about summary refs log tree commit diff
path: root/nixpkgs/maintainers
diff options
context:
space:
mode:
Diffstat (limited to 'nixpkgs/maintainers')
-rw-r--r--nixpkgs/maintainers/README.md174
-rw-r--r--nixpkgs/maintainers/maintainer-list.nix21523
-rw-r--r--nixpkgs/maintainers/scripts/README.md62
-rw-r--r--nixpkgs/maintainers/scripts/all-tarballs.nix16
-rw-r--r--nixpkgs/maintainers/scripts/bootstrap-files/README.md85
-rwxr-xr-xnixpkgs/maintainers/scripts/bootstrap-files/refresh-tarballs.bash282
-rw-r--r--nixpkgs/maintainers/scripts/build.nix55
l---------nixpkgs/maintainers/scripts/check-by-name.sh1
-rw-r--r--nixpkgs/maintainers/scripts/check-hydra-by-maintainer.nix71
-rwxr-xr-xnixpkgs/maintainers/scripts/check-maintainer-github-handles.sh66
-rw-r--r--nixpkgs/maintainers/scripts/check-maintainers-sorted.nix57
-rwxr-xr-xnixpkgs/maintainers/scripts/convert-to-import-cargo-lock.sh4
-rw-r--r--nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/.gitignore1
-rw-r--r--nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/Cargo.lock106
-rw-r--r--nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/Cargo.toml12
-rw-r--r--nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/default.nix16
-rw-r--r--nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/shell.nix5
-rw-r--r--nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/src/main.rs241
-rwxr-xr-xnixpkgs/maintainers/scripts/copy-tarballs.pl252
-rwxr-xr-xnixpkgs/maintainers/scripts/db-to-md.sh88
-rwxr-xr-xnixpkgs/maintainers/scripts/debian-patches.sh34
-rwxr-xr-xnixpkgs/maintainers/scripts/dep-licenses.sh57
-rwxr-xr-xnixpkgs/maintainers/scripts/doc/escape-code-markup.py97
-rwxr-xr-xnixpkgs/maintainers/scripts/doc/list-systemd-manpages.zsh33
-rwxr-xr-xnixpkgs/maintainers/scripts/doc/replace-xrefs-by-empty-links.py32
-rw-r--r--nixpkgs/maintainers/scripts/doc/unknown-code-language.lua12
-rw-r--r--nixpkgs/maintainers/scripts/eval-release.nix25
-rwxr-xr-xnixpkgs/maintainers/scripts/eval-release.sh11
-rwxr-xr-xnixpkgs/maintainers/scripts/feature-freeze-teams.pl98
-rwxr-xr-xnixpkgs/maintainers/scripts/fetch-kde-qt.sh196
-rw-r--r--nixpkgs/maintainers/scripts/find-tarballs.nix50
-rwxr-xr-xnixpkgs/maintainers/scripts/fix-maintainers.pl58
-rwxr-xr-xnixpkgs/maintainers/scripts/get-maintainer.sh73
-rw-r--r--nixpkgs/maintainers/scripts/haskell/dependencies.nix10
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/hydra-report.hs819
-rw-r--r--nixpkgs/maintainers/scripts/haskell/maintained-broken-pkgs.nix22
-rw-r--r--nixpkgs/maintainers/scripts/haskell/maintainer-handles.nix21
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/mark-broken.sh66
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/merge-and-open-pr.sh129
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/regenerate-hackage-packages.sh120
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh25
-rw-r--r--nixpkgs/maintainers/scripts/haskell/test-configurations.nix158
-rw-r--r--nixpkgs/maintainers/scripts/haskell/transitive-broken-packages.nix16
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/update-cabal2nix-unstable.sh17
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/update-hackage.sh35
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/update-stackage.sh87
-rwxr-xr-xnixpkgs/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh43
-rwxr-xr-xnixpkgs/maintainers/scripts/hydra-eval-failures.py112
-rwxr-xr-xnixpkgs/maintainers/scripts/hydra_eval_check13
-rw-r--r--nixpkgs/maintainers/scripts/luarocks-config.lua8
-rw-r--r--nixpkgs/maintainers/scripts/luarocks-packages.csv124
-rwxr-xr-xnixpkgs/maintainers/scripts/mdize-module.sh83
-rwxr-xr-xnixpkgs/maintainers/scripts/nix-call-package5
-rwxr-xr-xnixpkgs/maintainers/scripts/nix-diff.sh277
-rw-r--r--nixpkgs/maintainers/scripts/nix-generate-from-cpan.nix26
-rwxr-xr-xnixpkgs/maintainers/scripts/nix-generate-from-cpan.pl473
-rw-r--r--nixpkgs/maintainers/scripts/nixpkgs-lint.nix24
-rwxr-xr-xnixpkgs/maintainers/scripts/nixpkgs-lint.pl173
-rwxr-xr-xnixpkgs/maintainers/scripts/patchelf-hints.sh84
-rw-r--r--nixpkgs/maintainers/scripts/pluginupdate.py815
-rwxr-xr-xnixpkgs/maintainers/scripts/rebuild-amount.sh133
-rwxr-xr-xnixpkgs/maintainers/scripts/remove-old-aliases.py213
-rwxr-xr-xnixpkgs/maintainers/scripts/sha-to-sri.py228
-rwxr-xr-xnixpkgs/maintainers/scripts/update-channel-branches.sh112
-rw-r--r--nixpkgs/maintainers/scripts/update-dotnet-lockfiles.nix72
-rwxr-xr-xnixpkgs/maintainers/scripts/update-octave-packages468
-rw-r--r--nixpkgs/maintainers/scripts/update-octave-shell.nix12
-rwxr-xr-xnixpkgs/maintainers/scripts/update-python-libraries3
-rwxr-xr-xnixpkgs/maintainers/scripts/update-redirected-urls.sh12
-rwxr-xr-xnixpkgs/maintainers/scripts/update-ruby-packages16
-rwxr-xr-xnixpkgs/maintainers/scripts/update.nix227
-rw-r--r--nixpkgs/maintainers/scripts/update.py247
-rw-r--r--nixpkgs/maintainers/scripts/vanity-manual-equalities.txt7
-rwxr-xr-xnixpkgs/maintainers/scripts/vanity.sh122
-rw-r--r--nixpkgs/maintainers/team-list.nix1001
75 files changed, 30551 insertions, 0 deletions
diff --git a/nixpkgs/maintainers/README.md b/nixpkgs/maintainers/README.md
new file mode 100644
index 000000000000..f121ec756413
--- /dev/null
+++ b/nixpkgs/maintainers/README.md
@@ -0,0 +1,174 @@
+# Nixpkgs Maintainers
+
+Unlike other packaging ecosystems, the maintainer doesn't have exclusive
+control over the packages and modules they maintain. This more fluid approach
+is one reason why we scale to so many packages.
+
+## Definition and role of the maintainer
+
+The main responsibility of a maintainer is to keep the packages they maintain
+in a functioning state, and keep up with updates. In order to do that, they
+are empowered to make decisions over the packages they maintain.
+
+That being said, the maintainer is not alone proposing changes to the
+packages. Anybody (both bots and humans) can send PRs to bump or tweak the
+package.
+
+We also allow other non-maintainer committers to merge changes to the package,
+provided enough time and priority has been given to the maintainer.
+
+For most packages, we expect committers to wait at least a week before merging
+changes not endorsed by a package maintainer (which may be themselves). This should leave enough time
+for the maintainers to provide feedback.
+
+For critical packages, this convention needs to be negotiated with the
+maintainer. A critical package is one that causes mass-rebuild, or where an
+author is listed in the [`CODEOWNERS`](../.github/CODEOWNERS) file.
+
+In case of critical security updates, the [security team](https://nixos.org/community/teams/security) might override these
+heuristics in order to get the fixes in as fast as possible.
+
+In case of conflict, the maintainer takes priority and is allowed to revert
+the changes. This can happen for example if the maintainer was on holiday.
+
+### How to become a maintainer
+
+We encourage people who care about a package to assign themselves as a
+maintainer. Commit access to the Nixpkgs repository is not required for that.
+
+In order to do so, add yourself to the
+[`maintainer-list.nix`](./maintainer-list.nix), and then to the desired
+package's `meta.maintainers` list, and send a PR with the changes.
+
+### How to lose maintainer status
+
+Maintainers who have become inactive on a given package can be removed. This
+helps us keep an accurate view of the state of maintenance in Nixpkgs.
+
+The inactivity measure is currently not strictly enforced. We would typically
+look at it if we notice that the author hasn't reacted to package-related
+notifications for more than 3 months.
+
+Removing the maintainer happens by making a PR on the package, adding that
+person as a reviewer, and then waiting a week for a reaction.
+
+The maintainer is welcome to come back at any time.
+
+### Tools for maintainers
+
+When a pull request is made against a package, OfBorg will notify the
+appropriate maintainer(s).
+
+## Reviewing contributions
+
+### Individual maintainer list
+
+When adding users to [`maintainer-list.nix`](./maintainer-list.nix), the following
+checks should be performed:
+
+- If the user has specified a GPG key, verify that the commit is
+  signed by their key.
+
+  First, validate that the commit adding the maintainer is signed by
+  the key the maintainer listed. Check out the pull request and
+  compare its signing key with the listed key in the commit.
+
+  If the commit is not signed or it is signed by a different user, ask
+  them to either recommit using that key or to remove their key
+  information.
+
+  Given a maintainer entry like this:
+
+  ``` nix
+  {
+    example = {
+      email = "user@example.com";
+      name = "Example User";
+      keys = [{
+        fingerprint = "0000 0000 2A70 6423 0AED  3C11 F04F 7A19 AAA6 3AFE";
+      }];
+    }
+  };
+  ```
+
+  First receive their key from a keyserver:
+
+      $ gpg --recv-keys 0xF04F7A19AAA63AFE
+      gpg: key 0xF04F7A19AAA63AFE: public key "Example <user@example.com>" imported
+      gpg: Total number processed: 1
+      gpg:               imported: 1
+
+  Then check the commit is signed by that key:
+
+      $ git log --show-signature
+      commit b87862a4f7d32319b1de428adb6cdbdd3a960153
+      gpg: Signature made Wed Mar 12 13:32:24 2003 +0000
+      gpg:                using RSA key 000000002A7064230AED3C11F04F7A19AAA63AFE
+      gpg: Good signature from "Example User <user@example.com>
+      Author: Example User <user@example.com>
+      Date:   Wed Mar 12 13:32:24 2003 +0000
+
+          maintainers: adding example
+
+  and validate that there is a `Good signature` and the printed key
+  matches the user's submitted key.
+
+  Note: GitHub's "Verified" label does not display the user's full key
+  fingerprint, and should not be used for validating the key matches.
+
+- If the user has specified a `github` account name, ensure they have
+  also specified a `githubId` and verify the two match.
+
+  Maintainer entries that include a `github` field must also include
+  their `githubId`. People can and do change their GitHub name
+  frequently, and the ID is used as the official and stable identity
+  of the maintainer.
+
+  Given a maintainer entry like this:
+
+  ``` nix
+  {
+    example = {
+      email = "user@example.com";
+      name = "Example User";
+      github = "ghost";
+      githubId = 10137;
+    }
+  };
+  ```
+
+  First, make sure that the listed GitHub handle matches the author of
+  the commit.
+
+  Then, visit the URL `https://api.github.com/users/ghost` and
+  validate that the `id` field matches the provided `githubId`.
+
+### Maintainer teams
+
+Feel free to create a new maintainer team in [`team-list.nix`](./team-list.nix)
+when a group is collectively responsible for a collection of packages.
+Use taste and personal judgement when deciding if a team is warranted.
+
+Teams are allowed to define their own rules about membership.
+
+For example, some teams will represent a business or other group which
+wants to carefully track its members. Other teams may be very open about
+who can join, and allow anybody to participate.
+
+When reviewing changes to a team, read the team's scope and the context
+around the member list for indications about the team's membership
+policy.
+
+In any case, request reviews from the existing team members. If the team
+lists no specific membership policy, feel free to merge changes to the
+team after giving the existing members a few days to respond.
+
+*Important:* If a team says it is a closed group, do not merge additions
+to the team without an approval by at least one existing member.
+
+
+# Maintainer scripts
+
+Various utility scripts, which are mainly useful for nixpkgs maintainers,
+are available under `./scripts/`.  See its [README](./scripts/README.md)
+for further information.
diff --git a/nixpkgs/maintainers/maintainer-list.nix b/nixpkgs/maintainers/maintainer-list.nix
new file mode 100644
index 000000000000..961b17b49c12
--- /dev/null
+++ b/nixpkgs/maintainers/maintainer-list.nix
@@ -0,0 +1,21523 @@
+/* List of NixOS maintainers.
+    ```nix
+    handle = {
+      # Required
+      name = "Your name";
+
+      # Optional, but at least one of email, matrix or githubId must be given
+      email = "address@example.org";
+      matrix = "@user:example.org";
+      github = "GithubUsername";
+      githubId = your-github-id;
+
+      keys = [{
+        fingerprint = "AAAA BBBB CCCC DDDD EEEE  FFFF 0000 1111 2222 3333";
+      }];
+    };
+    ```
+
+    where
+
+    - `handle` is the handle you are going to use in nixpkgs expressions,
+    - `name` is a name that people would know and recognize you by,
+    - `email` is your maintainer email address,
+    - `matrix` is your Matrix user ID,
+    - `github` is your GitHub handle (as it appears in the URL of your profile page, `https://github.com/<userhandle>`),
+    - `githubId` is your GitHub user ID, which can be found at `https://api.github.com/users/<userhandle>`,
+    - `keys` is a list of your PGP/GPG key fingerprints.
+
+    Specifying a GitHub account ensures that you automatically:
+    - get invited to the @NixOS/nixpkgs-maintainers team ;
+    - once you are part of the @NixOS org, OfBorg will request you review
+      pull requests that modify a package for which you are a maintainer.
+
+    `handle == github` is strongly preferred whenever `github` is an acceptable attribute name and is short and convenient.
+
+    If `github` begins with a numeral, `handle` should be prefixed with an underscore.
+    ```nix
+    _1example = {
+      github = "1example";
+    };
+    ```
+
+    Add PGP/GPG keys only if you actually use them to sign commits and/or mail.
+
+    To get the required PGP/GPG values for a key run
+    ```shell
+    gpg --fingerprint <email> | head -n 2
+    ```
+
+    !!! Note that PGP/GPG values stored here are for informational purposes only, don't use this file as a source of truth.
+
+    More fields may be added in the future, however, in order to comply with GDPR this file should stay as minimal as possible.
+
+    When editing this file:
+     * keep the list alphabetically sorted, check with:
+         nix-instantiate --eval maintainers/scripts/check-maintainers-sorted.nix
+     * test the validity of the format with:
+         nix-build lib/tests/maintainers.nix
+
+    See `./scripts/check-maintainer-github-handles.sh` for an example on how to work with this data.
+*/
+{
+  _0b11stan = {
+    name = "Tristan Auvinet Pinaudeau";
+    email = "tristan@tic.sh";
+    github = "0b11stan";
+    githubId = 27831931;
+  };
+  _0nyr = {
+    email = "onyr.maintainer@gmail.com";
+    github = "0nyr";
+    githubId = 47721040;
+    name = "Florian Rascoussier";
+  };
+  _0qq = {
+    email = "0qqw0qqw@gmail.com";
+    github = "0qq";
+    githubId = 64707304;
+    name = "Dmitry Kulikov";
+  };
+  _0x120581f = {
+    email = "nixpkgs@0x120581f.dev";
+    name = "0x120581f";
+    github = "0x120581f";
+    githubId = 130835755;
+  };
+  _0x4A6F = {
+    email = "mail-maintainer@0x4A6F.dev";
+    matrix = "@0x4a6f:matrix.org";
+    name = "Joachim Ernst";
+    github = "0x4A6F";
+    githubId = 9675338;
+    keys = [{
+      fingerprint = "F466 A548 AD3F C1F1 8C88  4576 8702 7528 B006 D66D";
+    }];
+  };
+  _0xB10C = {
+    email = "nixpkgs@b10c.me";
+    name = "0xB10C";
+    github = "0xB10C";
+    githubId = 19157360;
+  };
+  _0xbe7a = {
+    email = "nix@be7a.de";
+    name = "Bela Stoyan";
+    github = "0xbe7a";
+    githubId = 6232980;
+    keys = [{
+      fingerprint = "2536 9E86 1AA5 9EB7 4C47  B138 6510 870A 77F4 9A99";
+    }];
+  };
+  _0xC45 = {
+    email = "jason@0xc45.com";
+    name = "Jason Vigil";
+    github = "0xC45";
+    githubId = 56617252;
+    matrix = "@oxc45:matrix.org";
+  };
+  _0xd61 = {
+    email = "dgl@degit.co";
+    name = "Daniel Glinka";
+    github = "0xd61";
+    githubId = 8351869;
+  };
+  _0xMRTT = {
+    email = "0xMRTT@proton.me";
+    name = "0xMRTT";
+    github = "0xMRTT";
+    githubId = 105598867;
+    matrix = "@0xmrtt:envs.net";
+  };
+  _1000101 = {
+    email = "b1000101@pm.me";
+    github = "1000101";
+    githubId = 791309;
+    name = "Jan Hrnko";
+  };
+  _1000teslas = {
+    name = "Kevin Tran";
+    github = "1000teslas";
+    githubId = 47207223;
+  };
+  _13r0ck = {
+    name = "Brock Szuszczewicz";
+    email = "bnr@tuta.io";
+    github = "13r0ck";
+    githubId = 58987761;
+  };
+  _21eleven = {
+    name = "Noah Lidell";
+    email = "noahlidell@gmail.com";
+    github = "21eleven";
+    githubId = 8813855;
+  };
+  _2gn = {
+    name = "Hiram Tanner";
+    github = "2gn";
+    githubId = 101851090;
+  };
+  _360ied = {
+    name = "Brian Zhu";
+    email = "therealbarryplayer@gmail.com";
+    github = "360ied";
+    githubId = 19516527;
+  };
+  _365tuwe = {
+    name = "Uwe Schlifkowitz";
+    email = "supertuwe@gmail.com";
+    github = "365tuwe";
+    githubId = 10263091;
+  };
+  _3699n = {
+    email = "nicholas@nvk.pm";
+    github = "3699n";
+    githubId = 7414843;
+    name = "Nicholas von Klitzing";
+  };
+  _3JlOy-PYCCKUi = {
+    name = "3JlOy-PYCCKUi";
+    email = "3jl0y_pycckui@riseup.net";
+    github = "3JlOy-PYCCKUi";
+    githubId = 46464602;
+  };
+  _3noch = {
+    email = "eacameron@gmail.com";
+    github = "3noch";
+    githubId = 882455;
+    name = "Elliot Cameron";
+  };
+  _414owen = {
+    email = "owen@owen.cafe";
+    github = "414owen";
+    githubId = 1714287;
+    name = "Owen Shepherd";
+  };
+  _4825764518 = {
+    email = "4825764518@purelymail.com";
+    matrix = "@kenzie:matrix.kenzi.dev";
+    github = "4825764518";
+    githubId = 100122841;
+    name = "Kenzie";
+    keys = [{
+      fingerprint = "D292 365E 3C46 A5AA 75EE  B30B 78DB 7EDE 3540 794B";
+    }];
+  };
+  _6AA4FD = {
+    email = "f6442954@gmail.com";
+    github = "6AA4FD";
+    githubId = 12578560;
+    name = "Quinn Bohner";
+  };
+  _8-bit-fox = {
+    email = "sebastian@markwaerter.de";
+    github = "8-bit-fox";
+    githubId = 43320117;
+    name = "Sebastian Marquardt";
+  };
+  _9999years = {
+    email = "rbt@fastmail.com";
+    github = "9999years";
+    githubId = 15312184;
+    name = "Rebecca Turner";
+  };
+  _999eagle = {
+    email = "github@999eagle.moe";
+    matrix = "@sophie:catgirl.cloud";
+    github = "999eagle";
+    githubId = 1221984;
+    name = "Sophie Tauchert";
+    keys = [{
+      fingerprint = "7B59 F09E 0FE5 BC34 F032  1FB4 5270 1DE5 F5F5 1125";
+    }];
+  };
+  _9glenda = {
+    email = "plan9git@proton.me";
+    matrix = "@9front:matrix.org";
+    github = "9glenda";
+    githubId = 69043370;
+    name = "9glenda";
+    keys = [{
+      fingerprint = "DBF4 E6D0 90B8 BEA4 4BFE  1F1C 3442 4321 39B5 0691";
+    }];
+  };
+  _9R = {
+    email = "nix@9-r.net";
+    github = "9R";
+    githubId = 381298;
+    name = "9R";
+  };
+  a1russell = {
+    email = "adamlr6+pub@gmail.com";
+    github = "a1russell";
+    githubId = 241628;
+    name = "Adam Russell";
+  };
+  aacebedo = {
+    email = "alexandre@acebedo.fr";
+    github = "aacebedo";
+    githubId = 1217680;
+    name = "Alexandre Acebedo";
+  };
+  aadibajpai = {
+    email = "hello@aadibajpai.com";
+    github = "aadibajpai";
+    githubId = 27063113;
+    name = "Aadi Bajpai";
+  };
+  aanderse = {
+    email = "aaron@fosslib.net";
+    matrix = "@aanderse:nixos.dev";
+    github = "aanderse";
+    githubId = 7755101;
+    name = "Aaron Andersen";
+  };
+  aaqaishtyaq = {
+    email = "aaqaishtyaq@gmail.com";
+    github = "aaqaishtyaq";
+    githubId = 22131756;
+    name = "Aaqa Ishtyaq";
+  };
+  aaronarinder = {
+    email = "aaronarinder@gmail.com";
+    github = "aaronArinder";
+    githubId = 26738844;
+    name = "Aaron Arinder";
+  };
+  aaronjanse = {
+    email = "aaron@ajanse.me";
+    matrix = "@aaronjanse:matrix.org";
+    github = "aaronjanse";
+    githubId = 16829510;
+    name = "Aaron Janse";
+  };
+  aaronjheng = {
+    email = "wentworth@outlook.com";
+    github = "aaronjheng";
+    githubId = 806876;
+    name = "Aaron Jheng";
+  };
+  aaronschif = {
+    email = "aaronschif@gmail.com";
+    github = "aaronschif";
+    githubId = 2258953;
+    name = "Aaron Schif";
+  };
+  aaschmid = {
+    email = "service@aaschmid.de";
+    github = "aaschmid";
+    githubId = 567653;
+    name = "Andreas Schmid";
+  };
+  abaldeau = {
+    email = "andreas@baldeau.net";
+    github = "baldo";
+    githubId = 178750;
+    name = "Andreas Baldeau";
+  };
+  abathur = {
+    email = "travis.a.everett+nixpkgs@gmail.com";
+    github = "abathur";
+    githubId = 2548365;
+    name = "Travis A. Everett";
+  };
+  abbe = {
+    email = "ashish.is@lostca.se";
+    matrix = "@abbe:badti.me";
+    github = "wahjava";
+    githubId = 2255192;
+    name = "Ashish SHUKLA";
+    keys = [{
+      fingerprint = "F682 CDCC 39DC 0FEA E116  20B6 C746 CFA9 E74F A4B0";
+    }];
+  };
+  abbradar = {
+    email = "ab@fmap.me";
+    github = "abbradar";
+    githubId = 1174810;
+    name = "Nikolay Amiantov";
+  };
+  abdiramen = {
+    email = "abdirahman.osmanthus@gmail.com";
+    github = "Abdiramen";
+    githubId = 15805292;
+    name = "Abdirahman Osman";
+  };
+  abhi18av = {
+    email = "abhi18av@gmail.com";
+    github = "abhi18av";
+    githubId = 12799326;
+    name = "Abhinav Sharma";
+  };
+  abigailbuccaneer = {
+    email = "abigailbuccaneer@gmail.com";
+    github = "AbigailBuccaneer";
+    githubId = 908758;
+    name = "Abigail Bunyan";
+  };
+  aborsu = {
+    email = "a.borsu@gmail.com";
+    github = "aborsu";
+    githubId = 5033617;
+    name = "Augustin Borsu";
+  };
+  aboseley = {
+    email = "adam.boseley@gmail.com";
+    github = "aboseley";
+    githubId = 13504599;
+    name = "Adam Boseley";
+  };
+  abueide = {
+    email = "andrea@abueide.com";
+    github = "abueide";
+    githubId = 19354425;
+    name = "Andrea Bueide";
+  };
+  abuibrahim = {
+    email = "ruslan@babayev.com";
+    github = "abuibrahim";
+    githubId = 2321000;
+    name = "Ruslan Babayev";
+  };
+  abustany = {
+    email = "adrien@bustany.org";
+    github = "abustany";
+    githubId = 2526296;
+    name = "Adrien Bustany";
+  };
+  abysssol = {
+    name = "abysssol";
+    email = "abysssol@pm.me";
+    matrix = "@abysssol:tchncs.de";
+    github = "abysssol";
+    githubId = 76763323;
+  };
+  acairncross = {
+    email = "acairncross@gmail.com";
+    github = "acairncross";
+    githubId = 1517066;
+    name = "Aiken Cairncross";
+  };
+  aciceri = {
+    name = "Andrea Ciceri";
+    email = "andrea.ciceri@autistici.org";
+    github = "aciceri";
+    githubId = 2318843;
+  };
+  acowley = {
+    email = "acowley@gmail.com";
+    github = "acowley";
+    githubId = 124545;
+    name = "Anthony Cowley";
+  };
+  acuteenvy = {
+    matrix = "@acuteenvy:matrix.org";
+    github = "acuteenvy";
+    githubId = 126529524;
+    name = "Lena";
+    keys = [{
+      fingerprint = "CE85 54F7 B9BC AC0D D648  5661 AB5F C04C 3C94 443F";
+    }];
+  };
+  adam248 = {
+    email = "adamjbutler091@gmail.com";
+    github = "adam248";
+    githubId = 85082674;
+    name = "Adam J. Butler";
+  };
+  adamcstephens = {
+    email = "happy.plan4249@valkor.net";
+    matrix = "@adam:valkor.net";
+    github = "adamcstephens";
+    githubId = 2071575;
+    name = "Adam C. Stephens";
+  };
+  adamlwgriffiths = {
+    email = "adam.lw.griffiths@gmail.com";
+    github = "adamlwgriffiths";
+    githubId = 1239156;
+    name = "Adam Griffiths";
+  };
+  adamt = {
+    email = "mail@adamtulinius.dk";
+    github = "adamtulinius";
+    githubId = 749381;
+    name = "Adam Tulinius";
+  };
+  addict3d = {
+    email = "nickbathum@gmail.com";
+    matrix = "@nbathum:matrix.org";
+    github = "addict3d";
+    githubId = 49227;
+    name = "Nick Bathum";
+  };
+  adelbertc = {
+    email = "adelbertc@gmail.com";
+    github = "adelbertc";
+    githubId = 1332980;
+    name = "Adelbert Chang";
+  };
+  adev = {
+    email = "adev@adev.name";
+    github = "adevress";
+    githubId = 1773511;
+    name = "Adrien Devresse";
+  };
+  adisbladis = {
+    email = "adisbladis@gmail.com";
+    matrix = "@adis:blad.is";
+    github = "adisbladis";
+    githubId = 63286;
+    name = "Adam Hose";
+  };
+  adjacentresearch = {
+    email = "nate@adjacentresearch.xyz";
+    github = "0xperp";
+    githubId = 96147421;
+    name = "0xperp";
+  };
+  Adjective-Object = {
+    email = "mhuan13@gmail.com";
+    github = "Adjective-Object";
+    githubId = 1174858;
+    name = "Maxwell Huang-Hobbs";
+  };
+  adnelson = {
+    email = "ithinkican@gmail.com";
+    github = "adnelson";
+    githubId = 5091511;
+    name = "Allen Nelson";
+  };
+  adolfogc = {
+    email = "adolfo.garcia.cr@gmail.com";
+    github = "adolfogc";
+    githubId = 1250775;
+    name = "Adolfo E. García Castro";
+  };
+  adriandole = {
+    email = "adrian@dole.tech";
+    github = "adriandole";
+    githubId = 25236206;
+    name = "Adrian Dole";
+  };
+  adriangl = {
+    email = "adrian@lauterer.it";
+    matrix = "@adriangl:pvv.ntnu.no";
+    github = "adrlau";
+    githubId = 25004152;
+    name = "Adrian Gunnar Lauterer";
+  };
+  AdsonCicilioti = {
+    name = "Adson Cicilioti";
+    email = "adson.cicilioti@live.com";
+    github = "AdsonCicilioti";
+    githubId = 6278398;
+  };
+  adsr = {
+    email = "as@php.net";
+    github = "adsr";
+    githubId = 315003;
+    name = "Adam Saponara";
+  };
+  adtya = {
+    email = "adtya@adtya.xyz";
+    github = "adtya";
+    githubId = 22346805;
+    name = "Adithya Nair";
+    keys = [{
+      fingerprint = "51E4 F5AB 1B82 BE45 B422  9CC2 43A5 E25A A5A2 7849";
+    }];
+  };
+  aerialx = {
+    email = "aaron+nixos@aaronlindsay.com";
+    github = "AerialX";
+    githubId = 117295;
+    name = "Aaron Lindsay";
+  };
+  aespinosa = {
+    email = "allan.espinosa@outlook.com";
+    github = "aespinosa";
+    githubId = 58771;
+    name = "Allan Espinosa";
+  };
+  aethelz = {
+    email = "aethelz@protonmail.com";
+    github = "eugenezastrogin";
+    githubId = 10677343;
+    name = "Eugene";
+  };
+  afh = {
+    email = "surryhill+nix@gmail.com";
+    github = "afh";
+    githubId = 16507;
+    name = "Alexis Hildebrandt";
+  };
+  aflatter = {
+    email = "flatter@fastmail.fm";
+    github = "aflatter";
+    githubId = 168;
+    name = "Alexander Flatter";
+  };
+  afldcr = {
+    email = "alex@fldcr.com";
+    github = "afldcr";
+    githubId = 335271;
+    name = "James Alexander Feldman-Crough";
+  };
+  afontain = {
+    email = "afontain@posteo.net";
+    github = "necessarily-equal";
+    githubId = 59283660;
+    name = "Antoine Fontaine";
+  };
+  aforemny = {
+    email = "aforemny@posteo.de";
+    github = "aforemny";
+    githubId = 610962;
+    name = "Alexander Foremny";
+  };
+  afranchuk = {
+    email = "alex.franchuk@gmail.com";
+    github = "afranchuk";
+    githubId = 4296804;
+    name = "Alex Franchuk";
+  };
+  agbrooks = {
+    email = "andrewgrantbrooks@gmail.com";
+    github = "agbrooks";
+    githubId = 19290901;
+    name = "Andrew Brooks";
+  };
+  aherrmann = {
+    email = "andreash87@gmx.ch";
+    github = "aherrmann";
+    githubId = 732652;
+    name = "Andreas Herrmann";
+  };
+  ahirner = {
+    email = "a.hirner+nixpkgs@gmail.com";
+    github = "ahirner";
+    githubId = 6055037;
+    name = "Alexander Hirner";
+  };
+  ahoneybun = {
+    email = "aaron@system76.com";
+    github = "ahoneybun";
+    githubId = 4884946;
+    name = "Aaron Honeycutt";
+  };
+  ahrzb = {
+    email = "ahrzb5@gmail.com";
+    github = "ahrzb";
+    githubId = 5220438;
+    name = "AmirHossein Roozbahani";
+  };
+  ahuzik = {
+    email = "ah1990au@gmail.com";
+    github = "alesya-h";
+    githubId = 209175;
+    name = "Alesya Huzik";
+  };
+  aidalgol = {
+    email = "aidalgol+nixpkgs@fastmail.net";
+    github = "aidalgol";
+    githubId = 2313201;
+    name = "Aidan Gauland";
+  };
+  aij = {
+    email = "aij+git@mrph.org";
+    github = "aij";
+    githubId = 4732885;
+    name = "Ivan Jager";
+  };
+  aikooo7 = {
+    name = "Diogo Fernandes";
+    email = "prozinhopro1973@gmail.com";
+    matrix = "@aikoo7:matrix.org";
+    github = "aikooo7";
+    githubId = 79667753;
+    keys = [{
+      fingerprint = "B0D7 2955 235F 6AB5 ACFA  1619 8C7F F5BB 1ADE F191";
+    }];
+  };
+  aiotter = {
+    email = "git@aiotter.com";
+    github = "aiotter";
+    githubId = 37664775;
+    name = "Yuto Oguchi";
+  };
+  airwoodix = {
+    email = "airwoodix@posteo.me";
+    github = "airwoodix";
+    githubId = 44871469;
+    name = "Etienne Wodey";
+  };
+  aither64 = {
+    email = "aither@havefun.cz";
+    github = "aither64";
+    githubId = 4717906;
+    name = "Jakub Skokan";
+  };
+  ajaxbits = {
+    email = "contact@ajaxbits.com";
+    github = "ajaxbits";
+    githubId = 45179933;
+    name = "Alex Jackson";
+  };
+  ajgrf = {
+    email = "a@ajgrf.com";
+    github = "ajgrf";
+    githubId = 10733175;
+    name = "Alex Griffin";
+  };
+  ajs124 = {
+    email = "nix@ajs124.de";
+    matrix = "@andreas.schraegle:helsinki-systems.de";
+    github = "ajs124";
+    githubId = 1229027;
+    name = "Andreas Schrägle";
+  };
+  ajwhouse = {
+    email = "adam@ajwh.chat";
+    github = "ajwhouse";
+    githubId = 56616368;
+    name = "Adam House";
+  };
+  ak = {
+    email = "ak@formalprivacy.com";
+    github = "alexanderkjeldaas";
+    githubId = 339369;
+    name = "Alexander Kjeldaas";
+  };
+  akamaus = {
+    email = "dmitryvyal@gmail.com";
+    github = "akamaus";
+    githubId = 58955;
+    name = "Dmitry Vyal";
+  };
+  akavel = {
+    email = "czapkofan@gmail.com";
+    github = "akavel";
+    githubId = 273837;
+    name = "Mateusz Czapliński";
+  };
+  akaWolf = {
+    email = "akawolf0@gmail.com";
+    github = "akaWolf";
+    githubId = 5836586;
+    name = "Artjom Vejsel";
+  };
+  akc = {
+    email = "akc@akc.is";
+    github = "akc";
+    githubId = 1318982;
+    name = "Anders Claesson";
+  };
+  akechishiro = {
+    email = "akechishiro-aur+nixpkgs@lahfa.xyz";
+    github = "AkechiShiro";
+    githubId = 14914796;
+    name = "Samy Lahfa";
+  };
+  a-kenji = {
+    email = "aks.kenji@protonmail.com";
+    github = "a-kenji";
+    githubId = 65275785;
+    name = "Alexander Kenji Berthold";
+  };
+  akgrant43 = {
+    name = "Alistair Grant";
+    email = "akg1012@fastmail.com.au";
+    github = "akgrant43";
+    githubId = 2062166;
+  };
+  akho = {
+    name = "Alexander Khodyrev";
+    email = "a@akho.name";
+    github = "akho";
+    githubId = 104951;
+  };
+  akkesm = {
+    name = "Alessandro Barenghi";
+    email = "alessandro.barenghi@tuta.io";
+    github = "akkesm";
+    githubId = 56970006;
+    keys = [{
+      fingerprint = "50E2 669C AB38 2F4A 5F72  1667 0D6B FC01 D45E DADD";
+    }];
+  };
+  akru = {
+    email = "mail@akru.me";
+    github = "akru";
+    githubId = 786394;
+    name = "Alexander Krupenkin ";
+  };
+  akshgpt7 = {
+    email = "akshgpt7@gmail.com";
+    github = "akshgpt7";
+    githubId = 20405311;
+    name = "Aksh Gupta";
+  };
+  al3xtjames = {
+    email = "nix@alextjam.es";
+    github = "al3xtjames";
+    githubId = 5672538;
+    name = "Alex James";
+    keys = [{
+      fingerprint = "F354 FFAB EA89 A49D 33ED  2590 4729 B829 AC5F CC72";
+    }];
+  };
+  alanpearce = {
+    email = "alan@alanpearce.eu";
+    github = "alanpearce";
+    githubId = 850317;
+    name = "Alan Pearce";
+  };
+  alapshin = {
+    email = "alapshin@fastmail.com";
+    github = "alapshin";
+    githubId = 321946;
+    name = "Andrei Lapshin";
+  };
+  albakham = {
+    email = "dev@geber.ga";
+    github = "albakham";
+    githubId = 43479487;
+    name = "Titouan Biteau";
+  };
+  albertchae = {
+    github = "albertchae";
+    githubId = 217050;
+    name = "Albert Chae";
+  };
+  aldoborrero = {
+    email = "aldoborrero+nixos@pm.me";
+    github = "aldoborrero";
+    githubId = 82811;
+    name = "Aldo Borrero";
+  };
+  alejandrosame = {
+    email = "alejandrosanchzmedina@gmail.com";
+    matrix = "@alejandrosame:matrix.org";
+    github = "alejandrosame";
+    githubId = 1078000;
+    name = "Alejandro Sánchez Medina";
+  };
+  aleksana = {
+    email = "me@aleksana.moe";
+    github = "Aleksanaa";
+    githubId = 42209822;
+    name = "Aleksana QwQ";
+  };
+  alekseysidorov = {
+    email = "sauron1987@gmail.com";
+    github = "alekseysidorov";
+    githubId = 83360;
+    name = "Aleksey Sidorov";
+  };
+  alerque = {
+    email = "caleb@alerque.com";
+    github = "alerque";
+    githubId = 173595;
+    name = "Caleb Maclennan";
+  };
+  ALEX11BR = {
+    email = "alexioanpopa11@gmail.com";
+    github = "ALEX11BR";
+    githubId = 49609151;
+    name = "Popa Ioan Alexandru";
+  };
+  alexarice = {
+    email = "alexrice999@hotmail.co.uk";
+    github = "alexarice";
+    githubId = 17208985;
+    name = "Alex Rice";
+  };
+  alexbakker = {
+    email = "ab@alexbakker.me";
+    github = "alexbakker";
+    githubId = 2387841;
+    name = "Alexander Bakker";
+  };
+  alexbiehl = {
+    email = "alexbiehl@gmail.com";
+    github = "alexbiehl";
+    githubId = 1876617;
+    name = "Alex Biehl";
+  };
+  alexchapman = {
+    email = "alex@farfromthere.net";
+    github = "AJChapman";
+    githubId = 8316672;
+    name = "Alex Chapman";
+  };
+  alexfmpe = {
+    email = "alexandre.fmp.esteves@gmail.com";
+    github = "alexfmpe";
+    githubId = 2335822;
+    name = "Alexandre Esteves";
+  };
+  alex-fu27 = {
+     email = "alex.fu27@gmail.com";
+     github = "alex-fu27";
+     githubId = 49982580;
+     name = "Alexander Fuchs";
+  };
+  alexnortung = {
+    name = "alexnortung";
+    email = "alex_nortung@live.dk";
+    github = "Alexnortung";
+    githubId = 1552267;
+  };
+  alexoundos = {
+    email = "alexoundos@gmail.com";
+    github = "AleXoundOS";
+    githubId = 464913;
+    name = "Alexander Tomokhov";
+  };
+  alexshpilkin = {
+    email = "ashpilkin@gmail.com";
+    github = "alexshpilkin";
+    githubId = 1010468;
+    keys = [{
+      fingerprint = "B595 D74D 6615 C010 469F  5A13 73E9 AA11 4B3A 894B";
+    }];
+    matrix = "@alexshpilkin:matrix.org";
+    name = "Alexander Shpilkin";
+  };
+  alexvorobiev = {
+    email = "alexander.vorobiev@gmail.com";
+    github = "alexvorobiev";
+    githubId = 782180;
+    name = "Alex Vorobiev";
+  };
+  alexwinter = {
+    email = "git@alexwinter.net";
+    github = "lxwntr";
+    githubId = 50754358;
+    name = "Alex Winter";
+  };
+  algram = {
+    email = "aliasgram@gmail.com";
+    github = "Algram";
+    githubId = 5053729;
+    name = "Alias Gram";
+  };
+  alias-dev = {
+    email = "alias-dev@protonmail.com";
+    github = "alias-dev";
+    githubId = 30437811;
+    name = "Alex Andrews";
+  };
+  alibabzo = {
+    email = "alistair.bill@gmail.com";
+    github = "alistairbill";
+    githubId = 2822871;
+    name = "Alistair Bill";
+  };
+  alirezameskin = {
