict, List, Optional, Tuple, Union, Any, Callable from urllib.parse import urljoin, urlparse from tempfile import NamedTemporaryFile -from dataclasses import dataclass +from dataclasses import dataclass, asdict import git @@ -85,21 +86,31 @@ def make_request(url: str, token=None) -> urllib.request.Request: headers["Authorization"] = f"token {token}" return urllib.request.Request(url, headers=headers) + +# a dictionary of plugins and their new repositories +Redirects = Dict['PluginDesc', 'Repo'] + class Repo: def __init__( - self, uri: str, branch: str, alias: Optional[str] + self, uri: str, branch: str ) -> None: self.uri = uri '''Url to the repo''' - self.branch = branch - self.alias = alias - self.redirect: Dict[str, str] = {} + self._branch = branch + # Redirect is the new Repo to use + self.redirect: Optional['Repo'] = None self.token = "dummy_token" @property def name(self): return self.uri.split('/')[-1] + @property + def branch(self): + return self._branch or "HEAD" + + def __str__(self) -> str: + return f"{self.uri}" def __repr__(self) -> str: return f"Repo({self.name}, {self.uri})" @@ -109,6 +120,7 @@ class Repo: @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def latest_commit(self) -> Tuple[str, datetime]: + log.debug("Latest commit") loaded = self._prefetch(None) updated = datetime.strptime(loaded['date'], "%Y-%m-%dT%H:%M:%S%z") @@ -124,6 +136,7 @@ class Repo: return loaded def prefetch(self, ref: Optional[str]) -> str: + print("Prefetching") loaded = self._prefetch(ref) return loaded["sha256"] @@ -137,21 +150,22 @@ class Repo: class RepoGitHub(Repo): def __init__( - self, owner: str, repo: str, branch: str, alias: Optional[str] + self, owner: str, repo: str, branch: str ) -> None: self.owner = owner self.repo = repo self.token = None '''Url to the repo''' - super().__init__(self.url(""), branch, alias) - log.debug("Instantiating github repo %s/%s", self.owner, self.repo) + super().__init__(self.url(""), branch) + log.debug("Instantiating github repo owner=%s and repo=%s", self.owner, self.repo) @property def name(self): return self.repo def url(self, path: str) -> str: - return urljoin(f"https://github.com/{self.owner}/{self.name}/", path) + res = urljoin(f"https://github.com/{self.owner}/{self.repo}/", path) + return res @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def has_submodules(self) -> bool: @@ -168,6 +182,7 @@ class RepoGitHub(Repo): @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def latest_commit(self) -> Tuple[str, datetime]: commit_url = self.url(f"commits/{self.branch}.atom") + log.debug("Sending request to %s", commit_url) commit_req = make_request(commit_url, self.token) with urllib.request.urlopen(commit_req, timeout=10) as req: self._check_for_redirect(commit_url, req) @@ -191,12 +206,9 @@ class RepoGitHub(Repo): new_owner, new_name = ( urllib.parse.urlsplit(response_url).path.strip("/").split("/")[:2] ) - end_line = "\n" if self.alias is None else f" as {self.alias}\n" - plugin_line = "{owner}/{name}" + end_line - old_plugin = plugin_line.format(owner=self.owner, name=self.name) - new_plugin = plugin_line.format(owner=new_owner, name=new_name) - self.redirect[old_plugin] = new_plugin + new_repo = RepoGitHub(owner=new_owner, repo=new_name, branch=self.branch) + self.redirect = new_repo def prefetch(self, commit: str) -> str: @@ -207,9 +219,9 @@ class RepoGitHub(Repo): return sha256 def prefetch_github(self, ref: str) -> str: - data = subprocess.check_output( - ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")] - ) + cmd = ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")] + log.debug("Running %s", cmd) + data = subprocess.check_output(cmd) return data.strip().decode("utf-8") def as_nix(self, plugin: "Plugin") -> str: @@ -226,7 +238,7 @@ class RepoGitHub(Repo): }}''' -@dataclass +@dataclass(frozen=True) class PluginDesc: repo: Repo branch: str @@ -239,21 +251,38 @@ class PluginDesc: else: return self.alias + def __lt__(self, other): + return self.repo.name < other.repo.name + + @staticmethod + def load_from_csv(config: FetchConfig, row: Dict[str, str]) -> 'PluginDesc': + branch = row["branch"] + repo = make_repo(row['repo'], branch.strip()) + repo.token = config.github_token + return PluginDesc(repo, branch.strip(), row["alias"]) + + + @staticmethod + def load_from_string(config: FetchConfig, line: str) -> 'PluginDesc': + branch = "HEAD" + alias = None + uri = line + if " as " in uri: + uri, alias = uri.split(" as ") + alias = alias.strip() + if "@" in uri: + uri, branch = uri.split("@") + repo = make_repo(uri.strip(), branch.strip()) + repo.token = config.github_token + return PluginDesc(repo, branch.strip(), alias) +@dataclass class Plugin: - def __init__( - self, - name: str, - commit: str, - has_submodules: bool, - sha256: str, - date: Optional[datetime] = None, - ) -> None: - self.name = name - self.commit = commit - self.has_submodules = has_submodules - self.sha256 = sha256 - self.date = date + name: str + commit: str + has_submodules: bool + sha256: str + date: Optional[datetime] = None @property def normalized_name(self) -> str: @@ -270,6 +299,27 @@ class Plugin: return copy +def load_plugins_from_csv(config: FetchConfig, input_file: Path,) -> List[PluginDesc]: + log.debug("Load plugins from csv %s", input_file) + plugins = [] + with open(input_file, newline='') as csvfile: + log.debug("Writing into %s", input_file) + reader = csv.DictReader(csvfile,) + for line in reader: + plugin = PluginDesc.load_from_csv(config, line) + plugins.append(plugin) + + return plugins + +def run_nix_expr(expr): + with CleanEnvironment(): + cmd = ["nix", "eval", "--extra-experimental-features", + "nix-command", "--impure", "--json", "--expr", expr] + log.debug("Running command %s", cmd) + out = subprocess.check_output(cmd) + data = json.loads(out) + return data + class Editor: """The configuration of the update script.""" @@ -293,20 +343,20 @@ class Editor: self.deprecated = deprecated or root.joinpath("deprecated.json") self.cache_file = cache_file or f"{name}-plugin-cache.json" - def get_current_plugins(self): + def get_current_plugins(self) -> List[Plugin]: """To fill the cache""" - return get_current_plugins(self) - - def load_plugin_spec(self, config: FetchConfig, plugin_file) -> List[PluginDesc]: + data = run_nix_expr(self.get_plugins) plugins = [] - with open(plugin_file) as f: - for line in f: - if line.startswith("#"): - continue - plugin = parse_plugin_line(config, line) - plugins.append(plugin) + for name, attr in data.items(): + print("get_current_plugins: name %s" % name) + p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"]) + plugins.append(p) return plugins + def load_plugin_spec(self, config: FetchConfig, plugin_file) -> List[PluginDesc]: + '''CSV spec''' + return load_plugins_from_csv(config, plugin_file) + def generate_nix(self, plugins, outfile: str): '''Returns nothing for now, writes directly to outfile''' raise NotImplementedError() @@ -316,11 +366,11 @@ class Editor: _prefetch = functools.partial(prefetch, cache=cache) def update() -> dict: - plugin_names = self.load_plugin_spec(config, input_file) + plugins = self.load_plugin_spec(config, input_file) try: pool = Pool(processes=config.proc) - results = pool.map(_prefetch, plugin_names) + results = pool.map(_prefetch, plugins) finally: cache.store() @@ -415,23 +465,10 @@ class CleanEnvironment(object): self.empty_config.close() -def get_current_plugins(editor: Editor) -> List[Plugin]: - with CleanEnvironment(): - cmd = ["nix", "eval", "--extra-experimental-features", "nix-command", "--impure", "--json", "--expr", editor.get_plugins] - log.debug("Running command %s", cmd) - out = subprocess.check_output(cmd) - data = json.loads(out) - plugins = [] - for name, attr in data.items(): - p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"]) - plugins.append(p) - return plugins - - def prefetch_plugin( p: PluginDesc, cache: "Optional[Cache]" = None, -) -> Tuple[Plugin, Dict[str, str]]: +) -> Tuple[Plugin, Optional[Repo]]: repo, branch, alias = p.repo, p.branch, p.alias name = alias or p.repo.name commit = None @@ -445,7 +482,7 @@ def prefetch_plugin( return cached_plugin, repo.redirect has_submodules = repo.has_submodules() - print(f"prefetch {name}") + log.debug(f"prefetch {name}") sha256 = repo.prefetch(commit) return ( @@ -454,12 +491,7 @@ def prefetch_plugin( ) -def fetch_plugin_from_pluginline(config: FetchConfig, plugin_line: str) -> Plugin: - plugin, _ = prefetch_plugin(parse_plugin_line(config, plugin_line)) - return plugin - - -def print_download_error(plugin: str, ex: Exception): +def print_download_error(plugin: PluginDesc, ex: Exception): print(f"{plugin}: {ex}", file=sys.stderr) ex_traceback = ex.__traceback__ tb_lines = [ @@ -468,20 +500,22 @@ def print_download_error(plugin: str, ex: Exception): ] print("\n".join(tb_lines)) - def check_results( - results: List[Tuple[PluginDesc, Union[Exception, Plugin], Dict[str, str]]] -) -> Tuple[List[Tuple[PluginDesc, Plugin]], Dict[str, str]]: + results: List[Tuple[PluginDesc, Union[Exception, Plugin], Optional[Repo]]] +) -> Tuple[List[Tuple[PluginDesc, Plugin]], Redirects]: ''' ''' - failures: List[Tuple[str, Exception]] = [] + failures: List[Tuple[PluginDesc, Exception]] = [] plugins = [] - redirects: Dict[str, str] = {} + redirects: Redirects = {} for (pdesc, result, redirect) in results: if isinstance(result, Exception): - failures.append((pdesc.name, result)) + failures.append((pdesc, result)) else: - plugins.append((pdesc, result)) - redirects.update(redirect) + new_pdesc = pdesc + if redirect is not None: + redirects.update({pdesc: redirect}) + new_pdesc = PluginDesc(redirect, pdesc.branch, pdesc.alias) + plugins.append((new_pdesc, result)) print(f"{len(results) - len(failures)} plugins were checked", end="") if len(failures) == 0: @@ -495,31 +529,17 @@ def check_results( sys.exit(1) -def make_repo(uri, branch, alias) -> Repo: +def make_repo(uri: str, branch) -> Repo: '''Instantiate a Repo with the correct specialization depending on server (gitub spec)''' # dumb check to see if it's of the form owner/repo (=> github) or https://... - res = uri.split('/') - if len(res) <= 2: - repo = RepoGitHub(res[0], res[1], branch, alias) + res = urlparse(uri) + if res.netloc in [ "github.com", ""]: + res = res.path.strip('/').split('/') + repo = RepoGitHub(res[0], res[1], branch) else: - repo = Repo(uri.strip(), branch, alias) + repo = Repo(uri.strip(), branch) return repo -def parse_plugin_line(config: FetchConfig, line: str) -> PluginDesc: - branch = "HEAD" - alias = None - uri = line - if " as " in uri: - uri, alias = uri.split(" as ") - alias = alias.strip() - if "@" in uri: - uri, branch = uri.split("@") - - repo = make_repo(uri.strip(), branch.strip(), alias) - repo.token = config.github_token - - return PluginDesc(repo, branch.strip(), alias) - def get_cache_path(cache_file_name: str) -> Optional[Path]: xdg_cache = os.environ.get("XDG_CACHE_HOME", None) @@ -576,36 +596,37 @@ class Cache: def prefetch( pluginDesc: PluginDesc, cache: Cache -) -> Tuple[PluginDesc, Union[Exception, Plugin], dict]: +) -> Tuple[PluginDesc, Union[Exception, Plugin], Optional[Repo]]: try: plugin, redirect = prefetch_plugin(pluginDesc, cache) cache[plugin.commit] = plugin return (pluginDesc, plugin, redirect) except Exception as e: - return (pluginDesc, e, {}) + return (pluginDesc, e, None) + def rewrite_input( config: FetchConfig, input_file: Path, deprecated: Path, - redirects: Dict[str, str] = None, - append: Tuple = (), + # old pluginDesc and the new + redirects: Redirects = {}, + append: List[PluginDesc] = [], ): - with open(input_file, "r") as f: - lines = f.readlines() + plugins = load_plugins_from_csv(config, input_file,) - lines.extend(append) + plugins.extend(append) if redirects: - lines = [redirects.get(line, line) for line in lines] cur_date_iso = datetime.now().strftime("%Y-%m-%d") with open(deprecated, "r") as f: deprecations = json.load(f) - for old, new in redirects.items(): - old_plugin = fetch_plugin_from_pluginline(config, old) - new_plugin = fetch_plugin_from_pluginline(config, new) + for pdesc, new_repo in redirects.items(): + new_pdesc = PluginDesc(new_repo, pdesc.branch, pdesc.alias) + old_plugin, _ = prefetch_plugin(pdesc) + new_plugin, _ = prefetch_plugin(new_pdesc) if old_plugin.normalized_name != new_plugin.normalized_name: deprecations[old_plugin.normalized_name] = { "new": new_plugin.normalized_name, @@ -615,10 +636,14 @@ def rewrite_input( json.dump(deprecations, f, indent=4, sort_keys=True) f.write("\n") - lines = sorted(lines, key=str.casefold) - with open(input_file, "w") as f: - f.writelines(lines) + log.debug("Writing into %s", input_file) + # fields = dataclasses.fields(PluginDesc) + fieldnames = ['repo', 'branch', 'alias'] + writer = csv.DictWriter(f, fieldnames, dialect='unix', quoting=csv.QUOTE_NONE) + writer.writeheader() + for plugin in sorted(plugins): + writer.writerow(asdict(plugin)) def commit(repo: git.Repo, message: str, files: List[Path]) -> None: @@ -660,9 +685,11 @@ def update_plugins(editor: Editor, args): ) for plugin_line in args.add_plugins: - editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=(plugin_line + "\n",)) + pdesc = PluginDesc.load_from_string(fetch_config, plugin_line) + append = [ pdesc ] + editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=append) update() - plugin = fetch_plugin_from_pluginline(fetch_config, plugin_line) + plugin, _ = prefetch_plugin(pdesc, ) if autocommit: commit( nixpkgs_repo, diff --git a/nixpkgs/maintainers/scripts/rebuild-amount.sh b/nixpkgs/maintainers/scripts/rebuild-amount.sh index bedd352db5f3..32810f6b98c0 100755 --- a/nixpkgs/maintainers/scripts/rebuild-amount.sh +++ b/nixpkgs/maintainers/scripts/rebuild-amount.sh @@ -35,7 +35,7 @@ toRemove=() cleanup() { rm -rf "${toRemove[@]}" } -trap cleanup EXIT SIGINT SIGQUIT ERR +trap cleanup EXIT MKTEMP='mktemp --tmpdir nix-rebuild-amount-XXXXXXXX' diff --git a/nixpkgs/maintainers/scripts/update-luarocks-packages b/nixpkgs/maintainers/scripts/update-luarocks-packages