+    email = "alireza.meskin@gmail.com";
+    github = "alirezameskin";
+    githubId = 36147;
+    name = "Alireza Meskin";
+  };
+  alizter = {
+    email = "alizter@gmail.com";
+    github = "Alizter";
+    githubId = 8614547;
+    name = "Ali Caglayan";
+  };
+  alkasm = {
+    email = "alexreynolds00@gmail.com";
+    github = "alkasm";
+    githubId = 9651002;
+    name = "Alexander Reynolds";
+  };
+  alkeryn = {
+    email = "plbraundev@gmail.com";
+    github = "alkeryn";
+    githubId = 11599075;
+    name = "Pierre-Louis Braun";
+  };
+  allonsy = {
+    email = "linuxbash8@gmail.com";
+    github = "allonsy";
+    githubId = 5892756;
+    name = "Alec Snyder";
+  };
+  allusive = {
+    email = "jasper@allusive.dev";
+    name = "Allusive";
+    github = "allusive-dev";
+    githubId = 99632976;
+  };
+  almac = {
+    email = "alma.cemerlic@gmail.com";
+    github = "a1mac";
+    githubId = 60479013;
+    name = "Alma Cemerlic";
+  };
+  Alper-Celik = {
+    email = "alper@alper-celik.dev";
+    name = "Alper Çelik";
+    github = "Alper-Celik";
+    githubId = 110625473;
+    keys = [{
+      fingerprint = "6B69 19DD CEE0 FAF3 5C9F  2984 FA90 C0AB 738A B873";
+    }
+    {
+      fingerprint = "DF68 C500 4024 23CC F9C5  E6CA 3D17 C832 4696 FE70";
+    }];
+  };
+  alternateved = {
+    email = "alternateved@pm.me";
+    github = "alternateved";
+    githubId = 45176912;
+    name = "Tomasz Hołubowicz";
+  };
+  AluisioASG = {
+    name = "Aluísio Augusto Silva Gonçalves";
+    email = "aluisio@aasg.name";
+    github = "AluisioASG";
+    githubId = 1904165;
+    keys = [{
+      fingerprint = "7FDB 17B3 C29B 5BA6 E5A9  8BB2 9FAA 63E0 9750 6D9D";
+    }];
+  };
+  alunduil = {
+    email = "alunduil@gmail.com";
+    github = "alunduil";
+    githubId = 169249;
+    name = "Alex Brandt";
+  };
+  alva = {
+    email = "alva@skogen.is";
+    github = "illfygli";
+    githubId = 42881386;
+    name = "Alva";
+    keys = [{
+      fingerprint = "B422 CFB1 C9EF 73F7 E1E2 698D F53E 3233 42F7 A6D3A";
+    }];
+  };
+  alxsimon = {
+    email = "alexis.simon@normalesup.org";
+    github = "alxsimon";
+    githubId = 9567176;
+    name = "Alexis Simon";
+  };
+  alyaeanyx = {
+    email = "alyaeanyx@mailbox.org";
+    github = "alyaeanyx";
+    githubId = 74795488;
+    name = "alyaeanyx";
+    keys = [{
+      fingerprint = "1F73 8879 5E5A 3DFC E2B3 FA32 87D1 AADC D25B 8DEE";
+    }];
+  };
+  amanjeev = {
+    email = "aj@amanjeev.com";
+    github = "amanjeev";
+    githubId = 160476;
+    name = "Amanjeev Sethi";
+  };
+  amanse = {
+    email = "amansetiarjp@gmail.com";
+    github = "amanse";
+    githubId = 13214574;
+    name = "Aman Setia";
+  };
+  amar1729 = {
+    email = "amar.paul16@gmail.com";
+    github = "Amar1729";
+    githubId = 15623522;
+    name = "Amar Paul";
+  };
+  amarshall = {
+    email = "andrew@johnandrewmarshall.com";
+    github = "amarshall";
+    githubId = 153175;
+    name = "Andrew Marshall";
+  };
+  amaxine = {
+    email = "max@ine.dev";
+    github = "amaxine";
+    githubId = 35892750;
+    name = "Maxine Aubrey";
+  };
+  ambroisie = {
+    email = "bruno.nixpkgs@belanyi.fr";
+    github = "ambroisie";
+    githubId = 12465195;
+    name = "Bruno BELANYI";
+  };
+  ambrop72 = {
+    email = "ambrop7@gmail.com";
+    github = "ambrop72";
+    githubId = 2626481;
+    name = "Ambroz Bizjak";
+  };
+  ameer = {
+    name = "Ameer Taweel";
+    email = "ameertaweel2002@gmail.com";
+    github = "AmeerTaweel";
+    githubId = 20538273;
+  };
+  amesgen = {
+    email = "amesgen@amesgen.de";
+    github = "amesgen";
+    githubId = 15369874;
+    name = "Alexander Esgen";
+    matrix = "@amesgen:amesgen.de";
+  };
+  ametrine = {
+    name = "Matilde Ametrine";
+    email = "matilde@diffyq.xyz";
+    github = "matilde-ametrine";
+    githubId = 90799677;
+    keys = [{
+      fingerprint = "7931 EB4E 4712 D7BE 04F8  6D34 07EE 1FFC A58A 11C5";
+    }];
+  };
+  amfl = {
+    email = "amfl@none.none";
+    github = "amfl";
+    githubId = 382798;
+    name = "amfl";
+  };
+  amiddelk = {
+    email = "amiddelk@gmail.com";
+    github = "amiddelk";
+    githubId = 1358320;
+    name = "Arie Middelkoop";
+  };
+  amiloradovsky = {
+    email = "miloradovsky@gmail.com";
+    github = "amiloradovsky";
+    githubId = 20530052;
+    name = "Andrew Miloradovsky";
+  };
+  aminechikhaoui = {
+    email = "amine.chikhaoui91@gmail.com";
+    github = "AmineChikhaoui";
+    githubId = 5149377;
+    name = "Amine Chikhaoui";
+  };
+  amorsillo = {
+    email = "andrew.morsillo@gmail.com";
+    github = "evelant";
+    githubId = 858965;
+    name = "Andrew Morsillo";
+  };
+  amz-x = {
+    email = "mail@amz-x.com";
+    github = "amz-x";
+    githubId = 18249234;
+    name = "Christopher Crouse";
+  };
+  AnatolyPopov = {
+    email = "aipopov@live.ru";
+    github = "AnatolyPopov";
+    githubId = 2312534;
+    name = "Anatolii Popov";
+  };
+  andehen = {
+    email = "git@andehen.net";
+    github = "andehen";
+    githubId = 754494;
+    name = "Anders Asheim Hennum";
+  };
+  andersk = {
+    email = "andersk@mit.edu";
+    github = "andersk";
+    githubId = 26471;
+    name = "Anders Kaseorg";
+  };
+  anderslundstedt = {
+    email = "git@anderslundstedt.se";
+    github = "anderslundstedt";
+    githubId = 4514101;
+    name = "Anders Lundstedt";
+  };
+  AndersonTorres = {
+    email = "torres.anderson.85@protonmail.com";
+    matrix = "@anderson_torres:matrix.org";
+    github = "AndersonTorres";
+    githubId = 5954806;
+    name = "Anderson Torres";
+  };
+  anderspapitto = {
+    email = "anderspapitto@gmail.com";
+    github = "anderspapitto";
+    githubId = 1388690;
+    name = "Anders Papitto";
+  };
+  andir = {
+    email = "andreas@rammhold.de";
+    github = "andir";
+    githubId = 638836;
+    name = "Andreas Rammhold";
+  };
+  andreasfelix = {
+    email = "fandreas@physik.hu-berlin.de";
+    github = "andreasfelix";
+    githubId = 24651767;
+    name = "Felix Andreas";
+  };
+  andres = {
+    email = "ksnixos@andres-loeh.de";
+    github = "kosmikus";
+    githubId = 293191;
+    name = "Andres Loeh";
+  };
+  andresilva = {
+    email = "andre.beat@gmail.com";
+    github = "andresilva";
+    githubId = 123550;
+    name = "André Silva";
+  };
+  andresnav = {
+    email = "nix@andresnav.com";
+    github = "andres-nav";
+    githubId = 118762770;
+    name = "Andres Navarro";
+  };
+  andrestylianos = {
+    email = "andre.stylianos@gmail.com";
+    github = "andrestylianos";
+    githubId = 7112447;
+    name = "Andre S. Ramos";
+  };
+  andrevmatos = {
+    email = "andrevmatos@gmail.com";
+    github = "andrevmatos";
+    githubId = 587021;
+    name = "André V L Matos";
+  };
+  andrewchambers = {
+    email = "ac@acha.ninja";
+    github = "andrewchambers";
+    githubId = 962885;
+    name = "Andrew Chambers";
+  };
+  andrew-d = {
+    email = "andrew@du.nham.ca";
+    github = "andrew-d";
+    githubId = 1079173;
+    name = "Andrew Dunham";
+  };
+  andrewrk = {
+    email = "superjoe30@gmail.com";
+    github = "andrewrk";
+    githubId = 106511;
+    name = "Andrew Kelley";
+  };
+  andrewsmith = {
+    email = "andrew@velvet.software";
+    github = "andrewsmith";
+    githubId = 29887;
+    name = "Andrew Smith";
+  };
+  andsild = {
+    email = "andsild@gmail.com";
+    github = "andsild";
+    githubId = 3808928;
+    name = "Anders Sildnes";
+  };
+  andys8 = {
+    github = "andys8";
+    githubId = 13085980;
+    name = "Andy";
+  };
+  aneeshusa = {
+    email = "aneeshusa@gmail.com";
+    github = "aneeshusa";
+    githubId = 2085567;
+    name = "Aneesh Agrawal";
+  };
+  an-empty-string = {
+    name = "Tris Emmy Wilson";
+    email = "tris@tris.fyi";
+    github = "an-empty-string";
+    githubId = 681716;
+  };
+  angaz = {
+    name = "Angus Dippenaar";
+    github = "angaz";
+    githubId = 10219618;
+  };
+  angristan = {
+    email = "angristan@pm.me";
+    github = "angristan";
+    githubId = 11699655;
+    name = "Stanislas Lange";
+  };
+  AngryAnt = {
+    name = "Emil \"AngryAnt\" Johansen";
+    email = "git@eej.dk";
+    matrix = "@angryant:envs.net";
+    github = "AngryAnt";
+    githubId = 102513;
+    keys = [{
+      fingerprint = "B7B7 582E 564E 789B FCB8  71AB 0C6D FE2F B234 534A";
+    }];
+  };
+  anhdle14 = {
+    name = "Le Anh Duc";
+    email = "anhdle14@icloud.com";
+    github = "anhdle14";
+    githubId = 9645992;
+    keys = [{
+      fingerprint = "AA4B 8EC3 F971 D350 482E  4E20 0299 AFF9 ECBB 5169";
+    }];
+  };
+  anhduy = {
+    email = "vo@anhduy.io";
+    github = "voanhduy1512";
+    githubId = 1771266;
+    name = "Vo Anh Duy";
+  };
+  Anillc = {
+    name = "Anillc";
+    email = "i@anillc.cn";
+    github = "Anillc";
+    githubId = 23411248;
+    keys = [{
+      fingerprint = "6141 1E4F FE10 CE7B 2E14  CD76 0BE8 A88F 47B2 145C";
+    }];
+  };
+  anirrudh = {
+    email = "anik597@gmail.com";
+    github = "anirrudh";
+    githubId = 6091755;
+    name = "Anirrudh Krishnan";
+  };
+  ankhers = {
+    email = "me@ankhers.dev";
+    github = "ankhers";
+    githubId = 750786;
+    name = "Justin Wood";
+  };
+  anmonteiro = {
+    email = "anmonteiro@gmail.com";
+    github = "anmonteiro";
+    githubId = 661909;
+    name = "Antonio Nuno Monteiro";
+  };
+  anna328p = {
+    email = "anna328p@gmail.com";
+    github = "anna328p";
+    githubId = 9790772;
+    name = "Anna";
+  };
+  annaaurora = {
+    email = "anna@annaaurora.eu";
+    matrix = "@papojari:artemislena.eu";
+    github = "auroraanna";
+    githubId = 81317317;
+    name = "Anna Aurora";
+  };
+  a-n-n-a-l-e-e = {
+    github = "a-n-n-a-l-e-e";
+    githubId = 150648636;
+    matrix = "@a-n-n-a-l-e-e:matrix.org";
+    name = "annalee";
+  };
+  anoa = {
+    matrix = "@andrewm:amorgan.xyz";
+    email = "andrew@amorgan.xyz";
+    github = "anoadragon453";
+    githubId = 1342360;
+    name = "Andrew Morgan";
+  };
+  anomalocaris = {
+    email = "duncan@anomalocaris.xyz";
+    github = "Anomalocaridid";
+    githubId = 29845794;
+    name = "Duncan Russell";
+  };
+  anpin = {
+    email = "pavel@anpin.fyi";
+    github = "anpin";
+    githubId = 6060545;
+    matrix = "@anpin:matrix.org";
+    name = "Pavel Anpin";
+    keys = [
+      { fingerprint = "06E8 4FF6 0CCF 7AFD 5101  76C9 0FBC D3EE 6310 7407"; }
+      # compare with https://keybase.io/anpin/pgp_keys.asc
+      { fingerprint = "DADF F3EA 06DC 8C1B 100A  24DB 312E 8F17 91C5 DA8C"; }
+    ];
+  };
+  anpryl = {
+    email = "anpryl@gmail.com";
+    github = "anpryl";
+    githubId = 5327697;
+    name = "Anatolii Prylutskyi";
+  };
+  anselmschueler = {
+    email = "mail@anselmschueler.com";
+    github = "schuelermine";
+    githubId = 48802534;
+    name = "Anselm Schüler";
+    matrix = "@schuelermine:matrix.org";
+    keys = [{
+      fingerprint = "CDBF ECA8 36FE E340 1CEB  58FF BA34 EE1A BA3A 0955";
+    }];
+  };
+  anthonyroussel = {
+    email = "anthony@roussel.dev";
+    github = "anthonyroussel";
+    githubId = 220084;
+    name = "Anthony Roussel";
+    keys = [{
+      fingerprint = "472D 368A F107 F443 F3A5  C712 9DC4 987B 1A55 E75E";
+    }];
+  };
+  antoinerg = {
+    email = "roygobeil.antoine@gmail.com";
+    github = "antoinerg";
+    githubId = 301546;
+    name = "Antoine Roy-Gobeil";
+  };
+  anton-dessiatov = {
+    email = "anton.dessiatov@gmail.com";
+    github = "anton-dessiatov";
+    githubId = 2873280;
+    name = "Anton Desyatov";
+  };
+  Anton-Latukha = {
+    email = "anton.latuka+nixpkgs@gmail.com";
+    github = "Anton-Latukha";
+    githubId = 20933385;
+    name = "Anton Latukha";
+  };
+  antonmosich = {
+    email = "anton@mosich.at";
+    github = "antonmosich";
+    githubId = 27223336;
+    name = "Anton Mosich";
+    keys = [ {
+      fingerprint = "F401 287C 324F 0A1C B321  657B 9B96 97B8 FB18 7D14";
+    } ];
+  };
+  antono = {
+    email = "self@antono.info";
+    github = "antono";
+    githubId = 7622;
+    name = "Antono Vasiljev";
+  };
+  antonxy = {
+    email = "anton.schirg@posteo.de";
+    github = "antonxy";
+    githubId = 4194320;
+    name = "Anton Schirg";
+  };
+  apeschar = {
+    email = "albert@peschar.net";
+    github = "apeschar";
+    githubId = 122977;
+    name = "Albert Peschar";
+  };
+  apeyroux = {
+    email = "alex@px.io";
+    github = "apeyroux";
+    githubId = 1078530;
+    name = "Alexandre Peyroux";
+  };
+  apfelkuchen6 = {
+    email = "apfelkuchen6@hrnz.li";
+    github = "apfelkuchen6";
+    githubId = 73002165;
+    name = "apfelkuchen6";
+  };
+  aplund = {
+    email = "austin.lund@gmail.com";
+    matrix = "@aplund:matrix.org";
+    github = "aplund";
+    githubId = 1369436;
+    name = "Austin Lund";
+    keys = [{
+      fingerprint = "7083 E268 4BFD 845F 2B84  9E74 B695 8918 ED23 32CE";
+    }];
+  };
+  applejag = {
+    email = "applejag.luminance905@passmail.com";
+    github = "applejag";
+    githubId = 2477952;
+    name = "Kalle Fagerberg";
+    keys = [
+      {
+        fingerprint = "F68E 6DB3 79FB 1FF0 7C72  6479 9874 DEDD 3592 5ED0";
+      }
+      {
+        fingerprint = "8DDB 3994 0A34 4FE5 4F3B  3E77 F161 001D EE78 1051";
+      }
+    ];
+  };
+  applePrincess = {
+    email = "appleprincess@appleprincess.io";
+    github = "applePrincess";
+    githubId = 17154507;
+    name = "Lein Matsumaru";
+    keys = [{
+      fingerprint = "BF8B F725 DA30 E53E 7F11  4ED8 AAA5 0652 F047 9205";
+    }];
+  };
+  appsforartists = {
+    github = "appsforartists";
+    githubId = 926648;
+    name = "Brenton Simpson";
+  };
+  apraga = {
+    email = "alexis.praga@proton.me";
+    github = "apraga";
+    githubId = 914687;
+    name = "Alexis Praga";
+  };
+  aprl = {
+    email = "aprl@acab.dev";
+    github = "cutestnekoaqua";
+    githubId = 30842467;
+    name = "April John";
+  };
+  aqrln = {
+    email = "nix@aqrln.net";
+    github = "aqrln";
+    githubId = 4923335;
+    name = "Alexey Orlenko";
+  };
+  ar1a = {
+    email = "aria@ar1as.space";
+    github = "ar1a";
+    githubId = 8436007;
+    name = "Aria Edmonds";
+  };
+  arcadio = {
+    email = "arc@well.ox.ac.uk";
+    github = "arcadio";
+    githubId = 56009;
+    name = "Arcadio Rubio García";
+  };
+  arcayr = {
+    email = "nix@arcayr.online";
+    github = "arcayr";
+    githubId = 11192354;
+    name = "Elliot Speck";
+  };
+  archer-65 = {
+    email = "mario.liguori.056@gmail.com";
+    github = "archer-65";
+    githubId = 76066109;
+    name = "Mario Liguori";
+  };
+  archseer = {
+    email = "blaz@mxxn.io";
+    github = "archseer";
+    githubId = 1372918;
+    name = "Blaž Hrastnik";
+  };
+  arcnmx = {
+    github = "arcnmx";
+    githubId = 13426784;
+    name = "arcnmx";
+  };
+  arcticlimer = {
+    email = "vinigm.nho@gmail.com";
+    github = "viniciusmuller";
+    githubId = 59743220;
+    name = "Vinícius Müller";
+  };
+  arcuru = {
+    email = "patrick@jackson.dev";
+    github = "arcuru";
+    githubId = 160646;
+    name = "Patrick Jackson";
+  };
+  ardumont = {
+    email = "eniotna.t@gmail.com";
+    github = "ardumont";
+    githubId = 718812;
+    name = "Antoine R. Dumont";
+  };
+  arezvov = {
+    email = "alex@rezvov.ru";
+    github = "arezvov";
+    githubId = 58516559;
+    name = "Alexander Rezvov";
+  };
+  argrat = {
+    email = "n.bertazzo@protonmail.com";
+    github = "argrat";
+    githubId = 98821629;
+    name = "Nicolò Bertazzo";
+  };
+  arian-d = {
+    email = "arianxdehghani@gmail.com";
+    github = "arian-d";
+    githubId = 40076285;
+    name = "Arian Dehghani";
+  };
+  arianvp = {
+    email = "arian.vanputten@gmail.com";
+    github = "arianvp";
+    githubId = 628387;
+    name = "Arian van Putten";
+  };
+  arikgrahl = {
+    email = "mail@arik-grahl.de";
+    github = "arikgrahl";
+    githubId = 8049011;
+    name = "Arik Grahl";
+  };
+  aristid = {
+    email = "aristidb@gmail.com";
+    github = "aristidb";
+    githubId = 30712;
+    name = "Aristid Breitkreuz";
+  };
+  ariutta = {
+    email = "anders.riutta@gmail.com";
+    github = "ariutta";
+    githubId = 1296771;
+    name = "Anders Riutta";
+  };
+  arjan-s = {
+    email = "github@anymore.nl";
+    github = "arjan-s";
+    githubId = 10400299;
+    name = "Arjan Schrijver";
+  };
+  arjix = {
+    email = "arjix@protonmail.com";
+    github = "arjix";
+    githubId = 62168569;
+    name = "arjix";
+  };
+  arkivm = {
+    email = "vikram186@gmail.com";
+    github = "arkivm";
+    githubId = 1118815;
+    name = "Vikram Narayanan";
+  };
+  armeenm = {
+    email = "mahdianarmeen@gmail.com";
+    github = "armeenm";
+    githubId = 29145250;
+    name = "Armeen Mahdian";
+  };
+  armijnhemel = {
+    email = "armijn@tjaldur.nl";
+    github = "armijnhemel";
+    githubId = 10587952;
+    name = "Armijn Hemel";
+  };
+  arnarg = {
+    email = "arnarg@fastmail.com";
+    github = "arnarg";
+    githubId = 1291396;
+    name = "Arnar Ingason";
+  };
+  arnoldfarkas = {
+    email = "arnold.farkas@gmail.com";
+    github = "arnoldfarkas";
+    githubId = 59696216;
+    name = "Arnold Farkas";
+  };
+  arnoutkroeze = {
+    email = "nixpkgs@arnoutkroeze.nl";
+    github = "ArnoutKroeze";
+    githubId = 37151054;
+    name = "Arnout Kroeze";
+  };
+  arobyn = {
+    email = "shados@shados.net";
+    github = "Shados";
+    githubId = 338268;
+    name = "Alexei Robyn";
+  };
+  artemist = {
+    email = "me@artem.ist";
+    github = "artemist";
+    githubId = 1226638;
+    name = "Artemis Tosini";
+    keys = [{
+      fingerprint = "3D2B B230 F9FA F0C5 1832  46DD 4FDC 96F1 61E7 BA8A";
+    }];
+  };
+  arthsmn = {
+    name = "Arthur Cerqueira";
+    github = "arthsmn";
+    githubId = 150680976;
+  };
+  arthur = {
+    email = "me@arthur.li";
+    github = "arthurl";
+    githubId = 3965744;
+    name = "Arthur Lee";
+  };
+  arthurteisseire = {
+    email = "arthurteisseire33@gmail.com";
+    github = "arthurteisseire";
+    githubId = 37193992;
+    name = "Arthur Teisseire";
+  };
+  arti5an = {
+    email = "artis4n@outlook.com";
+    github = "arti5an";
+    githubId = 14922630;
+    name = "Richard Smith";
+  };
+  artturin = {
+    email = "artturin@artturin.com";
+    matrix = "@artturin:matrix.org";
+    github = "Artturin";
+    githubId = 56650223;
+    name = "Artturi N";
+  };
+  arturcygan = {
+    email = "arczicygan@gmail.com";
+    github = "arcz";
+    githubId = 4679721;
+    name = "Artur Cygan";
+  };
+  artuuge = {
+    email = "artuuge@gmail.com";
+    github = "artuuge";
+    githubId = 10285250;
+    name = "Artur E. Ruuge";
+  };
+  asbachb = {
+    email = "asbachb-nixpkgs-5c2a@impl.it";
+    matrix = "@asbachb:matrix.org";
+    github = "asbachb";
+    githubId = 1482768;
+    name = "Benjamin Asbach";
+  };
+  asbjornolling = {
+    email = "asbjorn@olli.ng";
+    matrix = "@asbjorn:olli.ng";
+    github = "AsbjornOlling";
+    githubId = 11493130;
+    name = "Asbjørn Olling";
+  };
+  asciimoth = {
+    name = "Andrew";
+    email = "ascii@moth.contact";
+    github = "asciimoth";
+    githubId = 91414737;
+    keys = [{
+      fingerprint = "C5C8 4658 CCFD 7E8E 71DE  E933 AF3A E54F C3A3 5C9F";
+    }];
+  };
+  ashalkhakov = {
+    email = "artyom.shalkhakov@gmail.com";
+    github = "ashalkhakov";
+    githubId = 1270502;
+    name = "Artyom Shalkhakov";
+  };
+  ashgillman = {
+    email = "gillmanash@gmail.com";
+    github = "ashgillman";
+    githubId = 816777;
+    name = "Ashley Gillman";
+  };
+  ashkitten = {
+    email = "ashlea@protonmail.com";
+    github = "ashkitten";
+    githubId = 9281956;
+    name = "ash lea";
+  };
+  ashley = {
+    email = "ashley@kira64.xyz";
+    github = "kira64xyz";
+    githubId = 84152630;
+    name = "Ashley Chiara";
+  };
+  ashleyghooper = {
+    email = "ashleyghooper@gmail.com";
+    github = "ashleyghooper";
+    githubId = 11037075;
+    name = "Ashley Hooper";
+  };
+  ashvith-shetty = {
+    github = "Ashvith10";
+    githubId = 113123021;
+    name = "Ashvith Shetty";
+  };
+  aske = {
+    email = "aske@fmap.me";
+    github = "aske";
+    githubId = 869771;
+    name = "Kirill Boltaev";
+  };
+  asppsa = {
+    email = "asppsa@gmail.com";
+    github = "asppsa";
+    githubId = 453170;
+    name = "Alastair Pharo";
+  };
+  astavie = {
+    email = "astavie@pm.me";
+    github = "astavie";
+    githubId = 7745457;
+    name = "Astavie";
+  };
+  astro = {
+    email = "astro@spaceboyz.net";
+    github = "astro";
+    githubId = 12923;
+    name = "Astro";
+  };
+  astrobeastie = {
+    email = "fischervincent98@gmail.com";
+    github = "astrobeastie";
+    githubId = 26362368;
+    name = "Vincent Fischer";
+    keys = [{
+      fingerprint = "BF47 81E1 F304 1ADF 18CE  C401 DE16 C7D1 536D A72F";
+    }];
+  };
+  astsmtl = {
+    email = "astsmtl@yandex.ru";
+    github = "astsmtl";
+    githubId = 2093941;
+    name = "Alexander Tsamutali";
+  };
+  asymmetric = {
+    email = "lorenzo@mailbox.org";
+    github = "asymmetric";
+    githubId = 101816;
+    name = "Lorenzo Manacorda";
+  };
+  aszlig = {
+    email = "aszlig@nix.build";
+    github = "aszlig";
+    githubId = 192147;
+    name = "aszlig";
+    keys = [{
+      fingerprint = "DD52 6BC7 767D BA28 16C0 95E5 6840 89CE 67EB B691";
+    }];
+  };
+  atalii = {
+    email = "taliauster@gmail.com";
+    github = "atalii";
+    githubId = 120901234;
+    name = "tali auster";
+    matrix = "@atalii:matrix.org";
+  };
+  ataraxiasjel = {
+    email = "nix@ataraxiadev.com";
+    github = "AtaraxiaSjel";
+    githubId = 5314145;
+    name = "Dmitriy";
+    keys = [{
+      fingerprint = "922D A6E7 58A0 FE4C FAB4 E4B2 FD26 6B81 0DF4 8DF2";
+    }];
+  };
+  atemu = {
+    name = "Atemu";
+    email = "atemu.main+nixpkgs@gmail.com";
+    github = "Atemu";
+    githubId = 18599032;
+  };
+  athas = {
+    email = "athas@sigkill.dk";
+    github = "athas";
+    githubId = 55833;
+    name = "Troels Henriksen";
+  };
+  athre0z = {
+    email = "joel@zyantific.com";
+    github = "athre0z";
+    githubId = 6553158;
+    name = "Joel Höner";
+  };
+  atila = {
+    name = "Átila Saraiva";
+    email = "atilasaraiva@gmail.com";
+    github = "AtilaSaraiva";
+    githubId = 29521461;
+  };
+  atkinschang = {
+    email = "atkinschang+nixpkgs@gmail.com";
+    github = "AtkinsChang";
+    githubId = 5193600;
+    name = "Atkins Chang";
+  };
+  atkrad = {
+    name = "Mohammad Abdolirad";
+    email = "m.abdolirad@gmail.com";
+    github = "atkrad";
+    githubId = 351364;
+    keys = [
+      {
+        fingerprint = "0380 F2F8 DF7A BA1A E7DB  D84A 1935 1496 62CA FDB8";
+      }
+    ];
+  };
+  atnnn = {
+    email = "etienne@atnnn.com";
+    github = "AtnNn";
+    githubId = 706854;
+    name = "Etienne Laurin";
+  };
+  atry = {
+    name = "Bo Yang";
+    email = "atry@fb.com";
+    github = "Atry";
+    githubId = 601530;
+  };
+  attila-lendvai = {
+    name = "Attila Lendvai";
+    email = "attila@lendvai.name";
+    github = "attila-lendvai";
+    githubId = 840345;
+  };
+  auchter = {
+    name = "Michael Auchter";
+    email = "a@phire.org";
+    github = "auchter";
+    githubId = 1190483;
+  };
+  augustebaum = {
+    email = "auguste.apple@gmail.com";
+    github = "augustebaum";
+    githubId = 52001167;
+    name = "Auguste Baum";
+  };
+  auntie = {
+    email = "auntieNeo@gmail.com";
+    github = "auntieNeo";
+    githubId = 574938;
+    name = "Jonathan Glines";
+  };
+  austin-artificial = {
+    email = "austin.platt@artificial.io";
+    github = "austin-artificial";
+    githubId = 126663376;
+    name = "Austin Platt";
+  };
+  austinbutler = {
+    email = "austinabutler@gmail.com";
+    github = "austinbutler";
+    githubId = 354741;
+    name = "Austin Butler";
+  };
+  autophagy = {
+    email = "mail@autophagy.io";
+    github = "autophagy";
+    githubId = 12958979;
+    name = "Mika Naylor";
+  };
+  autrimpo = {
+    email = "michal@koutensky.net";
+    github = "autrimpo";
+    githubId = 5968483;
+    name = "Michal Koutenský";
+  };
+  autumnal = {
+    name = "Sven Friedrich";
+    email = "sven@autumnal.de";
+    github = "sevenautumns";
+    githubId = 20627275;
+    keys = [{
+      fingerprint = "6A2E 7FDD 1037 11A8 B996  E28E B051 064E 2FCA B71B";
+    }];
+  };
+  avakhrenev = {
+    email = "avakhrenev@gmail.com";
+    github = "avakhrenev";
+    githubId = 1060224;
+    name = "Alexey Vakhrenev";
+  };
+  avaq = {
+    email = "nixpkgs@account.avaq.it";
+    github = "Avaq";
+    githubId = 1217745;
+    name = "Aldwin Vlasblom";
+  };
+  averagebit = {
+    email = "averagebit@pm.me";
+    github = "averagebit";
+    githubId = 97070581;
+    name = "averagebit";
+  };
+  averelld = {
+    email = "averell+nixos@rxd4.com";
+    github = "averelld";
+    githubId = 687218;
+    name = "averelld";
+  };
+  avery = {
+    email = "averyl+nixos@protonmail.com";
+    github = "AveryLychee";
+    githubId = 9147625;
+    name = "Avery Lychee";
+  };
+  avh4 = {
+    email = "gruen0aermel@gmail.com";
+    github = "avh4";
+    githubId = 1222;
+    name = "Aaron VonderHaar";
+  };
+  aviallon = {
+    email = "antoine-nixos@lesviallon.fr";
+    github = "aviallon";
+    githubId = 7479436;
+    name = "Antoine Viallon";
+    keys = [{
+      fingerprint = "4AC4 A28D 7208 FC6F 2B51  5EA9 D126 B13A B555 E16F";
+    }];
+  };
+  avitex = {
+    email = "theavitex@gmail.com";
+    github = "avitex";
+    githubId = 5110816;
+    name = "avitex";
+    keys = [{
+      fingerprint = "271E 136C 178E 06FA EA4E  B854 8B36 6C44 3CAB E942";
+    }];
+  };
+  avnik = {
+    email = "avn@avnik.info";
+    github = "avnik";
+    githubId = 153538;
+    name = "Alexander V. Nikolaev";
+  };
+  aw = {
+    email = "aw-nixos@meterriblecrew.net";
+    github = "herrwiese";
+    githubId = 206242;
+    name = "Andreas Wiese";
+  };
+  ayazhafiz = {
+    email = "ayaz.hafiz.1@gmail.com";
+    github = "hafiz";
+    githubId = 262763;
+    name = "Ayaz Hafiz";
+  };
+  aycanirican = {
+    email = "iricanaycan@gmail.com";
+    github = "aycanirican";
+    githubId = 135230;
+    name = "Aycan iRiCAN";
+  };
+  ayes-web = {
+    email = "ayes2022@protonmail.com";
+    github = "ayes-web";
+    githubId = 52951851;
+    name = "ayes-web";
+  };
+  aynish = {
+    github = "Chickensoupwithrice";
+    githubId = 22575913;
+    name = "Anish Lakhwara";
+  };
+  azahi = {
+    name = "Azat Bahawi";
+    email = "azat@bahawi.net";
+    matrix = "@azahi:azahi.cc";
+    github = "azahi";
+    githubId = 22211000;
+    keys = [{
+      fingerprint = "2688 0377 C31D 9E81 9BDF  83A8 C8C6 BDDB 3847 F72B";
+    }];
+  };
+  azazak123 = {
+    email = "azazaka2002@gmail.com";
+    matrix = "@ne_dvoeshnik:matrix.org";
+    name = "Volodymyr Antonov";
+    github = "azazak123";
+    githubId = 50211158;
+  };
+  azd325 = {
+    email = "tim.kleinschmidt@gmail.com";
+    github = "Azd325";
+    githubId = 426541;
+    name = "Tim Kleinschmidt";
+  };
+  azuwis = {
+    email = "azuwis@gmail.com";
+    github = "azuwis";
+    githubId = 9315;
+    name = "Zhong Jianxin";
+  };
+  b4dm4n = {
+    email = "fabianm88@gmail.com";
+    github = "B4dM4n";
+    githubId = 448169;
+    name = "Fabian Möller";
+    keys = [{
+      fingerprint = "6309 E212 29D4 DA30 AF24  BDED 754B 5C09 63C4 2C50";
+    }];
+  };
+  babariviere = {
+    email = "me@babariviere.com";
+    github = "babariviere";
+    githubId = 12128029;
+    name = "Bastien Rivière";
+    keys = [{
+      fingerprint = "74AA 9AB4 E6FF 872B 3C5A  CB3E 3903 5CC0 B75D 1142";
+    }];
+  };
+  babbaj = {
+    name = "babbaj";
+    email = "babbaj45@gmail.com";
+    github = "babbaj";
+    githubId = 12820770;
+    keys = [{
+      fingerprint = "6FBC A462 4EAF C69C A7C4  98C1 F044 3098 48A0 7CAC";
+    }];
+  };
+  babeuh = {
+    name = "Raphael Le Goaller";
+    email = "babeuh@rlglr.fr";
+    github = "babeuh";
+    githubId = 60193302;
+  };
+  bachp = {
+    email = "pascal.bach@nextrem.ch";
+    matrix = "@bachp:matrix.org";
+    github = "bachp";
+    githubId = 333807;
+    name = "Pascal Bach";
+  };
+  backuitist = {
+    email = "biethb@gmail.com";
+    github = "backuitist";
+    githubId = 1017537;
+    name = "Bruno Bieth";
+  };
+  badele = {
+    name = "Bruno Adelé";
+    email = "brunoadele@gmail.com";
+    matrix = "@badele:matrix.org";
+    github = "badele";
+    githubId = 2806307;
+    keys = [{
+      fingerprint = "00F4 21C4 C537 7BA3 9820 E13F 6B95 E13D E469 CC5D";
+    }];
+  };
+  badmutex = {
+    email = "github@badi.sh";
+    github = "badmutex";
+    githubId = 35324;
+    name = "Badi' Abdul-Wahid";
+  };
+  baduhai = {
+    email = "baduhai@pm.me";
+    github = "baduhai";
+    githubId = 31864305;
+    name = "William";
+  };
+  baitinq = {
+    email = "manuelpalenzuelamerino@gmail.com";
+    name = "Baitinq";
+    github = "Baitinq";
+    githubId = 30861839;
+  };
+  balodja = {
+    email = "balodja@gmail.com";
+    github = "balodja";
+    githubId = 294444;
+    name = "Vladimir Korolev";
+  };
+  baloo = {
+    email = "nixpkgs@superbaloo.net";
+    github = "baloo";
+    githubId = 59060;
+    name = "Arthur Gautier";
+  };
+  balsoft = {
+    email = "balsoft75@gmail.com";
+    github = "balsoft";
+    githubId = 18467667;
+    name = "Alexander Bantyev";
+  };
+  bandresen = {
+    email = "bandresen@gmail.com";
+    github = "bennyandresen";
+    githubId = 80325;
+    name = "Benjamin Andresen";
+  };
+  barab-i = {
+    email = "barab_i@outlook.com";
+    github = "barab-i";
+    githubId = 92919899;
+    name = "Barab I";
+  };
+  baracoder = {
+    email = "baracoder@googlemail.com";
+    github = "baracoder";
+    githubId = 127523;
+    name = "Herman Fries";
+  };
+  BarinovMaxim = {
+    name = "Barinov Maxim";
+    email = "barinov274@gmail.com";
+    github = "barinov274";
+    githubId = 54442153;
+  };
+  barrucadu = {
+    email = "mike@barrucadu.co.uk";
+    github = "barrucadu";
+    githubId = 75235;
+    name = "Michael Walker";
+  };
+  bartsch = {
+    email = "consume.noise@gmail.com";
+    github = "bartsch";
+    githubId = 3390885;
+    name = "Daniel Martin";
+  };
+  bartuka = {
+    email = "wand@hey.com";
+    github = "wandersoncferreira";
+    githubId = 17708295;
+    name = "Wanderson Ferreira";
+    keys = [{
+      fingerprint = "A3E1 C409 B705 50B3 BF41  492B 5684 0A61 4DBE 37AE";
+    }];
+  };
+  bastaynav = {
+    name = "Ivan Bastrakov";
+    email = "bastaynav@proton.me";
+    matrix = "@bastaynav:matrix.org";
+    github = "bastaynav";
+    githubId = 6987136;
+    keys = [{
+      fingerprint = "2C6D 37D4 6AA1 DCDA BE8D  F346 43E2 CF4C 01B9 4940";
+    }];
+  };
+  basvandijk = {
+    email = "v.dijk.bas@gmail.com";
+    github = "basvandijk";
+    githubId = 576355;
+    name = "Bas van Dijk";
+  };
+  BattleCh1cken = {
+    email = "BattleCh1cken@larkov.de";
+    github = "BattleCh1cken";
+    githubId = 75806385;
+    name = "Felix Hass";
+  };
+  Baughn = {
+    email = "sveina@gmail.com";
+    github = "Baughn";
+    githubId = 45811;
+    name = "Svein Ove Aas";
+  };
+  Bauke = {
+    name = "Bauke";
+    email = "me@bauke.xyz";
+    matrix = "@baukexyz:matrix.org";
+    github = "Bauke";
+    githubId = 19501722;
+    keys = [{
+      fingerprint = "C593 27B5 9D0F 2622 23F6  1D03 C1C0 F299 52BC F558";
+    }];
+  };
+  bb010g = {
+    email = "me@bb010g.com";
+    matrix = "@bb010g:matrix.org";
+    github = "bb010g";
+    githubId = 340132;
+    name = "Brayden Banks";
+  };
+  bb2020 = {
+    github = "bb2020";
+    githubId = 19290397;
+    name = "Tunc Uzlu";
+  };
+  bbarker = {
+    email = "brandon.barker@gmail.com";
+    github = "bbarker";
+    githubId = 916366;
+    name = "Brandon Elam Barker";
+  };
+  bbenne10 = {
+    email = "Bryan.Bennett@protonmail.com";
+    matrix = "@bryan.bennett:matrix.org";
+    github = "bbenne10";
+    githubId = 687376;
+    name = "Bryan Bennett";
+    keys = [{
+      # compare with https://keybase.io/bbenne10
+      fingerprint = "41EA 00B4 00F9 6970 1CB2  D3AF EF90 E3E9 8B8F 5C0B";
+    }];
+  };
+  bbenno = {
+    email = "nix@bbenno.com";
+    github = "bbenno";
+    githubId = 32938211;
+    name = "Benno Bielmeier";
+  };
+  bbigras = {
+    email = "bigras.bruno@gmail.com";
+    github = "bbigras";
+    githubId = 24027;
+    name = "Bruno Bigras";
+  };
+  bbjubjub = {
+    name = "Julie B.";
+    email = "julie+nixpkgs@bbjubjub.fr";
+    github = "bbjubjub2494";
+    githubId = 15657735;
+  };
+  bburdette = {
+    email = "bburdette@protonmail.com";
+    github = "bburdette";
+    githubId = 157330;
+    name = "Ben Burdette";
+  };
+  bcarrell = {
+    email = "brandoncarrell@gmail.com";
+    github = "bcarrell";
+    githubId = 1015044;
+    name = "Brandon Carrell";
+  };
+  bcc32 = {
+    email = "me@bcc32.com";
+    github = "bcc32";
+    githubId = 1239097;
+    name = "Aaron Zeng";
+  };
+  bcdarwin = {
+    email = "bcdarwin@gmail.com";
+    github = "bcdarwin";
+    githubId = 164148;
+    name = "Ben Darwin";
+  };
+  bdd = {
+    email = "bdd@mindcast.org";
+    github = "bdd";
+    githubId = 11135;
+    name = "Berk D. Demir";
+  };
+  bddvlpr = {
+    email = "luna@bddvlpr.com";
+    github = "bddvlpr";
+    githubId = 17461028;
+    name = "Luna Simons";
+  };
+  bdesham = {
+    email = "benjamin@esham.io";
+    github = "bdesham";
+    githubId = 354230;
+    name = "Benjamin Esham";
+  };
+  bdimcheff = {
+    email = "brandon@dimcheff.com";
+    github = "bdimcheff";
+    githubId = 14111;
+    name = "Brandon Dimcheff";
+  };
+  beardhatcode = {
+    name = "Robbert Gurdeep Singh";
+    email = "nixpkgs@beardhatcode.be";
+    github = "beardhatcode";
+    githubId = 662538;
+  };
+  beeb = {
+    name = "Valentin Bersier";
+    email = "hi@beeb.li";
+    github = "beeb";
+    githubId = 703631;
+  };
+  beezow = {
+    name = "beezow";
+    email = "zbeezow@gmail.com";
+    github = "beezow";
+    githubId = 42082156;
+  };
+  bendlas = {
+    email = "herwig@bendlas.net";
+    matrix = "@bendlas:matrix.org";
+    github = "bendlas";
+    githubId = 214787;
+    name = "Herwig Hochleitner";
+  };
+  benediktbroich = {
+    name = "Benedikt Broich";
+    email = "b.broich@posteo.de";
+    github = "BenediktBroich";
+    githubId = 32903896;
+    keys = [{
+      fingerprint = "CB5C 7B3C 3E6F 2A59 A583  A90A 8A60 0376 7BE9 5976";
+    }];
+  };
+  benesim = {
+    name = "Benjamin Isbarn";
+    email = "benjamin.isbarn@gmail.com";
+    github = "BeneSim";
+    githubId = 29384538;
+    keys = [{
+      fingerprint = "D35E C9CE E631 638F F1D8  B401 6F0E 410D C3EE D02";
+    }];
+  };
+  benhiemer = {
+    name = "Benedikt Hiemer";
+    email = "ben.email@posteo.de";
+    github = "benhiemer";
+    githubId = 16649926;
+  };
+  benjaminedwardwebb = {
+    name = "Ben Webb";
+    email = "benjaminedwardwebb@gmail.com";
+    github = "benjaminedwardwebb";
+    githubId = 7118777;
+    keys = [{
+      fingerprint = "E9A3 7864 2165 28CE 507C  CA82 72EA BF75 C331 CD25";
+    }];
+  };
+  Benjamin-L = {
+    name = "Benjamin Lee";
+    email = "benjamin@computer.surgery";
+    matrix = "@benjamin:computer.surgery";
+    github = "Benjamin-L";
+    githubId = 6504174;
+    keys = [{
+      fingerprint = "9D84 09A0 44FC 1EEB AE2D  FA30 FB96 24E2 885D 55A4";
+    }];
+  };
+  benkuhn = {
+    email = "ben@ben-kuhn.com";
+    github = "ben-kuhn";
+    githubId = 16821405;
+    name = "Ben Kuhn";
+  };
+  benlemasurier = {
+    email = "ben@crypt.ly";
+    github = "benlemasurier";
+    githubId = 47993;
+    name = "Ben LeMasurier";
+    keys = [{
+      fingerprint = "0FD4 7407 EFD4 8FD8 8BF5  87B3 248D 430A E8E7 4189";
+    }];
+  };
+  benley = {
+    email = "benley@gmail.com";
+    github = "benley";
+    githubId = 1432730;
+    name = "Benjamin Staffin";
+  };
+  benneti = {
+    name = "Benedikt Tissot";
+    email = "benedikt.tissot@googlemail.com";
+    github = "benneti";
+    githubId = 11725645;
+  };
+  bennofs = {
+    email = "benno.fuenfstueck@gmail.com";
+    github = "bennofs";
+    githubId = 3192959;
+    name = "Benno Fünfstück";
+  };
+  benpye = {
+    email = "ben@curlybracket.co.uk";
+    github = "benpye";
+    githubId = 442623;
+    name = "Ben Pye";
+  };
+  benwbooth = {
+    email = "benwboooth@gmail.com";
+    github = "benwbooth";
+    githubId = 75972;
+    name = "Ben Booth";
+  };
+  benwis = {
+    name = "Ben Wishovich";
+    email = "ben@benw.is";
+    github = "benwis";
+    githubId = 6953353;
+  };
+  berberman = {
+    email = "berberman@yandex.com";
+    matrix = "@berberman:mozilla.org";
+    github = "berberman";
+    githubId = 26041945;
+    name = "Potato Hatsue";
+  };
+  berbiche = {
+    name = "Nicolas Berbiche";
+    email = "nicolas@normie.dev";
+    github = "berbiche";
+    githubId = 20448408;
+    keys = [{
+      fingerprint = "D446 E58D 87A0 31C7 EC15  88D7 B461 2924 45C6 E696";
+    }];
+  };
+  berce = {
+    email = "bert.moens@gmail.com";
+    github = "berce";
+    githubId = 10439709;
+    name = "Bert Moens";
+  };
+  berdario = {
+    email = "berdario@gmail.com";
+    github = "berdario";
+    githubId = 752835;
+    name = "Dario Bertini";
+  };
+  bergey = {
+    email = "bergey@teallabs.org";
+    github = "bergey";
+    githubId = 251106;
+    name = "Daniel Bergey";
+  };
+  bergkvist = {
+    email = "tobias@bergkv.ist";
+    github = "bergkvist";
+    githubId = 410028;
+    name = "Tobias Bergkvist";
+  };
+  berryp = {
+    email = "berryphillips@gmail.com";
+    github = "berryp";
+    githubId = 19911;
+    name = "Berry Phillips";
+  };
+  bertof = {
+    name = "Filippo Berto";
+    email = "berto.f@protonmail.com";
+    github = "bertof";
+    githubId = 9915675;
+    keys = [{
+      fingerprint = "17C5 1EF9 C0FE 2EB2 FE56  BB53 FE98 AE5E C52B 1056";
+    }];
+  };
+  betaboon = {
+    email = "betaboon@0x80.ninja";
+    github = "betaboon";
+    githubId = 7346933;
+    name = "betaboon";
+  };
+  bew = {
+    email = "benoit.dechezelles@gmail.com";
+    github = "bew";
+    githubId = 9730330;
+    name = "Benoit de Chezelles";
+  };
+  bezmuth = {
+    email = "benkel97@protonmail.com";
+    name = "Ben Kelly";
+    github = "bezmuth";
+    githubId = 31394095;
+  };
+  bfortz = {
+    email = "bernard.fortz@gmail.com";
+    github = "bfortz";
+    githubId = 16426882;
+    name = "Bernard Fortz";
+  };
+  bgamari = {
+    email = "ben@smart-cactus.org";
+    github = "bgamari";
+    githubId = 1010174;
+    name = "Ben Gamari";
+  };
+  bhall = {
+    email = "brendan.j.hall@bath.edu";
+    github = "brendan-hall";
+    githubId = 34919100;
+    name = "Brendan Hall";
+  };
+  bhipple = {
+    email = "bhipple@protonmail.com";
+    github = "bhipple";
+    githubId = 2071583;
+    name = "Benjamin Hipple";
+  };
+  bhougland = {
+    email = "benjamin.hougland@gmail.com";
+    github = "bhougland18";
+    githubId = 28444296;
+    name = "Benjamin Hougland";
+  };
+  billewanick = {
+    email = "bill@ewanick.com";
+    github = "billewanick";
+    githubId = 13324165;
+    name = "Bill Ewanick";
+  };
+  billhuang = {
+    email = "bill.huang2001@gmail.com";
+    github = "BillHuang2001";
+    githubId = 11801831;
+    name = "Bill Huang";
+  };
+  binarin = {
+    email = "binarin@binarin.ru";
+    github = "binarin";
+    githubId = 185443;
+    name = "Alexey Lebedeff";
+  };
+  binsky = {
+    email = "timo@binsky.org";
+    github = "binsky08";
+    githubId = 30630233;
+    name = "Timo Triebensky";
+  };
+  bjornfor = {
+    email = "bjorn.forsman@gmail.com";
+    github = "bjornfor";
+    githubId = 133602;
+    name = "Bjørn Forsman";
+  };
+  bkchr = {
+    email = "nixos@kchr.de";
+    github = "bkchr";
+    githubId = 5718007;
+    name = "Bastian Köcher";
+  };
+  blaggacao = {
+    name = "David Arnold";
+    email = "dar@xoe.solutions";
+    github = "blaggacao";
+    githubId = 7548295;
+  };
+  blankparticle = {
+    name = "BlankParticle";
+    email = "blankparticle@gmail.com";
+    github = "BlankParticle";
+    githubId = 130567419;
+    keys = [{
+      fingerprint = "1757 64C3 7065 AA8D 614D  41C9 0ACE 126D 7B35 9261";
+    }];
+  };
+  blanky0230 = {
+    email = "blanky0230@gmail.com";
+    github = "blanky0230";
+    githubId = 5700358;
+    name = "Thomas Blank";
+  };
+  blinry = {
+    name = "blinry";
+    email = "mail@blinry.org";
+    github = "blinry";
+    githubId = 81277;
+  };
+  blitz = {
+    email = "js@alien8.de";
+    matrix = "@js:ukvly.org";
+    github = "blitz";
+    githubId = 37907;
+    name = "Julian Stecklina";
+  };
+  bloveless = {
+    email = "brennon.loveless@gmail.com";
+    github = "bloveless";
+    githubId = 535135;
+    name = "Brennon Loveless";
+  };
+  bluescreen303 = {
+    email = "mathijs@bluescreen303.nl";
+    github = "bluescreen303";
+    githubId = 16330;
+    name = "Mathijs Kwik";
+  };
+  blusk = {
+    email = "bluskript@gmail.com";
+    github = "Bluskript";
+    githubId = 52386117;
+    name = "Blusk";
+  };
+  bmanuel = {
+    name = "Benjamin Manuel";
+    email = "ben@benmanuel.com";
+    github = "bmanuel";
+    githubId = 3662307;
+  };
+  bmilanov = {
+    name = "Biser Milanov";
+    email = "bmilanov11+nixpkgs@gmail.com";
+    github = "bmilanov";
+    githubId = 30090366;
+  };
+  bmwalters = {
+    name = "Bradley Walters";
+    email = "oss@walters.app";
+    github = "bmwalters";
+    githubId = 4380777;
+  };
+  bobakker = {
+    email = "bobakk3r@gmail.com";
+    github = "bobakker";
+    githubId = 10221570;
+    name = "Bo Bakker";
+  };
+  bobby285271 = {
+    name = "Bobby Rong";
+    email = "rjl931189261@126.com";
+    matrix = "@bobby285271:matrix.org";
+    github = "bobby285271";
+    githubId = 20080233;
+  };
+  bobvanderlinden = {
+    email = "bobvanderlinden@gmail.com";
+    github = "bobvanderlinden";
+    githubId = 6375609;
+    name = "Bob van der Linden";
+  };
+  bodil = {
+    email = "nix@bodil.org";
+    github = "bodil";
+    githubId = 17880;
+    name = "Bodil Stokke";
+  };
+  boj = {
+    email = "brian@uncannyworks.com";
+    github = "boj";
+    githubId = 50839;
+    name = "Brian Jones";
+  };
+  boltzmannrain = {
+    email = "boltzmannrain@gmail.com";
+    github = "boltzmannrain";
+    githubId = 150560585;
+    name = "Dmitry Ivankov";
+  };
+  booklearner = {
+    name = "booklearner";
+    email = "booklearner@proton.me";
+    matrix = "@booklearner:matrix.org";
+    github = "booklearner";
+    githubId = 103979114;
+    keys = [{
+      fingerprint = "17C7 95D4 871C 2F87 83C8  053D 0C61 C4E5 907F 76C8";
+    }];
+  };
+  booniepepper = {
+    name = "J.R. Hill";
+    email = "justin@so.dang.cool";
+    github = "booniepepper";
+    githubId = 17605298;
+  };
+  bootstrap-prime = {
+    email = "bootstrap.prime@gmail.com";
+    github = "bootstrap-prime";
+    githubId = 68566724;
+    name = "bootstrap-prime";
+  };
+  boozedog = {
+    email = "code@booze.dog";
+    github = "boozedog";
+    githubId = 1410808;
+    matrix = "@boozedog:matrix.org";
+    name = "David A. Buser";
+  };
+  borisbabic = {
+    email = "boris.ivan.babic@gmail.com";
+    github = "borisbabic";
+    githubId = 1743184;
+    name = "Boris Babić";
+  };
+  bosu = {
+    email = "boriss@gmail.com";
+    github = "bosu";
+    githubId = 3465841;
+    name = "Boris Sukholitko";
+  };
+  bouk = {
+    name = "Bouke van der Bijl";
+    email = "i@bou.ke";
+    github = "bouk";
+    githubId = 97820;
+  };
+  bpaulin = {
+    email = "brunopaulin@bpaulin.net";
+    github = "bpaulin";
+    githubId = 115711;
+    name = "bpaulin";
+  };
+  Br1ght0ne = {
+    email = "brightone@protonmail.com";
+    github = "Br1ght0ne";
+    githubId = 12615679;
+    name = "Oleksii Filonenko";
+    keys = [{
+      fingerprint = "F549 3B7F 9372 5578 FDD3  D0B8 A1BC 8428 323E CFE8";
+    }];
+  };
+  br337 = {
+    email = "brian.porumb@proton.me";
+    github = "br337";
+    githubId = 49288125;
+    name = "Brian Porumb";
+  };
+  bradediger = {
+    email = "brad@bradediger.com";
+    github = "bradediger";
+    githubId = 4621;
+    name = "Brad Ediger";
+  };
+  brahyerr = {
+    name = "Bryant Pham";
+    email = "bp@1829847@gmail.com";
+    github = "brahyerr";
+    githubId = 120991075;
+  };
+  brainrape = {
+    email = "martonboros@gmail.com";
+    github = "brainrake";
+    githubId = 302429;
+    name = "Marton Boros";
+  };
+  bramd = {
+    email = "bram@bramd.nl";
+    github = "bramd";
+    githubId = 86652;
+    name = "Bram Duvigneau";
+  };
+  braydenjw = {
+    email = "nixpkgs@willenborg.ca";
+    github = "braydenjw";
+    githubId = 2506621;
+    name = "Brayden Willenborg";
+  };
+  breakds = {
+    email = "breakds@gmail.com";
+    github = "breakds";
+    githubId = 1111035;
+    name = "Break Yang";
+  };
+  brecht = {
+    email = "brecht.savelkoul@alumni.lse.ac.uk";
+    github = "brechtcs";
+    githubId = 6107054;
+    name = "Brecht Savelkoul";
+  };
+  brendanreis = {
+    email = "brendanreis@gmail.com";
+    name = "Brendan Reis";
+    github = "brendanreis";
+    githubId = 10686906;
+  };
+  brettlyons = {
+    email = "blyons@fastmail.com";
+    github = "brettlyons";
+    githubId = 3043718;
+    name = "Brett Lyons";
+  };
+  brian-dawn = {
+    email = "brian.t.dawn@gmail.com";
+    github = "brian-dawn";
+    githubId = 1274409;
+    name = "Brian Dawn";
+  };
+  brianhicks = {
+    email = "brian@brianthicks.com";
+    github = "BrianHicks";
+    githubId = 355401;
+    name = "Brian Hicks";
+  };
+  brianmcgee = {
+    name = "Brian McGee";
+    email = "brian@41north.dev";
+    github = "brianmcgee";
+    githubId = 1173648;
+  };
+  brianmcgillion = {
+    name = "Brian McGillion";
+    email = "bmg.avoin@gmail.com";
+    github = "brianmcgillion";
+    githubId = 1044263;
+  };
+  brodes = {
+    email = "me@brod.es";
+    github = "brhoades";
+    githubId = 4763746;
+    name = "Billy Rhoades";
+    keys = [{
+      fingerprint = "BF4FCB85C69989B4ED95BF938AE74787A4B7C07E";
+    }];
+  };
+  broke = {
+    email = "broke@in-fucking.space";
+    github = "broke";
+    githubId = 1071610;
+    name = "Gunnar Nitsche";
+  };
+  brokenpip3 = {
+    email = "brokenpip3@gmail.com";
+    matrix = "@brokenpip3:matrix.org";
+    github = "brokenpip3";
+    githubId = 40476330;
+    name = "brokenpip3";
+  };
+  brpaz = {
+    email = "oss@brunopaz.dev";
+    github = "brpaz";
+    githubId = 184563;
+    name = "Bruno Paz";
+  };
+  bryanasdev000 = {
+    email = "bryanasdev000@gmail.com";
+    matrix = "@bryanasdev000:matrix.org";
+    github = "bryanasdev000";
+    githubId = 53131727;
+    name = "Bryan Albuquerque";
+  };
+  bryango = {
+    name = "Bryan Lai";
+    email = "bryanlais@gmail.com";
+    github = "bryango";
+    githubId = 26322692;
+  };
+  bryanhonof = {
+    name = "Bryan Honof";
+    email = "bryanhonof@gmail.com";
+    github = "bryanhonof";
+    githubId = 5932804;
+  };
+  bsima = {
+    email = "ben@bsima.me";
+    github = "bsima";
+    githubId = 200617;
+    name = "Ben Sima";
+  };
+  btlvr = {
+    email = "btlvr@protonmail.com";
+    github = "btlvr";
+    githubId = 32319131;
+    name = "Brett L";
+  };
+  buckley310 = {
+    email = "sean.bck@gmail.com";
+    matrix = "@buckley310:matrix.org";
+    github = "buckley310";
+    githubId = 2379774;
+    name = "Sean Buckley";
+  };
+  buffet = {
+    email = "niclas@countingsort.com";
+    github = "buffet";
+    githubId = 33751841;
+    name = "Niclas Meyer";
+  };
+  bugworm = {
+    email = "bugworm@zoho.com";
+    github = "bugworm";
+    githubId = 7214361;
+    name = "Roman Gerasimenko";
+  };
+  builditluc = {
+    email = "builditluc@icloud.com";
+    github = "Builditluc";
+    githubId = 37375448;
+    name = "Buildit";
+  };
+  bwlang = {
+    email = "brad@langhorst.com";
+    github = "bwlang";
+    githubId = 61636;
+    name = "Brad Langhorst";
+  };
+  bycEEE = {
+    email = "bycEEE@gmail.com";
+    github = "bycEEE";
+    githubId = 8891115;
+    name = "Brian Choy";
+  };
+  bzizou = {
+    email = "Bruno@bzizou.net";
+    github = "bzizou";
+    githubId = 2647566;
+    name = "Bruno Bzeznik";
+  };
+  c00w = {
+    email = "nix@daedrum.net";
+    github = "c00w";
+    githubId = 486199;
+    name = "Colin";
+  };
+  c0bw3b = {
+    email = "c0bw3b@gmail.com";
+    github = "c0bw3b";
+    githubId = 24417923;
+    name = "Renaud";
+  };
+  c0deaddict = {
+    email = "josvanbakel@protonmail.com";
+    github = "c0deaddict";
+    githubId = 510553;
+    name = "Jos van Bakel";
+  };
+  c4605 = {
+    email = "bolasblack@gmail.com";
+    github = "bolasblack";
+    githubId = 382011;
+    name = "c4605";
+  };
+  caarlos0 = {
+    name = "Carlos A Becker";
+    email = "carlos@becker.software";
+    github = "caarlos0";
+    githubId = 245435;
+  };
+  cab404 = {
+    email = "cab404@mailbox.org";
+    github = "cab404";
+    githubId = 6453661;
+    name = "Vladimir Serov";
+    keys = [
+      # compare with https://keybase.io/cab404
+      {
+        fingerprint = "1BB96810926F4E715DEF567E6BA7C26C3FDF7BB3";
+      }
+      {
+        fingerprint = "1EBC648C64D6045463013B3EB7EFFC271D55DB8A";
+      }
+    ];
+  };
+  CactiChameleon9 = {
+    email = "h19xjkkp@duck.com";
+    github = "CactiChameleon9";
+    githubId = 51231053;
+    name = "Daniel";
+  };
+  cadkin = {
+    email = "cva@siliconslumber.net";
+    name = "Cameron Adkins";
+    github = "cadkin";
+    githubId = 34077838;
+  };
+  cafkafk = {
+    email = "christina@cafkafk.com";
+    matrix = "@cafkafk:nixos.dev";
+    name = "Christina Sørensen";
+    github = "cafkafk";
+    githubId = 89321978;
+    keys = [
+      {
+        fingerprint = "7B9E E848 D074 AE03 7A0C  651A 8ED4 DEF7 375A 30C8";
+      }
+      {
+        fingerprint = "208A 2A66 8A2F CDE7 B5D3  8F64 CDDC 792F 6552 51ED";
+      }
+    ];
+  };
+  CaitlinDavitt = {
+    email = "CaitlinDavitt@gmail.com";
+    github = "CaitlinDavitt";
+    githubId = 48105979;
+    name = "Caitlin Davitt";
+  };
+  calavera = {
+    email = "david.calavera@gmail.com";
+    github = "calavera";
+    githubId = 1050;
+    matrix = "@davidcalavera:matrix.org";
+    name = "David Calavera";
+  };
+  calbrecht = {
+    email = "christian.albrecht@mayflower.de";
+    github = "calbrecht";
+    githubId = 1516457;
+    name = "Christian Albrecht";
+  };
+  callahad = {
+    email = "dan.callahan@gmail.com";
+    github = "callahad";
+    githubId = 24193;
+    name = "Dan Callahan";
+  };
+  calvertvl = {
+    email = "calvertvl@gmail.com";
+    github = "calvertvl";
+    githubId = 7435854;
+    name = "Victor Calvert";
+  };
+  camelpunch = {
+    email = "me@andrewbruce.net";
+    github = "camelpunch";
+    githubId = 141733;
+    name = "Andrew Bruce";
+  };
+  cameronfyfe = {
+    email = "cameron.j.fyfe@gmail.com";
+    github = "cameronfyfe";
+    githubId = 21013281;
+    name = "Cameron Fyfe";
+  };
+  cameronnemo = {
+    email = "cnemo@tutanota.com";
+    github = "CameronNemo";
+    githubId = 3212452;
+    name = "Cameron Nemo";
+  };
+  camillemndn = {
+    email = "camillemondon@free.fr";
+    github = "camillemndn";
+    githubId = 26444818;
+    name = "Camille M.";
+  };
+  campadrenalin = {
+    email = "campadrenalin@gmail.com";
+    github = "campadrenalin";
+    githubId = 289492;
+    name = "Philip Horger";
+  };
+  candeira = {
+    email = "javier@candeira.com";
+    github = "candeira";
+    githubId = 91694;
+    name = "Javier Candeira";
+  };
+  canndrew = {
+    email = "shum@canndrew.org";
+    github = "canndrew";
+    githubId = 5555066;
+    name = "Andrew Cann";
+  };
+  cap = {
+    name = "cap";
+    email = "nixos_xasenw9@digitalpostkasten.de";
+    github = "scaredmushroom";
+    githubId = 45340040;
+  };
+  CaptainJawZ = {
+    email = "CaptainJawZ@outlook.com";
+    name = "Danilo Reyes";
+    github = "CaptainJawZ";
+    githubId = 43111068;
+  };
+  CardboardTurkey = {
+    name = "Kiran Ostrolenk";
+    email = "kiran@ostrolenk.co.uk";
+    github = "CardboardTurkey";
+    githubId = 34030186;
+    keys = [{
+      fingerprint = "8BC7 74E4 A2EC 7507 3B61  A647 0BBB 1C8B 1C36 39EE";
+    }];
+  };
+  carloscraveiro = {
+    email = "carlos.craveiro@usp.br";
+    github = "CarlosCraveiro";
+    githubId = 85318248;
+    name = "Carlos Henrique Craveiro Aquino Veras";
+  };
+  carlosdagos = {
+    email = "m@cdagostino.io";
+    github = "carlosdagos";
+    githubId = 686190;
+    name = "Carlos D'Agostino";
+  };
+  carlossless = {
+    email = "contact@carlossless.io";
+    matrix = "@carlossless:matrix.org";
+    github = "carlossless";
+    githubId = 498906;
+    name = "Karolis Stasaitis";
+  };
+  carlsverre = {
+    email = "accounts@carlsverre.com";
+    github = "carlsverre";
+    githubId = 82591;
+    name = "Carl Sverre";
+  };
+  carlthome = {
+    name = "Carl Thomé";
+    email = "carlthome@gmail.com";
+    github = "carlthome";
+    githubId = 1595907;
+  };
+  carpinchomug = {
+    email = "aki.suda@protonmail.com";
+    github = "carpinchomug";
+    githubId = 101536256;
+    name = "Akiyoshi Suda";
+  };
+  cartr = {
+    email = "carter.sande@duodecima.technology";
+    github = "cartr";
+    githubId = 5241813;
+    name = "Carter Sande";
+  };
+  casey = {
+    email = "casey@rodarmor.net";
+    github = "casey";
+    githubId = 1945;
+    name = "Casey Rodarmor";
+  };
+  catap = {
+    email = "kirill@korins.ky";
+    github = "catap";
+    githubId = 37775;
+    name = "Kirill A. Korinsky";
+  };
+  catern = {
+    email = "sbaugh@catern.com";
+    github = "catern";
+    githubId = 5394722;
+    name = "Spencer Baugh";
+  };
+  cathalmullan = {
+    email = "contact@cathal.dev";
+    github = "CathalMullan";
+    githubId = 37139470;
+    name = "Cathal Mullan";
+  };
+  catouc = {
+    email = "catouc@philipp.boeschen.me";
+    github = "catouc";
+    githubId = 25623213;
+    name = "Philipp Böschen";
+  };
+  caugner = {
+    email = "nixos@caugner.de";
+    github = "caugner";
+    githubId = 495429;
+    name = "Claas Augner";
+  };
+  cawilliamson = {
+    email = "home@chrisaw.com";
+    github = "cawilliamson";
+    githubId = 1141769;
+    matrix = "@cawilliamson:nixos.dev";
+    name = "Christopher A. Williamson";
+  };
+  cbleslie = {
+    email = "cameronleslie@gmail.com";
+    github = "cbleslie";
+    githubId = 500963;
+    name = "C.B.Leslie";
+  };
+  cbley = {
+    email = "claudio.bley@gmail.com";
+    github = "avdv";
+    githubId = 3471749;
+    name = "Claudio Bley";
+  };
+  cbourjau = {
+    email = "christianb@posteo.de";
+    github = "cbourjau";
+    githubId = 3288058;
+    name = "Christian Bourjau";
+  };
+  cbrewster = {
+    email = "cbrewster@hey.com";
+    github = "cbrewster";
+    githubId = 9086315;
+    name = "Connor Brewster";
+  };
+  cburstedde = {
+    email = "burstedde@ins.uni-bonn.de";
+    github = "cburstedde";
+    githubId = 109908;
+    name = "Carsten Burstedde";
+    keys = [{
+      fingerprint = "1127 A432 6524 BF02 737B  544E 0704 CD9E 550A 6BCD";
+    }];
+  };
+  ccellado = {
+    email = "annplague@gmail.com";
+    github = "ccellado";
+    githubId = 44584960;
+    name = "Denis Khalmatov";
+  };
+  cdepillabout = {
+    email = "cdep.illabout@gmail.com";
+    matrix = "@cdepillabout:matrix.org";
+    github = "cdepillabout";
+    githubId = 64804;
+    name = "Dennis Gosnell";
+  };
+  cdmistman = {
+    name = "Colton Donnelly";
+    email = "colton@donn.io";
+    matrix = "@donnellycolton:matrix.org";
+    github = "cdmistman";
+    githubId = 23486351;
+  };
+  cdombroski = {
+    name = "Chris Dombroski";
+    email = "cdombroski@gmail.com";
+    matrix = "@cdombroski:kow.is";
+    github = "cdombroski";
+    githubId = 244909;
+  };
+  ceedubs = {
+    email = "ceedubs@gmail.com";
+    github = "ceedubs";
+    githubId = 977929;
+    name = "Cody Allen";
+  };
+  centromere = {
+    email = "nix@centromere.net";
+    github = "centromere";
+    githubId = 543423;
+    name = "Alex Wied";
+  };
+  cfhammill = {
+    email = "cfhammill@gmail.com";
+    github = "cfhammill";
+    githubId = 7467038;
+    name = "Chris Hammill";
+  };
+  cfouche = {
+    email = "chaddai.fouche@gmail.com";
+    github = "Chaddai";
+    githubId = 5771456;
+    name = "Chaddaï Fouché";
+  };
+  cfsmp3 = {
+    email = "carlos@sanz.dev";
+    github = "cfsmp3";
+    githubId = 5949913;
+    name = "Carlos Fernandez Sanz";
+  };
+  cge = {
+    email = "cevans@evanslabs.org";
+    github = "cgevans";
+    githubId = 2054509;
+    name = "Constantine Evans";
+    keys = [
+      {
+        fingerprint = "32B1 6EE7 DBA5 16DE 526E  4C5A B67D B1D2 0A93 A9F9";
+      }
+      {
+        fingerprint = "669C 1D24 5A87 DB34 6BE4  3216 1A1D 58B8 6AE2 AABD";
+      }
+    ];
+  };
+  Ch1keen = {
+    email = "gihoong7@gmail.com";
+    github = "Ch1keen";
+    githubId = 40013212;
+    name = "Han Jeongjun";
+  };
+  chaduffy = {
+    email = "charles@dyfis.net";
+    github = "charles-dyfis-net";
+    githubId = 22370;
+    name = "Charles Duffy";
+  };
+  changlinli = {
+    email = "mail@changlinli.com";
+    github = "changlinli";
+    githubId = 1762540;
+    name = "Changlin Li";
+  };
+  chanley = {
+    email = "charlieshanley@gmail.com";
+    github = "charlieshanley";
+    githubId = 8228888;
+    name = "Charlie Hanley";
+  };
+  chaoflow = {
+    email = "flo@chaoflow.net";
+    github = "chaoflow";
+    githubId = 89596;
+    name = "Florian Friesdorf";
+  };
+  ChaosAttractor = {
+    email = "lostattractor@gmail.com";
+    github = "LostAttractor";
+    githubId = 46527539;
+    name = "ChaosAttractor";
+    keys = [{
+      fingerprint = "A137 4415 DB7C 6439 10EA  5BF1 0FEE 4E47 5940 E125";
+    }];
+  };
+  charlesbaynham = {
+    email = "charlesbaynham@gmail.com";
+    github = "charlesbaynham";
+    githubId = 4397637;
+    name = "Charles Baynham";
+  };
+  CharlesHD = {
+    email = "charleshdespointes@gmail.com";
+    github = "CharlesHD";
+    githubId = 6608071;
+    name = "Charles Huyghues-Despointes";
+  };
+  chayleaf = {
+    email = "chayleaf-nix@pavluk.org";
+    github = "chayleaf";
+    githubId = 9590981;
+    keys = [{
+      fingerprint = "4314 3701 154D 9E5F 7051  7ECF 7817 1AD4 6227 E68E";
+    }];
+    matrix = "@chayleaf:matrix.pavluk.org";
+    name = "Anna Pavlyuk";
+  };
+  chekoopa = {
+    email = "chekoopa@mail.ru";
+    github = "chekoopa";
+    githubId = 1689801;
+    name = "Mikhail Chekan";
+  };
+  chen = {
+    email = "i@cuichen.cc";
+    github = "cu1ch3n";
+    githubId = 80438676;
+    name = "Chen Cui";
+  };
+  ChengCat = {
+    email = "yu@cheng.cat";
+    github = "ChengCat";
+    githubId = 33503784;
+    name = "Yucheng Zhang";
+  };
+  cheriimoya = {
+    email = "github@hausch.xyz";
+    github = "cheriimoya";
+    githubId = 28303440;
+    name = "Max Hausch";
+  };
+  chessai = {
+    email = "chessai1996@gmail.com";
+    github = "chessai";
+    githubId = 18648043;
+    name = "Daniel Cartwright";
+  };
+  chewblacka = {
+    github = "chewblacka";
+    githubId = 18430320;
+    name = "John Garcia";
+  };
+  Chili-Man = {
+    email = "dr.elhombrechile@gmail.com";
+    name = "Diego Rodriguez";
+    github = "Chili-Man";
+    githubId = 631802;
+    keys = [{
+      fingerprint = "099E 3F97 FA08 3D47 8C75  EBEC E0EB AD78 F019 0BD9";
+    }];
+  };
+  chiroptical = {
+    email = "chiroptical@gmail.com";
+    github = "chiroptical";
+    githubId = 3086255;
+    name = "Barry Moore II";
+  };
+  chisui = {
+    email = "chisui.pd@gmail.com";
+    github = "chisui";
+    githubId = 4526429;
+    name = "Philipp Dargel";
+  };
+  chito = {
+    email = "iamchito@protonmail.com";
+    github = "chitochi";
+    githubId = 153365419;
+    matrix = "@chito:nichijou.dev";
+    name = "Chito";
+  };
+  chivay = {
+    email = "hubert.jasudowicz@gmail.com";
+    github = "chivay";
+    githubId = 14790226;
+    name = "Hubert Jasudowicz";
+  };
+  c-h-johnson = {
+    name = "Charles Johnson";
+    email = "charles@charlesjohnson.name";
+    github = "c-h-johnson";
+    githubId = 138403247;
+  };
+  chkno = {
+    email = "scottworley@scottworley.com";
+    github = "chkno";
+    githubId = 1118859;
+    name = "Scott Worley";
+  };
+  choochootrain = {
+    email = "hurshal@imap.cc";
+    github = "choochootrain";
+    githubId = 803961;
+    name = "Hurshal Patel";
+  };
+  chpatrick = {
+    email = "chpatrick@gmail.com";
+    github = "chpatrick";
+    githubId = 832719;
+    name = "Patrick Chilton";
+  };
+  chreekat = {
+    email = "b@chreekat.net";
+    github = "chreekat";
+    githubId = 538538;
+    name = "Bryan Richter";
+  };
+  chrisjefferson = {
+    email = "chris@bubblescope.net";
+    github = "ChrisJefferson";
+    githubId = 811527;
+    name = "Christopher Jefferson";
+  };
+  chris-martin = {
+    email = "ch.martin@gmail.com";
+    github = "chris-martin";
+    githubId = 399718;
+    name = "Chris Martin";
+  };
+  chrispattison = {
+    email = "chpattison@gmail.com";
+    github = "ChrisPattison";
+    githubId = 641627;
+    name = "Chris Pattison";
+  };
+  chrispickard = {
+    email = "chrispickard9@gmail.com";
+    github = "chrispickard";
+    githubId = 1438690;
+    name = "Chris Pickard";
+  };
+  chrisrosset = {
+    email = "chris@rosset.org.uk";
+    github = "chrisrosset";
+    githubId = 1103294;
+    name = "Christopher Rosset";
+  };
+  christophcharles = {
+    github = "christophcharles";
+    githubId = 23055925;
+    name = "Christoph Charles";
+  };
+  christopherpoole = {
+    email = "mail@christopherpoole.net";
+    github = "christopherpoole";
+    githubId = 2245737;
+    name = "Christopher Mark Poole";
+  };
+  christoph-heiss = {
+    email = "christoph@c8h4.io";
+    github = "christoph-heiss";
+    githubId = 7571069;
+    name = "Christoph Heiss";
+    keys = [{
+      fingerprint = "9C56 1D64 30B2 8D6B DCBC 9CEB 73D5 E7FD EE3D E49A";
+    }];
+  };
+  chrpinedo = {
+    github = "chrpinedo";
+    githubId = 2324630;
+    name = "Christian Pinedo";
+  };
+  chuahou = {
+    email = "human+github@chuahou.dev";
+    github = "chuahou";
+    githubId = 12386805;
+    name = "Chua Hou";
+  };
+  chuangzhu = {
+    name = "Chuang Zhu";
+    email = "nixos@chuang.cz";
+    github = "chuangzhu";
+    githubId = 31200881;
+    keys = [{
+      fingerprint = "5D03 A5E6 0754 A3E3 CA57 5037 E838 CED8 1CFF D3F9";
+    }];
+  };
+  chvp = {
+    email = "nixpkgs@cvpetegem.be";
+    matrix = "@charlotte:vanpetegem.me";
+    github = "chvp";
+    githubId = 42220376;
+    name = "Charlotte Van Petegem";
+  };
+  ciferkey = {
+    name = "Matthew Brunelle";
+    email = "ciferkey@gmail.com";
+    github = "ciferkey";
+    githubId = 101422;
+  };
+  cigrainger = {
+    name = "Christopher Grainger";
+    email = "chris@amplified.ai";
+    github = "cigrainger";
+    githubId = 3984794;
+  };
+  ciil = {
+    email = "simon@lackerbauer.com";
+    github = "ciil";
+    githubId = 3956062;
+    name = "Simon Lackerbauer";
+  };
+  cimm = {
+    email = "8k9ft8m5gv@astil.be";
+    github = "cimm";
+    githubId = 68112;
+    name = "Simon";
+  };
+  cirno-999 = {
+    email = "reverene@protonmail.com";
+    github = "cirno-999";
+    githubId = 73712874;
+    name = "cirno-999";
+  };
+  citadelcore = {
+    email = "alex@arctarus.co.uk";
+    github = "VertexA115";
+    githubId = 5567402;
+    name = "Alex Zero";
+    keys = [{
+      fingerprint = "A0AA 4646 B8F6 9D45 4553  5A88 A515 50ED B450 302C";
+    }];
+  };
+  cizra = {
+    email = "todurov+nix@gmail.com";
+    github = "cizra";
+    githubId = 2131991;
+    name = "Elmo Todurov";
+  };
+  cjab = {
+    email = "chad+nixpkgs@jablonski.xyz";
+    github = "cjab";
+    githubId = 136485;
+    name = "Chad Jablonski";
+  };
+  ck3d = {
+    email = "ck3d@gmx.de";
+    github = "ck3d";
+    githubId = 25088352;
+    name = "Christian Kögler";
+  };
+  ckauhaus = {
+    email = "kc@flyingcircus.io";
+    github = "ckauhaus";
+    githubId = 1448923;
+    name = "Christian Kauhaus";
+  };
+  ckie = {
+    email = "nixpkgs-0efe364@ckie.dev";
+    github = "ckiee";
+    githubId = 25263210;
+    keys = [{
+      fingerprint = "539F 0655 4D35 38A5 429A  E253 13E7 9449 C052 5215";
+    }];
+    name = "ckie";
+    matrix = "@ckie:ckie.dev";
+  };
+  cko = {
+    email = "christine.koppelt@gmail.com";
+    github = "cko";
+    githubId = 68239;
+    name = "Christine Koppelt";
+  };
+  clacke = {
+    email = "claes.wallin@greatsinodevelopment.com";
+    github = "clacke";
+    githubId = 199180;
+    name = "Claes Wallin";
+  };
+  cleeyv = {
+    email = "cleeyv@riseup.net";
+    github = "cleeyv";
+    githubId = 71959829;
+    name = "Cleeyv";
+  };
+  clerie = {
+    email = "nix@clerie.de";
+    github = "clerie";
+    githubId = 9381848;
+    name = "clerie";
+  };
+  cleverca22 = {
+    email = "cleverca22@gmail.com";
+    matrix = "@cleverca22:matrix.org";
+    github = "cleverca22";
+    githubId = 848609;
+    name = "Michael Bishop";
+  };
+  clkamp = {
+    email = "c@lkamp.de";
+    github = "clkamp";
+    githubId = 46303707;
+    name = "Christian Lütke-Stetzkamp";
+  };
+  clr-cera = {
+    email = "clrcera05@gmail.com";
+    github = "clr-cera";
+    githubId = 93736542;
+    name = "Clr";
+  };
+  cmacrae = {
+    email = "hi@cmacr.ae";
+    github = "cmacrae";
+    githubId = 3392199;
+    name = "Calum MacRae";
+  };
+  cmars = {
+    email = "nix@cmars.tech";
+    github = "cmars";
+    githubId = 23741;
+    name = "Casey Marshall";
+    keys = [{
+      fingerprint = "6B78 7E5F B493 FA4F D009  5D10 6DEC 2758 ACD5 A973";
+    }];
+  };
+  cmcdragonkai = {
+    email = "roger.qiu@matrix.ai";
+    github = "CMCDragonkai";
+    githubId = 640797;
+    name = "Roger Qiu";
+  };
+  cmfwyp = {
+    email = "cmfwyp@riseup.net";
+    github = "cmfwyp";
+    githubId = 20808761;
+    name = "cmfwyp";
+  };
+  cmm = {
+    email = "repo@cmm.kakpryg.net";
+    github = "cmm";
+    githubId = 718298;
+    name = "Michael Livshin";
+  };
+  CobaltCause = {
+    name = "Charles Hall";
+    email = "charles@computer.surgery";
+    github = "CobaltCause";
+    githubId = 7003738;
+    matrix = "@charles:computer.surgery";
+  };
+  cobbal = {
+    email = "andrew.cobb@gmail.com";
+    github = "cobbal";
+    githubId = 180339;
+    name = "Andrew Cobb";
+  };
+  coconnor = {
+    email = "coreyoconnor@gmail.com";
+    github = "coreyoconnor";
+    githubId = 34317;
+    name = "Corey O'Connor";
+  };
+  code-asher = {
+    email = "ash@coder.com";
+    github = "code-asher";
+    githubId = 45609798;
+    name = "Asher";
+    keys = [{
+      fingerprint = "6E3A FA6D 915C C2A4 D26F  C53E 7BB4 BA9C 783D 2BBC";
+    }];
+  };
+  codec = {
+    email = "codec@fnord.cx";
+    github = "codec";
+    githubId = 118829;
+    name = "codec";
+  };
+  CodeLongAndProsper90 = {
+    github = "CodeLongAndProsper90";
+    githubId = 50145141;
+    email = "jupiter@m.rdis.dev";
+    name = "Scott Little";
+  };
+  codifryed = {
+    email = "gb@guyboldon.com";
+    name = "Guy Boldon";
+    github = "codifryed";
+    githubId = 27779510;
+    keys = [{
+      fingerprint = "FDF5 EF67 8CC1 FE22 1845  6A22 CF7B BB5B C756 1BD3";
+    }];
+  };
+  codsl = {
+    email = "codsl@riseup.net";
+    github = "codsl";
+    githubId = 6402559;
+    name = "codsl";
+  };
+  codyopel = {
+    email = "codyopel@gmail.com";
+    github = "codyopel";
+    githubId = 5561189;
+    name = "Cody Opel";
+  };
+  coffeeispower = {
+    email = "tiagodinis33@proton.me";
+    github = "coffee-is-power";
+    name = "Tiago Dinis";
+    githubId = 92828847;
+  };
+  cofob = {
+    name = "Egor Ternovoy";
+    email = "cofob@riseup.net";
+    matrix = "@cofob:matrix.org";
+    github = "cofob";
+    githubId = 49928332;
+    keys = [{
+      fingerprint = "5F3D 9D3D ECE0 8651 DE14  D29F ACAD 4265 E193 794D";
+    }];
+  };
+  Cogitri = {
+    email = "oss@cogitri.dev";
+    github = "Cogitri";
+    githubId = 8766773;
+    matrix = "@cogitri:cogitri.dev";
+    name = "Rasmus Thomsen";
+  };
+  cohei = {
+    email = "a.d.xvii.kal.mai@gmail.com";
+    github = "cohei";
+    githubId = 3477497;
+    name = "TANIGUCHI Kohei";
+  };
+  cohencyril = {
+    email = "cyril.cohen@inria.fr";
+    github = "CohenCyril";
+    githubId = 298705;
+    name = "Cyril Cohen";
+  };
+  colamaroro = {
+    name = "Corentin Rondier";
+    email = "github@rondier.io";
+    github = "colamaroro";
+    githubId = 12484955;
+    matrix = "@colamaroro:lovelyrad.io";
+  };
+  cole-h = {
+    name = "Cole Helbling";
+    email = "cole.e.helbling@outlook.com";
+    matrix = "@cole-h:matrix.org";
+    github = "cole-h";
+    githubId = 28582702;
+    keys = [{
+      fingerprint = "68B8 0D57 B2E5 4AC3 EC1F  49B0 B37E 0F23 7101 6A4C";
+    }];
+  };
+  colemickens = {
+    email = "cole.mickens@gmail.com";
+    matrix = "@colemickens:matrix.org";
+    github = "colemickens";
+    githubId = 327028;
+    name = "Cole Mickens";
+  };
+  colescott = {
+    email = "colescottsf@gmail.com";
+    github = "colescott";
+    githubId = 5684605;
+    name = "Cole Scott";
+  };
+  colinsane = {
+    name = "Colin Sane";
+    email = "colin@uninsane.org";
+    matrix = "@colin:uninsane.org";
+    github = "uninsane";
+    githubId = 106709944;
+  };
+  collares = {
+    email = "mauricio@collares.org";
+    github = "collares";
+    githubId = 244239;
+    name = "Mauricio Collares";
+  };
+  coloquinte = {
+    email = "gabriel.gouvine_nix@m4x.org";
+    github = "coloquinte";
+    githubId = 4102525;
+    name = "Gabriel Gouvine";
+  };
+  commandodev = {
+    email = "ben@perurbis.com";
+    github = "commandodev";