index 73a233c5f103..cab63ca44e38 100755 --- a/nixpkgs/maintainers/scripts/update-luarocks-packages +++ b/nixpkgs/maintainers/scripts/update-luarocks-packages @@ -31,7 +31,7 @@ from pluginupdate import Editor, update_plugins, FetchConfig, CleanEnvironment PKG_LIST="maintainers/scripts/luarocks-packages.csv" TMP_FILE="$(mktemp)" GENERATED_NIXFILE="pkgs/development/lua-modules/generated-packages.nix" -LUAROCKS_CONFIG="$NIXPKGS_PATH/maintainers/scripts/luarocks-config.lua" +LUAROCKS_CONFIG="maintainers/scripts/luarocks-config.lua" HEADER = """/* {GENERATED_NIXFILE} is an auto-generated file -- DO NOT EDIT! Regenerate it with: @@ -158,14 +158,14 @@ def generate_pkg_nix(plug: LuaPlugin): Our cache key associates "p.name-p.version" to its rockspec ''' log.debug("Generating nix expression for %s", plug.name) - cmd = [ "luarocks", "nix"] + custom_env = os.environ.copy() + custom_env['LUAROCKS_CONFIG'] = LUAROCKS_CONFIG + cmd = [ "luarocks", "nix"] if plug.maintainers: cmd.append(f"--maintainers={plug.maintainers}") - # updates plugin directly from its repository - print("server: [%s]" % plug.server) # if plug.server == "src": if plug.src != "": if plug.src is None: @@ -194,7 +194,8 @@ def generate_pkg_nix(plug: LuaPlugin): cmd.append(f"--lua-dir={lua_drv_path}/bin") log.debug("running %s", ' '.join(cmd)) - output = subprocess.check_output(cmd, text=True) + + output = subprocess.check_output(cmd, env=custom_env, text=True) output = "callPackage(" + output.strip() + ") {};\n\n" return (plug, output) diff --git a/nixpkgs/maintainers/team-list.nix b/nixpkgs/maintainers/team-list.nix index bf4fcc6a4a7d..86d297730ce3 100644 --- a/nixpkgs/maintainers/team-list.nix +++ b/nixpkgs/maintainers/team-list.nix @@ -3,16 +3,26 @@ # Required members = [ maintainer1 maintainer2 ]; scope = "Maintain foo packages."; + shortName = "foo"; + # Optional + enableFeatureFreezePing = true; + githubTeams = [ "my-subsystem" ]; }; where - `members` is the list of maintainers belonging to the group, - `scope` describes the scope of the group. + - `shortName` short human-readable name + - `enableFeatureFreezePing` will ping this team during the Feature Freeze announcements on releases + - `githubTeams` will ping specified GitHub teams as well More fields may be added in the future. - Please keep the list alphabetically sorted. + When editing this file: + * keep the list alphabetically sorted + * test the validity of the format with: + nix-build lib/tests/teams.nix */ { lib }: @@ -27,6 +37,7 @@ with lib.maintainers; { m1cr0man ]; scope = "Maintain ACME-related packages and modules."; + shortName = "ACME"; }; bazel = { @@ -41,6 +52,8 @@ with lib.maintainers; { ylecornec ]; scope = "Bazel build tool & related tools https://bazel.build/"; + shortName = "Bazel"; + enableFeatureFreezePing = true; }; beam = { @@ -53,7 +66,43 @@ with lib.maintainers; { minijackson yurrriq ]; + githubTeams = [ + "beam" + ]; scope = "Maintain BEAM-related packages and modules."; + shortName = "BEAM"; + enableFeatureFreezePing = true; + }; + + blockchains = { + members = [ + mmahut + RaghavSood + ]; + scope = "Maintain Blockchain packages and modules."; + shortName = "Blockchains"; + enableFeatureFreezePing = true; + }; + + c = { + members = [ + matthewbauer + mic92 + ]; + scope = "Maintain C libraries and tooling."; + shortName = "C"; + enableFeatureFreezePing = true; + }; + + c3d2 = { + members = [ + astro + SuperSandro2000 + revol-xut + ]; + scope = "Maintain packages used in the