+    githubId = 87764;
+    name = "Ben Ford";
+  };
+  CompEng0001 = {
+    email = "sb1501@canterbury.ac.uk";
+    github = "CompEng0001";
+    githubId = 40290417;
+    name = "Seb Blair";
+  };
+  confus = {
+    email = "con-f-use@gmx.net";
+    github = "con-f-use";
+    githubId = 11145016;
+    name = "J.C.";
+  };
+  congee = {
+    email = "changshengwu@pm.me";
+    matrix = "@congeec:matrix.org";
+    github = "Congee";
+    name = "Changsheng Wu";
+    githubId = 2083950;
+  };
+  conni2461 = {
+    email = "simon.hauser@outlook.com";
+    github = "Conni2461";
+    name = "Simon Hauser";
+    githubId = 15233006;
+  };
+  connorbaker = {
+    email = "connor.baker@tweag.io";
+    matrix = "@connorbaker:matrix.org";
+    github = "connorbaker";
+    name = "Connor Baker";
+    githubId = 3880346;
+  };
+  conradmearns = {
+    email = "conradmearns+github@pm.me";
+    github = "ConradMearns";
+    githubId = 5510514;
+    name = "Conrad Mearns";
+  };
+  considerate = {
+    email = "viktor.kronvall@gmail.com";
+    github = "considerate";
+    githubId = 217918;
+    name = "Viktor Kronvall";
+  };
+  contrun = {
+    email = "uuuuuu@protonmail.com";
+    github = "contrun";
+    githubId = 32609395;
+    name = "B YI";
+  };
+  copumpkin = {
+    email = "pumpkingod@gmail.com";
+    github = "copumpkin";
+    githubId = 2623;
+    name = "Dan Peebles";
+  };
+  corbanr = {
+    email = "corban@raunco.co";
+    github = "CorbanR";
+    githubId = 1918683;
+    matrix = "@corbansolo:matrix.org";
+    name = "Corban Raun";
+    keys = [
+      {
+        fingerprint = "6607 0B24 8CE5 64ED 22CE  0950 A697 A56F 1F15 1189";
+      }
+      {
+        fingerprint = "D8CB 816A B678 A4E6 1EC7  5325 230F 4AC1 53F9 0F29";
+      }
+    ];
+  };
+  corngood = {
+    email = "corngood@gmail.com";
+    github = "corngood";
+    githubId = 3077118;
+    name = "David McFarland";
+  };
+  coroa = {
+    email = "jonas@chaoflow.net";
+    github = "coroa";
+    githubId = 2552981;
+    name = "Jonas Hörsch";
+  };
+  costrouc = {
+    email = "chris.ostrouchov@gmail.com";
+    github = "costrouc";
+    githubId = 1740337;
+    name = "Chris Ostrouchov";
+  };
+  cottand = {
+    email = "nico@dcotta.eu";
+    github = "cottand";
+    githubId = 45274424;
+    name = "Nico D'Cotta";
+  };
+  couchemar = {
+    email = "couchemar@yandex.ru";
+    github = "couchemar";
+    githubId = 1573344;
+    name = "Andrey Pavlov";
+  };
+  cpages = {
+    email = "page@ruiec.cat";
+    github = "cpages";
+    githubId = 411324;
+    name = "Carles Pagès";
+  };
+  cpcloud = {
+    name = "Phillip Cloud";
+    github = "cpcloud";
+    githubId = 417981;
+  };
+  cpu = {
+    email = "daniel@binaryparadox.net";
+    github = "cpu";
+    githubId = 292650;
+    name = "Daniel McCarney";
+    keys = [{
+      fingerprint = "8026 D24A A966 BF9C D3CD  CB3C 08FB 2BFC 470E 75B4";
+    }];
+  };
+  Crafter = {
+    email = "crafter@crafter.rocks";
+    github = "Craftzman7";
+    githubId = 70068692;
+    name = "Crafter";
+  };
+  craigem = {
+    email = "craige@mcwhirter.io";
+    github = "craigem";
+    githubId = 6470493;
+    name = "Craige McWhirter";
+  };
+  cransom = {
+    email = "cransom@hubns.net";
+    github = "cransom";
+    githubId = 1957293;
+    name = "Casey Ransom";
+  };
+  CrazedProgrammer = {
+    email = "crazedprogrammer@gmail.com";
+    github = "CrazedProgrammer";
+    githubId = 12202789;
+    name = "CrazedProgrammer";
+  };
+  creator54 = {
+    email = "hi.creator54@gmail.com";
+    github = "Creator54";
+    githubId = 34543609;
+    name = "creator54";
+  };
+  crinklywrappr = {
+    email = "crinklywrappr@pm.me";
+    name = "Daniel Fitzpatrick";
+    github = "crinklywrappr";
+    githubId = 56522;
+  };
+  cript0nauta = {
+    email = "shareman1204@gmail.com";
+    github = "cript0nauta";
+    githubId = 1222362;
+    name = "Matías Lang";
+  };
+  criyle = {
+    email = "i+nixos@goj.ac";
+    name = "Yang Gao";
+    githubId = 6821729;
+    github = "criyle";
+  };
+  croissong = {
+    email = "jan.moeller0@pm.me";
+    name = "Jan Möller";
+    github = "Croissong";
+    githubId = 4162215;
+    keys = [{
+      fingerprint = "CE97 9DEE 904C 26AA 3716  78C2 96A4 38F9 EE72 572F";
+    }];
+  };
+  crschnick = {
+    email = "crschnick@xpipe.io";
+    name = "Christopher Schnick";
+    github = "crschnick";
+    githubId = 72509152;
+  };
+  CRTified = {
+    email = "carl.schneider+nixos@rub.de";
+    matrix = "@schnecfk:ruhr-uni-bochum.de";
+    github = "CRTified";
+    githubId = 2440581;
+    name = "Carl Richard Theodor Schneider";
+    keys = [{
+      fingerprint = "2017 E152 BB81 5C16 955C  E612 45BC C1E2 709B 1788";
+    }];
+  };
+  Cryolitia = {
+    name = "Beiyan Cryolitia";
+    email = "Cryolitia@gmail.com";
+    github = "Cryolitia";
+    githubId = 23723294;
+    keys = [{
+      fingerprint = "1C3C 6547 538D 7152 310C 0EEA 84DD 0C01 30A5 4DF7";
+    }];
+  };
+  cryptix = {
+    email = "cryptix@riseup.net";
+    github = "cryptix";
+    githubId = 111202;
+    name = "Henry Bubert";
+  };
+  CrystalGamma = {
+    email = "nixos@crystalgamma.de";
+    github = "CrystalGamma";
+    githubId = 6297001;
+    name = "Jona Stubbe";
+  };
+  csingley = {
+    email = "csingley@gmail.com";
+    github = "csingley";
+    githubId = 398996;
+    name = "Christopher Singley";
+  };
+  cswank = {
+    email = "craigswank@gmail.com";
+    github = "cswank";
+    githubId = 490965;
+    name = "Craig Swank";
+  };
+  ctron = {
+    email = "ctron@dentrassi.de";
+    github = "ctron";
+    githubId = 202474;
+    name = "Jens Reimann";
+  };
+  cust0dian = {
+    email = "serg@effectful.software";
+    github = "cust0dian";
+    githubId = 119854490;
+    name = "Serg Nesterov";
+    keys = [{
+      fingerprint = "6E7D BA30 DB5D BA60 693C  3BE3 1512 F6EB 84AE CC8C";
+    }];
+  };
+  cwoac = {
+    email = "oliver@codersoffortune.net";
+    github = "cwoac";
+    githubId = 1382175;
+    name = "Oliver Matthews";
+  };
+  cwyc = {
+    email = "hello@cwyc.page";
+    github = "cwyc";
+    githubId = 16950437;
+    name = "cwyc";
+  };
+  cynerd = {
+    name = "Karel Kočí";
+    email = "cynerd@email.cz";
+    github = "Cynerd";
+    githubId = 3811900;
+    keys = [{
+      fingerprint = "2B1F 70F9 5F1B 48DA 2265 A7FA A6BC 8B8C EB31 659B";
+    }];
+  };
+  cyntheticfox = {
+    email = "cyntheticfox@gh0st.sh";
+    github = "cyntheticfox";
+    githubId = 17628961;
+    keys = [{
+      fingerprint = "73C1 C5DF 51E7 BB92 85E9  A262 5960 278C E235 F821";
+    }];
+    matrix = "@houstdav000:gh0st.ems.host";
+    name = "Cynthia Fox";
+  };
+  cyounkins = {
+    name = "Craig Younkins";
+    email = "cyounkins@gmail.com";
+    github = "cyounkins";
+    githubId = 346185;
+  };
+  cypherpunk2140 = {
+    email = "stefan.mihaila@pm.me";
+    github = "stefan-mihaila";
+    githubId = 2217136;
+    name = "Ștefan D. Mihăilă";
+    keys = [
+      {
+        fingerprint = "CBC9 C7CC 51F0 4A61 3901 C723 6E68 A39B F16A 3ECB";
+      }
+      {
+        fingerprint = "7EAB 1447 5BBA 7DDE 7092 7276 6220 AD78 4622 0A52";
+      }
+    ];
+  };
+  cyplo = {
+    email = "nixos@cyplo.dev";
+    matrix = "@cyplo:cyplo.dev";
+    github = "cyplo";
+    githubId = 217899;
+    name = "Cyryl Płotnicki";
+  };
+  d3vil0p3r = {
+    name = "Antonio Voza";
+    email = "vozaanthony@gmail.com";
+    github = "D3vil0p3r";
+    githubId = 83867734;
+  };
+  d4ilyrun = {
+    name = "Léo Duboin";
+    email = "leo@duboin.com";
+    github = "d4ilyrun";
+    githubId = 34611103;
+  };
+  dadada = {
+    name = "dadada";
+    email = "dadada@dadada.li";
+    github = "dadada";
+    githubId = 7216772;
+    keys = [{
+      fingerprint = "D68C 8469 5C08 7E0F 733A  28D0 EEB8 D1CE 62C4 DFEA";
+    }];
+  };
+  dalance = {
+    email = "dalance@gmail.com";
+    github = "dalance";
+    githubId = 4331004;
+    name = "Naoya Hatta";
+  };
+  dalpd = {
+    email = "denizalpd@ogr.iu.edu.tr";
+    github = "dalpd";
+    githubId = 16895361;
+    name = "Deniz Alp Durmaz";
+  };
+  DAlperin = {
+    email = "git@dov.dev";
+    github = "DAlperin";
+    githubId = 16063713;
+    name = "Dov Alperin";
+    keys = [{
+      fingerprint = "4EED 5096 B925 86FA 1101  6673 7F2C 07B9 1B52 BB61";
+    }];
+  };
+  DamienCassou = {
+    email = "damien@cassou.me";
+    github = "DamienCassou";
+    githubId = 217543;
+    name = "Damien Cassou";
+  };
+  dan4ik605743 = {
+    email = "6057430gu@gmail.com";
+    github = "dan4ik605743";
+    githubId = 86075850;
+    name = "Danil Danevich";
+  };
+  danbst = {
+    email = "abcz2.uprola@gmail.com";
+    github = "danbst";
+    githubId = 743057;
+    name = "Danylo Hlynskyi";
+  };
+  danc86 = {
+    name = "Dan Callaghan";
+    email = "djc@djc.id.au";
+    github = "danc86";
+    githubId = 398575;
+    keys = [{
+      fingerprint = "1C56 01F1 D70A B56F EABB  6BC0 26B5 AA2F DAF2 F30A";
+    }];
+  };
+  dancek = {
+    email = "hannu.hartikainen@gmail.com";
+    github = "dancek";
+    githubId = 245394;
+    name = "Hannu Hartikainen";
+  };
+  dandellion = {
+    email = "daniel@dodsorf.as";
+    matrix = "@dandellion:dodsorf.as";
+    github = "dali99";
+    githubId = 990767;
+    name = "Daniel Olsen";
+  };
+  danderson = {
+    email = "dave@natulte.net";
+    github = "danderson";
+    githubId = 1918;
+    name = "David Anderson";
+  };
+  daneads = {
+    email = "me@daneads.com";
+    github = "daneads";
+    githubId = 24708079;
+    name = "Dan Eads";
+  };
+  danielbarter = {
+    email = "danielbarter@gmail.com";
+    github = "danielbarter";
+    githubId = 8081722;
+    name = "Daniel Barter";
+  };
+  danieldk = {
+    email = "me@danieldk.eu";
+    github = "danieldk";
+    githubId = 49398;
+    name = "Daniël de Kok";
+  };
+  danielfullmer = {
+    email = "danielrf12@gmail.com";
+    github = "danielfullmer";
+    githubId = 1298344;
+    name = "Daniel Fullmer";
+  };
+  danielrolls = {
+    email = "daniel.rolls.27@googlemail.com";
+    github = "danielrolls";
+    githubId = 50051176;
+    name = "Daniel Rolls";
+  };
+  danielsidhion = {
+    email = "nixpkgs@sidhion.com";
+    github = "DanielSidhion";
+    githubId = 160084;
+    name = "Daniel Sidhion";
+  };
+  daniyalsuri6 = {
+    email = "daniyal.suri@gmail.com";
+    github = "daniyalsuri6";
+    githubId = 107034852;
+    name = "Daniyal Suri";
+  };
+  dannixon = {
+    email = "dan@dan-nixon.com";
+    github = "DanNixon";
+    githubId = 4037377;
+    name = "Dan Nixon";
+    matrix = "@dannixon:matrix.org";
+  };
+  dansbandit = {
+    github = "dansbandit";
+    githubId = 4530687;
+    name = "dansbandit";
+  };
+  danth = {
+    name = "Daniel Thwaites";
+    email = "danthwaites30@btinternet.com";
+    matrix = "@danth:danth.me";
+    github = "danth";
+    githubId = 28959268;
+    keys = [{
+      fingerprint = "4779 D1D5 3C97 2EAE 34A5  ED3D D8AF C4BF 0567 0F9D";
+    }];
+  };
+  dariof4 = {
+    name = "dariof4";
+    email = "dazedtank@gmail.com";
+    github = "dariof4";
+    githubId = 9992814;
+  };
+  darkonion0 = {
+    name = "Alexandre Peruggia";
+    email = "darkgenius1@protonmail.com";
+    matrix = "@alexoo:matrix.org";
+    github = "DarkOnion0";
+    githubId = 68606322;
+  };
+  das-g = {
+    email = "nixpkgs@raphael.dasgupta.ch";
+    github = "das-g";
+    githubId = 97746;
+    name = "Raphael Das Gupta";
+  };
+  dasisdormax = {
+    email = "dasisdormax@mailbox.org";
+    github = "dasisdormax";
+    githubId = 3714905;
+    keys = [{
+      fingerprint = "E59B A198 61B0 A9ED C1FA  3FB2 02BA 0D44 80CA 6C44";
+    }];
+    name = "Maximilian Wende";
+  };
+  das_j = {
+    email = "janne@hess.ooo";
+    matrix = "@janne.hess:helsinki-systems.de";
+    github = "dasJ";
+    githubId = 4971975;
+    name = "Janne Heß";
+  };
+  dasj19 = {
+    email = "daniel@serbanescu.dk";
+    github = "dasj19";
+    githubId = 7589338;
+    name = "Daniel Șerbănescu";
+  };
+  datafoo = {
+    github = "datafoo";
+    githubId = 34766150;
+    name = "datafoo";
+  };
+  DataHearth = {
+    email = "dev@antoine-langlois.net";
+    github = "DataHearth";
+    githubId = 28595242;
+    name = "DataHearth";
+    keys = [{
+      fingerprint = "A129 2547 0298 BFEE 7EE0  92B3 946E 2D0C 410C 7B3D";
+    }];
+  };
+  davegallant = {
+    name = "Dave Gallant";
+    email = "davegallant@gmail.com";
+    github = "davegallant";
+    githubId = 4519234;
+  };
+  davhau = {
+    email = "d.hauer.it@gmail.com";
+    name = "David Hauer";
+    github = "DavHau";
+    githubId = 42246742;
+  };
+  david50407 = {
+    email = "me@davy.tw";
+    github = "david50407";
+    githubId = 841969;
+    name = "David Kuo";
+  };
+  davidak = {
+    email = "post@davidak.de";
+    matrix = "@davidak:matrix.org";
+    github = "davidak";
+    githubId = 91113;
+    name = "David Kleuker";
+  };
+  davidarmstronglewis = {
+    email = "davidlewis@mac.com";
+    github = "oceanlewis";
+    githubId = 6754950;
+    name = "Ocean Armstrong Lewis";
+  };
+  davidcromp = {
+    email = "davidcrompton1192@gmail.com";
+    github = "CyborgPotato";
+    githubId = 10701143;
+    name = "David Crompton";
+  };
+  david-hamelin = {
+    email = "david.hamelin@outlook.fr";
+    github = "HamelinDavid";
+    githubId = 118536343;
+    name = "David Hamelin";
+  };
+  david-r-cox = {
+    email = "david@integrated-reasoning.com";
+    github = "david-r-cox";
+    githubId = 4259949;
+    name = "David Cox";
+    keys = [{
+      fingerprint = "0056 A3F6 9918 1E0D 8FF0  BCDE 65BB 07FA A4D9 4634";
+    }];
+  };
+  davidrusu = {
+    email = "davidrusu.me@gmail.com";
+    github = "davidrusu";
+    githubId = 1832378;
+    name = "David Rusu";
+  };
+  david-sawatzke = {
+    email = "d-nix@sawatzke.dev";
+    github = "david-sawatzke";
+    githubId = 11035569;
+    name = "David Sawatzke";
+  };
+  davidtwco = {
+    email = "david@davidtw.co";
+    github = "davidtwco";
+    githubId = 1295100;
+    name = "David Wood";
+    keys = [{
+      fingerprint = "5B08 313C 6853 E5BF FA91  A817 0176 0B4F 9F53 F154";
+    }];
+  };
+  davisrichard437 = {
+    email = "davisrichard437@gmail.com";
+    github = "davisrichard437";
+    githubId = 85075437;
+    name = "Richard Davis";
+  };
+  davorb = {
+    email = "davor@davor.se";
+    github = "davorb";
+    githubId = 798427;
+    name = "Davor Babic";
+  };
+  davsanchez = {
+    email = "davidslt+nixpkgs@pm.me";
+    github = "DavSanchez";
+    githubId = 11422515;
+    name = "David Sánchez";
+  };
+  dawidd6 = {
+    email = "dawidd0811@gmail.com";
+    github = "dawidd6";
+    githubId = 9713907;
+    name = "Dawid Dziurla";
+  };
+  dawidsowa = {
+    email = "dawid_sowa@posteo.net";
+    github = "dawidsowa";
+    githubId = 49904992;
+    name = "Dawid Sowa";
+  };
+  daylinmorgan = {
+    email = "daylinmorgan@gmail.com";
+    github = "daylinmorgan";
+    githubId = 47667941;
+    name = "Daylin Morgan";
+  };
+  dbalan = {
+    email = "nix@dbalan.in";
+    github = "dbalan";
+    githubId = 223910;
+    name = "Dhananjay Balan";
+  };
+  dbeckwith = {
+    email = "djbsnx@gmail.com";
+    github = "dbeckwith";
+    githubId = 1279939;
+    name = "Daniel Beckwith";
+  };
+  dbirks = {
+    email = "david@birks.dev";
+    github = "dbirks";
+    githubId = 7545665;
+    name = "David Birks";
+    keys = [{
+      fingerprint = "B26F 9AD8 DA20 3392 EF87  C61A BB99 9F83 D9A1 9A36";
+    }];
+  };
+  dblsaiko = {
+    email = "me@dblsaiko.net";
+    github = "2xsaiko";
+    githubId = 3987560;
+    name = "Marco Rebhan";
+  };
+  dbohdan = {
+    email = "dbohdan@dbohdan.com";
+    github = "dbohdan";
+    githubId = 3179832;
+    name = "D. Bohdan";
+  };
+  dbrgn = {
+    email = "nix@dbrgn.ch";
+    github = "dbrgn";
+    githubId = 105168;
+    name = "Danilo B.";
+    keys = [{
+      fingerprint = "20EE 002D 778A E197 EF7D  0D2C B993 FF98 A90C 9AB1";
+    }];
+  };
+  dbrock = {
+    email = "daniel@brockman.se";
+    github = "dbrock";
+    githubId = 14032;
+    name = "Daniel Brockman";
+  };
+  DCsunset = {
+    email = "DCsunset@protonmail.com";
+    github = "DCsunset";
+    githubId = 23468812;
+    name = "DCsunset";
+  };
+  ddelabru = {
+    email = "ddelabru@redhat.com";
+    github = "ddelabru";
+    githubId = 39909293;
+    name = "Dominic Delabruere";
+  };
+  dduan = {
+    email = "daniel@duan.ca";
+    github = "dduan";
+    githubId = 75067;
+    name = "Daniel Duan";
+  };
+  de11n = {
+    email = "nixpkgs-commits@deshaw.com";
+    github = "de11n";
+    githubId = 130508846;
+    name = "Elliot Cameron";
+  };
+  dearrude = {
+    name = "Ebrahim Nejati";
+    email = "dearrude@tfwno.gf";
+    github = "DearRude";
+    githubId = 30749142;
+    keys = [{
+      fingerprint = "4E35 F2E5 2132 D654 E815  A672 DB2C BC24 2868 6000";
+    }];
+  };
+  declan = {
+    name = "Declan Rixon";
+    email = "declan.fraser.rixon@gmail.com";
+    github = "DeclanRixon";
+    githubId = 57464835;
+  };
+  deejayem = {
+    email = "nixpkgs.bu5hq@simplelogin.com";
+    github = "deejayem";
+    githubId = 2564003;
+    name = "David Morgan";
+    keys = [{
+      fingerprint = "9B43 6B14 77A8 79C2 6CDB  6604 C171 2510 02C2 00F2";
+    }];
+  };
+  deemp = {
+    email = "deempleton@gmail.com";
+    github = "deemp";
+    githubId = 48378098;
+    name = "Danila Danko";
+  };
+  deepfire = {
+    email = "_deepfire@feelingofgreen.ru";
+    github = "deepfire";
+    githubId = 452652;
+    name = "Kosyrev Serge";
+  };
+  DeeUnderscore = {
+    email = "d.anzorge@gmail.com";
+    github = "DeeUnderscore";
+    githubId = 156239;
+    name = "D Anzorge";
+  };
+  defelo = {
+    name = "Defelo";
+    matrix = "@defelo:matrix.defelo.de";
+    github = "Defelo";
+    githubId = 41747605;
+    keys = [{
+      fingerprint = "6130 3BBA D7D1 BF74 EFA4  4E3B E7FE 2087 E438 0E64";
+    }];
+  };
+  deifactor = {
+    name = "Ash Zahlen";
+    email = "ext0l@riseup.net";
+    github = "deifactor";
+    githubId = 30192992;
+  };
+  deinferno = {
+    name = "deinferno";
+    github = "deinferno";
+    githubId = 14363193;
+  };
+  delan = {
+    name = "Delan Azabani";
+    email = "delan@azabani.com";
+    github = "delan";
+    githubId = 465303;
+  };
+  delehef = {
+    name = "Franklin Delehelle";
+    email = "nix@odena.eu";
+    github = "delehef";
+    githubId = 1153808;
+  };
+  deliciouslytyped = {
+    github = "deliciouslytyped";
+    githubId = 47436522;
+    name = "deliciouslytyped";
+  };
+  delroth = {
+    email = "delroth@gmail.com";
+    github = "delroth";
+    githubId = 202798;
+    name = "Pierre Bourdon";
+  };
+  delta = {
+    email = "d4delta@outlook.fr";
+    github = "D4Delta";
+    githubId = 12224254;
+    name = "Delta";
+  };
+  delta231 = {
+    email = "swstkbaranwal@gmail.com";
+    github = "Delta456";
+    githubId = 28479139;
+    name = "Swastik Baranwal";
+  };
+  deltadelta = {
+    email = "contact@libellules.eu";
+    name = "Dara Ly";
+    github = "tournemire";
+    githubId = 20159432;
+  };
+  deltaevo = {
+    email = "deltaduartedavid@gmail.com";
+    github = "DeltaEvo";
+    githubId = 8864716;
+    name = "Duarte David";
+  };
+  demin-dmitriy = {
+    email = "demindf@gmail.com";
+    github = "demin-dmitriy";
+    githubId = 5503422;
+    name = "Dmitriy Demin";
+  };
+  demine = {
+    email = "riches_tweaks0o@icloud.com";
+    github = "demine0";
+    githubId = 51992962;
+    name = "Nikita Demin";
+  };
+  demize = {
+    email = "johannes@kyriasis.com";
+    github = "kyrias";
+    githubId = 2285387;
+    name = "Johannes Löthberg";
+  };
+  demyanrogozhin = {
+    email = "demyan.rogozhin@gmail.com";
+    github = "demyanrogozhin";
+    githubId = 62989;
+    name = "Demyan Rogozhin";
+  };
+  derchris = {
+    email = "derchris@me.com";
+    github = "derchrisuk";
+    githubId = 706758;
+    name = "Christian Gerbrandt";
+  };
+  derdennisop = {
+    email = "dennish@wuitz.de";
+    github = "derdennisop";
+    githubId = 52411861;
+    name = "Dennis";
+  };
+  derekcollison = {
+    email = "derek@nats.io";
+    github = "derekcollison";
+    githubId = 90097;
+    name = "Derek Collison";
+  };
+  DerGuteMoritz = {
+    email = "moritz@twoticketsplease.de";
+    github = "DerGuteMoritz";
+    githubId = 19733;
+    name = "Moritz Heidkamp";
+  };
+  DerickEddington = {
+    email = "derick.eddington@pm.me";
+    github = "DerickEddington";
+    githubId = 4731128;
+    name = "Derick Eddington";
+  };
+  dermetfan = {
+    email = "serverkorken@gmail.com";
+    github = "dermetfan";
+    githubId = 4956158;
+    name = "Robin Stumm";
+  };
+  DerTim1 = {
+    email = "tim.digel@active-group.de";
+    github = "DerTim1";
+    githubId = 21953890;
+    name = "Tim Digel";
+  };
+  desiderius = {
+    email = "didier@devroye.name";
+    github = "desiderius";
+    githubId = 1311761;
+    name = "Didier J. Devroye";
+  };
+  desttinghim = {
+    email = "opensource@louispearson.work";
+    matrix = "@desttinghim:matrix.org";
+    github = "desttinghim";
+    githubId = 10042482;
+    name = "Louis Pearson";
+  };
+  detegr = {
+    name = "Antti Keränen";
+    email = "detegr@rbx.email";
+    github = "Detegr";
+    githubId = 724433;
+  };
+  Dettorer = {
+    name = "Paul Hervot";
+    email = "paul.hervot@dettorer.net";
+    matrix = "@dettorer:matrix.org";
+    github = "Dettorer";
+    githubId = 2761682;
+  };
+  developer-guy = {
+    name = "Batuhan Apaydın";
+    email = "developerguyn@gmail.com";
+    github = "developer-guy";
+    githubId = 16693043;
+  };
+  devhell = {
+    email = ''"^"@regexmail.net'';
+    github = "devhell";
+    githubId = 896182;
+    name = "devhell";
+  };
+  devins2518 = {
+    email = "drsingh2518@icloud.com";
+    github = "devins2518";
+    githubId = 17111639;
+    name = "Devin Singh";
+  };
+  devpikachu = {
+    email = "andrei.hava@proton.me";
+    matrix = "@andrei:matrix.detpikachu.dev";
+    github = "devpikachu";
+    githubId = 30475873;
+    name = "Andrei Hava";
+  };
+  devplayer0 = {
+    email = "dev@nul.ie";
+    github = "devplayer0";
+    githubId = 1427254;
+    name = "Jack O'Sullivan";
+  };
+  devusb = {
+    email = "mhelton@devusb.us";
+    github = "devusb";
+    githubId = 4951663;
+    name = "Morgan Helton";
+  };
+  dezgeg = {
+    email = "tuomas.tynkkynen@iki.fi";
+    github = "dezgeg";
+    githubId = 579369;
+    name = "Tuomas Tynkkynen";
+  };
+  dfithian = {
+    email = "daniel.m.fithian@gmail.com";
+    name = "Daniel Fithian";
+    github = "dfithian";
+    githubId = 8409320;
+  };
+  dfordivam = {
+    email = "dfordivam+nixpkgs@gmail.com";
+    github = "dfordivam";
+    githubId = 681060;
+    name = "Divam";
+  };
+  dfoxfranke = {
+    email = "dfoxfranke@gmail.com";
+    github = "dfoxfranke";
+    githubId = 4708206;
+    name = "Daniel Fox Franke";
+  };
+  dgliwka = {
+    email = "dawid.gliwka@gmail.com";
+    github = "dgliwka";
+    githubId = 33262214;
+    name = "Dawid Gliwka";
+  };
+  d-goldin = {
+    email = "dgoldin+github@protonmail.ch";
+    github = "d-goldin";
+    githubId = 43349662;
+    name = "Dima";
+    keys = [{
+      fingerprint = "1C4E F4FE 7F8E D8B7 1E88 CCDF BAB1 D15F B7B4 D4CE";
+    }];
+  };
+  dgollings = {
+    email = "daniel.gollings+nixpkgs@gmail.com";
+    github = "dgollings";
+    githubId = 2032823;
+    name = "Daniel Gollings";
+  };
+  dgonyeo = {
+    email = "derek@gonyeo.com";
+    github = "dgonyeo";
+    githubId = 2439413;
+    name = "Derek Gonyeo";
+  };
+  dguenther = {
+    email = "dguenther9@gmail.com";
+    github = "dguenther";
+    githubId = 767083;
+    name = "Derek Guenther";
+  };
+  dhkl = {
+    email = "david@davidslab.com";
+    github = "dhl";
+    githubId = 265220;
+    name = "David Leung";
+  };
+  DianaOlympos = {
+    github = "DianaOlympos";
+    githubId = 15774340;
+    name = "Thomas Depierre";
+  };
+  diegolelis = {
+    email = "diego.o.lelis@gmail.com";
+    github = "DiegoLelis";
+    githubId = 8404455;
+    name = "Diego Lelis";
+  };
+  diegs = {
+    email = "dpontor@gmail.com";
+    github = "diegs";
+    githubId = 74719;
+    name = "Diego Pontoriero";
+  };
+  DieracDelta = {
+    email = "justin@restivo.me";
+    github = "DieracDelta";
+    githubId = 13730968;
+    name = "Justin Restivo";
+  };
+  dietmarw = {
+    name = "Dietmar Winkler";
+    email = "dietmar.winkler@dwe.no";
+    github = "dietmarw";
+    githubId = 9332;
+  };
+  diffumist = {
+    email = "git@diffumist.me";
+    github = "Diffumist";
+    githubId = 32810399;
+    name = "Diffumist";
+  };
+  DimitarNestorov = {
+    name = "Dimitar Nestorov";
+    github = "DimitarNestorov";
+    githubId = 8790386;
+  };
+  diogotcorreia = {
+    name = "Diogo Correia";
+    email = "me@diogotc.com";
+    matrix = "@dtc:diogotc.com";
+    github = "diogotcorreia";
+    githubId = 7467891;
+    keys = [{
+      fingerprint = "111F 91B7 5F61 99D8 985B  4C70 12CF 31FD FF17 2B77";
+    }];
+  };
+  diogox = {
+    name = "Diogo Xavier";
+    github = "diogox";
+    githubId = 13244408;
+  };
+  dipinhora = {
+    email = "dipinhora+github@gmail.com";
+    github = "dipinhora";
+    githubId = 11946442;
+    name = "Dipin Hora";
+  };
+  dirkx = {
+    email = "dirkx@webweaving.org";
+    github = "dirkx";
+    githubId = 392583;
+    name = "Dirk-Willem van Gulik";
+  };
+  disassembler = {
+    email = "disasm@gmail.com";
+    github = "disassembler";
+    githubId = 651205;
+    name = "Samuel Leathers";
+  };
+  disserman = {
+    email = "disserman@gmail.com";
+    github = "divi255";
+    githubId = 40633781;
+    name = "Sergei S.";
+  };
+  dit7ya = {
+    email = "7rat13@gmail.com";
+    github = "dit7ya";
+    githubId = 14034137;
+    name = "Mostly Void";
+  };
+  ditsuke = {
+    name = "Tushar";
+    email = "hello@ditsuke.com";
+    github = "ditsuke";
+    githubId = 72784348;
+    keys = [{
+      fingerprint = "8FD2 153F 4889 541A 54F1  E09E 71B6 C31C 8A5A 9D21";
+    }];
+  };
+  dixslyf = {
+    name = "Dixon Sean Low Yan Feng";
+    email = "dixonseanlow@protonmail.com";
+    github = "dixslyf";
+    githubId = 56017218;
+    keys = [{
+      fingerprint = "E6F4 BFB4 8DE3 893F 68FC  A15F FF5F 4B30 A41B BAC8";
+    }];
+  };
+  djacu = {
+    email = "daniel.n.baker@gmail.com";
+    github = "djacu";
+    githubId = 7043297;
+    name = "Daniel Baker";
+  };
+  djanatyn = {
+    email = "djanatyn@gmail.com";
+    github = "djanatyn";
+    githubId = 523628;
+    name = "Jonathan Strickland";
+  };
+  Dje4321 = {
+    email = "dje4321@gmail.com";
+    github = "dje4321";
+    githubId = 10913120;
+    name = "Dje4321";
+  };
+  djwf = {
+    email = "dave@weller-fahy.com";
+    github = "djwf";
+    githubId = 73162;
+    name = "David J. Weller-Fahy";
+  };
+  dkabot = {
+    email = "dkabot@dkabot.com";
+    github = "dkabot";
+    githubId = 1316469;
+    name = "Naomi Morse";
+  };
+  dlesl = {
+    email = "dlesl@dlesl.com";
+    github = "dlesl";
+    githubId = 28980797;
+    name = "David Leslie";
+  };
+  dlip = {
+    email = "dane@lipscombe.com.au";
+    github = "dlip";
+    githubId = 283316;
+    name = "Dane Lipscombe";
+  };
+  dmalikov = {
+    email = "malikov.d.y@gmail.com";
+    github = "dmalikov";
+    githubId = 997543;
+    name = "Dmitry Malikov";
+  };
+  DMills27 = {
+    github = "DMills27";
+    githubId = 5251658;
+    name = "Dominic Mills";
+  };
+  DmitryTsygankov = {
+    email = "dmitry.tsygankov@gmail.com";
+    github = "DmitryTsygankov";
+    githubId = 425354;
+    name = "Dmitry Tsygankov";
+  };
+  dmjio = {
+    email = "djohnson.m@gmail.com";
+    github = "dmjio";
+    githubId = 875324;
+    name = "David Johnson";
+  };
+  dmrauh = {
+    email = "dmrauh@posteo.de";
+    github = "dmrauh";
+    githubId = 37698547;
+    name = "Dominik Michael Rauh";
+  };
+  dmvianna = {
+    email = "dmlvianna@gmail.com";
+    github = "dmvianna";
+    githubId = 1708810;
+    name = "Daniel Vianna";
+  };
+  dmytrokyrychuk = {
+    email = "dmytro@kyrych.uk";
+    github = "dmytrokyrychuk";
+    githubId = 699961;
+    name = "Dmytro Kyrychuk";
+  };
+  dnr = {
+    email = "dnr@dnr.im";
+    github = "dnr";
+    githubId = 466723;
+    name = "David Reiss";
+  };
+  dochang = {
+    email = "dochang@gmail.com";
+    github = "dochang";
+    githubId = 129093;
+    name = "Desmond O. Chang";
+  };
+  domenkozar = {
+    email = "domen@dev.si";
+    github = "domenkozar";
+    githubId = 126339;
+    name = "Domen Kozar";
+  };
+  DomesticMoth = {
+    name = "Andrew";
+    email = "silkmoth@protonmail.com";
+    github = "asciimoth";
+    githubId = 91414737;
+    keys = [{
+      fingerprint = "7D6B AE0A A98A FDE9 3396  E721 F87E 15B8 3AA7 3087";
+    }];
+  };
+  dominikh = {
+    email = "dominik@honnef.co";
+    github = "dominikh";
+    githubId = 39825;
+    name = "Dominik Honnef";
+  };
+  donovanglover = {
+    github = "donovanglover";
+    githubId = 2374245;
+    name = "Donovan Glover";
+    keys = [{
+      fingerprint = "EE7D 158E F9E7 660E 0C33  86B2 8FC5 F7D9 0A5D 8F4D";
+    }];
+  };
+  donteatoreo = {
+    name = "DontEatOreo";
+    github = "DontEatOreo";
+    githubId = 57304299;
+    keys = [{
+      fingerprint = "33CD 5C0A 673C C54D 661E  5E4C 0DB5 361B EEE5 30AB";
+    }];
+  };
+  doriath = {
+    email = "tomasz.zurkowski@gmail.com";
+    github = "doriath";
+    githubId = 150959;
+    name = "Tomasz Zurkowski";
+  };
+  doronbehar = {
+    email = "me@doronbehar.com";
+    github = "doronbehar";
+    githubId = 10998835;
+    name = "Doron Behar";
+  };
+  dotemup = {
+    email = "dotemup.designs+nixpkgs@gmail.com";
+    github = "dotemup";
+    githubId = 11077277;
+    name = "Dote";
+  };
+  dotlambda = {
+    email = "rschuetz17@gmail.com";
+    matrix = "@robert:funklause.de";
+    github = "dotlambda";
+    githubId = 6806011;
+    name = "Robert Schütz";
+  };
+  dottedmag = {
+    email = "dottedmag@dottedmag.net";
+    github = "dottedmag";
+    githubId = 16120;
+    name = "Misha Gusarov";
+    keys = [{
+      fingerprint = "A8DF 1326 9E5D 9A38 E57C  FAC2 9D20 F650 3E33 8888";
+    }];
+  };
+  dpaetzel = {
+    email = "david.paetzel@posteo.de";
+    github = "dpaetzel";
+    githubId = 974130;
+    name = "David Pätzel";
+  };
+  dpausp = {
+    email = "dpausp@posteo.de";
+    github = "dpausp";
+    githubId = 1965950;
+    name = "Tobias Stenzel";
+    keys = [{
+      fingerprint = "4749 0887 CF3B 85A1 6355  C671 78C7 DD40 DF23 FB16";
+    }];
+  };
+  dpc = {
+    email = "dpc@dpc.pw";
+    github = "dpc";
+    githubId = 9209;
+    matrix = "@dpc:matrix.org";
+    name = "Dawid Ciężarkiewicz";
+    keys = [{
+      fingerprint = "0402 11D2 0830 2D71 5792 8197 86BB 1D5B 5575 7D38";
+    }];
+  };
+  DPDmancul = {
+    name = "Davide Peressoni";
+    email = "davide.peressoni@tuta.io";
+    matrix = "@dpd-:matrix.org";
+    github = "DPDmancul";
+    githubId = 3186857;
+  };
+  dpercy = {
+    email = "dpercy@dpercy.dev";
+    github = "dpercy";
+    githubId = 349909;
+    name = "David Percy";
+  };
+  dpflug = {
+    email = "david@pflug.email";
+    github = "dpflug";
+    githubId = 108501;
+    name = "David Pflug";
+  };
+  dr460nf1r3 = {
+    email = "root@dr460nf1r3.org";
+    github = "dr460nf1r3";
+    githubId = 12834713;
+    name = "Nico Jensch";
+    keys = [{
+      fingerprint = "D245 D484 F357 8CB1 7FD6  DA6B 67DB 29BF F3C9 6757";
+    }];
+  };
+  dramaturg = {
+    email = "seb@ds.ag";
+    github = "dramaturg";
+    githubId = 472846;
+    name = "Sebastian Krohn";
+  };
+  drets = {
+    email = "dmitryrets@gmail.com";
+    github = "drets";
+    githubId = 6199462;
+    name = "Dmytro Rets";
+  };
+  drewrisinger = {
+    email = "drisinger+nixpkgs@gmail.com";
+    github = "drewrisinger";
+    githubId = 10198051;
+    name = "Drew Risinger";
+  };
+  dritter = {
+    email = "dritter03@googlemail.com";
+    github = "dritter";
+    githubId = 1544760;
+    name = "Dominik Ritter";
+  };
+  drperceptron = {
+    github = "drperceptron";
+    githubId = 92106371;
+    name = "Dr Perceptron";
+    keys = [{
+      fingerprint = "7E38 89D9 B1A8 B381 C8DE  A15F 95EB 6DFF 26D1 CEB0";
+    }];
+  };
+  DrSensor = {
+    name = "Fahmi Akbar Wildana";
+    email = "sensorfied@gmail.com";
+    matrix = "@drsensor:matrix.org";
+    github = "DrSensor";
+    githubId = 4953069;
+  };
+  drupol = {
+    name = "Pol Dellaiera";
+    email = "pol.dellaiera@protonmail.com";
+    matrix = "@drupol:matrix.org";
+    github = "drupol";
+    githubId = 252042;
+    keys = [{
+      fingerprint = "85F3 72DF 4AF3 EF13 ED34  72A3 0AAF 2901 E804 0715";
+    }];
+  };
+  dsalaza4 = {
+    email = "podany270895@gmail.com";
+    github = "dsalaza4";
+    githubId = 11205987;
+    name = "Daniel Salazar";
+  };
+  dschrempf = {
+    name = "Dominik Schrempf";
+    email = "dominik.schrempf@gmail.com";
+    github = "dschrempf";
+    githubId = 5596239;
+    keys = [{
+      fingerprint = "62BC E2BD 49DF ECC7 35C7  E153 875F 2BCF 163F 1B29";
+    }];
+  };
+  dsferruzza = {
+    email = "david.sferruzza@gmail.com";
+    github = "dsferruzza";
+    githubId = 1931963;
+    name = "David Sferruzza";
+  };
+  dsuetin = {
+    name = "Danil Suetin";
+    email = "suetin085+nixpkgs@protonmail.com";
+    matrix = "@dani0854:matrix.org";
+    github = "dani0854";
+    githubId = 32674935;
+    keys = [{
+      fingerprint = "E033 FE26 0E62 224B B35C  75C9 DE8B 9CED 0696 C600";
+    }];
+  };
+  dsymbol = {
+    name = "dsymbol";
+    github = "dsymbol";
+    githubId = 88138099;
+  };
+  dtzWill = {
+    email = "w@wdtz.org";
+    github = "dtzWill";
+    githubId = 817330;
+    name = "Will Dietz";
+    keys = [{
+      fingerprint = "389A 78CB CD88 5E0C 4701  DEB9 FD42 C7D0 D414 94C8";
+    }];
+  };
+  dukc = {
+    email = "ajieskola@gmail.com";
+    github = "dukc";
+    githubId = 24233408;
+    name = "Ate Eskola";
+  };
+  dump_stack = {
+    email = "root@dumpstack.io";
+    github = "jollheef";
+    githubId = 1749762;
+    name = "Mikhail Klementev";
+    keys = [{
+      fingerprint = "5DD7 C6F6 0630 F08E DAE7  4711 1525 585D 1B43 C62A";
+    }];
+  };
+  dunxen = {
+    email = "git@dunxen.dev";
+    matrix = "@dunxen:x0f.org";
+    github = "dunxen";
+    githubId = 3072149;
+    name = "Duncan Dean";
+    keys = [{
+      fingerprint = "9484 44FC E03B 05BA 5AB0  591E C37B 1C1D 44C7 86EE";
+    }];
+  };
+  dwarfmaster = {
+    email = "nixpkgs@dwarfmaster.net";
+    github = "dwarfmaster";
+    githubId = 2025623;
+    name = "Luc Chabassier";
+  };
+  dxf = {
+    email = "dingxiangfei2009@gmail.com";
+    github = "dingxiangfei2009";
+    githubId = 6884440;
+    name = "Ding Xiang Fei";
+  };
+  d-xo = {
+    email = "hi@d-xo.org";
+    github = "d-xo";
+    githubId = 6689924;
+    name = "David Terry";
+  };
+  dylanmtaylor = {
+    email = "dylan@dylanmtaylor.com";
+    github = "dylanmtaylor";
+    githubId = 277927;
+    name = "Dylan Taylor";
+  };
+  dysinger = {
+    email = "tim@dysinger.net";
+    github = "dysinger";
+    githubId = 447;
+    name = "Tim Dysinger";
+  };
+  dywedir = {
+    email = "dywedir@gra.red";
+    matrix = "@dywedir:matrix.org";
+    github = "dywedir";
+    githubId = 399312;
+    name = "Vladyslav M.";
+  };
+  dzabraev = {
+    email = "dzabraew@gmail.com";
+    github = "dzabraev";
+    githubId = 15128988;
+    name = "Maksim Dzabraev";
+  };
+  e1mo = {
+    email = "nixpkgs@e1mo.de";
+    matrix = "@e1mo:chaos.jetzt";
+    github = "e1mo";
+    githubId = 61651268;
+    name = "Moritz Fromm";
+    keys = [{
+      fingerprint = "67BE E563 43B6 420D 550E  DF2A 6D61 7FD0 A85B AADA";
+    }];
+  };
+  eadwu = {
+    email = "edmund.wu@protonmail.com";
+    github = "eadwu";
+    githubId = 22758444;
+    name = "Edmund Wu";
+  };
+  ealasu = {
+    email = "emanuel.alasu@gmail.com";
+    github = "ealasu";
+    githubId = 1362096;
+    name = "Emanuel Alasu";
+  };
+  eamsden = {
+    email = "edward@blackriversoft.com";
+    github = "eamsden";
+    githubId = 54573;
+    name = "Edward Amsden";
+  };
+  earldouglas = {
+    email = "james@earldouglas.com";
+    github = "earldouglas";
+    githubId = 424946;
+    name = "James Earl Douglas";
+  };
+  EBADBEEF = {
+    name = "EBADBEEF";
+    email = "errno@ebadf.com";
+    github = "EBADBEEF";
+    githubId = 4167946;
+  };
+  ebbertd = {
+    email = "daniel@ebbert.nrw";
+    github = "ebbertd";
+    githubId = 20522234;
+    name = "Daniel Ebbert";
+    keys = [{
+      fingerprint = "E765 FCA3 D9BF 7FDB 856E  AD73 47BC 1559 27CB B9C7";
+    }];
+  };
+  ebzzry = {
+    email = "ebzzry@ebzzry.io";
+    github = "ebzzry";
+    githubId = 7875;
+    name = "Rommel Martinez";
+  };
+  ecklf = {
+    email = "ecklf@icloud.com";
+    github = "ecklf";
+    githubId = 8146736;
+    name = "Florentin Eckl";
+  };
+  eclairevoyant = {
+    github = "eclairevoyant";
+    githubId = 848000;
+    name = "éclairevoyant";
+  };
+  edanaher = {
+    email = "nixos@edanaher.net";
+    github = "edanaher";
+    githubId = 984691;
+    name = "Evan Danaher";
+  };
+  edbentley = {
+    email = "hello@edbentley.dev";
+    github = "edbentley";
+    githubId = 15923595;
+    name = "Ed Bentley";
+  };
+  edcragg = {
+    email = "ed.cragg@eipi.xyz";
+    github = "nuxeh";
+    githubId = 1516017;
+    name = "Ed Cragg";
+  };
+  eddsteel = {
+    email = "edd@eddsteel.com";
+    github = "eddsteel";
+    githubId = 206872;
+    name = "Edd Steel";
+    keys = [{
+      fingerprint = "1BE8 48D7 6C7C 4C51 349D  DDCC 3362 0159 D403 85A0";
+    }];
+  };
+  edef = {
+    email = "edef@edef.eu";
+    github = "edef1c";
+    githubId = 50854;
+    name = "edef";
+  };
+  edeneast = {
+    email = "edenofest@gmail.com";
+    github = "edeneast";
+    githubId = 2746374;
+    name = "edeneast";
+  };
+  ederoyd46 = {
+    email = "matt@ederoyd.co.uk";
+    github = "ederoyd46";
+    githubId = 119483;
+    name = "Matthew Brown";
+  };
+  edlimerkaj = {
+    name = "Edli Merkaj";
+    email = "edli.merkaj@identinet.io";
+    github = "edlimerkaj";
+    githubId = 71988351;
+  };
+  edmundmiller = {
+    name = "Edmund Miller";
+    email = "git@edmundmiller.dev";
+    matrix = "@emiller:beeper.com";
+    github = "edmundmiller";
+    githubId = 20095261;
+  };
+  edrex = {
+    email = "ericdrex@gmail.com";
+    github = "edrex";
+    githubId = 14615;
+    keys = [{
+      fingerprint = "AC47 2CCC 9867 4644 A9CF  EB28 1C5C 1ED0 9F66 6824";
+    }];
+    matrix = "@edrex:matrix.org";
+    name = "Eric Drechsel";
+  };
+  edswordsmith = {
+    email = "eduardo.espadeiro@tecnico.ulisboa.pt";
+    github = "EdSwordsmith";
+    githubId = 22300113;
+    name = "Eduardo Espadeiro";
+  };
+  eduarrrd = {
+    email = "e.bachmakov@gmail.com";
+    github = "eduarrrd";
+    githubId = 1181393;
+    name = "Eduard Bachmakov";
+  };
+  edude03 = {
+    email = "michael@melenion.com";
+    github = "edude03";
+    githubId = 494483;
+    name = "Michael Francis";
+  };
+  edwtjo = {
+    email = "ed@cflags.cc";
+    github = "edwtjo";
+    githubId = 54799;
+    name = "Edward Tjörnhammar";
+  };
+  eelco = {
+    email = "edolstra+nixpkgs@gmail.com";
+    github = "edolstra";
+    githubId = 1148549;
+    name = "Eelco Dolstra";
+  };
+  ehegnes = {
+    email = "eric.hegnes@gmail.com";
+    github = "ehegnes";
+    githubId = 884970;
+    name = "Eric Hegnes";
+  };
+  ehllie = {
+    email = "me@ehllie.xyz";
+    github = "ehllie";
+    githubId = 20847625;
+    name = "Elizabeth Paź";
+  };
+  ehmry = {
+    email = "ehmry@posteo.net";
+    github = "ehmry";
+    githubId = 537775;
+    name = "Emery Hemingway";
+  };
+  eigengrau = {
+    email = "seb@schattenkopie.de";
+    name = "Sebastian Reuße";
+    github = "eigengrau";
+    githubId = 4939947;
+  };
+  eikek = {
+    email = "eike.kettner@posteo.de";
+    github = "eikek";
+    githubId = 701128;
+    name = "Eike Kettner";
+  };
+  eken = {
+    email = "edvin.kallstrom@protonmail.com";
+    github = "Eken-beep";
+    name = "Edvin Källström";
+    githubId = 84442052;
+  };
+  ekimber  = {
+    email = "ekimber@protonmail.com";
+    github = "ekimber";
+    name = "Edward Kimber";
+    githubId = 99987;
+  };
+  ekleog = {
+    email = "leo@gaspard.io";
+    matrix = "@leo:gaspard.ninja";
+    github = "Ekleog";
+    githubId = 411447;
+    name = "Leo Gaspard";
+  };
+  elasticdog = {
+    email = "aaron@elasticdog.com";
+    github = "elasticdog";
+    githubId = 4742;
+    name = "Aaron Bull Schaefer";
+  };
+  elatov = {
+    email = "elatov@gmail.com";
+    github = "elatov";
+    githubId = 7494394;
+    name = "Karim Elatov";
+  };
+  eleanor = {
+    email = "dejan@proteansec.com";
+    github = "proteansec";
+    githubId = 1753498;
+    name = "Dejan Lukan";
+  };
+  electrified = {
+    email = "ed@maidavale.org";
+    github = "electrified";
+    githubId = 103082;
+    name = "Ed Brindley";
+  };
+  elesiuta = {
+    email = "elesiuta@gmail.com";
+    github = "elesiuta";
+    githubId = 8146662;
+    name = "Eric Lesiuta";
+  };
+  eliandoran = {
+    email = "contact@eliandoran.me";
+    name = "Elian Doran";
+    github = "eliandoran";
+    githubId = 21236836;
+  };
+  eliasp = {
+    email = "mail@eliasprobst.eu";
+    matrix = "@eliasp:kde.org";
+    github = "eliasp";
+    githubId = 48491;
+    name = "Elias Probst";
+  };
+  elijahcaine = {
+    email = "elijahcainemv@gmail.com";
+    github = "pop";
+    githubId = 1897147;
+    name = "Elijah Caine";
+  };
+  Elinvention = {
+    email = "elia@elinvention.ovh";
+    github = "Elinvention";
+    githubId = 5737945;
+    name = "Elia Argentieri";
+  };
+  elitak = {
+    email = "elitak@gmail.com";
+    github = "elitak";
+    githubId = 769073;
+    name = "Eric Litak";
+  };
+  elizagamedev = {
+    email = "eliza@eliza.sh";
+    github = "elizagamedev";
+    githubId = 4576666;
+    name = "Eliza Velasquez";
+  };
+  elkowar = {
+    email = "thereal.elkowar@gmail.com";
+    github = "elkowar";
+    githubId = 5300871;
+    name = "Leon Kowarschick";
+  };
+  elliot = {
+    email = "hack00mind@gmail.com";
+    github = "Eliot00";
+    githubId = 18375468;
+    name = "Elliot Xu";
+  };
+  elliottslaughter = {
+    name = "Elliott Slaughter";
+    email = "elliottslaughter@gmail.com";
+    github = "elliottslaughter";
+    githubId = 3129;
+  };
+  elliottvillars = {
+    email = "elliottvillars@gmail.com";
+    github = "elliottvillars";
+    githubId = 48104179;
+    name = "Elliott Villars";
+  };
+  ellis = {
+    email = "nixos@ellisw.net";
+    github = "ellis";
+    githubId = 97852;
+    name = "Ellis Whitehead";
+  };
+  elnudev = {
+    email = "elnu@elnu.com";
+    github = "ElnuDev";
+    githubId = 9874955;
+    name = "Elnu";
+  };
+  elohmeier = {
+    email = "elo-nixos@nerdworks.de";
+    github = "elohmeier";
+    githubId = 2536303;
+    name = "Enno Lohmeier";
+  };
+  elvishjerricco = {
+    email = "elvishjerricco@gmail.com";
+    matrix = "@elvishjerricco:matrix.org";
+    github = "ElvishJerricco";
+    githubId = 1365692;
+    name = "Will Fancher";
+  };
+  emantor = {
+    email = "rouven+nixos@czerwinskis.de";
+    github = "Emantor";
+    githubId = 934284;
+    name = "Rouven Czerwinski";
+  };
+  emattiza = {
+    email = "nix@mattiza.dev";
+    github = "emattiza";
+    githubId = 11719476;
+    name = "Evan Mattiza";
+  };
+  embr = {
+    email = "hi@liclac.eu";
+    github = "liclac";
+    githubId = 428026;
+    name = "embr";
+  };
+  emilioziniades = {
+    email = "emilioziniades@protonmail.com";
+    github = "emilioziniades";
+    githubId = 75438244;
+    name = "Emilio Ziniades";
+  };
+  emily = {
+    email = "nixpkgs@emily.moe";
+    github = "emilazy";
+    githubId = 18535642;
+    name = "Emily";
+  };
+  emilylange = {
+    email = "nix@emilylange.de";
+    github = "emilylange";
+    githubId = 55066419;
+    name = "Emily Lange";
+  };
+  emilytrau = {
+    name = "Emily Trau";
+    email = "emily+nix@downunderctf.com";
+    github = "emilytrau";
+    githubId = 13267947;
+  };
+  emmabastas = {
+    email = "emma.bastas@protonmail.com";
+    matrix = "@emmabastas:matrix.org";
+    github = "emmabastas";
+    githubId = 22533224;
+    name = "Emma Bastås";
+  };
+  emmanuelrosa = {
+    email = "emmanuelrosa@protonmail.com";
+    matrix = "@emmanuelrosa:matrix.org";
+    github = "emmanuelrosa";
+    githubId = 13485450;
+    name = "Emmanuel Rosa";
+  };
+  emptyflask = {
+    email = "jon@emptyflask.dev";
+    github = "emptyflask";
+    githubId = 28287;
+    name = "Jon Roberts";
+  };
+  enderger = {
+    email = "endergeryt@gmail.com";
+    github = "enderger";
+    githubId = 36283171;
+    name = "Daniel";
+  };
+  endgame = {
+    email = "jack@jackkelly.name";
+    github = "endgame";
+    githubId = 231483;
+    name = "Jack Kelly";
+  };
+  endle = {
+    email = "lizhenbo@yahoo.com";
+    github = "Endle";
+    githubId = 3221521;
+    name = "Zhenbo Li";
+    matrix = "@zhenbo:matrix.org";
+  };
+  endocrimes = {
+    email = "dani@builds.terrible.systems";
+    github = "endocrimes";
+    githubId = 1330683;
+    name = "Danielle Lancashire";
+  };
+  enorris = {
+    name = "Eric Norris";
+    email = "erictnorris@gmail.com";
+    github = "ericnorris";
+    githubId = 1906605;
+  };
+  Enteee = {
+    email = "nix@duckpond.ch";
+    github = "Enteee";
+    githubId = 5493775;
+    name = "Ente";
+  };
+  Enzime = {
+    github = "Enzime";
+    githubId = 10492681;
+    name = "Michael Hoang";
+  };
+  eonpatapon = {
+    email = "eon@patapon.info";
+    github = "eonpatapon";
+    githubId = 418227;
+    name = "Jean-Philippe Braun";
+  };
+  eperuffo = {
+    email = "info@emanueleperuffo.com";
+    github = "emanueleperuffo";
+    githubId = 5085029;
+    name = "Emanuele Peruffo";
+  };
+  equirosa = {
+    email = "eduardo@eduardoquiros.com";
+    github = "equirosa";
+    githubId = 39096810;
+    name = "Eduardo Quiros";
+  };
+  eqyiel = {
+    email = "ruben@maher.fyi";
+    github = "eqyiel";
+    githubId = 3422442;
+    name = "Ruben Maher";
+  };
+  eraserhd = {
+    email = "jason.m.felice@gmail.com";
+    github = "eraserhd";
+    githubId = 147284;
+    name = "Jason Felice";
+  };
+  ercao = {
+    email = "vip@ercao.cn";
+    github = "ercao";
+    githubId = 51725284;
+    name = "ercao";
+    keys = [{
+      fingerprint = "F3B0 36F7 B0CB 0964 3C12  D3C7 FFAB D125 7ECF 0889";
+    }];
+  };
+  erdnaxe = {
+    email = "erdnaxe@crans.org";
+    github = "erdnaxe";
+    githubId = 2663216;
+    name = "Alexandre Iooss";
+    keys = [{
+      fingerprint = "2D37 1AD2 7E2B BC77 97E1  B759 6C79 278F 3FCD CC02";
+    }];
+  };
+  ereslibre = {
+    email = "ereslibre@ereslibre.es";
+    matrix = "@ereslibre:matrix.org";
+    github = "ereslibre";
+    githubId = 8706;
+    name = "Rafael Fernández López";
+  };
+  ericbmerritt = {
+    email = "eric@afiniate.com";
+    github = "ericbmerritt";
+    githubId = 4828;
+    name = "Eric Merritt";
+  };
+  ericdallo = {
+    email = "ercdll1337@gmail.com";
+    github = "ericdallo";
+    githubId = 7820865;
+    name = "Eric Dallo";
+  };
+  ericsagnes = {
+    email = "eric.sagnes@gmail.com";
+    github = "ericsagnes";
+    githubId = 367880;
+    name = "Eric Sagnes";
+  };
+  ericson2314 = {
+    email = "John.Ericson@Obsidian.Systems";
+    matrix = "@ericson2314:matrix.org";
+    github = "Ericson2314";
+    githubId = 1055245;
+    name = "John Ericson";
+  };
+  erictapen = {
+    email = "kerstin@erictapen.name";
+    github = "erictapen";
+    githubId = 11532355;
+    name = "Kerstin Humm";
+    keys = [{
+      fingerprint = "F178 B4B4 6165 6D1B 7C15  B55D 4029 3358 C7B9 326B";
+    }];
+  };
+  ericthemagician = {
+    email = "eric@ericyen.com";
+    matrix = "@eric:jupiterbroadcasting.com";
+    github = "EricTheMagician";
+    githubId = 323436;
+    name = "Eric Yen";
+  };
+  erikarvstedt = {
+    email = "erik.arvstedt@gmail.com";
+    matrix = "@erikarvstedt:matrix.org";
+    github = "erikarvstedt";
+    githubId = 36110478;
+    name = "Erik Arvstedt";
+  };
+  erikbackman = {
+    email = "contact@ebackman.net";
+    github = "erikbackman";
+    githubId = 46724898;
+    name = "Erik Backman";
+  };
+  erikryb = {
+    email = "erik.rybakken@math.ntnu.no";
+    github = "erikryb";
+    githubId = 3787281;
+    name = "Erik Rybakken";
+  };
+  erin = {
+    name = "Erin van der Veen";
+    email = "erin@erinvanderveen.nl";
+    github = "ErinvanderVeen";
+    githubId = 10973664;
+  };
+  erosennin = {
+    email = "ag@sologoc.com";
+    github = "erosennin";
+    githubId = 1583484;
+    name = "Andrey Golovizin";
+  };
+  errnoh = {
+    github = "errnoh";
+    githubId = 373946;
+    name = "Erno Hopearuoho";
+  };
+  ersin = {
+    email = "me@ersinakinci.com";
+    github = "ersinakinci";
+    githubId = 5427394;
+    name = "Ersin Akinci";
+  };
+  ertes = {
+    email = "esz@posteo.de";
+    github = "ertes";
+    githubId = 1855930;
+    name = "Ertugrul Söylemez";
+  };
+  esau79p = {
+    github = "EsAu79p";
+    githubId = 21313906;
+    name = "EsAu";
+  };
+  esclear = {
+    github = "esclear";
+    githubId = 7432848;
+    name = "Daniel Albert";
+  };
+  eskytthe = {
+    email = "eskytthe@gmail.com";
+    github = "eskytthe";
+    githubId = 2544204;
+    name = "Erik Skytthe";
+  };
+  ethancedwards8 = {
+    email = "ethan@ethancedwards.com";
+    github = "ethancedwards8";
+    githubId = 60861925;
+    name = "Ethan Carter Edwards";
+    keys = [{
+      fingerprint = "0E69 0F46 3457 D812 3387  C978 F93D DAFA 26EF 2458";
+    }];
+  };
+  ethercrow = {
+    email = "ethercrow@gmail.com";
+    github = "ethercrow";
+    githubId = 222467;
+    name = "Dmitry Ivanov";
+  };
+  ethindp = {
+    name = "Ethin Probst";
+    email = "harlydavidsen@gmail.com";
+    matrix = "@ethindp:the-gdn.net";
+    github = "ethindp";
+    githubId = 8030501;
+  };
+  ethinx = {
+    email = "eth2net@gmail.com";
+    github = "ethinx";
+    githubId = 965612;
+    name = "York Wong";
+  };
+  Etjean = {
+    email = "et.jean@outlook.fr";
+    github = "Etjean";
+    githubId = 32169529;
+    name = "Etienne Jean";
+  };
+  ettom = {
+    email = "ettom22@hotmail.com";
+    github = "ettom";
+    githubId = 36895504;
+    name = "ettom";
+  };
+  etu = {
+    email = "elis@hirwing.se";
+    matrix = "@etu:semi.social";
+    github = "etu";
+    githubId = 461970;
+    name = "Elis Hirwing";
+    keys = [{
+      fingerprint = "67FE 98F2 8C44 CF22 1828  E12F D57E FA62 5C9A 925F";
+    }];
+  };
+  euank = {
+    email = "euank-nixpkg@euank.com";
+    github = "euank";
+    githubId = 2147649;
+    name = "Euan Kemp";
+  };
+  eureka-cpu = {
+    email = "github.eureka@gmail.com";
+    github = "eureka-cpu";
+    githubId = 57543709;
+    name = "Chris O'Brien";
+  };
+  evalexpr = {
+    name = "Jonathan Wilkins";
+    email = "nixos@wilkins.tech";
+    matrix = "@evalexpr:matrix.org";
+    github = "evalexpr";
+    githubId = 23485511;
+    keys = [{
+      fingerprint = "8129 5B85 9C5A F703 C2F4  1E29 2D1D 402E 1776 3DD6";
+    }];
+  };
+  evan-goode = {
+    email = "mail@evangoo.de";
+    name = "Evan Goode";
+    github = "evan-goode";
+    githubId = 7495216;
+    matrix = "@goode:matrix.org";
+  };
+  evanjs = {
+    email = "evanjsx@gmail.com";
+    github = "evanjs";
+    githubId = 1847524;
+    name = "Evan Stoll";
+  };
+  evanrichter = {
+    email = "evanjrichter@gmail.com";
+    github = "evanrichter";
+    githubId = 330292;
+    name = "Evan Richter";
+  };
+  evax = {
+    email = "nixos@evax.fr";
+    github = "evax";
+    githubId = 599997;
+    name = "evax";
+  };
+  evck = {
+    email = "eric@evenchick.com";
+    github = "ericevenchick";
+    githubId = 195032;
+    name = "Eric Evenchick";
+  };
+  evenbrenden = {
+    email = "packages@anythingexternal.com";
+    github = "evenbrenden";
+    githubId = 2512008;
+    name = "Even Brenden";
+  };
+  evey = {
+    email = "nix@lubdub.nl";
+    github = "lub-dub";
+    githubId = 159288204;
+    name = "evey";
+  };
+  evilmav = {
+    email = "elenskiy.ilya@gmail.com";
+    github = "evilmav";
+    githubId = 6803717;
+    name = "Ilya Elenskiy";
+  };
+  evils = {
+    email = "evils.devils@protonmail.com";
+    matrix = "@evils:nixos.dev";
+    github = "evils";
+    githubId = 30512529;
+    name = "Evils";
+  };
+  ewok = {
+    email = "ewok@ewok.ru";
+    github = "ewok-old";
+    githubId = 454695;
+    name = "Artur Taranchiev";
+  };
+  ewuuwe = {
+    email = "ewu.uweq@pm.me";
+    github = "ewuuwe";
+    githubId = 63652646;
+    name = "Xaver Oswald";
+  };
+  exarkun = {
+    email = "exarkun@twistedmatrix.com";
+    github = "exarkun";
+    githubId = 254565;
+    name = "Jean-Paul Calderone";
+  };
+  exfalso = {
+    email = "0slemi0@gmail.com";
+    github = "exFalso";
+    githubId = 1042674;
+    name = "Andras Slemmer";
+  };
+  exi = {
+    email = "nixos@reckling.org";
+    github = "exi";
+    githubId = 449463;
+    name = "Reno Reckling";
+  };
+  exlevan = {
+    email = "exlevan@gmail.com";
+    github = "exlevan";
+    githubId = 873530;
+    name = "Alexey Levan";
+  };
+  expipiplus1 = {
+    email = "nix@monoid.al";
+    matrix = "@ellie:monoid.al";
+    github = "expipiplus1";
+    githubId = 857308;
+    name = "Ellie Hermaszewska";
+    keys = [{
+      fingerprint = "FC1D 3E4F CBCA 80DF E870  6397 C811 6E3A 0C1C A76A";
+    }];
+  };
+  exploitoverload = {
+    email = "nix@exploitoverload.com";
+    github = "exploitoverload";
+    githubId = 99678549;
+    name = "Asier Armenteros";
+  };
+  extends = {
+    email = "sharosari@gmail.com";
+    github = "ImExtends";
+    githubId = 55919390;
+    name = "Vincent VILLIAUMEY";
+  };
+  eyjhb = {
+    email = "eyjhbb@gmail.com";
+    matrix = "@eyjhb:eyjhb.dk";
+    github = "eyJhb";
+    githubId = 25955146;
+    name = "eyJhb";
+  };
+  eymeric = {
+    name = "Eymeric Dechelette";
+    email = "hatchchcien@protonmail.com";
+    github = "hatch01";
+    githubId = 42416805;
+  };
+  f2k1de = {
+    name = "f2k1de";
+    email = "hi@f2k1.de";
+    github = "f2k1de";
+    githubId = 11199213;
+  };
+  f4814n = {
+    email = "me@f4814n.de";
+    github = "f4814";
+    githubId = 11909469;
+    name = "Fabian Geiselhart";
+  };
+  fab = {
+    email = "mail@fabian-affolter.ch";
+    matrix = "@fabaff:matrix.org";
+    name = "Fabian Affolter";
+    github = "fabaff";
+    githubId = 116184;
+    keys = [{
+      fingerprint = "2F6C 930F D3C4 7E38 6AFA  4EB4 E23C D2DD 36A4 397F";
+    }];
+  };
+  fabiangd = {
+    email = "fabian.g.droege@gmail.com";
+    name = "Fabian G. Dröge";
+    github = "FabianGD";
+    githubId = 40316600;
+  };
+  fabianhauser = {
+    email = "fabian.nixos@fh2.ch";
+    github = "fabianhauser";
+    githubId = 368799;
+    name = "Fabian Hauser";
+    keys = [{
+      fingerprint = "50B7 11F4 3DFD 2018 DCE6  E8D0 8A52 A140 BEBF 7D2C";
+    }];
+  };
+  fabianhjr = {
+    email = "fabianhjr@protonmail.com";
+    github = "fabianhjr";
+    githubId = 303897;
+    name = "Fabián Heredia Montiel";
+  };
+  fadenb = {
+    email = "tristan.helmich+nixos@gmail.com";
+    github = "fadenb";
+    githubId = 878822;
+    name = "Tristan Helmich";
+  };
+  falsifian = {
+    email = "james.cook@utoronto.ca";
+    github = "falsifian";
+    githubId = 225893;
+    name = "James Cook";
+  };
+  farcaller = {
+    name = "Vladimir Pouzanov";
+    email = "farcaller@gmail.com";
+    github = "farcaller";
+    githubId = 693;
+  };
+  fare = {
+    email = "fahree@gmail.com";
+    github = "fare";
+    githubId = 8073;
+    name = "Francois-Rene Rideau";
+  };
+  farlion = {
+    email = "florian.peter@gmx.at";
+    github = "workflow";
+    githubId = 1276854;
+    name = "Florian Peter";
+  };
+  farnoy = {
+    email = "jakub@okonski.org";
+    github = "farnoy";
+    githubId = 345808;
+    name = "Jakub Okoński";
+  };
+  fbeffa = {
+    email = "beffa@fbengineering.ch";
+    github = "fedeinthemix";
+    githubId = 7670450;
+    name = "Federico Beffa";
+  };
+  fbergroth = {
+    email = "fbergroth@gmail.com";
+    github = "fbergroth";
+    githubId = 1211003;
+    name = "Fredrik Bergroth";
+  };
+  fbrs = {
+    email = "yuuki@protonmail.com";
+    github = "cideM";
+    githubId = 4246921;
+    name = "Florian Beeres";
+  };
+  fd = {
+    email = "simon.menke@gmail.com";
+    github = "fd";
+    githubId = 591;
+    name = "Simon Menke";
+  };
+  fdns = {
+    email = "fdns02@gmail.com";
+    github = "fdns";
+    githubId = 541748;
+    name = "Felipe Espinoza";
+  };
+  federicoschonborn = {
+    name = "Federico Damián Schonborn";
+    email = "fdschonborn@gmail.com";
+    github = "FedericoSchonborn";
+    githubId = 62166915;
+    matrix = "@FedericoDSchonborn:matrix.org";
+    keys = [
+      { fingerprint = "517A 8A6A 09CA A11C 9667  CEE3 193F 70F1 5C9A B0A0"; }
+    ];
+  };
+  fedx-sudo = {
+    email = "fedx-sudo@pm.me";
+    github = "FedX-sudo";
+    githubId = 66258975;
+    name = "Fedx sudo";
+    matrix = "fedx:matrix.org";
+  };
+  fee1-dead = {
+    email = "ent3rm4n@gmail.com";
+    github = "fee1-dead";
+    githubId = 43851243;
+    name = "Deadbeef";
+  };
+  fehnomenal = {
+    email = "fehnomenal@fehn.systems";
+    github = "fehnomenal";
+    githubId = 9959940;
+    name = "Andreas Fehn";
+  };
+  felipeqq2 = {
+    name = "Felipe Silva";
+    email = "nixpkgs@felipeqq2.rocks";
+    github = "felipeqq2";
+    githubId = 71830138;
+    keys = [{ fingerprint = "7391 BF2D A2C3 B2C9 BE25  ACA9 C7A7 4616 F302 5DF4"; }];
+    matrix = "@felipeqq2:pub.solar";
+  };
+  felixalbrigtsen = {
+    email = "felix@albrigtsen.it";
+    github = "felixalbrigtsen";
+    githubId = 64613093;
+    name = "Felix Albrigtsen";
+    matrix = "@felixalb:feal.no";
+  };
+  felixscheinost = {
+    name = "Felix Scheinost";
+    email = "felix.scheinost@posteo.de";
+    github = "felixscheinost";
+    githubId = 31761492;
+  };
+  felixsinger = {
+    email = "felixsinger@posteo.net";
+    github = "felixsinger";
+    githubId = 628359;
+    name = "Felix Singer";
+  };
+  felschr = {
+    email = "dev@felschr.com";
+    matrix = "@felschr:matrix.org";
+    github = "felschr";
+    githubId = 3314323;
+    name = "Felix Schröter";
+    keys = [
+      {
+        # historical
+        fingerprint = "6AB3 7A28 5420 9A41 82D9  0068 910A CB9F 6BD2 6F58";
+      }
+      {
+        fingerprint = "7E08 6842 0934 AA1D 6821  1F2A 671E 39E6 744C 807D";
+      }
+    ];
+  };
+  fernsehmuell = {
+    email = "fernsehmuel@googlemail.com";
+    matrix = "@fernsehmuell:matrix.org";
+    github = "fernsehmuell";
+    githubId = 5198058;
+    name = "Udo Sauer";
+  };
+  ffinkdevs = {
+    email = "fink@h0st.space";
+    github = "ffinkdevs";
+    githubId = 45924649;
+    name = "Fabian Fink";
+  };
+  fgaz = {
+    email = "fgaz@fgaz.me";
+    matrix = "@fgaz:matrix.org";
+    github = "fgaz";
+    githubId = 8182846;
+    name = "Francesco Gazzetta";
+  };
+  figsoda = {
+    email = "figsoda@pm.me";
+    matrix = "@figsoda:matrix.org";
+    github = "figsoda";
+    githubId = 40620903;
+    name = "figsoda";
+  };
+  fionera = {
+    email = "nix@fionera.de";
+    github = "fionera";
+    githubId = 5741401;
+    name = "Tim Windelschmidt";
+  };
+  firefly-cpp = {
+    email = "iztok@iztok-jr-fister.eu";
+    github = "firefly-cpp";
+    githubId = 1633361;
+    name = "Iztok Fister Jr.";
+  };
+  FireyFly = {
+    email = "nix@firefly.nu";
+    github = "FireyFly";
+    githubId = 415760;
+    name = "Jonas Höglund";
+  };
+  fishi0x01 = {
+    email = "fishi0x01@gmail.com";
+    github = "fishi0x01";
+    githubId = 10799507;
+    name = "Karl Fischer";
+  };
+  fitzgibbon = {
+    name = "Niall FitzGibbon";
+    email = "fitzgibbon.niall@gmail.com";
+    github = "fitzgibbon";
+    githubId = 617048;
+  };
+  fkautz = {
+    name = "Frederick F. Kautz IV";
+    email = "fkautz@alumni.cmu.edu";
+    github = "fkautz";
+    githubId = 135706;
+  };
+  FlafyDev = {
+    name = "Flafy Arazi";
+    email = "flafyarazi@gmail.com";
+    github = "FlafyDev";
+    githubId = 44374434;
+  };
+  Flakebi = {
+    email = "flakebi@t-online.de";
+    github = "Flakebi";
+    githubId = 6499211;
+    name = "Sebastian Neubauer";
+    keys = [{
+      fingerprint = "2F93 661D AC17 EA98 A104  F780 ECC7 55EE 583C 1672";
+    }];
+  };
+  flandweber = {
+    email = "finn@landweber.xyz";
+    github = "flandweber";
+    githubId = 110117466;
+    matrix = "@flandweber:envs.net";
+    name = "Finn Landweber";
+  };
+  fleaz = {
+    email = "mail@felixbreidenstein.de";
+    matrix = "@fleaz:rainbownerds.de";
+    github = "fleaz";
+    githubId = 2489598;
+    name = "Felix Breidenstein";
+  };
+  flemzord = {
+    email = "maxence@maireaux.fr";
+    github = "flemzord";
+    githubId = 1952914;
+    name = "Maxence Maireaux";
+  };
+  flexagoon = {
+    email = "flexagoon@pm.me";
+    github = "flexagoon";
+    githubId = 66178592;
+    name = "Pavel Zolotarevskiy";
+  };
+  flexiondotorg = {
+    name = "Martin Wimpress";
+    email = "martin@wimpress.org";
+    matrix = "@wimpress:matrix.org";
+    github = "flexiondotorg";
+    githubId = 304639;
+  };
+  fliegendewurst = {
+    email = "arne.keller@posteo.de";
+    github = "FliegendeWurst";
+    githubId = 12560461;
+    name = "Arne Keller";
+  };
+  flokli = {
+    email = "flokli@flokli.de";
+    github = "flokli";
+    githubId = 183879;
+    name = "Florian Klink";
+  };
+  florentc = {
+    github = "florentc";
+    githubId = 1149048;
+    name = "Florent Ch.";
+  };
+  FlorianFranzen = {
+    email = "Florian.Franzen@gmail.com";
+    github = "FlorianFranzen";
+    githubId = 781077;
+    name = "Florian Franzen";
+  };
+  florianjacob = {
+    email = "projects+nixos@florianjacob.de";
+    github = "florianjacob";
+    githubId = 1109959;
+    name = "Florian Jacob";
+  };
+  flosse = {
+    email = "mail@markus-kohlhase.de";
+    github = "flosse";
+    githubId = 276043;
+    name = "Markus Kohlhase";
+  };
+  fluffynukeit = {
+    email = "dan@fluffynukeit.com";
+    github = "fluffynukeit";
+    githubId = 844574;
+    name = "Daniel Austin";
+  };
+  flyfloh = {
+    email = "nix@halbmastwurf.de";
+    github = "flyfloh";
+    githubId = 74379;
+    name = "Florian Pester";
+  };
+  fmhoeger = {
+    email = "fmhoeger@mirsem.org";
+    name = "fmhoeger";
+    github = "fmhoeger";
+    githubId = 59626853;
+  };
+  fmoda3 = {
+    email = "fmoda3@mac.com";
+    github = "fmoda3";
+    githubId = 1746471;
+    name = "Frank Moda III";
+  };
+  fmthoma = {
+    email = "f.m.thoma@googlemail.com";
+    github = "fmthoma";
+    githubId = 5918766;
+    name = "Franz Thoma";
+  };
+  fogti = {
+    name = "Alain Fogtia Zscheile";
+    email = "fogti+devel@ytrizja.de";
+    github = "fogti";
+    githubId = 1618343;
+  };
+  foo-dogsquared = {
+    email = "foodogsquared@foodogsquared.one";
+    github = "foo-dogsquared";
+    githubId = 34962634;
+    matrix = "@foodogsquared:matrix.org";
+    name = "Gabriel Arazas";
+    keys = [{
+      fingerprint = "DDD7 D0BD 602E 564B AA04  FC35 1431 0D91 4115 2B92";
+    }];
+  };
+  fooker = {
+    email = "fooker@lab.sh";
+    github = "fooker";
+    githubId = 405105;
+    name = "Dustin Frisch";
+  };
+  foolnotion = {
+    email = "bogdan.burlacu@pm.me";
+    github = "foolnotion";
+    githubId = 844222;
+    name = "Bogdan Burlacu";
+    keys = [{
+      fingerprint = "B722 6464 838F 8BDB 2BEA  C8C8 5B0E FDDF BA81 6105";
+    }];
+  };
+  forkk = {
+    email = "forkk@forkk.net";
+    github = "Forkk";
+    githubId = 1300078;
+    name = "Andrew Okin";
+  };
+  fornever = {
+    email = "friedrich@fornever.me";
+    github = "ForNeVeR";
+    githubId = 92793;
+    name = "Friedrich von Never";
+  };
+  fpletz = {
+    email = "fpletz@fnordicwalking.de";
+    github = "fpletz";
+    githubId = 114159;
+    name = "Franz Pletz";
+    keys = [{
+      fingerprint = "8A39 615D CE78 AF08 2E23  F303 846F DED7 7926 17B4";
+    }];
+  };
+  fps = {
+    email = "mista.tapas@gmx.net";
+    github = "fps";
+    githubId = 84968;
+    name = "Florian Paul Schmidt";
+  };
+  fptje = {
+    email = "fpeijnenburg@gmail.com";
+    github = "FPtje";
+    githubId = 1202014;
+    name = "Falco Peijnenburg";
+  };
+  fragamus = {
+    email = "innovative.engineer@gmail.com";
+    github = "fragamus";
+    githubId = 119691;
+    name = "Michael Gough";
+  };
+  franciscod = {
+    github = "franciscod";
+    githubId = 726447;
+    name = "Francisco Demartino";
+  };
+  franzmondlichtmann = {
+    name = "Franz Schroepf";
+    email = "franz-schroepf@t-online.de";
+    github = "franzmondlichtmann";
+    githubId = 105480088;
+  };
+  freax13 = {
+    email = "erbse.13@gmx.de";
+    github = "Freax13";
+    githubId = 14952658;
+    name = "Tom Dohrmann";
+  };
+  fredeb = {
+    email = "im@fredeb.dev";
+    github = "FredeEB";
+    githubId = 7551358;
+    name = "Frede Emil";
+  };
+  frederictobiasc = {
+    email = "dev@ntr.li";
+    github = "frederictobiasc";
+    githubId = 26125115;
+    name = "Frédéric Christ";
+  };
+  Freed-Wu = {
+    email = "wuzhenyu@ustc.edu";
+    github = "Freed-Wu";
+    githubId = 32936898;
+    name = "Wu Zhenyu";
+  };
+  freezeboy = {
+    github = "freezeboy";
+    githubId = 13279982;
+    name = "freezeboy";
+  };
+  Fresheyeball = {
+    email = "fresheyeball@gmail.com";
+    github = "Fresheyeball";
+    githubId = 609279;
+    name = "Isaac Shapira";
+  };
+  freyacodes = {
+    email = "freya@arbjerg.dev";
+    github = "freyacodes";
+    githubId = 2582617;
+    name = "Freya Arbjerg";
+  };
+  fricklerhandwerk = {
+    email = "valentin@fricklerhandwerk.de";
+    github = "fricklerhandwerk";
+    githubId = 6599296;
+    name = "Valentin Gagarin";
+  };
+  fridh = {
+    email = "fridh@fridh.nl";
+    github = "FRidh";
+    githubId = 2129135;
+    name = "Frederik Rietdijk";
+  };
+  friedelino = {
+    email = "friede.mann@posteo.de";
+    github = "friedelino";
+    githubId = 46672819;
+    name = "Frido Friedemann";
+  };
+  frlan = {
+    email = "frank@frank.uvena.de";
+    github = "frlan";
+    githubId = 1010248;
+    name = "Frank Lanitz";
+  };
+  frogamic = {
+    email = "frogamic@protonmail.com";
+    github = "frogamic";
+    githubId = 10263813;
+    name = "Dominic Shelton";
+    matrix = "@frogamic:beeper.com";
+    keys = [{
+      fingerprint = "779A 7CA8 D51C C53A 9C51  43F7 AAE0 70F0 67EC 00A5";
+    }];
+  };
+  frontsideair = {
+    email = "photonia@gmail.com";
+    github = "frontsideair";
+    githubId = 868283;
+    name = "Fatih Altinok";
+  };
+  fro_ozen = {
+    email = "fro_ozen@gmx.de";
+    github = "froozen";
+    githubId = 1943632;
+    name = "fro_ozen";
+  };
+  Frostman = {
+    email = "me@slukjanov.name";
+    github = "Frostman";
+    githubId = 134872;
+    name = "Sergei Lukianov";
+  };
+  fryuni = {
+    name = "Luiz Ferraz";
+    email = "luiz@lferraz.com";
+    github = "Fryuni";
+    githubId = 11063910;
+    keys = [{
+      fingerprint = "2109 4B0E 560B 031E F539  62C8 2B56 8731 DB24 47EC";
+    }];
+  };
+  fsagbuya = {
+    email = "fa@m-labs.ph";
+    github = "fsagbuya";
+    githubId = 77672306;
+    name = "Florian Agbuya";
+  };
+  fstamour = {
+    email = "fr.st-amour@gmail.com";
+    github = "fstamour";
+    githubId = 2881922;
+    name = "Francis St-Amour";
+  };
+  f--t = {
+    email = "git@f-t.me";
+    github = "f--t";
+    githubId = 2817965;
+    name = "f--t";
+  };
+  ftrvxmtrx = {
+    email = "ftrvxmtrx@gmail.com";
+    github = "ftrvxmtrx";
+    githubId = 248148;
+    name = "Sigrid Solveig Haflínudóttir";
+  };
+  fuerbringer = {
+    email = "severin@fuerbringer.info";
+    github = "fuerbringer";
+    githubId = 10528737;
+    name = "Severin Fürbringer";
+  };
+  fufexan = {
+    email = "fufexan@protonmail.com";
+    github = "fufexan";
+    githubId = 36706276;
+    name = "Fufezan Mihai";
+  };
+  fugi = {
+    email = "me@fugi.dev";
+    github = "fugidev";
+    githubId = 21362942;
+    name = "Fugi";
+  };
+  fusion809 = {
+    email = "brentonhorne77@gmail.com";
+    github = "fusion809";
+    githubId = 4717341;
+    name = "Brenton Horne";
+  };
+  fuuzetsu = {
+    email = "fuuzetsu@fuuzetsu.co.uk";
+    github = "Fuuzetsu";
+    githubId = 893115;
+    name = "Mateusz Kowalczyk";
+  };
+  fuzen = {
+    email = "me@fuzen.cafe";
+    github = "LovingMelody";
+    githubId = 17859309;
+    name = "Fuzen";
+  };
+  fuzzdk = {
+    github = "fuzzdk";
+    githubId = 12715461;
+    name = "Anders Bo Rasmussen";
+  };
+  fwam = {
+    name = "Legion Orsetti";
+    email = "fwam@queereen.dev";
+    github = "fwam";
+    githubId = 113541944;
+    keys = [{
+      fingerprint = "3822 20B8 57ED 0602 3786  8A7A 18E1 AE22 D704 B4FC";
+    }];
+  };
+  fwc = {
+    github = "fwc";
+    githubId = 29337229;
+    name = "mtths";
+  };
+  fxfactorial = {
+    email = "edgar.factorial@gmail.com";
+    github = "fxfactorial";
+    githubId = 3036816;
+    name = "Edgar Aroutiounian";
+  };
+  fxttr = {
+    name = "Florian Büstgens";
+    email = "fb@fx-ttr.de";
+    github = "fxttr";
+    githubId = 16306293;
+  };
+  fzakaria = {
+    name = "Farid Zakaria";
+    email = "farid.m.zakaria@gmail.com";
+    matrix = "@fzakaria:matrix.org";
+    github = "fzakaria";
+    githubId = 605070;
+  };
+  gabesoft = {
+    email = "gabesoft@gmail.com";
+    github = "gabesoft";
+    githubId = 606000;
+    name = "Gabriel Adomnicai";
+  };