C3D2 hackspace"; + shortName = "c3d2"; + enableFeatureFreezePing = true; }; cinnamon = { @@ -61,6 +110,8 @@ with lib.maintainers; { mkg20001 ]; scope = "Maintain Cinnamon desktop environment and applications made by the LinuxMint team."; + shortName = "Cinnamon"; + enableFeatureFreezePing = true; }; chia = { @@ -68,6 +119,41 @@ with lib.maintainers; { lourkeur ]; scope = "Maintain the Chia blockchain and its dependencies"; + shortName = "Chia Blockchain"; + }; + + coq = { + members = [ + cohencyril + Zimmi48 + # gares has no entry in the maintainers list + siraben + vbgl + ]; + scope = "Maintain the Coq theorem prover and related packages."; + shortName = "Coq"; + enableFeatureFreezePing = true; + }; + + darwin = { + members = [ + toonn + ]; + githubTeams = [ + "darwin-maintainers" + ]; + scope = "Maintain Darwin compatibility of packages and Darwin-only packages."; + shortName = "Darwin"; + enableFeatureFreezePing = true; + }; + + cosmopolitan = { + members = [ + lourkeur + tomberek + ]; + scope = "Maintain the Cosmopolitan LibC and related programs."; + shortName = "Cosmopolitan"; }; deshaw = { @@ -76,6 +162,7 @@ with lib.maintainers; { limeytexan ]; scope = "Group registration for D. E. Shaw employees who collectively maintain packages."; + shortName = "Shaw employees"; }; determinatesystems = { @@ -85,11 +172,75 @@ with lib.maintainers; { grahamc ]; scope = "Group registration for packages maintained by Determinate Systems."; + shortName = "Determinate Systems employees"; + }; + + dhall = { + members = [ + Gabriel439 + ehmry + ]; + scope = "Maintain Dhall and related packages."; + shortName = "Dhall"; + enableFeatureFreezePing = true; + }; + + docker = { + members = [ + roberth + utdemir + ]; + scope = "Maintain Docker and related tools."; + shortName = "DockerTools"; + enableFeatureFreezePing = true; + }; + + docs = { + members = [ + ryantm + ]; + scope = "Maintain nixpkgs/NixOS documentation and tools for building it."; + shortName = "Docs"; + enableFeatureFreezePing = true; + }; + + emacs = { + members = [ + adisbladis + ]; + scope = "Maintain the Emacs editor and packages."; + shortName = "Emacs"; + enableFeatureFreezePing = true; + }; + + enlightenment = { + members = [ + romildo + ]; + githubTeams = [ + "enlightenment" + ]; + scope = "Maintain Enlightenment desktop environment and related packages."; + shortName = "Enlightenment"; + enableFeatureFreezePing = true; + }; + + # Dummy group for the "everyone else" section + feature-freeze-everyone-else = { + members = [ ]; + githubTeams = [ + "nixpkgs-committers" + "release-engineers" + ]; + scope = "Dummy team for the #everyone else' section during feture freezes, not to be used as package maintainers!"; + shortName = "Everyone else"; + enableFeatureFreezePing = true; }; freedesktop = { members = [ jtojnar ]; scope = "Maintain Freedesktop.org packages for graphical desktop."; + shortName = "freedesktop.org packaging"; }; gcc = { @@ -99,30 +250,35 @@ with lib.maintainers; { ericson2314 ]; scope = "Maintain GCC (GNU Compiler Collection) compilers"; + shortName = "GCC"; }; golang = { members = [ c00w - cstrahan - Frostman kalbasit mic92 - orivej - rvolosatovs zowoq ]; scope = "Maintain Golang compilers."; + shortName = "Go"; + enableFeatureFreezePing = true; }; gnome = { members = [ + bobby285271 hedning jtojnar dasj19 maxeaubrey ]; + githubTeams = [ + "gnome" + ]; scope = "Maintain GNOME desktop environment and platform."; + shortName = "GNOME"; + enableFeatureFreezePing = true; }; haskell = { @@ -132,7 +288,12 @@ with lib.maintainers; { maralorn sternenseemann ]; + githubTeams = [ + "haskell" + ]; scope = "Maintain Haskell packages and infrastructure."; + shortName = "Haskell"; + enableFeatureFreezePing = true; }; home-assistant = { @@ -143,6 +304,7 @@ with lib.maintainers; { mic92 ]; scope = "Maintain the Home Assistant ecosystem"; + shortName = "Home Assistant"; }; iog = { @@ -154,16 +316,17 @@ with lib.maintainers; { nrdxp ]; scope = "Input-Output Global employees, which maintain critical software"; + shortName = "Input-Output Global employees"; }; jitsi = { members = [ cleeyv - petabyteboy ryantm yuka ]; scope = "Maintain Jitsi."; + shortName = "Jitsi"; }; kubernetes = { @@ -175,6 +338,7 @@ with lib.maintainers; { zowoq ]; scope = "Maintain the Kubernetes package and module"; + shortName = "Kubernetes"; }; kodi = { @@ -187,6 +351,7 @@ with lib.maintainers; { sephalon ]; scope = "Maintain Kodi and related packages."; + shortName = "Kodi"; }; linux-kernel = { @@ -197,6 +362,51 @@ with lib.maintainers; { qyliss ]; scope = "Maintain the Linux kernel."; + shortName = "Linux Kernel"; + }; + + lumiguide = { + # Verify additions by approval of an already existing member of the team. + members = [ + roelvandijk + lucus16 + ]; + scope = "Group registration for LumiGuide employees who collectively maintain packages."; + shortName = "Lumiguide employees"; + }; + + lumina = { + members = [ + romildo + ]; + githubTeams = [ + "lumina" + ]; + scope = "Maintain lumina desktop environment and related packages."; + shortName = "Lumina"; + enableFeatureFreezePing = true; + }; + + lxqt = { + members = [ + romildo + ]; + githubTeams = [ + "lxqt" + ]; + scope = "Maintain LXQt desktop environment and related packages."; + shortName = "LXQt"; + enableFeatureFreezePing = true; + }; + + marketing = { + members = [ + garbas + tomberek + ]; + scope = "Marketing of Nix/NixOS/nixpkgs."; + shortName = "Marketing"; + enableFeatureFreezePing = true; }; mate = { @@ -205,6 +415,7 @@ with lib.maintainers; { romildo ]; scope = "Maintain Mate desktop environment and related packages."; + shortName = "MATE"; }; matrix = { @@ -218,6 +429,53 @@ with lib.maintainers; { sumnerevans ]; scope = "Maintain the ecosystem around Matrix, a decentralized messenger."; + shortName = "Matrix"; + }; + + mobile = { + members = [ + samueldr + ]; + scope = "Maintain Mobile NixOS."; + shortName = "Mobile"; + enableFeatureFreezePing = true; + }; + + nix = { + members = [ + Profpatsch + eelco + grahamc + pierron + ]; + scope = "Maintain the Nix package manager."; + shortName = "Nix/nix-cli ecosystem"; + enableFeatureFreezePing = true; + }; + + nixos-modules = { + members = [ + ericson2314 + infinisil + qyliss + roberth + ]; + scope = "Maintain nixpkgs module system internals."; + shortName = "NixOS Modules / internals"; + enableFeatureFreezePing = true; + }; + + numtide = { + members = [ + mic92 + flokli + jfroche + tazjin + zimbatm + ]; + enableFeatureFreezePing = true; + scope = "Group registration for Numtide team members who collectively maintain packages."; + shortName = "Numtide team"; }; openstack = { @@ -226,6 +484,7 @@ with lib.maintainers; { SuperSandro2000 ]; scope = "Maintain the ecosystem around OpenStack"; + shortName = "OpenStack"; }; pantheon = { @@ -233,7 +492,21 @@ with lib.maintainers; { davidak bobby285271 ]; + githubTeams = [ + "pantheon" + ]; scope = "Maintain Pantheon desktop environment and platform."; + shortName = "Pantheon"; + enableFeatureFreezePing = true; + }; + + perl = { + members = [ + sgo + ]; + scope = "Maintain the Perl interpreter and Perl packages."; + shortName = "Perl"; + enableFeatureFreezePing = true; }; php = { @@ -245,7 +518,12 @@ with lib.maintainers; { ma27 talyz ]; + githubTeams = [ + "php" + ]; scope = "Maintain PHP related packages and extensions."; + shortName = "PHP"; + enableFeatureFreezePing = true; }; podman = { @@ -255,7 +533,54 @@ with lib.maintainers; { vdemeester zowoq ]; + githubTeams = [ + "podman" + ]; scope = "Maintain Podman and CRI-O related packages and modules."; + shortName = "Podman"; + enableFeatureFreezePing = true; + }; + + postgres = { + members = [ + thoughtpolice + ]; + scope = "Maintain the PostgreSQL package and plugins along with the NixOS module."; + shortName = "PostgreSQL"; + enableFeatureFreezePing = true; + }; + + python = { + members = [ + fridh + hexa + jonringer + ]; + scope = "Maintain the Python interpreter and related packages."; + shortName = "Python"; + enableFeatureFreezePing = true; + }; + + qt-kde = { + members = [ + ttuegel + ]; + githubTeams = [ + "qt-kde" + ]; + scope = "Maintain the KDE desktop environment and Qt."; + shortName = "Qt / KDE"; + enableFeatureFreezePing = true; + }; + + r = { + members = [ + bcdarwin + jbedo + ]; + scope = "Maintain the R programming language and related packages."; + shortName = "R"; + enableFeatureFreezePing = true; }; redcodelabs = { @@ -265,6 +590,38 @@ with lib.maintainers; { wintrmvte ]; scope = "Maintain Red Code Labs related packages and modules."; + shortName = "Red Code Labs"; + }; + + release = { + members = [ ]; + githubTeams = [ + "nixos-release-managers" + ]; + scope = "Manage the current nixpkgs/NixOS release."; + shortName = "Release"; + enableFeatureFreezePing = true; + }; + + ruby = { + members = [ + marsam + ]; + scope = "Maintain the Ruby interpreter and related packages."; + shortName = "Ruby"; + enableFeatureFreezePing = true; + }; + + rust = { + members = [ + andir + lnl7 + mic92 + zowoq + ]; + scope = "Maintain the Rust compiler toolchain and nixpkgs integration."; + shortName = "Rust"; + enableFeatureFreezePing = true; }; sage = { @@ -275,6 +632,7 @@ with lib.maintainers; { collares ]; scope = "Maintain SageMath and the dependencies that are likely to break it."; + shortName = "SageMath"; }; sphinx = { @@ -282,6 +640,7 @@ with lib.maintainers; { SuperSandro2000 ]; scope = "Maintain Sphinx related packages."; + shortName = "Sphinx"; }; serokell = { @@ -291,6 +650,26 @@ with lib.maintainers; { mkaito ]; scope = "Group registration for Serokell employees who collectively maintain packages."; + shortName = "Serokell employees"; + }; + + systemd = { + members = [ ]; + githubTeams = [ + "systemd" + ]; + scope = "Maintain systemd for NixOS."; + shortName = "systemd"; + enableFeatureFreezePing = true; + }; + + tests = { + members = [ + tfc + ]; + scope = "Maintain the NixOS VM test runner."; + shortName = "NixOS tests"; + enableFeatureFreezePing = true; }; tts = { @@ -299,6 +678,18 @@ with lib.maintainers; { mic92 ]; scope = "coqui-ai TTS (formerly Mozilla TTS) and leaf packages"; + shortName = "coqui-ai TTS"; + }; + + vim = { + members = [ + jonringer + softinio + teto + ]; + scope = "Maintain the vim and neovim text editors and related packages."; + shortName = "Vim/Neovim"; + enableFeatureFreezePing = true; }; xfce = { @@ -306,5 +697,6 @@ with lib.maintainers; { romildo ]; scope = "Maintain Xfce desktop environment and related packages."; + shortName = "Xfce"; }; } |