+  GabrielDougherty = {
+    email = "contact@gabrieldougherty.com";
+    github = "GabrielDougherty";
+    githubId = 10541219;
+    name = "Gabriel Dougherty";
+  };
+  Gabriella439 = {
+    email = "GenuineGabriella@gmail.com";
+    github = "Gabriella439";
+    githubId = 1313787;
+    name = "Gabriella Gonzalez";
+  };
+  gador = {
+    email = "florian.brandes@posteo.de";
+    github = "gador";
+    githubId = 1883533;
+    name = "Florian Brandes";
+    keys = [{
+      fingerprint = "0200 3EF8 8D2B CF2D 8F00  FFDC BBB3 E40E 5379 7FD9";
+    }];
+  };
+  gaelreyrol = {
+    email = "me@gaelreyrol.dev";
+    matrix = "@Zevran:matrix.org";
+    name = "Gaël Reyrol";
+    github = "gaelreyrol";
+    githubId = 498465;
+    keys = [{
+      fingerprint = "3492 D8FA ACFF 4C5F A56E  50B7 DFB9 B69A 2C42 7F61";
+    }];
+  };
+  GaetanLepage = {
+    email = "gaetan@glepage.com";
+    github = "GaetanLepage";
+    githubId = 33058747;
+    name = "Gaetan Lepage";
+  };
+  galagora = {
+    email = "lightningstrikeiv@gmail.com";
+    github = "Galagora";
+    githubId = 45048741;
+    name = "Alwanga Oyango";
+  };
+  galaxy = {
+    email = "galaxy@dmc.chat";
+    matrix = "@galaxy:mozilla.org";
+    name = "The Galaxy";
+    github = "ga1aksy";
+    githubId = 148551648;
+    keys = [{
+      fingerprint = "48CA 3873 9E9F CA8E 76A0  835A E3DE CF85 4212 E1EA";
+    }];
+  };
+  gal_bolle = {
+    email = "florent.becker@ens-lyon.org";
+    github = "FlorentBecker";
+    githubId = 7047019;
+    name = "Florent Becker";
+  };
+  galen = {
+    github = "galenhuntington";
+    githubId = 1851962;
+    name = "Galen Huntington";
+  };
+  gamb = {
+    email = "adam.gamble@pm.me";
+    github = "gamb";
+    githubId = 293586;
+    name = "Adam Gamble";
+  };
+  gangaram = {
+    email = "Ganga.Ram@tii.ae";
+    github = "gangaram-tii";
+    githubId = 131853076;
+    name = "Ganga Ram";
+  };
+  garaiza-93 = {
+    email = "araizagustavo93@gmail.com";
+    github = "garaiza-93";
+    githubId = 57430880;
+    name = "Gustavo Araiza";
+  };
+  garbas = {
+    email = "rok@garbas.si";
+    github = "garbas";
+    githubId = 20208;
+    name = "Rok Garbas";
+  };
+  gardspirito = {
+    name = "gardspirito";
+    email = "nyxoroso@gmail.com";
+    github = "gardspirito";
+    githubId = 29687558;
+  };
+  garrison = {
+    email = "jim@garrison.cc";
+    github = "garrison";
+    githubId = 91987;
+    name = "Jim Garrison";
+  };
+  gavin = {
+    email = "gavin.rogers@holo.host";
+    github = "gavinrogers";
+    githubId = 2430469;
+    name = "Gavin Rogers";
+  };
+  gaykitty = {
+    github = "gaykitty";
+    githubId = 126119280;
+    name = "Kitty Pride";
+  };
+  gazally = {
+    email = "gazally@runbox.com";
+    github = "gazally";
+    githubId = 16470252;
+    name = "Gemini Lasswell";
+  };
+  gbpdt = {
+    email = "nix@pdtpartners.com";
+    github = "gbpdt";
+    githubId = 25106405;
+    name = "Graham Bennett";
+  };
+  gbtb = {
+    email = "goodbetterthebeast3@gmail.com";
+    github = "gbtb";
+    githubId = 37017396;
+    name = "gbtb";
+  };
+  gdamjan = {
+    email = "gdamjan@gmail.com";
+    matrix = "@gdamjan:spodeli.org";
+    github = "gdamjan";
+    githubId = 81654;
+    name = "Damjan Georgievski";
+  };
+  gdd = {
+    email = "gabriel.doriath.dohler@ens.fr";
+    github = "gabriel-doriath-dohler";
+    githubId = 40209356;
+    name = "Gabriel Doriath Döhler";
+  };
+  gdinh = {
+    email = "nix@contact.dinh.ai";
+    github = "gdinh";
+    githubId = 34658064;
+    name = "Grace Dinh";
+  };
+  gebner = {
+    email = "gebner@gebner.org";
+    github = "gebner";
+    githubId = 313929;
+    name = "Gabriel Ebner";
+  };
+  geluk = {
+    email = "johan+nix@geluk.io";
+    github = "geluk";
+    githubId = 1516985;
+    name = "Johan Geluk";
+  };
+  genericnerdyusername = {
+    name = "GenericNerdyUsername";
+    email = "genericnerdyusername@proton.me";
+    github = "GenericNerdyUsername";
+    githubId = 111183546;
+    keys = [{
+      fingerprint = "58CE D4BE 6B10 149E DA80  A990 2F48 6356 A4CB 30F3";
+    }];
+  };
+  genofire = {
+    name = "genofire";
+    email = "geno+dev@fireorbit.de";
+    github = "genofire";
+    githubId = 6905586;
+    keys = [{
+      fingerprint = "386E D1BF 848A BB4A 6B4A  3C45 FC83 907C 125B C2BC";
+    }];
+  };
+  georgesalkhouri = {
+    name = "Georges Alkhouri";
+    email = "incense.stitch_0w@icloud.com";
+    github = "GeorgesAlkhouri";
+    githubId = 6077574;
+    keys = [{
+      fingerprint = "1608 9E8D 7C59 54F2 6A7A 7BD0 8BD2 09DC C54F D339";
+    }];
+  };
+  georgewhewell = {
+    email = "georgerw@gmail.com";
+    github = "georgewhewell";
+    githubId = 1176131;
+    name = "George Whewell";
+  };
+  georgyo = {
+    email = "george@shamm.as";
+    github = "georgyo";
+    githubId = 19374;
+    name = "George Shammas";
+    keys = [{
+      fingerprint = "D0CF 440A A703 E0F9 73CB  A078 82BB 70D5 41AE 2DB4";
+    }];
+  };
+  gepbird = {
+    email = "gutyina.gergo.2@gmail.com";
+    github = "gepbird";
+    githubId = 29818440;
+    name = "Gutyina Gergő";
+    keys = [
+      { fingerprint = "RoAfvqa6w1l8Vdm3W60TDXurYwJ6h03VEGD+wDNGEwc"; }
+      { fingerprint = "MP2UpIRtJpbFFqyucP431H/FPCfn58UhEUTro4lXtRs"; }
+    ];
+  };
+  gerg-l = {
+    email = "gregleyda@proton.me";
+    github = "Gerg-L";
+    githubId = 88247690;
+    name = "Greg Leyda";
+  };
+  geri1701 = {
+    email = "geri@sdf.org";
+    github = "geri1701";
+    githubId = 67984144;
+    name = "Gerhard Schwanzer";
+  };
+  gernotfeichter = {
+    email = "gernotfeichter@gmail.com";
+    github = "gernotfeichter";
+    githubId = 23199375;
+    name = "Gernot Feichter";
+  };
+  gerschtli = {
+    email = "tobias.happ@gmx.de";
+    github = "Gerschtli";
+    githubId = 10353047;
+    name = "Tobias Happ";
+  };
+  getchoo = {
+    email = "getchoo@tuta.io";
+    github = "getchoo";
+    githubId = 48872998;
+    name = "Seth";
+  };
+  getpsyched = {
+    name = "Priyanshu Tripathi";
+    email = "priyanshu@getpsyched.dev";
+    matrix = "@getpsyched:matrix.org";
+    github = "getpsyched";
+    githubId = 43472218;
+  };
+  gfrascadorio = {
+    email = "gfrascadorio@tutanota.com";
+    github = "gfrascadorio";
+    githubId = 37602871;
+    name = "Galois";
+  };
+  ggpeti = {
+    email = "ggpeti@gmail.com";
+    matrix = "@ggpeti:ggpeti.com";
+    github = "ggPeti";
+    githubId = 3217744;
+    name = "Peter Ferenczy";
+  };
+  ghostbuster91 = {
+    name = "Kasper Kondzielski";
+    email = "kghost0@gmail.com";
+    github = "ghostbuster91";
+    githubId = 5662622;
+  };
+  ghuntley = {
+    email = "ghuntley@ghuntley.com";
+    github = "ghuntley";
+    githubId = 127353;
+    name = "Geoffrey Huntley";
+  };
+  gigahawk = {
+    email = "Jasper Chan";
+    name = "jasperchan515@gmail.com";
+    github = "Gigahawk";
+    githubId = 10356230;
+  };
+  gigglesquid = {
+    email = "jack.connors@protonmail.com";
+    github = "gigglesquid";
+    githubId = 3685154;
+    name = "Jack connors";
+    keys = [{
+      fingerprint = "21DF 8034 B212 EDFF 9F19  9C19 F65B 7583 7ABF D019";
+    }];
+  };
+  gila = {
+    email = "jeffry.molanus@gmail.com";
+    github = "gila";
+    githubId = 15957973;
+    name = "Jeffry Molanus";
+  };
+  gilice = {
+    email = "gilice@proton.me";
+    github = "gilice";
+    githubId = 104317939;
+    name = "gilice";
+  };
+  gilligan = {
+    email = "tobias.pflug@gmail.com";
+    github = "gilligan";
+    githubId = 27668;
+    name = "Tobias Pflug";
+  };
+  gin66 = {
+    email = "jochen@kiemes.de";
+    github = "gin66";
+    githubId = 5549373;
+    name = "Jochen Kiemes";
+  };
+  giogadi = {
+    email = "lgtorres42@gmail.com";
+    github = "giogadi";
+    githubId = 1713676;
+    name = "Luis G. Torres";
+  };
+  giomf = {
+    email = "giomf@mailbox.org";
+    github = "giomf";
+    githubId = 35076723;
+    name = "Guillaume Fournier";
+  };
+  giorgiga = {
+    email = "giorgio.gallo@bitnic.it";
+    github = "giorgiga";
+    githubId = 471835;
+    name = "Giorgio Gallo";
+  };
+  GirardR1006 = {
+    email = "julien.girard2@cea.fr";
+    github = "GirardR1006";
+    githubId = 19275558;
+    name = "Julien Girard-Satabin";
+  };
+  GKasparov = {
+    email = "mizozahr@gmail.com";
+    github = "GKasparov";
+    githubId = 60962839;
+    name = "Mazen Zahr";
+  };
+  gkleen = {
+    name = "Gregor Kleen";
+    email = "xpnfr@bouncy.email";
+    github = "gkleen";
+    githubId = 20089782;
+  };
+  gleber = {
+    email = "gleber.p@gmail.com";
+    github = "gleber";
+    githubId = 33185;
+    name = "Gleb Peregud";
+  };
+  glenns = {
+    email = "glenn.searby@gmail.com";
+    github = "GlennS";
+    githubId = 615606;
+    name = "Glenn Searby";
+  };
+  Gliczy = {
+    name = "Gliczy";
+    github = "Gliczy";
+    githubId = 129636582;
+  };
+  glittershark = {
+    name = "Griffin Smith";
+    email = "root@gws.fyi";
+    github = "glittershark";
+    githubId = 1481027;
+    keys = [{
+      fingerprint = "0F11 A989 879E 8BBB FDC1  E236 44EF 5B5E 861C 09A7";
+    }];
+  };
+  gloaming = {
+    email = "ch9871@gmail.com";
+    github = "gloaming";
+    githubId = 10156748;
+    name = "Craig Hall";
+  };
+  globin = {
+    email = "mail@glob.in";
+    github = "globin";
+    githubId = 1447245;
+    name = "Robin Gloster";
+  };
+  gm6k = {
+    email = "nix@quidecco.pl";
+    name = "Isidor Zeuner";
+  };
+  gmacon = {
+    name = "George Macon";
+    matrix = "@gmacon:matrix.org";
+    github = "gmacon";
+    githubId = 238853;
+  };
+  gmemstr = {
+    email = "git@gmem.ca";
+    github = "gmemstr";
+    githubId = 1878840;
+    name = "Gabriel Simmer";
+  };
+  gnxlxnxx = {
+    email = "gnxlxnxx@web.de";
+    github = "gnxlxnxx";
+    githubId = 25820499;
+    name = "Roman Kretschmer";
+  };
+  goatchurchprime = {
+    email = "julian@goatchurch.org.uk";
+    github = "goatchurchprime";
+    githubId = 677254;
+    name = "Julian Todd";
+  };
+  gobidev = {
+    email = "adrian.groh@t-online.de";
+    github = "Gobidev";
+    githubId = 50576978;
+    name = "Adrian Groh";
+    keys = [{
+      fingerprint = "62BD BF30 83E9 7076 9665 B60B 3AA3 153E 98B0 D771";
+    }];
+  };
+  goertzenator = {
+    email = "daniel.goertzen@gmail.com";
+    github = "goertzenator";
+    githubId = 605072;
+    name = "Daniel Goertzen";
+  };
+  goibhniu = {
+    email = "cillian.deroiste@gmail.com";
+    github = "cillianderoiste";
+    githubId = 643494;
+    name = "Cillian de Róiste";
+  };
+  GoldsteinE = {
+    email = "root@goldstein.rs";
+    github = "GoldsteinE";
+    githubId = 12019211;
+    name = "Maximilian Siling";
+    keys = [{
+      fingerprint = "0BAF 2D87 CB43 746F 6237  2D78 DE60 31AB A0BB 269A";
+    }];
+  };
+  Gonzih = {
+    email = "gonzih@gmail.com";
+    github = "Gonzih";
+    githubId = 266275;
+    name = "Max Gonzih";
+  };
+  goodrone = {
+    email = "goodrone@gmail.com";
+    github = "goodrone";
+    githubId = 1621335;
+    name = "Andrew Trachenko";
+  };
+  gotcha = {
+    email = "gotcha@bubblenet.be";
+    github = "gotcha";
+    githubId = 105204;
+    name = "Godefroid Chapelle";
+  };
+  govanify = {
+    name = "Gauvain 'GovanifY' Roussel-Tarbouriech";
+    email = "gauvain@govanify.com";
+    github = "GovanifY";
+    githubId = 6375438;
+    keys = [{
+      fingerprint = "5214 2D39 A7CE F8FA 872B  CA7F DE62 E1E2 A614 5556";
+    }];
+  };
+  gp2112 = {
+    email = "me@guip.dev";
+    github = "gp2112";
+    githubId = 26512375;
+    name = "Guilherme Paixão";
+    keys = [{
+      fingerprint = "4382 7E28 86E5 C34F 38D5  7753 8C81 4D62 5FBD 99D1";
+    }];
+  };
+  gpanders = {
+    name = "Gregory Anders";
+    email = "greg@gpanders.com";
+    github = "gpanders";
+    githubId = 8965202;
+    keys = [{
+      fingerprint = "B9D5 0EDF E95E ECD0 C135  00A9 56E9 3C2F B6B0 8BDB";
+    }];
+  };
+  gpl = {
+    email = "nixos-6c64ce18-bbbc-414f-8dcb-f9b6b47fe2bc@isopleth.org";
+    github = "gpl";
+    githubId = 39648069;
+    name = "isogram";
+  };
+  gpyh = {
+    email = "yacine.hmito@gmail.com";
+    github = "yacinehmito";
+    githubId = 6893840;
+    name = "Yacine Hmito";
+  };
+  gracicot = {
+    email = "gracicot42@gmail.com";
+    github = "gracicot";
+    githubId = 2906673;
+    name = "Guillaume Racicot";
+  };
+  graham33 = {
+    email = "graham@grahambennett.org";
+    github = "graham33";
+    githubId = 10908649;
+    name = "Graham Bennett";
+  };
+  grahamc = {
+    email = "graham@grahamc.com";
+    github = "grahamc";
+    githubId = 76716;
+    name = "Graham Christensen";
+  };
+  gravndal = {
+    email = "gaute.ravndal+nixos@gmail.com";
+    github = "gravndal";
+    githubId = 4656860;
+    name = "Gaute Ravndal";
+  };
+  gray-heron = {
+    email = "ave+nix@cezar.info";
+    github = "gray-heron";
+    githubId = 7032646;
+    name = "Cezary Siwek";
+  };
+  graysonhead = {
+    email = "grayson@graysonhead.net";
+    github = "graysonhead";
+    githubId = 6179496;
+    name = "Grayson Head";
+  };
+  grburst = {
+    email = "GRBurst@protonmail.com";
+    github = "GRBurst";
+    githubId = 4647221;
+    name = "GRBurst";
+    keys = [{
+      fingerprint = "7FC7 98AB 390E 1646 ED4D  8F1F 797F 6238 68CD 00C2";
+    }];
+  };
+  greg = {
+    email = "greg.hellings@gmail.com";
+    github = "greg-hellings";
+    githubId = 273582;
+    name = "greg";
+  };
+  greizgh = {
+    email = "greizgh@ephax.org";
+    github = "greizgh";
+    githubId = 1313624;
+    name = "greizgh";
+  };
+  greydot = {
+    email = "lanablack@amok.cc";
+    github = "greydot";
+    githubId = 7385287;
+    name = "Lana Black";
+  };
+  gridaphobe = {
+    email = "eric@seidel.io";
+    github = "gridaphobe";
+    githubId = 201997;
+    name = "Eric Seidel";
+  };
+  grindhold = {
+    name = "grindhold";
+    email = "grindhold+nix@skarphed.org";
+    github = "grindhold";
+    githubId = 2592640;
+  };
+  grnnja = {
+    email = "grnnja@gmail.com";
+    github = "grnnja";
+    githubId = 31556469;
+    name = "Prem Netsuwan";
+  };
+  groodt = {
+    email = "groodt@gmail.com";
+    github = "groodt";
+    githubId = 343415;
+    name = "Greg Roodt";
+  };
+  gruve-p = {
+    email = "groestlcoin@gmail.com";
+    github = "gruve-p";
+    githubId = 11212268;
+    name = "gruve-p";
+  };
+  gschwartz = {
+    email = "gsch@pennmedicine.upenn.edu";
+    github = "GregorySchwartz";
+    githubId = 2490088;
+    name = "Gregory Schwartz";
+  };
+  gspia = {
+    email = "iahogsp@gmail.com";
+    github = "gspia";
+    githubId = 3320792;
+    name = "gspia";
+  };
+  gtrunsec = {
+    email = "gtrunsec@hardenedlinux.org";
+    github = "GTrunSec";
+    githubId = 21156405;
+    name = "GuangTao Zhang";
+  };
+  guekka = {
+    github = "Guekka";
+    githubId = 39066502;
+    name = "Guekka";
+  };
+  guibert = {
+    email = "david.guibert@gmail.com";
+    github = "dguibert";
+    githubId = 1178864;
+    name = "David Guibert";
+  };
+  guibou = {
+    email = "guillaum.bouchard@gmail.com";
+    github = "guibou";
+    githubId = 9705357;
+    name = "Guillaume Bouchard";
+  };
+  GuillaumeDesforges = {
+    email = "aceus02@gmail.com";
+    github = "GuillaumeDesforges";
+    githubId = 1882000;
+    name = "Guillaume Desforges";
+  };
+  guillaumekoenig = {
+    email = "guillaume.edward.koenig@gmail.com";
+    github = "guillaumekoenig";
+    githubId = 10654650;
+    name = "Guillaume Koenig";
+  };
+  guserav = {
+    github = "guserav";
+    githubId = 28863828;
+    name = "guserav";
+  };
+  guyonvarch = {
+    email = "joris@guyonvarch.me";
+    github = "guyonvarch";
+    githubId = 6768842;
+    name = "Joris Guyonvarch";
+  };
+  gvolpe = {
+    email = "volpegabriel@gmail.com";
+    github = "gvolpe";
+    githubId = 443978;
+    name = "Gabriel Volpe";
+  };
+  gytis-ivaskevicius = {
+    name = "Gytis Ivaskevicius";
+    email = "me@gytis.io";
+    matrix = "@gytis-ivaskevicius:matrix.org";
+    github = "gytis-ivaskevicius";
+    githubId = 23264966;
+  };
+  h7x4 = {
+    name = "h7x4";
+    email = "h7x4@nani.wtf";
+    matrix = "@h7x4:nani.wtf";
+    github = "h7x4";
+    githubId = 14929991;
+    keys = [{
+      fingerprint = "F7D3 7890 228A 9074 40E1  FD48 46B9 228E 814A 2AAC";
+    }];
+  };
+  hacker1024 = {
+    name = "hacker1024";
+    email = "hacker1024@users.sourceforge.net";
+    github = "hacker1024";
+    githubId = 20849728;
+  };
+  hagl = {
+    email = "harald@glie.be";
+    github = "hagl";
+    githubId = 1162118;
+    name = "Harald Gliebe";
+  };
+  hakuch = {
+    email = "hakuch@gmail.com";
+    github = "hakuch";
+    githubId = 1498782;
+    name = "Jesse Haber-Kucharsky";
+  };
+  hamburger1984 = {
+    email = "hamburger1984@gmail.com";
+    github = "hamburger1984";
+    githubId = 438976;
+    name = "Andreas Krohn";
+  };
+  hamhut1066 = {
+    email = "github@hamhut1066.com";
+    github = "moredhel";
+    githubId = 1742172;
+    name = "Hamish Hutchings";
+  };
+  hanemile = {
+    email = "mail@emile.space";
+    github = "HanEmile";
+    githubId = 22756350;
+    name = "Emile Hansmaennel";
+  };
+  hansjoergschurr = {
+    email = "commits@schurr.at";
+    github = "hansjoergschurr";
+    githubId = 9850776;
+    name = "Hans-Jörg Schurr";
+  };
+  HaoZeke = {
+    email = "r95g10@gmail.com";
+    github = "HaoZeke";
+    githubId = 4336207;
+    name = "Rohit Goswami";
+    keys = [{
+      fingerprint = "74B1 F67D 8E43 A94A 7554  0768 9CCC E364 02CB 49A6";
+    }];
+  };
+  happyalu = {
+    email = "alok@parlikar.com";
+    github = "happyalu";
+    githubId = 231523;
+    name = "Alok Parlikar";
+  };
+  happy-river = {
+    email = "happyriver93@runbox.com";
+    github = "happy-river";
+    githubId = 54728477;
+    name = "Happy River";
+  };
+  happysalada = {
+    email = "raphael@megzari.com";
+    matrix = "@happysalada:matrix.org";
+    github = "happysalada";
+    githubId = 5317234;
+    name = "Raphael Megzari";
+  };
+  hardselius = {
+    email = "martin@hardselius.dev";
+    github = "hardselius";
+    githubId = 1422583;
+    name = "Martin Hardselius";
+    keys = [{
+      fingerprint = "3F35 E4CA CBF4 2DE1 2E90  53E5 03A6 E6F7 8693 6619";
+    }];
+  };
+  harrisonthorne = {
+    email = "harrisonthorne@proton.me";
+    github = "muni-corn";
+    githubId = 33523827;
+    name = "Harrison Thorne";
+  };
+  haruki7049 = {
+    email = "tontonkirikiri@gmail.com";
+    github = "haruki7049";
+    githubId = 64677724;
+    name = "haruki7049";
+  };
+  harvidsen = {
+    email = "harvidsen@gmail.com";
+    github = "harvidsen";
+    githubId = 62279738;
+    name = "Håkon Arvidsen";
+  };
+  haslersn = {
+    email = "haslersn@fius.informatik.uni-stuttgart.de";
+    github = "haslersn";
+    githubId = 33969028;
+    name = "Sebastian Hasler";
+  };
+  havvy = {
+    email = "ryan.havvy@gmail.com";
+    github = "Havvy";
+    githubId = 731722;
+    name = "Ryan Scheel";
+  };
+  hawkw = {
+    email = "eliza@elizas.website";
+    github = "hawkw";
+    githubId = 2796466;
+    name = "Eliza Weisman";
+  };
+  hax404 = {
+    email = "hax404foogit@hax404.de";
+    matrix = "@hax404:hax404.de";
+    github = "hax404";
+    githubId = 1379411;
+    name = "Georg Haas";
+  };
+  hbjydev = {
+    email = "hayden@kuraudo.io";
+    github = "hbjydev";
+    githubId = 22327045;
+    name = "Hayden Young";
+  };
+  hbunke = {
+    email = "bunke.hendrik@gmail.com";
+    github = "hbunke";
+    githubId = 1768793;
+    name = "Hendrik Bunke";
+  };
+  hce = {
+    email = "hc@hcesperer.org";
+    github = "hce";
+    githubId = 147689;
+    name = "Hans-Christian Esperer";
+  };
+  hdhog = {
+    name = "Serg Larchenko";
+    email = "hdhog@hdhog.ru";
+    github = "hdhog";
+    githubId = 386666;
+    keys = [{
+      fingerprint = "A25F 6321 AAB4 4151 4085  9924 952E ACB7 6703 BA63";
+    }];
+  };
+  hectorj = {
+    email = "hector.jusforgues+nixos@gmail.com";
+    github = "hectorj";
+    githubId = 2427959;
+    name = "Hector Jusforgues";
+  };
+  hedning = {
+    email = "torhedinbronner@gmail.com";
+    github = "hedning";
+    githubId = 71978;
+    name = "Tor Hedin Brønner";
+  };
+  heel = {
+    email = "parizhskiy@gmail.com";
+    github = "HeeL";
+    githubId = 287769;
+    name = "Sergii Paryzhskyi";
+  };
+  heisfer = {
+    email = "heisfer@refract.dev";
+    github = "heisfer";
+    githubId = 28564678;
+    matrix = "@heisfer:matrix.org";
+    name = "Heisfer";
+  };
+  helium = {
+    email = "helium.dev@tuta.io";
+    github = "helium18";
+    githubId = 86223025;
+    name = "helium";
+  };
+  helkafen = {
+    email = "arnaudpourseb@gmail.com";
+    github = "Helkafen";
+    githubId = 2405974;
+    name = "Sébastian Méric de Bellefon";
+  };
+  hellwolf = {
+    email = "zhicheng.miao@gmail.com";
+    github = "hellwolf";
+    githubId = 186660;
+    name = "Miao, ZhiCheng";
+  };
+  henkery = {
+    email = "jim@reupload.nl";
+    github = "henkery";
+    githubId = 1923309;
+    name = "Jim van Abkoude";
+  };
+  henkkalkwater = {
+    email = "chris+nixpkgs@netsoj.nl";
+    github = "HenkKalkwater";
+    githubId = 4262067;
+    matrix = "@chris:netsoj.nl";
+    name = "Chris Josten";
+  };
+  henrikolsson = {
+    email = "henrik@fixme.se";
+    github = "henrikolsson";
+    githubId = 982322;
+    name = "Henrik Olsson";
+  };
+  henrirosten = {
+    email = "henri.rosten@unikie.com";
+    github = "henrirosten";
+    githubId = 49935860;
+    name = "Henri Rosten";
+  };
+  henrytill = {
+    email = "henrytill@gmail.com";
+    github = "henrytill";
+    githubId = 6430643;
+    name = "Henry Till";
+  };
+  heph2 = {
+    email = "srht@mrkeebs.eu";
+    github = "heph2";
+    githubId = 87579883;
+    name = "Marco";
+  };
+  herberteuler = {
+    email = "herberteuler@gmail.com";
+    github = "herberteuler";
+    githubId = 1401179;
+    name = "Guanpeng Xu";
+  };
+  herbetom = {
+    email = "nixos@tomherbers.de";
+    github = "herbetom";
+    githubId = 15121114;
+    name = "Tom Herbers";
+  };
+  hexa = {
+    email = "hexa@darmstadt.ccc.de";
+    matrix = "@hexa:lossy.network";
+    github = "mweinelt";
+    githubId = 131599;
+    name = "Martin Weinelt";
+  };
+  hexagonal-sun = {
+    email = "dev@mattleach.net";
+    github = "hexagonal-sun";
+    githubId = 222664;
+    name = "Matthew Leach";
+  };
+  hexchen = {
+    email = "nix@lilwit.ch";
+    github = "hexchen";
+    githubId = 41522204;
+    name = "hexchen";
+  };
+  hexclover = {
+    email = "hexclover@outlook.com";
+    github = "hexclover";
+    githubId = 47456195;
+    name = "hexclover";
+  };
+  heyimnova = {
+    email = "git@heyimnova.dev";
+    github = "heyimnova";
+    githubId = 115728866;
+    name = "Nova Witterick";
+    keys = [{
+      fingerprint = "4304 6B43 8D83 078E 3DF7  10D6 DEB0 E15C 6D2A 5A7C";
+    }];
+  };
+  hh = {
+    email = "hh@m-labs.hk";
+    github = "HarryMakes";
+    githubId = 66358631;
+    name = "Harry Ho";
+  };
+  hhm = {
+    email = "heehooman+nixpkgs@gmail.com";
+    github = "hhm0";
+    githubId = 3656888;
+    name = "hhm";
+  };
+  hhydraa = {
+    email = "hcurfman@keemail.me";
+    github = "hhydraa";
+    githubId = 58676303;
+    name = "hhydraa";
+  };
+  higebu = {
+    name = "Yuya Kusakabe";
+    email = "yuya.kusakabe@gmail.com";
+    github = "higebu";
+    githubId = 733288;
+  };
+
+  hikari = {
+    email = "HikariNee@protonmail.com";
+    github = "HikariNee";
+    githubId = 72349937;
+    name = "Hikari";
+  };
+  hirenashah = {
+    email = "hiren@hiren.io";
+    github = "hirenashah";
+    githubId = 19825977;
+    name = "Hiren Shah";
+  };
+
+  hiro98 = {
+    email = "hiro@protagon.space";
+    github = "vale981";
+    githubId = 4025991;
+    name = "Valentin Boettcher";
+    keys = [{
+      fingerprint = "45A9 9917 578C D629 9F5F  B5B4 C22D 4DE4 D7B3 2D19";
+    }];
+  };
+  hitsmaxft = {
+    name = "Bhe Hongtyu";
+    email = "mfthits@gmail.com";
+    github = "hitsmaxft";
+    githubId = 352727;
+  };
+  hjones2199 = {
+    email = "hjones2199@gmail.com";
+    github = "hjones2199";
+    githubId = 5525217;
+    name = "Hunter Jones";
+  };
+  hkjn = {
+    email = "me@hkjn.me";
+    name = "Henrik Jonsson";
+    github = "hkjn";
+    githubId = 287215;
+    keys = [{
+      fingerprint = "D618 7A03 A40A 3D56 62F5  4B46 03EF BF83 9A5F DC15";
+    }];
+  };
+  hleboulanger = {
+    email = "hleboulanger@protonmail.com";
+    name = "Harold Leboulanger";
+    github = "thbkrshw";
+    githubId = 33122;
+  };
+  hloeffler = {
+    name = "Hauke Löffler";
+    email = "nix@hauke-loeffler.de";
+    github = "hloeffler";
+    githubId = 6627191;
+  };
+  hlolli = {
+    email = "hlolli@gmail.com";
+    github = "hlolli";
+    githubId = 6074754;
+    name = "Hlodver Sigurdsson";
+  };
+  hmajid2301 = {
+    name = "Haseeb Majid";
+    email = "hello@haseebmajid.dev";
+    github = "hmajid2301";
+    githubId = 998807;
+    keys = [{
+      fingerprint = "A236 785D 59F1 9076 1E9C E8EC 7828 3DB3 D233 E1F9";
+    }];
+  };
+  hmenke = {
+    name = "Henri Menke";
+    email = "henri@henrimenke.de";
+    matrix = "@hmenke:matrix.org";
+    github = "hmenke";
+    githubId = 1903556;
+    keys = [{
+      fingerprint = "F1C5 760E 45B9 9A44 72E9  6BFB D65C 9AFB 4C22 4DA3";
+    }];
+  };
+  hodapp = {
+    email = "hodapp87@gmail.com";
+    github = "Hodapp87";
+    githubId = 896431;
+    name = "Chris Hodapp";
+  };
+  holgerpeters = {
+    name = "Holger Peters";
+    email = "holger.peters@posteo.de";
+    github = "HolgerPeters";
+    githubId = 4097049;
+  };
+  hollowman6 = {
+    email = "hollowman@hollowman.ml";
+    github = "HollowMan6";
+    githubId = 43995067;
+    name = "Songlin Jiang";
+  };
+  holymonson = {
+    email = "holymonson@gmail.com";
+    github = "holymonson";
+    githubId = 902012;
+    name = "Monson Shao";
+  };
+  hongchangwu = {
+    email = "wuhc85@gmail.com";
+    github = "hongchangwu";
+    githubId = 362833;
+    name = "Hongchang Wu";
+  };
+  honnip = {
+    name = "Jung seungwoo";
+    email = "me@honnip.page";
+    matrix = "@honnip:matrix.org";
+    github = "honnip";
+    githubId = 108175486;
+    keys = [{
+      fingerprint = "E4DD 51F7 FA3F DCF1 BAF6  A72C 576E 43EF 8482 E415";
+    }];
+  };
+  hoppla20 = {
+    email = "privat@vincentcui.de";
+    github = "hoppla20";
+    githubId = 25618740;
+    name = "Vincent Cui";
+  };
+  hoverbear = {
+    email = "operator+nix@hoverbear.org";
+    matrix = "@hoverbear:matrix.org";
+    github = "Hoverbear";
+    githubId = 130903;
+    name = "Ana Hobden";
+  };
+  hqurve = {
+    email = "hqurve@outlook.com";
+    github = "hqurve";
+    githubId = 53281855;
+    name = "hqurve";
+  };
+  hraban = {
+    email = "hraban@0brg.net";
+    github = "hraban";
+    githubId = 137852;
+    name = "Hraban Luyat";
+  };
+  hrdinka = {
+    email = "c.nix@hrdinka.at";
+    github = "hrdinka";
+    githubId = 1436960;
+    name = "Christoph Hrdinka";
+  };
+  hrhino = {
+    email = "hora.rhino@gmail.com";
+    github = "hrhino";
+    githubId = 28076058;
+    name = "Harrison Houghton";
+  };
+  hschaeidt = {
+    email = "he.schaeidt@gmail.com";
+    github = "hschaeidt";
+    githubId = 1614615;
+    name = "Hendrik Schaeidt";
+  };
+  htr = {
+    email = "hugo@linux.com";
+    github = "htr";
+    githubId = 39689;
+    name = "Hugo Tavares Reis";
+  };
+  huantian = {
+    name = "David Li";
+    email = "davidtianli@gmail.com";
+    matrix = "@huantian:huantian.dev";
+    github = "huantianad";
+    githubId = 20760920;
+    keys = [{
+      fingerprint = "731A 7A05 AD8B 3AE5 956A  C227 4A03 18E0 4E55 5DE5";
+    }];
+  };
+  hubble = {
+    name = "Hubble the Wolverine";
+    email = "hubblethewolverine@gmail.com";
+    matrix = "@hubofeverything:bark.lgbt";
+    github = "the-furry-hubofeverything";
+    githubId = 53921912;
+  };
+  hufman = {
+    email = "hufman@gmail.com";
+    github = "hufman";
+    githubId = 1592375;
+    name = "Walter Huf";
+  };
+  hughobrien = {
+    email = "github@hughobrien.ie";
+    github = "hughobrien";
+    githubId = 3400690;
+    name = "Hugh O'Brien";
+  };
+  hugolgst = {
+    email = "hugo.lageneste@pm.me";
+    github = "hugolgst";
+    githubId = 15371828;
+    name = "Hugo Lageneste";
+  };
+  hugoreeves = {
+    email = "hugo@hugoreeves.com";
+    github = "HugoReeves";
+    githubId = 20039091;
+    name = "Hugo Reeves";
+    keys = [{
+      fingerprint = "78C2 E81C 828A 420B 269A  EBC1 49FA 39F8 A7F7 35F9";
+    }];
+  };
+  hulr = {
+    github = "hulr";
+    githubId = 17255815;
+    name = "hulr";
+  };
+  humancalico = {
+    email = "humancalico@disroot.org";
+    github = "humancalico";
+    githubId = 51334444;
+    name = "Akshat Agarwal";
+  };
+  hummeltech = {
+    email = "hummeltech2024@gmail.com";
+    github = "hummeltech";
+    githubId = 6109326;
+    name = "David Hummel";
+  };
+  huyngo = {
+    email = "huyngo@disroot.org";
+    github = "Huy-Ngo";
+    name = "Ngô Ngọc Đức Huy";
+    githubId = 19296926;
+    keys = [{
+      fingerprint = "DF12 23B1 A9FD C5BE 3DA5  B6F7 904A F1C7 CDF6 95C3";
+    }];
+  };
+  hypersw = {
+    email = "baltic@hypersw.net";
+    github = "hypersw";
+    githubId = 2332070;
+    name = "Serge Baltic";
+  };
+  hyphon81 = {
+    email = "zero812n@gmail.com";
+    github = "hyphon81";
+    githubId = 12491746;
+    name = "Masato Yonekawa";
+  };
+  hyshka = {
+    name = "Bryan Hyshka";
+    email = "bryan@hyshka.com";
+    github = "hyshka";
+    githubId = 2090758;
+    keys = [{
+      fingerprint = "24F4 1925 28C4 8797 E539  F247 DB2D 93D1 BFAA A6EA";
+    }];
+  };
+  hyzual = {
+    email = "hyzual@gmail.com";
+    github = "Hyzual";
+    githubId = 2051507;
+    name = "Joris Masson";
+  };
+  hzeller = {
+    email = "h.zeller@acm.org";
+    github = "hzeller";
+    githubId = 140937;
+    name = "Henner Zeller";
+  };
+  i077 = {
+    email = "nixpkgs@imranhossa.in";
+    github = "i077";
+    githubId = 2789926;
+    name = "Imran Hossain";
+  };
+  iagoq = {
+    github = "iagocq";
+    githubId = 18238046;
+    name = "Iago Manoel Brito";
+    keys = [{
+      fingerprint = "DF90 9D58 BEE4 E73A 1B8C  5AF3 35D3 9F9A 9A1B C8DA";
+    }];
+  };
+  iammrinal0 = {
+    email = "nixpkgs@mrinalpurohit.in";
+    matrix = "@iammrinal0:nixos.dev";
+    github = "iAmMrinal0";
+    githubId = 890062;
+    name = "Mrinal";
+  };
+  iand675 = {
+    email = "ian@iankduncan.com";
+    github = "iand675";
+    githubId = 69209;
+    name = "Ian Duncan";
+  };
+  ianliu = {
+    email = "ian.liu88@gmail.com";
+    github = "ianliu";
+    githubId = 30196;
+    name = "Ian Liu Rodrigues";
+  };
+  ianmjones = {
+    email = "ian@ianmjones.com";
+    github = "ianmjones";
+    githubId = 4710;
+    name = "Ian M. Jones";
+  };
+  ianwookim = {
+    email = "ianwookim@gmail.com";
+    github = "wavewave";
+    githubId = 1031119;
+    name = "Ian-Woo Kim";
+  };
+  ibizaman = {
+    email = "ibizapeanut@gmail.com";
+    github = "ibizaman";
+    githubId = 1044950;
+    name = "Pierre Penninckx";
+    keys = [{
+      fingerprint = "A01F 10C6 7176 B2AE 2A34  1A56 D4C5 C37E 6031 A3FE";
+    }];
+  };
+  iblech = {
+    email = "iblech@speicherleck.de";
+    github = "iblech";
+    githubId = 3661115;
+    name = "Ingo Blechschmidt";
+  };
+  icewind1991 = {
+    name = "Robin Appelman";
+    email = "robin@icewind.nl";
+    github = "icewind1991";
+    githubId = 1283854;
+  };
+  icyrockcom = {
+    github = "icyrockcom";
+    githubId = 785140;
+    name = "icyrock";
+  };
+  icy-thought = {
+    name = "Icy-Thought";
+    email = "gilganyx@pm.me";
+    matrix = "@gilganix:matrix.org";
+    github = "Icy-Thought";
+    githubId = 53710398;
+  };
+  idlip = {
+    name = "Dilip";
+    email = "igoldlip@gmail.com";
+    github = "idlip";
+    githubId = 117019901;
+  };
+  idontgetoutmuch = {
+    email = "dominic@steinitz.org";
+    github = "idontgetoutmuch";
+    githubId = 1550265;
+    name = "Dominic Steinitz";
+  };
+  iFreilicht = {
+    github = "iFreilicht";
+    githubId = 9742635;
+    matrix = "@ifreilicht:matrix.org";
+    email = "nixpkgs@mail.felix-uhl.de";
+    name = "Felix Uhl";
+  };
+  ifurther = {
+    github = "ifurther";
+    githubId = 55025025;
+    name = "Feather Lin";
+  };
+  igsha = {
+    email = "igor.sharonov@gmail.com";
+    github = "igsha";
+    githubId = 5345170;
+    name = "Igor Sharonov";
+  };
+  iimog = {
+    email = "iimog@iimog.org";
+    github = "iimog";
+    githubId = 7403236;
+    name = "Markus J. Ankenbrand";
+  };
+  ikervagyok = {
+    email = "ikervagyok@gmail.com";
+    github = "ikervagyok";
+    githubId = 7481521;
+    name = "Balázs Lengyel";
+  };
+  ilian = {
+    email = "ilian@tuta.io";
+    github = "ilian";
+    githubId = 25505957;
+    name = "Ilian";
+  };
+  iliayar = {
+    email = "iliayar3@gmail.com";
+    github = "iliayar";
+    githubId = 17529355;
+    name = "Ilya Yaroshevskiy";
+  };
+  ilikeavocadoes = {
+    email = "ilikeavocadoes@hush.com";
+    github = "ilikeavocadoes";
+    githubId = 36193715;
+    name = "Lassi Haasio";
+  };
+  ilkecan = {
+    email = "ilkecan@protonmail.com";
+    matrix = "@ilkecan:matrix.org";
+    github = "ilkecan";
+    githubId = 40234257;
+    name = "ilkecan bozdogan";
+  };
+  illegalprime = {
+    email = "themichaeleden@gmail.com";
+    github = "illegalprime";
+    githubId = 4401220;
+    name = "Michael Eden";
+  };
+  illiusdope = {
+    email = "mat@marini.ca";
+    github = "illiusdope";
+    githubId = 61913481;
+    name = "Mat Marini";
+  };
+  illustris = {
+    email = "me@illustris.tech";
+    github = "illustris";
+    githubId = 3948275;
+    name = "Harikrishnan R";
+  };
+  ilya-fedin = {
+    email = "fedin-ilja2010@ya.ru";
+    github = "ilya-fedin";
+    githubId = 17829319;
+    name = "Ilya Fedin";
+  };
+  ilya-kolpakov = {
+    email = "ilya.kolpakov@gmail.com";
+    github = "1pakch";
+    githubId = 592849;
+    name = "Ilya Kolpakov";
+  };
+  ilyakooo0 = {
+    name = "Ilya Kostyuchenko";
+    email = "ilyakooo0@gmail.com";
+    github = "ilyakooo0";
+    githubId = 6209627;
+  };
+  imalison = {
+    email = "IvanMalison@gmail.com";
+    github = "colonelpanic8";
+    githubId = 1246619;
+    name = "Ivan Malison";
+  };
+  imalsogreg = {
+    email = "imalsogreg@gmail.com";
+    github = "imalsogreg";
+    githubId = 993484;
+    name = "Greg Hale";
+  };
+  imgabe = {
+    email = "gabrielpmonte@hotmail.com";
+    github = "ImGabe";
+    githubId = 24387926;
+    name = "Gabriel Pereira";
+  };
+  imincik = {
+    email = "ivan.mincik@gmail.com";
+    matrix = "@imincik:matrix.org";
+    github = "imincik";
+    githubId = 476346;
+    name = "Ivan Mincik";
+  };
+  imlonghao = {
+    email = "nixos@esd.cc";
+    github = "imlonghao";
+    githubId = 4951333;
+    name = "Hao Long";
+  };
+  immae = {
+    email = "ismael@bouya.org";
+    matrix = "@immae:immae.eu";
+    github = "immae";
+    githubId = 510202;
+    name = "Ismaël Bouya";
+  };
+  impl = {
+    email = "noah@noahfontes.com";
+    matrix = "@impl:matrix.org";
+    github = "impl";
+    githubId = 41129;
+    name = "Noah Fontes";
+    keys = [{
+      fingerprint = "F5B2 BE1B 9AAD 98FE 2916  5597 3665 FFF7 9D38 7BAA";
+    }];
+  };
+  imuli = {
+    email = "i@imu.li";
+    github = "imuli";
+    githubId = 4085046;
+    name = "Imuli";
+  };
+  inclyc = {
+    email = "i@lyc.dev";
+    github = "inclyc";
+    githubId = 36667224;
+    name = "Yingchi Long";
+  };
+  indexyz = {
+    email = "indexyz@pm.me";
+    github = "5aaee9";
+    githubId = 7685264;
+    name = "Indexyz";
+  };
+  ineol = {
+    email = "leo.stefanesco@gmail.com";
+    github = "ineol";
+    githubId = 37965;
+    name = "Léo Stefanesco";
+  };
+  infinidoge = {
+    name = "Infinidoge";
+    email = "infinidoge@inx.moe";
+    github = "Infinidoge";
+    githubId = 22727114;
+  };
+  infinisil = {
+    email = "contact@infinisil.com";
+    matrix = "@infinisil:matrix.org";
+    github = "infinisil";
+    githubId = 20525370;
+    name = "Silvan Mosberger";
+    keys = [{
+      fingerprint = "6C2B 55D4 4E04 8266 6B7D  DA1A 422E 9EDA E015 7170";
+    }];
+  };
+  infinitivewitch = {
+    name = "Infinitive Witch";
+    email = "infinitivewitch@disroot.org";
+    matrix = "@infinitivewitch:fedora.im";
+    github = "infinitivewitch";
+    githubId = 128256833;
+    keys = [{
+      fingerprint = "CF3D F4AD C7BD 1FDB A88B  E4B3 CA2D 43DA 939D 94FB";
+    }];
+  };
+  ingenieroariel = {
+    email = "ariel@nunez.co";
+    github = "ingenieroariel";
+    githubId = 54999;
+    name = "Ariel Nunez";
+  };
+  Intuinewin = {
+    email = "antoinelabarussias@gmail.com";
+    github = "Intuinewin";
+    githubId = 13691729;
+    name = "Antoine Labarussias";
+    keys = [{
+      fingerprint = "5CB5 9AA0 D180 1997 2FB3  E0EC 943A 1DE9 372E BE4E";
+    }];
+  };
+  invokes-su = {
+    email = "nixpkgs-commits@deshaw.com";
+    github = "invokes-su";
+    githubId = 88038050;
+    name = "Souvik Sen";
+  };
+  iogamaster = {
+    email = "iogamastercode+nixpkgs@gmail.com";
+    name = "IogaMaster";
+    github = "iogamaster";
+    githubId = 67164465;
+  };
+  ionutnechita = {
+    email = "ionut_n2001@yahoo.com";
+    github = "ionutnechita";
+    githubId = 9405900;
+    name = "Ionut Nechita";
+  };
+  iopq = {
+    email = "iop_jr@yahoo.com";
+    github = "iopq";
+    githubId = 1817528;
+    name = "Igor Polyakov";
+  };
+  iquerejeta = {
+    github = "iquerejeta";
+    githubId = 31273774;
+    name = "Inigo Querejeta-Azurmendi";
+  };
+  irenes = {
+    name = "Irene Knapp";
+    email = "ireneista@gmail.com";
+    matrix = "@irenes:matrix.org";
+    github = "IreneKnapp";
+    githubId = 157678;
+    keys = [{
+      fingerprint = "E864 BDFA AB55 36FD C905  5195 DBF2 52AF FB26 19FD";
+    }];
+  };
+  ironicbadger = {
+    email = "alexktz@gmail.com";
+    github = "ironicbadger";
+    githubId = 2773080;
+    name = "Alex Kretzschmar";
+  };
+  ironpinguin = {
+    email = "michele@catalano.de";
+    github = "ironpinguin";
+    githubId = 137306;
+    name = "Michele Catalano";
+  };
+  isaozler = {
+    email = "isaozler@gmail.com";
+    github = "isaozler";
+    githubId = 1378630;
+    name = "Isa Ozler";
+  };
+  isgy = {
+    name = "isgy";
+    email = "isgy@teiyg.com";
+    github = "tgys";
+    githubId = 13622947;
+    keys = [{
+      fingerprint = "1412 816B A9FA F62F D051 1975 D3E1 B013 B463 1293";
+    }];
+  };
+  ius = {
+    email = "j.de.gram@gmail.com";
+    name = "Joerie de Gram";
+    matrix = "@ius:nltrix.net";
+    github = "ius";
+    githubId = 529626;
+  };
+  ivan = {
+    email = "ivan@ludios.org";
+    github = "ivan";
+    githubId = 4458;
+    name = "Ivan Kozik";
+  };
+  ivan770 = {
+    email = "ivan@ivan770.me";
+    github = "ivan770";
+    githubId = 14003886;
+    name = "Ivan Leshchenko";
+  };
+  ivan-babrou = {
+    email = "nixpkgs@ivan.computer";
+    name = "Ivan Babrou";
+    github = "bobrik";
+    githubId = 89186;
+  };
+  ivanbrennan = {
+    email = "ivan.brennan@gmail.com";
+    github = "ivanbrennan";
+    githubId = 1672874;
+    name = "Ivan Brennan";
+    keys = [{
+      fingerprint = "7311 2700 AB4F 4CDF C68C  F6A5 79C3 C47D C652 EA54";
+    }];
+  };
+  ivankovnatsky = {
+    github = "ivankovnatsky";
+    githubId = 75213;
+    name = "Ivan Kovnatsky";
+    keys = [{
+      fingerprint = "6BD3 7248 30BD 941E 9180  C1A3 3A33 FA4C 82ED 674F";
+    }];
+  };
+  ivanmoreau = {
+    email = "Iván Molina Rebolledo";
+    github = "ivanmoreau";
+    githubId = 10843250;
+    name = "ivan@ivmoreau.com";
+  };
+  ivan-timokhin = {
+    email = "nixpkgs@ivan.timokhin.name";
+    name = "Ivan Timokhin";
+    github = "ivan-timokhin";
+    githubId = 9802104;
+  };
+  ivan-tkatchev = {
+    email = "tkatchev@gmail.com";
+    github = "ivan-tkatchev";
+    githubId = 650601;
+    name = "Ivan Tkatchev";
+  };
+  ivar = {
+    email = "ivar.scholten@protonmail.com";
+    github = "IvarWithoutBones";
+    githubId = 41924494;
+    name = "Ivar";
+  };
+  ivarmedi = {
+    email = "ivar@larsson.me";
+    github = "ivarmedi";
+    githubId = 1318743;
+    name = "Ivar";
+  };
+  iwanb = {
+    email = "tracnar@gmail.com";
+    github = "iwanb";
+    githubId = 4035835;
+    name = "Iwan";
+  };
+  ixmatus = {
+    email = "parnell@digitalmentat.com";
+    github = "ixmatus";
+    githubId = 30714;
+    name = "Parnell Springmeyer";
+  };
+  ixxie = {
+    email = "matan@fluxcraft.net";
+    github = "ixxie";
+    githubId = 20320695;
+    name = "Matan Bendix Shenhav";
+  };
+  iynaix = {
+    email = "iynaix@gmail.com";
+    github = "iynaix";
+    githubId = 94313;
+    name = "Xianyi Lin";
+  };
+  izorkin = {
+    email = "Izorkin@gmail.com";
+    github = "Izorkin";
+    githubId = 26877687;
+    name = "Yurii Izorkin";
+  };
+  j03 = {
+    email = "github@johannesloetzsch.de";
+    github = "johannesloetzsch";
+    githubId = 175537;
+    name = "Johannes Lötzsch";
+  };
+  j0hax = {
+    name = "Johannes Arnold";
+    email = "johannes.arnold@stud.uni-hannover.de";
+    github = "j0hax";
+    githubId = 3802620;
+  };
+  j0lol = {
+    name = "Jo";
+    email = "me@j0.lol";
+    github = "j0lol";
+    githubId = 24716467;
+  };
+  j0xaf = {
+    email = "j0xaf@j0xaf.de";
+    name = "Jörn Gersdorf";
+    github = "j0xaf";
+    githubId = 932697;
+  };
+  j4m3s = {
+    name = "James Landrein";
+    email = "github@j4m3s.eu";
+    github = "j4m3s-s";
+    githubId = 9413812;
+  };
+  jacbart = {
+    name = "Jack Bartlett";
+    email = "jacbart@gmail.com";
+    github = "jacbart";
+    githubId = 7909687;
+  };
+  jacfal = {
+    name = "Jakub Pravda";
+    email = "me@jakubpravda.net";
+    github = "jakub-pravda";
+    githubId = 16310411;
+  };
+  jacg = {
+    name = "Jacek Generowicz";
+    email = "jacg@my-post-office.net";
+    github = "jacg";
+    githubId = 2570854;
+  };
+  jackgerrits = {
+    email = "jack@jackgerrits.com";
+    github = "jackgerrits";
+    githubId = 7558482;
+    name = "Jack Gerrits";
+  };
+  jaduff = {
+    email = "jdduffpublic@proton.me";
+    github = "jaduff";
+    githubId = 10690970;
+    name = "James Duff";
+  };
+  jagajaga = {
+    email = "ars.seroka@gmail.com";
+    github = "jagajaga";
+    githubId = 2179419;
+    name = "Arseniy Seroka";
+  };
+  jakehamilton = {
+    name = "Jake Hamilton";
+    email = "jake.hamilton@hey.com";
+    matrix = "@jakehamilton:matrix.org";
+    github = "jakehamilton";
+    githubId = 7005773;
+    keys = [{
+      fingerprint = "B982 0250 1720 D540 6A18  2DA8 188E 4945 E85B 2D21";
+    }];
+  };
+  jakeisnt = {
+    name = "Jacob Chvatal";
+    email = "jake@isnt.online";
+    github = "jakeisnt";
+    githubId = 29869612;
+  };
+  jakelogemann = {
+    email = "jake.logemann@gmail.com";
+    github = "jakelogemann";
+    githubId = 820715;
+    name = "Jake Logemann";
+  };
+  jakestanger = {
+    email = "mail@jstanger.dev";
+    github = "JakeStanger";
+    githubId = 5057870;
+    name = "Jake Stanger";
+  };
+  jakewaksbaum = {
+    email = "jake.waksbaum@gmail.com";
+    github = "jbaum98";
+    githubId = 5283991;
+    name = "Jake Waksbaum";
+  };
+  jakubgs = {
+    email = "jakub@gsokolowski.pl";
+    github = "jakubgs";
+    githubId = 2212681;
+    name = "Jakub Grzgorz Sokołowski";
+  };
+  jakuzure = {
+    email = "shin@posteo.jp";
+    github = "jakuzure";
+    githubId = 11823547;
+    name = "jakuzure";
+  };
+  jali-clarke = {
+    email = "jinnah.ali-clarke@outlook.com";
+    name = "Jinnah Ali-Clarke";
+    github = "jali-clarke";
+    githubId = 17733984;
+  };
+  james-atkins = {
+    name = "James Atkins";
+    github = "james-atkins";
+    githubId = 9221409;
+  };
+  jamiemagee = {
+    email = "jamie.magee@gmail.com";
+    github = "JamieMagee";
+    githubId = 1358764;
+    name = "Jamie Magee";
+  };
+  janik = {
+    name = "Janik";
+    email = "janik@aq0.de";
+    matrix = "@janik0:matrix.org";
+    github = "Janik-Haag";
+    githubId = 80165193;
+  };
+  jankaifer = {
+    name = "Jan Kaifer";
+    email = "jan@kaifer.cz";
+    github = "jankaifer";
+    githubId = 12820484;
+  };
+  jansol = {
+    email = "jan.solanti@paivola.fi";
+    github = "jansol";
+    githubId = 2588851;
+    name = "Jan Solanti";
+  };
+  jappie = {
+    email = "jappieklooster@hotmail.com";
+    github = "jappeace";
+    githubId = 3874017;
+    name = "Jappie Klooster";
+  };
+  jasoncarr = {
+    email = "jcarr250@gmail.com";
+    github = "jasoncarr0";
+    githubId = 6874204;
+    name = "Jason Carr";
+  };
+  jasonodoom = {
+    email = "jasonodoom@riseup.net";
+    github = "jasonodoom";
+    githubId = 6789916;
+    name = "Jason Odoom";
+  };
+  javaguirre = {
+    email = "contacto@javaguirre.net";
+    github = "javaguirre";
+    githubId = 488556;
+    name = "Javier Aguirre";
+  };
+  javimerino = {
+    email = "merino.jav@gmail.com";
+    name = "Javi Merino";
+    github = "JaviMerino";
+    githubId = 44926;
+  };
+  jayesh-bhoot = {
+    name = "Jayesh Bhoot";
+    email = "jb@jayeshbhoot.com";
+    github = "jyssh";
+    githubId = 1915507;
+  };
+  jayman2000 = {
+    email = "jason@jasonyundt.email";
+    github = "Jayman2000";
+    githubId = 5579359;
+    name = "Jason Yundt";
+  };
+  jb55 = {
+    email = "jb55@jb55.com";
+    github = "jb55";
+    githubId = 45598;
+    name = "William Casarin";
+  };
+  jbcrail = {
+    name = "Joseph Crail";
+    email = "jbcrail@gmail.com";
+    github = "jbcrail";
+    githubId = 6038;
+  };
+  jbedo = {
+    email = "cu@cua0.org";
+    matrix = "@jb:vk3.wtf";
+    github = "jbedo";
+    githubId = 372912;
+    name = "Justin Bedő";
+  };
+  jbgi = {
+    email = "jb@giraudeau.info";
+    github = "jbgi";
+    githubId = 221929;
+    name = "Jean-Baptiste Giraudeau";
+  };
+  jbgosselin = {
+    email = "gosselinjb@gmail.com";
+    matrix = "@dennajort:matrix.org";
+    github = "jbgosselin";
+    githubId = 1536838;
+    name = "Jean-Baptiste Gosselin";
+  };
+  jboy = {
+    email = "jboy+nixos@bius.moe";
+    githubId = 2187261;
+    github = "jboynyc";
+    matrix = "@jboy:utwente.io";
+    name = "John Boy";
+  };
+  j-brn = {
+    email = "me@bricker.io";
+    github = "j-brn";
+    githubId = 40566146;
+    name = "Jonas Braun";
+  };
+  jc = {
+    name = "Josh Cooper";
+    email = "josh@cooper.is";
+    github = "joshua-cooper";
+    githubId = 35612334;
+  };
+  jceb = {
+    name = "Jan Christoph Ebersbach";
+    email = "jceb@e-jc.de";
+    github = "jceb";
+    githubId = 101593;
+  };
+  jchw = {
+    email = "johnwchadwick@gmail.com";
+    github = "jchv";
+    githubId = 938744;
+    name = "John Chadwick";
+  };
+  jcouyang = {
+    email = "oyanglulu@gmail.com";
+    github = "jcouyang";
+    githubId = 1235045;
+    name = "Jichao Ouyang";
+    keys = [{
+      fingerprint = "A506 C38D 5CC8 47D0 DF01  134A DA8B 833B 5260 4E63";
+    }];
+  };
+  jcs090218 = {
+    email = "jcs090218@gmail.com";
+    github = "jcs090218";
+    githubId = 8685505;
+    name = "Jen-Chieh Shen";
+  };
+  jcspeegs = {
+    email = "justin@speegs.com";
+    github = "jcspeegs";
+    githubId = 34928409;
+    name = "Justin Speegle";
+  };
+  jcumming = {
+    email = "jack@mudshark.org";
+    github = "jcumming";
+    githubId = 1982341;
+    name = "Jack Cummings";
+  };
+  jdagilliland = {
+    email = "jdagilliland@gmail.com";
+    github = "jdagilliland";
+    githubId = 1383440;
+    name = "Jason Gilliland";
+  };
+  jdahm = {
+    email = "johann.dahm@gmail.com";
+    github = "jdahm";
+    githubId = 68032;
+    name = "Johann Dahm";
+  };
+  jdanek = {
+    email = "jdanek@redhat.com";
+    github = "jirkadanek";
+    githubId = 17877663;
+    keys = [{
+      fingerprint = "D4A6 F051 AD58 2E7C BCED  5439 6927 5CAD F15D 872E";
+    }];
+    name = "Jiri Daněk";
+  };
+  jdbaldry = {
+    email = "jack.baldry@grafana.com";
+    github = "jdbaldry";
+    githubId = 4599384;
+    name = "Jack Baldry";
+  };
+  jdehaas = {
+    email = "qqlq@nullptr.club";
+    github = "jeroendehaas";
+    githubId = 117874;
+    name = "Jeroen de Haas";
+  };
+  jdelStrother = {
+    email = "me@delstrother.com";
+    github = "jdelStrother";
+    githubId = 2377;
+    name = "Jonathan del Strother";
+  };
+  jdreaver = {
+    email = "johndreaver@gmail.com";
+    github = "jdreaver";
+    githubId = 1253071;
+    name = "David Reaver";
+  };
+  jduan = {
+    name = "Jingjing Duan";
+    email = "duanjingjing@gmail.com";
+    github = "jduan";
+    githubId = 452450;
+  };
+  jdupak = {
+    name = "Jakub Dupak";
+    email = "dev@jakubdupak.com";
+    github = "jdupak";
+    githubId = 22683640;
+  };
+  jecaro = {
+    email = "jeancharles.quillet@gmail.com";
+    github = "jecaro";
+    githubId = 17029738;
+    name = "Jean-Charles Quillet";
+  };
+  jedsek = {
+    email = "jedsek@qq.com";
+    github = "jedsek";
+    githubId = 63626406;
+    name = "Jedsek";
+  };
+  jefdaj = {
+    email = "jefdaj@gmail.com";
+    github = "jefdaj";
+    githubId = 1198065;
+    name = "Jeffrey David Johnson";
+  };
+  jefflabonte = {
+    email = "grimsleepless@protonmail.com";
+    github = "JeffLabonte";
+    githubId = 9425955;
+    name = "Jean-François Labonté";
+  };
+  jensbin = {
+    email = "jensbin+git@pm.me";
+    github = "jensbin";
+    githubId = 1608697;
+    name = "Jens Binkert";
+  };
+  jeremiahs = {
+    email = "jeremiah@secrist.xyz";
+    github = "JeremiahSecrist";
+    githubId = 26032621;
+    matrix = "@jeremiahs:matrix.org";
+    name = "Jeremiah Secrist";
+  };
+  jeremyschlatter = {
+    email = "github@jeremyschlatter.com";
+    github = "jeremyschlatter";
+    githubId = 5741620;
+    name = "Jeremy Schlatter";
+  };
+  jerith666 = {
+    email = "github@matt.mchenryfamily.org";
+    github = "jerith666";
+    githubId = 854319;
+    name = "Matt McHenry";
+  };
+  jerrysm64 = {
+    email = "jerry.starke@icloud.com";
+    github = "jerrysm64";
+    githubId = 42114389;
+    name = "Jerry Starke";
+  };
+  jeschli = {
+    email = "jeschli@gmail.com";
+    github = "0mbi";
+    githubId = 10786794;
+    name = "Markus Hihn";
+  };
+  jessemoore = {
+    email = "jesse@jessemoore.dev";
+    github = "jesseDMoore1994";
+    githubId = 30251156;
+    name = "Jesse Moore";
+  };
+  jethro = {
+    email = "jethrokuan95@gmail.com";
+    github = "jethrokuan";
+    githubId = 1667473;
+    name = "Jethro Kuan";
+  };
+  jevy = {
+    email = "jevin@quickjack.ca";
+    github = "jevy";
+    githubId = 110620;
+    name = "Jevin Maltais";
+  };
+  jfb = {
+    email = "james@yamtime.com";
+    github = "tftio";
+    githubId = 143075;
+    name = "James Felix Black";
+  };
+  jfchevrette = {
+    email = "jfchevrette@gmail.com";
+    github = "jfchevrette";
+    githubId = 3001;
+    name = "Jean-Francois Chevrette";
+    keys = [{
+      fingerprint = "B612 96A9 498E EECD D5E9  C0F0 67A0 5858 0129 0DC6";
+    }];
+  };
+  jflanglois = {
+    email = "yourstruly@julienlanglois.me";
+    github = "jflanglois";
+    githubId = 18501;
+    name = "Julien Langlois";
+  };
+  jfly = {
+    name = "Jeremy Fleischman";
+    email = "jeremyfleischman@gmail.com";
+    github = "jfly";
+    githubId = 277474;
+    keys = [{
+      fingerprint = "F1F1 3395 8E8E 9CC4 D9FC  9647 1931 9CD8 416A 642B";
+    }];
+  };
+  jfroche = {
+    name = "Jean-François Roche";
+    email = "jfroche@pyxel.be";
+    matrix = "@jfroche:matrix.pyxel.cloud";
+    github = "jfroche";
+    githubId = 207369;
+    keys = [{
+      fingerprint = "7EB1 C02A B62B B464 6D7C  E4AE D1D0 9DE1 69EA 19A0";
+    }];
+  };
+  jfvillablanca = {
+    email = "jmfv.dev@gmail.com";
+    matrix = "@jfvillablanca:matrix.org";
+    github = "jfvillablanca";
+    githubId = 31008330;
+    name = "Jann Marc Villablanca";
+  };
+  jgart = {
+    email = "jgart@dismail.de";
+    github = "jgarte";
+    githubId = 47760695;
+    name = "Jorge Gomez";
+  };
+  jgeerds = {
+    email = "jascha@geerds.org";
+    github = "jgeerds";
+    githubId = 1473909;
+    name = "Jascha Geerds";
+  };
+  jgertm = {
+    email = "jger.tm@gmail.com";
+    github = "jgertm";
+    githubId = 6616642;
+    name = "Tim Jaeger";
+  };
+  jgillich = {
+    email = "jakob@gillich.me";
+    github = "jgillich";
+    githubId = 347965;
+    name = "Jakob Gillich";
+  };
+  jglukasik = {
+    email = "joseph@jgl.me";
+    github = "jglukasik";
+    githubId = 6445082;
+    name = "Joseph Lukasik";
+  };
+  jgoux = {
+    email = "hi@jgoux.dev";
+    github = "jgoux";
+    githubId = 1443499;
+    name = "Julien Goux";
+  };
+  jhh = {
+    email = "jeff@j3ff.io";
+    github = "jhh";
+    githubId = 14412;
+    name = "Jeff Hutchison";
+  };
+  jhhuh = {
+    email = "jhhuh.note@gmail.com";
+    github = "jhhuh";
+    githubId = 5843245;
+    name = "Ji-Haeng Huh";
+  };
+  jhillyerd = {
+    email = "james+nixos@hillyerd.com";
+    github = "jhillyerd";
+    githubId = 2502736;
+    name = "James Hillyerd";
+  };
+  j-hui = {
+    email = "j-hui@cs.columbia.edu";
+    github = "j-hui";
+    githubId = 11800204;
+    name = "John Hui";
+  };
+  jiegec = {
+    name = "Jiajie Chen";
+    email = "c@jia.je";
+    github = "jiegec";
+    githubId = 6127678;
+  };
+  jiehong = {
+    email = "nixos@majiehong.com";
+    github = "Jiehong";
+    githubId = 1061229;
+    name = "Jiehong Ma";
+  };
+  jirkamarsik = {
+    email = "jiri.marsik89@gmail.com";
+    github = "jirkamarsik";
+    githubId = 184898;
+    name = "Jirka Marsik";
+  };
+  jitwit = {
+    email = "jrn@bluefarm.ca";
+    github = "jitwit";
+    githubId = 51518420;
+    name = "jitwit";
+  };
+  jjjollyjim = {
+    email = "jamie@kwiius.com";
+    github = "JJJollyjim";
+    githubId = 691552;
+    name = "Jamie McClymont";
+  };
+  jk = {
+    email = "hello+nixpkgs@j-k.io";
+    matrix = "@j-k:matrix.org";
+    github = "06kellyjac";
+    githubId = 9866621;
+    name = "Jack";
+  };
+  jkarlson = {
+    email = "jekarlson@gmail.com";
+    github = "ethorsoe";
+    githubId = 1204734;
+    name = "Emil Karlson";
+  };
+  j-keck = {
+    email = "jhyphenkeck@gmail.com";
+    github = "j-keck";
+    githubId = 3081095;
+    name = "Jürgen Keck";
+  };
+  jl178 = {
+    email = "jeredlittle1996@gmail.com";
+    github = "jl178";
+    githubId = 72664723;
+    name = "Jered Little";
+  };
+  jlamur = {
+    email = "contact@juleslamur.fr";
+    github = "jlamur";
+    githubId = 7054317;
+    name = "Jules Lamur";
+    keys = [{
+      fingerprint = "B768 6CD7 451A 650D 9C54  4204 6710 CF0C 1CBD 7762";
+    }];
+  };
+  jleightcap = {
+    email = "jack@leightcap.com";
+    github = "jleightcap";
+    githubId = 30168080;
+    name = "Jack Leightcap";
+  };
+  jlesquembre = {
+    email = "jl@lafuente.me";
+    github = "jlesquembre";
+    githubId = 1058504;
+    name = "José Luis Lafuente";
+  };
+  jloyet = {
+    email = "ml@fatbsd.com";
+    github = "fatpat";
+    githubId = 822436;
+    name = "Jérôme Loyet";
+  };
+  jluttine = {
+    email = "jaakko.luttinen@iki.fi";
+    github = "jluttine";
+    githubId = 2195834;
+    name = "Jaakko Luttinen";
+  };
+  jm2dev = {
+    email = "jomarcar@gmail.com";
+    github = "jm2dev";
+    githubId = 474643;
+    name = "José Miguel Martínez Carrasco";
+  };
+  jmagnusj = {
+    email = "jmagnusj@gmail.com";
+    github = "magnusjonsson";
+    githubId = 8900;
+    name = "Johan Magnus Jonsson";
+  };
+  jmbaur = {
+    email = "jaredbaur@fastmail.com";
+    github = "jmbaur";
+    githubId = 45740526;
+    name = "Jared Baur";
+  };
+  jmc-figueira = {
+    email = "business+nixos@jmc-figueira.dev";
+    github = "jmc-figueira";
+    githubId = 6634716;
+    name = "João Figueira";
+    keys = [
+      # GitHub signing key
+      {
+        fingerprint = "EC08 7AA3 DEAD A972 F015  6371 DC7A E56A E98E 02D7";
+      }
+      # Email encryption
+      {
+        fingerprint = "816D 23F5 E672 EC58 7674  4A73 197F 9A63 2D13 9E30";
+      }
+    ];
+  };
+  jmettes = {
+    email = "jonathan@jmettes.com";
+    github = "jmettes";
+    githubId = 587870;
+    name = "Jonathan Mettes";
+  };
+  jmgilman = {
+    email = "joshuagilman@gmail.com";
+    github = "jmgilman";
+    githubId = 2308444;
+    name = "Joshua Gilman";
+  };
+  jmillerpdt = {
+    email = "jcmiller@pdtpartners.com";
+    github = "jmillerpdt";
+    githubId = 54179289;
+    name = "Jason Miller";
+  };
+  jnsgruk = {
+    email = "jon@sgrs.uk";
+    github = "jnsgruk";
+    githubId = 668505;
+    name = "Jon Seager";
+  };
+  jo1gi = {
+    email = "joakimholm@protonmail.com";
+    github = "jo1gi";
+    githubId = 26695750;
+    name = "Joakim Holm";
+  };
+  joachifm = {
+    email = "joachifm@fastmail.fm";
+    github = "joachifm";
+    githubId = 41977;
+    name = "Joachim Fasting";
+  };
+  joachimschmidt557 = {
+    email = "joachim.schmidt557@outlook.com";
+    github = "joachimschmidt557";
+    githubId = 28556218;
+    name = "Joachim Schmidt";
+  };
+  joamaki = {
+    email = "joamaki@gmail.com";
+    github = "joamaki";
+    githubId = 1102396;
+    name = "Jussi Maki";
+  };
+  jobojeha = {
+    email = "jobojeha@jeppener.de";
+    github = "jobojeha";
+    githubId = 60272884;
+    name = "Jonathan Jeppener-Haltenhoff";
+  };
+  jocelynthode = {
+    email = "jocelyn.thode@gmail.com";
+    github = "jocelynthode";
+    githubId = 3967312;
+    name = "Jocelyn Thode";
+  };
+  joedevivo = {
+    github = "joedevivo";
+    githubId = 55951;
+    name = "Joe DeVivo";
+  };
+  joelancaster = {
+    email = "joe.a.lancas@gmail.com";
+    github = "JoeLancaster";
+    githubId = 16760945;
+    name = "Joe Lancaster";
+  };
+  joelburget = {
+    email = "joelburget@gmail.com";
+    github = "joelburget";
+    githubId = 310981;
+    name = "Joel Burget";
+  };
+  joelkoen = {
+    email = "mail@joelkoen.com";
+    github = "joelkoen";
+    githubId = 122502655;
+    name = "Joel Koen";
+  };
+  joelmo = {
+    email = "joel.moberg@gmail.com";
+    github = "joelmo";
+    githubId = 336631;
+    name = "Joel Moberg";
+  };
+  joepie91 = {
+    email = "admin@cryto.net";
+    matrix = "@joepie91:pixie.town";
+    name = "Sven Slootweg";
+    github = "joepie91";
+    githubId = 1663259;
+  };
+  joerdav = {
+    email = "joe.davidson.21111@gmail.com";
+    github = "joerdav";
+    name = "Joe Davidson";
+    githubId = 19927761;
+  };
+  joesalisbury = {
+    email = "salisbury.joseph@gmail.com";
+    github = "JosephSalisbury";
+    githubId = 297653;
+    name = "Joe Salisbury";
+  };
+  johannwagner = {
+    email = "nix@wagner.digital";
+    github = "johannwagner";
+    githubId = 12380026;
+    name = "Johann Wagner";
+  };
+  johanot = {
+    email = "write@ownrisk.dk";
+    github = "johanot";
+    githubId = 998763;
+    name = "Johan Thomsen";
+  };
+  johbo = {
+    email = "johannes@bornhold.name";
+    github = "johbo";
+    githubId = 117805;
+    name = "Johannes Bornhold";
+  };
+  johnazoidberg = {
+    email = "git@danielschaefer.me";
+    github = "JohnAZoidberg";
+    githubId = 5307138;
+    name = "Daniel Schäfer";
+  };
+  johnchildren = {
+    email = "john.a.children@gmail.com";
+    github = "johnchildren";
+    githubId = 32305209;
+    name = "John Children";
+  };
+  johnmh = {
+    email = "johnmh@openblox.org";
+    github = "JohnMH";
+    githubId = 2576152;
+    name = "John M. Harris, Jr.";
+  };
+  johnpyp = {
+    name = "John Paul Penaloza";
+    email = "johnpyp.dev@gmail.com";
+    github = "johnpyp";
+    githubId = 20625636;
+  };
+  johnramsden = {
+    email = "johnramsden@riseup.net";
+    github = "johnramsden";
+    githubId = 8735102;
+    name = "John Ramsden";
+  };
+  johnrichardrinehart = {
+    email = "johnrichardrinehart@gmail.com";
+    github = "johnrichardrinehart";
+    githubId = 6321578;
+    name = "John Rinehart";
+  };
+  john-rodewald = {
+    email = "jnrodewald99@gmail.com";
+    github = "john-rodewald";
+    githubId = 51028009;
+    name = "John Rodewald";
+  };
+  john-shaffer = {
+    email = "jdsha@proton.me";
+    github = "john-shaffer";
+    githubId = 53870456;
+    name = "John Shaffer";
+  };
+  johntitor = {
+    email = "huyuumi.dev@gmail.com";
+    github = "JohnTitor";
+    githubId = 25030997;
+    name = "Yuki Okushi";
+  };
+  jojosch = {
+    name = "Johannes Schleifenbaum";
+    email = "johannes@js-webcoding.de";
+    matrix = "@jojosch:jswc.de";
+    github = "jojosch";
+    githubId = 327488;
+    keys = [{
+      fingerprint = "7249 70E6 A661 D84E 8B47  678A 0590 93B1 A278 BCD0";
+    }];
+  };
+  jokatzke = {
+    email = "jokatzke@fastmail.com";
+    github = "jokatzke";
+    githubId = 46931073;
+    name = "Jonas Katzke";
+  };
+  joko = {
+    email = "ioannis.koutras@gmail.com";
+    github = "jokogr";
+    githubId = 1252547;
+    keys = [{
+      # compare with https://keybase.io/joko
+      fingerprint = "B154 A8F9 0610 DB45 0CA8  CF39 85EA E7D9 DF56 C5CA";
+    }];
+    name = "Ioannis Koutras";
+  };
+  jonaenz = {
+    name = "Jona Enzinger";
+    email = "5xt3zyy5l@mozmail.com";
+    matrix = "@jona:matrix.jonaenz.de";
+    github = "JonaEnz";
+    githubId = 57130301;
+    keys = [{
+      fingerprint = "1CC5 B67C EB9A 13A5 EDF6 F10E 0B4A 3662 FC58 9202";
+    }];
+  };
+  jonafato = {
+    email = "jon@jonafato.com";
+    github = "jonafato";
+    githubId = 392720;
+    name = "Jon Banafato";
+  };
+  jonathanmarler = {
+    email = "johnnymarler@gmail.com";
+    github = "marler8997";
+    githubId = 304904;
+    name = "Jonathan Marler";
+  };
+  jonathanreeve = {
+    email = "jon.reeve@gmail.com";
+    github = "JonathanReeve";
+    githubId = 1843676;
+    name = "Jonathan Reeve";
+  };
+  jonnybolton = {
+    email = "jonnybolton@gmail.com";
+    github = "jonnynightingale";
+    githubId = 8580434;
+    name = "Jonny Bolton";
+  };
+  jonringer = {
+    email = "jonringer117@gmail.com";
+    matrix = "@jonringer:matrix.org";
+    github = "jonringer";
+    githubId = 7673602;
+    name = "Jonathan Ringer";
+  };
+  jopejoe1 = {
+    email = "johannes@joens.email";
+    matrix = "@jopejoe1:matrix.org";
+    github = "jopejoe1";
+    githubId = 34899572;
+    name = "Johannes Jöns";
+  };
+  jordanisaacs = {
+    name = "Jordan Isaacs";
+    email = "nix@jdisaacs.com";
+    github = "jordanisaacs";
+    githubId = 19742638;
+  };
+  jorise = {
+    email = "info@jorisengbers.nl";
+    github = "JorisE";
+    githubId = 1767283;
+    name = "Joris Engbers";
+  };
+  jorsn = {
+    name = "Johannes Rosenberger";
+    email = "johannes@jorsn.eu";
+    github = "jorsn";
+    githubId = 4646725;
+  };
+  joscha = {
+    name = "Joscha Loos";
+    email = "j.loos@posteo.net";
+    github = "jooooscha";
+    githubId = 57965027;
+  };
+  josephst = {
+    name = "Joseph Stahl";
+    email = "hello@josephstahl.com";
+    github = "josephst";
+    githubId = 1269177;
+  };
+  josephsurin = {
+    name = "Joseph Surin";
+    email = "nix@jsur.in";
+    github = "josephsurin";
+    githubId = 14977484;
+  };
+  joshniemela = {
+    name = "Joshua Niemelä";
+    email = "josh@jniemela.dk";
+    github = "joshniemela";
+    githubId = 88747315;
+  };
+  joshuafern = {
+    name = "Joshua Fern";
+    email = "joshuafern@protonmail.com";
+    github = "JoshuaFern";
+    githubId = 4300747;
+  };
+  joshvanl = {
+    email = " me@joshvanl.dev ";
+    github = "JoshVanL";
+    githubId = 15893072;
+    name = "Josh van Leeuwen";
+  };
+  jpagex = {
+    name = "Jérémy Pagé";
+    email = "contact@jeremypage.me";
+    github = "jpagex";
+    githubId = 635768;
+  };
+  jpas = {
+    name = "Jarrod Pas";
+    email = "jarrod@jarrodpas.com";
+    github = "jpas";
+    githubId = 5689724;
+  };
+  jpdoyle = {
+    email = "joethedoyle@gmail.com";
+    github = "jpdoyle";
+    githubId = 1918771;
+    name = "Joe Doyle";
+  };
+  jpentland = {
+    email = "joe.pentland@gmail.com";
+    github = "jpentland";
+    githubId = 1135582;
+    name = "Joe Pentland";
+  };
+  jperras = {
+    email = "joel@nerderati.com";
+    github = "jperras";
+    githubId = 20675;
+    name = "Joël Perras";
+  };
+  jpetrucciani = {
+    email = "j@cobi.dev";
+    github = "jpetrucciani";
+    githubId = 8117202;
+    name = "Jacobi Petrucciani";
+  };
+  jpierre03 = {
+    email = "nix@prunetwork.fr";
+    github = "jpierre03";
+    githubId = 954536;
+    name = "Jean-Pierre PRUNARET";
+  };
+  jpotier = {
+    email = "jpo.contributes.to.nixos@marvid.fr";
+    github = "jpotier";
+    githubId = 752510;
+    name = "Martin Potier";
+  };
+  jpts = {
+    email = "james+nixpkgs@cleverley-prance.uk";
+    github = "jpts";
+    githubId = 5352661;
+    name = "James Cleverley-Prance";
+  };
+  jqqqqqqqqqq = {
+    email = "jqqqqqqqqqq@gmail.com";
+    github = "jqqqqqqqqqq";
+    githubId = 12872927;
+    name = "Curtis Jiang";
+  };
+  jqueiroz = {
+    email = "nixos@johnjq.com";
+    github = "jqueiroz";
+    githubId = 4968215;
+    name = "Jonathan Queiroz";
+  };
+  jraygauthier = {
+    email = "jraygauthier@gmail.com";
+    github = "jraygauthier";
+    githubId = 4611077;
+    name = "Raymond Gauthier";
+  };
+  jrpotter = {
+    email = "jrpotter2112@gmail.com";
+    github = "jrpotter";
+    githubId = 3267697;
+    name = "Joshua Potter";
+  };
+  jshcmpbll = {
+    email = "me@joshuadcampbell.com";
+    github = "jshcmpbll";
+    githubId = 16374374;
+    name = "Joshua Campbell";
+  };
+  jshholland = {
+    email = "josh@inv.alid.pw";
+    github = "jshholland";
+    githubId = 107689;
+    name = "Josh Holland";
+  };
+  jsierles = {
+    email = "joshua@hey.com";
+    matrix = "@jsierles:matrix.org";
+    name = "Joshua Sierles";
+    github = "jsierles";
+    githubId = 82;
+  };
+  jsimonetti = {
+    email = "jeroen+nixpkgs@simonetti.nl";
+    matrix = "@jeroen:simonetti.nl";
+    name = "Jeroen Simonetti";
+    github = "jsimonetti";
+    githubId = 5478838;
+  };
+  jsoo1 = {
+    email = "jsoo1@asu.edu";
+    github = "jsoo1";
+    name = "John Soo";
+    githubId = 10039785;
+  };
+  jsusk = {
+    email = "joshua@suskalo.org";
+    github = "IGJoshua";
+    name = "Joshua Suskalo";
+    githubId = 27734541;
+  };
+  jtbx = {
+    email = "jtbx@duck.com";
+    name = "Jeremy Baxter";
+    github = "jtbx";
+    githubId = 92071952;
+  };
+  jtcoolen = {
+    email = "jtcoolen@pm.me";
+    name = "Julien Coolen";
+    github = "jtcoolen";
+    githubId = 54635632;
+    keys = [{
+      fingerprint = "4C68 56EE DFDA 20FB 77E8  9169 1964 2151 C218 F6F5";
+    }];
+  };
+  jtobin = {
+    email = "jared@jtobin.io";
+    github = "jtobin";
+    githubId = 1414434;
+    name = "Jared Tobin";
+  };
+  jtojnar = {
+    email = "jtojnar@gmail.com";
+    matrix = "@jtojnar:matrix.org";
+    github = "jtojnar";
+    githubId = 705123;
+    name = "Jan Tojnar";
+  };
+  jtrees = {
+    email = "me@jtrees.io";
+    github = "jtrees";
+    githubId = 5802758;
+    name = "Joshua Trees";
+  };
+  juancmuller = {
+    email = "nix@juancmuller.com";
+    githubId = 208500;
+    github = "jcmuller";
+    matrix = "@jcmuller@beeper.com";
+    name = "Juan C. Müller";
+    keys = [{
+      fingerprint = "D78D 25D8 A1B8 2596 267F  35B8 F44E A51A 28F9 B4A7";
+    }];
+  };
+  juaningan = {
+    email = "juaningan@gmail.com";
+    github = "oneingan";
+    githubId = 810075;
+    name = "Juan Rodal";
+  };
+  juboba = {
+    email = "juboba@gmail.com";
+    github = "juboba";
+    githubId = 1189739;
+    name = "Julio Borja Barra";
+  };
+  jue89 = {
+    email = "me@jue.yt";
+    github = "jue89";
+    githubId = 6105784;
+    name = "Juergen Fitschen";
+  };
+  jugendhacker = {
+    name = "j.r";
+    email = "j.r@jugendhacker.de";
+    github = "jugendhacker";
+    githubId = 12773748;
+    matrix = "@j.r:chaos.jetzt";
+  };
+  juliendehos = {
+    email = "dehos@lisic.univ-littoral.fr";
+    github = "juliendehos";
+    githubId = 11947756;
+    name = "Julien Dehos";
+  };
+  julienmalka = {
+    email = "julien.malka@me.com";
+    github = "JulienMalka";
+    githubId = 1792886;
+    name = "Julien Malka";
+  };
+  juliusrickert = {
+    email = "nixpkgs@juliusrickert.de";
+    github = "juliusrickert";
+    githubId = 5007494;
+    name = "Julius Rickert";
+  };
+  julm = {
+    email = "julm+nixpkgs@sourcephile.fr";
+    github = "ju1m";
+    githubId = 21160136;
+    name = "Julien Moutinho";
+  };
+  Julow = {
+    email = "jules@j3s.fr";
+    matrix = "@juloo:matrix.org";
+    github = "Julow";
+    githubId = 2310568;
+    name = "Jules Aguillon";
+  };
+  jumper149 = {
+    email = "felixspringer149@gmail.com";
+    github = "jumper149";
+    githubId = 39434424;
+    name = "Felix Springer";
+  };
+  junjihashimoto = {
+    email = "junji.hashimoto@gmail.com";
+    github = "junjihashimoto";
+    githubId = 2469618;
+    name = "Junji Hashimoto";
+  };
+  jurraca = {
+    email = "julienu@pm.me";
+    github = "jurraca";
+    githubId = 5124422;
+    name = "Julien Urraca";
+  };
+  justanotherariel = {
+    email = "ariel@ebersberger.io";
+    github = "justanotherariel";
+    githubId = 31776703;
+    name = "Ariel Ebersberger";
+  };
+  justinas = {
+    email = "justinas@justinas.org";
+    github = "justinas";
+    githubId = 662666;
+    name = "Justinas Stankevičius";
+  };
+  justinlime = {
+    email = "justinlime1999@gmail.com";
+    github = "justinlime";
+    githubId = 119710965;
+    name = "Justin Fields";
+  };
+  justinlovinger = {
+    email = "git@justinlovinger.com";
+    github = "JustinLovinger";
+    githubId = 7183441;
+    name = "Justin Lovinger";
+  };
+  justinwoo = {
+    email = "moomoowoo@gmail.com";
+    github = "justinwoo";
+    githubId = 2396926;
+    name = "Justin Woo";
+  };
+  jvanbruegge = {
+    email = "supermanitu@gmail.com";
+    github = "jvanbruegge";
+    githubId = 1529052;
+    name = "Jan van Brügge";
+    keys = [{
+      fingerprint = "3513 5CE5 77AD 711F 3825  9A99 3665 72BE 7D6C 78A2";
+    }];
+  };
+  jwatt = {
+    email = "jwatt@broken.watch";
+    github = "jjwatt";
+    githubId = 2397327;
+    name = "Jesse Wattenbarger";
+  };
+  jwiegley = {
+    email = "johnw@newartisans.com";
+    github = "jwiegley";
+    githubId = 8460;
+    name = "John Wiegley";
+  };
+  jwijenbergh = {
+    email = "jeroenwijenbergh@protonmail.com";
+    github = "jwijenbergh";
+    githubId = 46386452;
+    name = "Jeroen Wijenbergh";
+  };
+  jwoudenberg = {
+    email = "nixpkgs@jasperwoudenberg.com";
+    github = "jwoudenberg";
+    githubId = 1525551;
+    name = "Jasper Woudenberg";
+  };
+  jwygoda = {
+    email = "jaroslaw@wygoda.me";
+    github = "jwygoda";
+    githubId = 20658981;
+    name = "Jarosław Wygoda";
+  };
+  jyp = {
+    email = "jeanphilippe.bernardy@gmail.com";
+    github = "jyp";
+    githubId = 27747;
+    name = "Jean-Philippe Bernardy";
+  };
+  jzellner = {
+    email = "jeffz@eml.cc";
+    github = "sofuture";
+    githubId = 66669;
+    name = "Jeff Zellner";
+  };
+  k3a = {
+    email = "git+nix@catmail.app";
+    name = "Mario Hros";
+    github = "k3a";
+    githubId = 966992;
+  };
+  k900 = {
+    name = "Ilya K.";
+    email = "me@0upti.me";
+    github = "K900";
+    githubId = 386765;
+    matrix = "@k900:0upti.me";
+  };
+  kachick = {
+    email = "kachick1@gmail.com";
+    github = "kachick";
+    githubId = 1180335;
+    name = "Kenichi Kamiya";
+    keys = [{
+      fingerprint = "9121 5D87 20CA B405 C63F  24D2 EF6E 574D 040A E2A5";
+    }];
+  };
+  kaction = {
+    name = "Dmitry Bogatov";
+    email = "KAction@disroot.org";
+    github = "KAction";
+    githubId = 44864956;
+    keys = [{
+      fingerprint = "3F87 0A7C A7B4 3731 2F13  6083 749F D4DF A2E9 4236";
+    }];
+  };
+  kaiha = {
+    email = "kai.harries@gmail.com";
+    github = "KaiHa";
+    githubId = 6544084;
+    name = "Kai Harries";
+  };
+  kalbasit = {
+    email = "wael.nasreddine@gmail.com";
+    matrix = "@kalbasit:matrix.org";
+    github = "kalbasit";
+    githubId = 87115;
+    name = "Wael Nasreddine";
+  };
+  kalebpace = {
+    email = "kaleb.pace@pm.me";
+    matrix = "@kalebpace:matrix.org";
+    github = "kalebpace";
+    githubId = 5586615;
+    name = "Kaleb Pace";
+  };
+  kalekseev = {
+    email = "mail@kalekseev.com";
+    github = "kalekseev";
+    githubId = 367259;
+    name = "Konstantin Alekseev";
+  };
+  kamadorueda = {
+    name = "Kevin Amado";
+    email = "kamadorueda@gmail.com";
+    github = "kamadorueda";
+    githubId = 47480384;
+    keys = [{
+      fingerprint = "2BE3 BAFD 793E A349 ED1F  F00F 04D0 CEAF 916A 9A40";
+    }];
+  };
+  kamilchm = {
+    email = "kamil.chm@gmail.com";
+    github = "kamilchm";
+    githubId = 1621930;
+    name = "Kamil Chmielewski";
+  };
+  kampfschlaefer = {
+    email = "arnold@arnoldarts.de";
+    github = "kampfschlaefer";
+    githubId = 3831860;
+    name = "Arnold Krille";
+  };
+  kanashimia = {
+    email = "chad@redpilled.dev";
+    github = "kanashimia";
+    githubId = 56224949;
+    name = "Mia Kanashi";
+  };
+  karantan = {
+    name = "Gasper Vozel";
+    email = "karantan@gmail.com";
+    github = "karantan";
+    githubId = 7062631;
+  };
+  KarlJoad = {
+    email = "karl@hallsby.com";
+    github = "KarlJoad";
+    githubId = 34152449;
+    name = "Karl Hallsby";
+  };
+  karolchmist = {
+    email = "info+nix@chmist.com";
+    github = "karolchmist";
+    githubId = 1927188;
+    name = "karolchmist";
+  };
+  kashw2 = {
+    email = "supra4keanu@hotmail.com";
+    github = "kashw2";
+    githubId = 15855440;
+    name = "Keanu Ashwell";
+  };
+  katexochen = {
+    github = "katexochen";
+    githubId = 49727155;
+    matrix = "@katexochen:matrix.org";
+    name = "Paul Meyer";
+  };
+  katrinafyi = {
+    name = "katrinafyi";
+    github = "katrinafyi";
+    githubId = 39479354;
+  };
+  kayhide = {
+    email = "kayhide@gmail.com";
+    github = "kayhide";
+    githubId = 1730718;
+    name = "Hideaki Kawai";
+  };
+  kazcw = {
+    email = "kaz@lambdaverse.org";
+    github = "kazcw";
+    githubId = 1047859;
+    name = "Kaz Wesley";
+  };
+  kazenyuk = {
+    email = "kazenyuk@pm.me";
+    github = "nvmd";
+    githubId = 524492;
+    name = "Sergey Kazenyuk";
+  };
+  kbdharun = {
+    email = "kbdharunkrishna@gmail.com";
+    matrix = "@kbdk:matrix.org";
+    github = "kbdharun";
+    githubId = 26346867;
+    name = "K.B.Dharun Krishna";
+  };
+  kcalvinalvin = {
+    email = "calvin@kcalvinalvin.info";
+    github = "kcalvinalvin";
+    githubId = 37185887;
+    name = "Calvin Kim";
+  };
+  keenanweaver = {
+    email = "keenanweaver@protonmail.com";
+    name = "Keenan Weaver";
+    github = "keenanweaver";
+    githubId = 37268985;
+  };
+  keksbg = {
+    email = "keksbg@riseup.net";
+    name = "Stella";
+    github = "keksbg";
+    githubId = 10682187;
+    keys = [{
+      fingerprint = "AB42 1F18 5A19 A160 AD77  9885 3D6D CA5B 6F2C 2A7A";
+    }];
+  };
+  keldu = {
+    email = "mail@keldu.de";
+    github = "keldu";
+    githubId = 15373888;
+    name = "Claudius Holeksa";
+  };
+  ken-matsui = {
+    github = "ken-matsui";
+    githubId = 26405363;
+    name = "Ken Matsui";
+    keys = [{
+      fingerprint = "3611 8CD3 6DE8 3334 B44A  DDE4 1033 60B3 298E E433";
+    }];
+  };
+  kennyballou = {
+    email = "kb@devnulllabs.io";
+    github = "kennyballou";
+    githubId = 2186188;
+    name = "Kenny Ballou";
+    keys = [{
+      fingerprint = "932F 3E8E 1C0F 4A98 95D7  B8B8 B0CA A28A 0295 8308";
+    }];
+  };
+  kenran = {
+    email = "johannes.maier@mailbox.org";
+    github = "kenranunderscore";
+    githubId = 5188977;
+    matrix = "@kenran_:matrix.org";
+    name = "Johannes Maier";
+  };
+  kentjames = {
+    email = "jameschristopherkent@gmail.com";
+    github = "KentJames";
+    githubId = 2029444;
+    name = "James Kent";
+  };
+  kephasp = {
+    email = "pierre@nothos.net";
+    github = "kephas";
+    githubId = 762421;
+    name = "Pierre Thierry";
+  };
+  keto = {
+    github = "TheRealKeto";
+    githubId = 24854941;
+    name = "Keto";
+  };
+  ketzacoatl = {
+    email = "ketzacoatl@protonmail.com";
+    github = "ketzacoatl";
+    githubId = 10122937;
+    name = "ketzacoatl";
+  };
+  kevincox = {
+    email = "kevincox@kevincox.ca";
+    matrix = "@kevincox:matrix.org";
+    github = "kevincox";
+    githubId = 494012;
+    name = "Kevin Cox";
+    keys = [{
+      fingerprint = "B66B 891D D83B 0E67 7D84 FC30 9BB9 2CC1 552E 99AA";
+    }];
+  };
+  kevingriffin = {
+    email = "me@kevin.jp";
+    github = "kevingriffin";
+    githubId = 209729;
+    name = "Kevin Griffin";
+  };
+  kevink = {
+    email = "kevin@kevink.dev";
+    github = "Unkn0wnCat";
+    githubId = 8211181;
+    name = "Kevin Kandlbinder";
+  };
+  kfears = {
+    email = "kfearsoff@gmail.com";
+    github = "KFearsoff";
+    githubId = 66781795;
+    matrix = "@kfears:matrix.org";
+    name = "KFears";
+  };
+  kfollesdal = {
+    email = "kfollesdal@gmail.com";
+    github = "kfollesdal";
+    githubId = 546087;
+    name = "Kristoffer K. Føllesdal";
+  };
+  kgtkr = {
+    email = "contact@kgtkr.net";
+    github = "kgtkr";
+    githubId = 17868838;
+    name = "kgtkr";
+    keys = [{
+      fingerprint = "B30D BE93 81E0 3D5D F301 88C8 1F6E B951 9F57 3241";
+    }];
+  };
+  khaneliman = {
+    email = "khaneliman12@gmail.com";
+    github = "khaneliman";
+    githubId = 1778670;
+    name = "Austin Horstman";
+  };
+  khaser = {
+    email = "a-horohorin@mail.ru";
+    github = "khaser";
+    githubId = 59027018;
+    name = "Andrey Khorokhorin";
+  };
+  kho-dialga = {
+    email = "ivandashenyou@gmail.com";
+    github = "Kho-Dialga";
+    githubId = 55767703;
+    name = "Iván Brito";
+  };
+  khumba = {
+    email = "bog@khumba.net";
+    github = "khumba";
+    githubId = 788813;
+    name = "Bryan Gardiner";
+  };
+  khushraj = {
+    email = "khushraj.rathod@gmail.com";
+    github = "khrj";
+    githubId = 44947946;
+    name = "Khushraj Rathod";
+    keys = [{
+      fingerprint = "1988 3FD8 EA2E B4EC 0A93  1E22 B77B 2A40 E770 2F19";
+    }];
+  };
+  KibaFox = {
+    email = "kiba.fox@foxypossibilities.com";
+    github = "KibaFox";
+    githubId = 16481032;
+    name = "Kiba Fox";
+  };
+  kidanger = {
+    email = "angerj.dev@gmail.com";
+    github = "kidanger";
+    githubId = 297479;
+    name = "Jérémy Anger";
+  };
+  kidd = {
+    email = "raimonster@gmail.com";
+    github = "kidd";
+    githubId = 25607;
+    name = "Raimon Grau";
+  };
+  kidonng = {
+    email = "hi@xuann.wang";
+    github = "kidonng";
+    githubId = 44045911;
+    name = "Kid";
+  };
+  kidsan = {
+    github = "Kidsan";
+    githubId = 8798449;
+    name = "kidsan";
+  };
+  kierdavis = {
+    email = "kierdavis@gmail.com";
+    github = "kierdavis";
+    githubId = 845652;
+    name = "Kier Davis";
+  };
+  kilianar = {
+    email = "mail@kilianar.de";
+    github = "kilianar";
+    githubId = 105428155;
+    name = "kilianar";
+  };
+  kilimnik = {
+    email = "mail@kilimnik.de";
+    github = "kilimnik";
+    githubId = 5883283;
+    name = "Daniel Kilimnik";
+  };
+  killercup = {
+    email = "killercup@gmail.com";
+    github = "killercup";
+    githubId = 20063;
+    name = "Pascal Hertleif";
+  };
+  kiloreux = {
+    email = "kiloreux@gmail.com";
+    github = "kiloreux";
+    githubId = 6282557;
+    name = "Kiloreux Emperex";
+  };
+  kim0 = {
+    email = "email.ahmedkamal@googlemail.com";
+    github = "kim0";
+    githubId = 59667;
+    name = "Ahmed Kamal";
+  };
+  kimat = {
+    email = "mail@kimat.org";
+    github = "kimat";
+    githubId = 3081769;
+    name = "Kimat Boven";
+  };
+  kimburgess = {
+    email = "kim@acaprojects.com";
+    github = "kimburgess";
+    githubId = 843652;
+    name = "Kim Burgess";
+  };
+  kindrowboat = {
+    email = "hello@kindrobot.ca";
+    github = "kindrowboat";
+    githubId = 777773;
+    name = "Stef Dunlap";
+  };
+  kini = {
+    email = "keshav.kini@gmail.com";
+    github = "kini";
+    githubId = 691290;
+    name = "Keshav Kini";
+  };
+  kinzoku = {
+    email = "kinzokudev4869@gmail.com";
+    github = "kinzoku-dev";
+    githubId = 140647311;
+    name = "Ayman Hamza";
+  };
+  kip93 = {
+    name = "Leandro Reina Kiperman";
+    email = "leandro@kip93.net";
+    matrix = "@kip93:matrix.org";
+    github = "kip93";
+    githubId = 26793632;
+  };
+  kira-bruneau = {
+    email = "kira.bruneau@pm.me";
+    name = "Kira Bruneau";
+    github = "kira-bruneau";
+    githubId = 382041;
+  };
+  kirelagin = {
+    email = "kirelagin@gmail.com";
+    matrix = "@kirelagin:matrix.org";
+    github = "kirelagin";
+    githubId = 451835;
+    name = "Kirill Elagin";
+  };
+  kirikaza = {
+    email = "k@kirikaza.ru";
+    github = "kirikaza";
+    githubId = 804677;
+    name = "Kirill Kazakov";
+  };
+  kirillrdy = {
+    email = "kirillrdy@gmail.com";
+    github = "kirillrdy";
+    githubId = 12160;
+    name = "Kirill Radzikhovskyy";
+  };
+  kiskae = {
+    github = "Kiskae";
+    githubId = 546681;
+    name = "Jeroen van Leusen";
+  };
+  kisonecat = {
+    email = "kisonecat@gmail.com";
+    github = "kisonecat";
+    githubId = 148352;
+    name = "Jim Fowler";
+  };
+  kittywitch = {
+    email = "kat@inskip.me";
+    github = "kittywitch";
+    githubId = 67870215;
+    name = "Kat Inskip";
+    keys = [{
+      fingerprint = "9CC6 44B5 69CD A59B C874  C4C9 E8DD E3ED 1C90 F3A0";
+    }];
+  };
+  kiwi = {
+    email = "envy1988@gmail.com";
+    github = "Kiwi";
+    githubId = 35715;
+    name = "Robert Djubek";
+    keys = [{
+      fingerprint = "8992 44FC D291 5CA2 0A97  802C 156C 88A5 B0A0 4B2A";
+    }];
+  };
+  kjeremy = {
+    email = "kjeremy@gmail.com";
+    name = "Jeremy Kolb";
+    github = "kjeremy";
+    githubId = 4325700;
+  };
+  kkharji = {
+    name = "kkharji";
+    email = "kkharji@protonmail.com";
+    github = "kkharji";
+    githubId = 65782666;
+  };
+  klden = {
+    name = "Kenzyme Le";
+    email = "kl@kenzymele.com";
+    github = "klDen";
+    githubId = 5478260;
+  };
+  klntsky = {
+    email = "klntsky@gmail.com";
+    name = "Vladimir Kalnitsky";
+    github = "klntsky";
+    githubId = 18447310;
+  };
+  kloenk = {
+    email = "me@kloenk.dev";
+    matrix = "@kloenk:petabyte.dev";
+    name = "Finn Behrens";
+    github = "Kloenk";
+    githubId = 12898828;
+    keys = [{
+      fingerprint = "6881 5A95 D715 D429 659B  48A4 B924 45CF C954 6F9D";
+    }];
+  };
+  kmcopper = {
+    email = "kmcopper@danwin1210.me";
+    name = "Kyle Copperfield";
+    github = "kmcopper";
+    githubId = 57132115;
+  };
+  kmeakin = {
+    email = "karlwfmeakin@gmail.com";
+    name = "Karl Meakin";
+    github = "Kmeakin";
+    githubId = 19665139;
+  };
+
+  kmein = {
+    email = "kmein@posteo.de";
+    name = "Kierán Meinhardt";
+    github = "kmein";
+    githubId = 10352507;
+  };
+  kmicklas = {
+    email = "maintainer@kmicklas.com";
+    name = "Ken Micklas";
+    github = "kmicklas";
+    githubId = 929096;
+  };
+  knairda = {
+    email = "adrian@kummerlaender.eu";
+    name = "Adrian Kummerlaender";
+    github = "KnairdA";
+    githubId = 498373;
+  };
+  knarkzel = {
+    email = "knarkzel@gmail.com";
+    name = "Knarkzel";
+    github = "Knarkzel";
+    githubId = 85593302;
+  };
+  knedlsepp = {
+    email = "josef.kemetmueller@gmail.com";
+    github = "knedlsepp";
+    githubId = 3287933;
+    name = "Josef Kemetmüller";
+  };
+  knightpp = {
+    email = "knightpp@proton.me";
+    github = "knightpp";
+    githubId = 28928944;
+    name = "Danylo Kondratiev";
+  };
+  knl = {
+    email = "nikola@knezevic.co";
+    github = "knl";
+    githubId = 361496;
+    name = "Nikola Knežević";
+  };
+  kolaente = {
+    email = "k@knt.li";
+    github = "kolaente";
+    githubId = 13721712;
+    name = "Konrad Langenberg";
+  };
+  kolbycrouch = {
+    email = "kjc.devel@gmail.com";
+    github = "kolbycrouch";
+    githubId = 6346418;
+    name = "Kolby Crouch";
+  };
+  kolloch = {
+    email = "info@eigenvalue.net";
+    github = "kolloch";
+    githubId = 339354;
+    name = "Peter Kolloch";
+  };
+  konimex = {
+    email = "herdiansyah@netc.eu";
+    github = "konimex";
+    githubId = 15692230;
+    name = "Muhammad Herdiansyah";
+  };
+  konradmalik = {
+    email = "konrad.malik@gmail.com";
+    matrix = "@konradmalik:matrix.org";
+    name = "Konrad Malik";
+    github = "konradmalik";
+    githubId = 13033392;
+  };
+  konst-aa = {
+    email = "konstantin.astafurov@gmail.com";
+    github = "konst-aa";
+    githubId = 40547702;
+    name = "Konstantin Astafurov";
+  };
+  koozz = {
+    email = "koozz@linux.com";
+    github = "koozz";
+    githubId = 264372;
+    name = "Jan van den Berg";
+  };
+  koppor = {
+    email = "kopp.dev@gmail.com";
+    github = "koppor";
+    githubId = 1366654;
+    name = "Oliver Kopp";
+  };
+  koral = {
+    email = "koral@mailoo.org";
+    github = "k0ral";
+    githubId = 524268;
+    name = "Koral";
+  };
+  koralowiec = {
+    email = "qnlgzyrw@anonaddy.me";
+    github = "koralowiec";
+    githubId = 36413794;
+    name = "Arek Kalandyk";
+  };
+  koslambrou = {
+    email = "koslambrou@gmail.com";
+    github = "koslambrou";
+    githubId = 2037002;
+    name = "Konstantinos";
+  };
+  kouyk = {
+    email = "skykinetic@stevenkou.xyz";
+    github = "kouyk";
+    githubId = 1729497;
+    name = "Steven Kou";
+  };
+  kovirobi = {
+    email = "kovirobi@gmail.com";
+    github = "KoviRobi";
+    githubId = 1903418;
+    name = "Kovacsics Robert";
+  };
+  kquick = {
+    email = "quick@sparq.org";
+    github = "kquick";
+    githubId = 787421;
+    name = "Kevin Quick";
+  };
+  kradalby = {
+    name = "Kristoffer Dalby";
+    email = "kristoffer@dalby.cc";
+    github = "kradalby";
+    githubId = 98431;
+  };
+  kraem = {
+    email = "me@kraem.xyz";
+    github = "kraem";
+    githubId = 26622971;
+    name = "Ronnie Ebrin";
+  };
+  kragniz = {
+    email = "louis@kragniz.eu";
+    github = "kragniz";
+    githubId = 735008;
+    name = "Louis Taylor";
+  };
+  kranurag7 = {
+    email = "contact.anurag7@gmail.com";
+    github = "kranurag7";
+    githubId = 81210977;
+    name = "Anurag";
+  };
+  kranzes = {
+    email = "personal@ilanjoselevich.com";
+    github = "Kranzes";
+    githubId = 56614642;
+    name = "Ilan Joselevich";
+  };
+  krav = {
+    email = "kristoffer@microdisko.no";
+    github = "krav";
+    githubId = 4032;
+    name = "Kristoffer Thømt Ravneberg";
+  };
+  kristian-brucaj = {
+    email = "kbrucaj@gmail.com";
+    github = "Flameslice";
+    githubId = 8893110;
+    name = "Kristian Brucaj";
+  };
+  kristoff3r = {
+    email = "k.soeholm@gmail.com";
+    github = "kristoff3r";
+    githubId = 160317;
+    name = "Kristoffer Søholm";
+  };
+  kritnich = {
+    email = "kritnich@kritni.ch";
+    github = "Kritnich";
+    githubId = 22116767;
+    name = "Kritnich";
+  };
+  krloer = {
+    email = "kriloneri@gmail.com";
+    github = "krloer";
+    githubId = 45591621;
+    name = "Kristoffer Longva Eriksen";
+    matrix = "@krisleri:pvv.ntnu.no";
+  };
+  kroell = {
+    email = "nixosmainter@makroell.de";
+    github = "rokk4";
+    githubId = 17659803;
+    name = "Matthias Axel Kröll";
+  };
+  krostar = {
+    email = "alexis.destrez@pm.me";
+    github = "krostar";
+    githubId = 5759930;
+    name = "Alexis Destrez";
+  };
+  krupkat = {
+    github = "krupkat";
+    githubId = 6817216;
+    name = "Tomas Krupka";
+    matrix = "@krupkat:matrix.org";
+  };
+  krzaczek = {
+    name = "Pawel Krzaczkowski";
+    email = "pawel@printu.pl";
+    github = "krzaczek";
+    githubId = 5773701;
+  };
+  ktf = {
+    email = "giulio.eulisse@cern.ch";
+    github = "ktf";
+    githubId = 10544;
+    name = "Giuluo Eulisse";
+  };
+  kthielen = {
+    email = "kthielen@gmail.com";
+    github = "kthielen";
+    githubId = 1409287;
+    name = "Kalani Thielen";
+  };
+  ktor = {
+    email = "kruszewsky@gmail.com";
+    github = "ktor";
+    githubId = 99639;
+    name = "Pawel Kruszewski";
+  };
+  kubukoz = {
+    email = "kubukoz@gmail.com";
+    github = "kubukoz";
+    githubId = 894884;
+    name = "Jakub Kozłowski";
+  };
+  kud = {
+    email = "kasa7qi@gmail.com";
+    github = "KUD-00";
+    githubId = 70764075;
+    name = "kud";
+  };
+  kupac = {
+    github = "Kupac";
+    githubId = 8224569;
+    name = "László Kupcsik";
+  };
+  kurnevsky = {
+    email = "kurnevsky@gmail.com";
+    github = "kurnevsky";
+    githubId = 2943605;
+    name = "Evgeny Kurnevsky";
+  };
+  kuwii = {
+    name = "kuwii";
+    email = "kuwii.someone@gmail.com";
+    github = "kuwii";
+    githubId = 10705175;
+  };
+  kuznero = {
+    email = "roman@kuznero.com";
+    github = "kuznero";
+    githubId = 449813;
+    name = "Roman Kuznetsov";
+  };
+  kwohlfahrt = {
+    email = "kai.wohlfahrt@gmail.com";
+    github = "kwohlfahrt";
+    githubId = 2422454;
+    name = "Kai Wohlfahrt";
+  };
+  kylehendricks = {
+    name = "Kyle Hendricks";
+    email = "kyle-github@mail.hendricks.nu";
+    github = "kylehendricks";
+    githubId = 981958;
+  };
+  kyleondy = {
+    email = "kyle@ondy.org";
+    github = "KyleOndy";
+    githubId = 1640900;
+    name = "Kyle Ondy";
+    keys = [{
+      fingerprint = "3C79 9D26 057B 64E6 D907  B0AC DB0E 3C33 491F 91C9";
+    }];
+  };
+  kylesferrazza = {
+    name = "Kyle Sferrazza";
+    email = "nixpkgs@kylesferrazza.com";
+
+    github = "kylesferrazza";
+    githubId = 6677292;
+
+    keys = [{
+      fingerprint = "5A9A 1C9B 2369 8049 3B48  CF5B 81A1 5409 4816 2372";
+    }];
+  };
+  l0b0 = {
+    email = "victor@engmark.name";
+    github = "l0b0";
+    githubId = 168301;
+    name = "Victor Engmark";
+  };
+  l3af = {
+    email = "L3afMeAlon3@gmail.com";
+    matrix = "@L3afMe:matrix.org";
+    github = "L3afMe";
+    githubId = 72546287;
+    name = "L3af";
+  };
+  laalsaas = {
+    email = "laalsaas@systemli.org";
+    github = "laalsaas";
+    githubId = 43275254;
+    name = "laalsaas";
+  };
+  lach = {
+    email = "iam@lach.pw";
+    github = "CertainLach";
+    githubId = 6235312;
+    keys = [{
+      fingerprint = "323C 95B5 DBF7 2D74 8570  C0B7 40B5 D694 8143 175F";
+    }];
+    name = "Yaroslav Bolyukin";
+  };
+  lafrenierejm = {
+    email = "joseph@lafreniere.xyz";
+    github = "lafrenierejm";
+    githubId = 11155300;
+    keys = [{
+      fingerprint = "0375 DD9A EDD1 68A3 ADA3  9EBA EE23 6AA0 141E FCA3";
+    }];
+    name = "Joseph LaFreniere";
+  };
+  lagoja = {
+    github = "Lagoja";
+    githubId =750845;
+    name = "John Lago";
+  };
+  laikq = {
+    email = "gwen@quasebarth.de";
+    github = "laikq";
+    githubId = 55911173;
+    name = "Gwendolyn Quasebarth";
+  };
+  lamarios = {
+    matrix = "@lamarios:matrix.org";
+    github = "lamarios";
+    githubId = 1192563;
+    name = "Paul Fauchon";
+  };
+  lambda-11235 = {
+    email = "taranlynn0@gmail.com";
+    github = "lambda-11235";
+    githubId = 16354815;
+    name = "Taran Lynn";
+  };
+  lammermann = {
+    email = "k.o.b.e.r@web.de";
+    github = "lammermann";
+    githubId = 695526;
+    name = "Benjamin Kober";
+  };
+  larsr = {
+    email = "Lars.Rasmusson@gmail.com";
+    github = "larsr";
+    githubId = 182024;
+    name = "Lars Rasmusson";
+  };
+  l-as = {
+    email = "las@protonmail.ch";
+    matrix = "@Las:matrix.org";
+    github = "L-as";
+    githubId = 22075344;
+    keys = [{
+      fingerprint = "A093 EA17 F450 D4D1 60A0  1194 AC45 8A7D 1087 D025";
+    }];
+    name = "Las Safin";
+  };
+  lasandell = {
+    email = "lasandell@gmail.com";
+    github = "lasandell";
+    githubId = 2034420;
+    name = "Luke Sandell";
+  };
+  lassulus = {
+    email = "lassulus@gmail.com";
+    matrix = "@lassulus:lassul.us";
+    github = "Lassulus";
+    githubId = 621759;
+    name = "Lassulus";
+  };
+  laurailway = {
+    email = "laurailway.git@posteo.net";
+    github = "LAURAilway";
+    githubId = 118690640;
+    name = "Laura";
+  };
+  laurent-f1z1 = {
+    email = "laurent.nixpkgs@fainsin.bzh";
+    github = "Laurent2916";
+    githubId = 21087104;
+    name = "Laurent Fainsin";
+  };
+  lavafroth = {
+    email = "lavafroth@protonmail.com";
+    github = "lavafroth";
+    githubId = 107522312;
+    name = "Himadri Bhattacharjee";
+  };
+  layus = {
+    email = "layus.on@gmail.com";
+    github = "layus";
+    githubId = 632767;
+    name = "Guillaume Maudoux";
+  };
+  lblasc = {
+    email = "lblasc@znode.net";
+    github = "lblasc";
+    githubId = 32152;
+    name = "Luka Blaskovic";
+  };
+  lbpdt = {
+    email = "nix@pdtpartners.com";
+    github = "lbpdt";
+    githubId = 45168934;
+    name = "Louis Blin";
+  };
+  lde = {
+    email = "lilian.deloche@puck.fr";
+    github = "lde";
+    githubId = 1447020;
+    name = "Lilian Deloche";
+  };
+  ldelelis = {
+    email = "ldelelis@est.frba.utn.edu.ar";
+    github = "ldelelis";
+    githubId = 20250323;
+    name = "Lucio Delelis";
+  };
+  ldenefle = {
+    email = "ldenefle@gmail.com";
+    github = "ldenefle";
+    githubId = 20558127;
+    name = "Lucas Denefle";
+  };
+  ldesgoui = {
+    email = "ldesgoui@gmail.com";
+    matrix = "@ldesgoui:matrix.org";
+    github = "ldesgoui";
+    githubId = 2472678;
+    name = "Lucas Desgouilles";
+  };
+  ldprg = {
+    email = "lukas_4dr@gmx.at";
+    matrix = "@ldprg:matrix.org";
+    github = "LDprg";
+    githubId = 71488985;
+    name = "LDprg";
+  };
+  league = {
+    email = "league@contrapunctus.net";
+    github = "league";
+    githubId = 50286;
+    name = "Christopher League";
+  };
+  leahneukirchen = {
+    email = "leah@vuxu.org";
+    github = "leahneukirchen";
+    githubId = 139;
+    name = "Leah Neukirchen";
+  };
+  lebastr = {
+    email = "lebastr@gmail.com";
+    github = "lebastr";
+    githubId = 887072;
+    name = "Alexander Lebedev";
+  };
+  lecoqjacob = {
+    name = "Jacob LeCoq";
+    email = "lecoqjacob@gmail.com";
+    githubId = 9278174;
+    github = "lecoqjacob";
+    keys = [{
+      fingerprint = "C505 1E8B 06AC 1776 6875  1B60 93AF DAD0 10B3 CB8D";
+    }];
+  };
+  ledif = {
+    email = "refuse@gmail.com";
+    github = "ledif";
+    githubId = 307744;
+    name = "Adam Fidel";
+  };
+  leemachin = {
+    email = "me@mrl.ee";
+    github = "leemeichin";
+    githubId = 736291;
+    name = "Lee Machin";
+  };
+  leenaars = {
+    email = "ml.software@leenaa.rs";
+    github = "leenaars";
+    githubId = 4158274;
+    name = "Michiel Leenaars";
+  };
+  leifhelm = {
+    email = "jakob.leifhelm@gmail.com";
+    github = "leifhelm";
+    githubId = 31693262;
+    name = "Jakob Leifhelm";
+    keys = [{
+      fingerprint = "4A82 F68D AC07 9FFD 8BF0  89C4 6817 AA02 3810 0822";
+    }];
+  };
+  leixb = {
+    email = "abone9999+nixpkgs@gmail.com";
+    matrix = "@leix_b:matrix.org";
+    github = "Leixb";
+    githubId = 17183803;
+    name = "Aleix Boné";
+    keys = [{
+      fingerprint = "63D3 F436 EDE8 7E1F 1292  24AF FC03 5BB2 BB28 E15D";
+    }];
+  };
+  lejonet = {
+    email = "daniel@kuehn.se";
+    github = "lejonet";
+    githubId = 567634;
+    name = "Daniel Kuehn";
+  };
+  lelgenio = {
+    email = "lelgenio@disroot.org";
+    github = "lelgenio";
+    githubId = 31388299;
+    name = "Leonardo Eugênio";
+  };
+  leo248 = {
+    github ="leo248";
+    githubId = 95365184;
+    keys = [{
+      fingerprint = "81E3 418D C1A2 9687 2C4D  96DC BB1A 818F F295 26D2";
+    }];
+    name = "leo248";
+  };
+  leo60228 = {
+    email = "leo@60228.dev";
+    matrix = "@leo60228:matrix.org";
+    github = "leo60228";
+    githubId = 8355305;
+    name = "leo60228";
+    keys = [{
+      fingerprint = "5BE4 98D5 1C24 2CCD C21A  4604 AC6F 4BA0 78E6 7833";
+    }];
+  };
+  leona = {
+    email = "nix@leona.is";
+    github = "leona-ya";
+    githubId = 11006031;
+    name = "Leona Maroni";
+  };
+  leonardoce = {
+    email = "leonardo.cecchi@gmail.com";
+    github = "leonardoce";
+    githubId = 1572058;
+    name = "Leonardo Cecchi";
+  };
+  leonid = {
+    email = "belyaev.l@northeastern.edu";
+    github = "leonidbelyaev";
+    githubId = 77865363;
+    name = "Leonid Belyaev";
+  };
+  leshainc = {
+    email = "leshainc@fomalhaut.me";
+    github = "LeshaInc";
+    githubId = 42153076;
+    name = "Alexey Nikashkin";
+  };
+  lesuisse = {
+    email = "thomas@gerbet.me";
+    github = "LeSuisse";
+    githubId = 737767;
+    name = "Thomas Gerbet";
+  };
+  lethalman = {
+    email = "lucabru@src.gnome.org";
+    github = "lucabrunox";
+    githubId = 480920;
+    name = "Luca Bruno";
+  };
+  leungbk = {
+    email = "leungbk@mailfence.com";
+    github = "leungbk";
+    githubId = 29217594;
+    name = "Brian Leung";
+  };
+  lewo = {
+    email = "lewo@abesis.fr";
+    matrix = "@lewo:matrix.org";
+    github = "nlewo";
+    githubId = 3425311;
+    name = "Antoine Eiche";
+  };
+  lexuge = {
+    name = "Harry Ying";
+    email = "lexugeyky@outlook.com";
+    github = "LEXUGE";
+    githubId = 13804737;
+    keys = [{
+      fingerprint = "7FE2 113A A08B 695A C8B8  DDE6 AE53 B4C2 E58E DD45";
+    }];
+  };
+  lf- = {
+    email = "nix-maint@lfcode.ca";
+    github = "lf-";
+    githubId = 6652840;
+    name = "Jade";
+  };
+  lgcl = {
+    email = "dev@lgcl.de";
+    name = "Leon Vack";
+    github = "LogicalOverflow";
+    githubId = 5919957;
+  };
+  lheckemann = {
+    email = "git@sphalerite.org";
+    github = "lheckemann";
+    githubId = 341954;
+    name = "Linus Heckemann";
+  };
+  lhvwb = {
+    email = "nathaniel.baxter@gmail.com";
+    github = "nathanielbaxter";
+    githubId = 307589;
+    name = "Nathaniel Baxter";
+  };
+  liamdiprose = {
+    email = "liam@liamdiprose.com";
+    github = "liamdiprose";
+    githubId = 1769386;
+    name = "Liam Diprose";
+  };
+  liassica = {
+    email = "git-commit.jingle869@aleeas.com";
+    github = "Liassica";
+    githubId = 115422798;
+    name = "Liassica";
+    keys = [{
+      fingerprint = "83BE 3033 6164 B971 FA82  7036 0D34 0E59 4980 7BDD";
+    }];
+  };
+  liberatys = {
+    email = "liberatys@hey.com";
+    name = "Nick Anthony Flueckiger";
+    github = "liberatys";
+    githubId = 35100156;
+  };
+  libjared = {
+    email = "jared@perrycode.com";
+    github = "libjared";
+    githubId = 3746656;
+    matrix = "@libjared:matrix.org";
+    name = "Jared Perry";
+  };
+  liff = {
+    email = "liff@iki.fi";
+    github = "liff";
+    githubId = 124475;
+    name = "Olli Helenius";
+  };
+  lightbulbjim = {
+    email = "chris@killred.net";
+    github = "lightbulbjim";
+    githubId = 4312404;
+    name = "Chris Rendle-Short";
+  };
+  lightdiscord = {
+    email = "root@arnaud.sh";
+    github = "lightdiscord";
+    githubId = 24509182;
+    name = "Arnaud Pascal";
+  };
+  lightquantum = {
+    email = "self@lightquantum.me";
+    github = "PhotonQuantum";
+    githubId = 18749973;
+    name = "Yanning Chen";
+    matrix = "@self:lightquantum.me";
+  };
+  Ligthiago = {
+    email = "donets.andre@gmail.com";
+    github = "Ligthiago";
+    githubId = 142721811;
+    name = "Andrey Donets";
+  };
+  lihop = {
+    email = "nixos@leroy.geek.nz";
+    github = "lihop";
+    githubId = 3696783;
+    name = "Leroy Hopson";
+  };
+  liketechnik = {
+    name = "Florian Warzecha";
+
+    email = "liketechnik@disroot.org";
+    github = "liketechnik";
+    githubId = 24209689;
+
+    keys = [{
+      fingerprint = "92D8 A09D 03DD B774 AABD 53B9 E136 2F07 D750 DB5C";
+    }];
+  };
+  lillycham = {
+    email = "lillycat332@gmail.com";
+    github = "lillycat332";
+    githubId = 54189319;
+    name = "Lilly Cham";
+  };
+  lilyball = {
+    email = "lily@sb.org";
+    github = "lilyball";
+    githubId = 714;
+    name = "Lily Ballard";
+  };
+  lilyinstarlight = {
+    email = "lily@lily.flowers";
+    matrix = "@lily:lily.flowers";
+    github = "lilyinstarlight";
+    githubId = 298109;
+    name = "Lily Foster";
+  };
+  limeytexan = {
+    email = "limeytexan@gmail.com";
+    github = "limeytexan";
+    githubId = 36448130;
+    name = "Michael Brantley";
+  };
+  linc01n = {
+    email = "git@lincoln.hk";
+    github = "linc01n";
+    githubId = 667272;
+    name = "Lincoln Lee";
+  };
+  linj = {
+    name = "Lin Jian";
+    email = "me@linj.tech";
+    matrix = "@me:linj.tech";
+    github = "jian-lin";
+    githubId = 75130626;
+    keys = [{
+      fingerprint = "80EE AAD8 43F9 3097 24B5  3D7E 27E9 7B91 E63A 7FF8";
+    }];
+  };
+  linquize = {
+    email = "linquize@yahoo.com.hk";
+    github = "linquize";
+    githubId = 791115;
+    name = "Linquize";
+  };
+  linsui = {
+    email = "linsui555@gmail.com";
+    github = "linsui";
+    githubId = 36977733;
+    name = "linsui";
+  };
+  linus = {
+    email = "linusarver@gmail.com";
+    github = "listx";
+    githubId = 725613;
+    name = "Linus Arver";
+  };
+  linuxissuper = {
+    email = "m+nix@linuxistcool.de";
+    matrix = "@m:linuxistcool.de";
+    github = "linuxissuper";
+    githubId = 74221543;
+    name = "Moritz Goltdammer";
+  };
+  lionello = {
+    email = "lio@lunesu.com";
+    github = "lionello";
+    githubId = 591860;
+    name = "Lionello Lunesu";
+  };
+  livnev = {
+    email = "lev@liv.nev.org.uk";
+    github = "livnev";
+    githubId = 3964494;
+    name = "Lev Livnev";
+    keys = [{
+      fingerprint = "74F5 E5CC 19D3 B5CB 608F  6124 68FF 81E6 A785 0F49";
+    }];
+  };
+  liyangau = {
+    email = "d@aufomm.com";
+    github = "liyangau";
+    githubId = 71299093;
+    name = "Li Yang";
+  };
+  lizelive = {
+    email = "nixpkgs@lize.live";
+    github = "lizelive";
+    githubId = 40217331;
+    name = "LizeLive";
+  };
+  lluchs = {
+    email = "lukas.werling@gmail.com";
+    github = "lluchs";
+    githubId = 516527;
+    name = "Lukas Werling";
+  };
+  lnl7 = {
+    email = "daiderd@gmail.com";
+    github = "LnL7";
+    githubId = 689294;
+    name = "Daiderd Jordan";
+  };
+  lo1tuma = {
+    email = "schreck.mathias@gmail.com";
+    github = "lo1tuma";
+    githubId = 169170;
+    name = "Mathias Schreck";
+  };
+  locallycompact = {
+    email = "dan.firth@homotopic.tech";
+    github = "locallycompact";
+    githubId = 1267527;
+    name = "Daniel Firth";
+  };
+  lockejan = {
+    email = "git@smittie.de";
+    matrix = "@jan:smittie.de";
+    github = "lockejan";
+    githubId = 25434434;
+    name = "Jan Schmitt";
+    keys = [{
+      fingerprint = "1763 9903 2D7C 5B82 5D5A  0EAD A2BC 3C6F 1435 1991";
+    }];
+  };
+  locochoco = {
+    email = "contact@locochoco.dev";
+    github = "loco-choco";
+    githubId = 58634087;
+    name = "Ivan Pancheniak";
+  };
+  lodi = {
+    email = "anthony.lodi@gmail.com";
+    github = "lodi";
+    githubId = 918448;
+    name = "Anthony Lodi";
+  };
+  loewenheim = {
+    email = "loewenheim@mailbox.org";
+    github = "loewenheim";
+    githubId = 7622248;
+    name = "Sebastian Zivota";
+  };
+  logo = {
+    email = "logo4poop@protonmail.com";
+    matrix = "@logo4poop:matrix.org";
+    github = "logo4poop";
+    githubId = 24994565;
+    name = "Isaac Silverstein";
+  };
+  loicreynier = {
+    email = "loic@loicreynier.fr";
+    github = "loicreynier";
+    githubId = 88983487;
+    name = "Loïc Reynier";
+  };
+  lom = {
+    email = "legendofmiracles@protonmail.com";
+    matrix = "@legendofmiracles:matrix.org";
+    github = "legendofmiracles";
+    githubId = 30902201;
+    name = "legendofmiracles";
+    keys = [{
+      fingerprint = "CC50 F82C 985D 2679 0703  AF15 19B0 82B3 DEFE 5451";
+    }];
+  };
+  longer = {
+    email = "michal@mieszczak.com.pl";
+    name = "Michał Mieszczak";
+    github = "LongerHV";
+    githubId = 46924944;
+  };
+  lopsided98 = {
+    email = "benwolsieffer@gmail.com";
+    github = "lopsided98";
+    githubId = 5624721;
+    name = "Ben Wolsieffer";
+  };
+  lord-valen = {
+    name = "Lord Valen";
+    matrix = "@lord-valen:matrix.org";
+    github = "Lord-Valen";
+    githubId = 46138807;
+  };
+  lorenz = {
+    name = "Lorenz Brun";
+    email = "lorenz@brun.one";
+    github = "lorenz";
+    githubId = 5228892;
+  };
+  lorenzleutgeb = {
+    email = "lorenz@leutgeb.xyz";
+    github = "lorenzleutgeb";
+    githubId = 542154;
+    name = "Lorenz Leutgeb";
+  };
+  loskutov = {
+    email = "ignat.loskutov@gmail.com";
+    github = "loskutov";
+    githubId = 1202012;
+    name = "Ignat Loskutov";
+  };
+  lostnet = {
+    email = "lost.networking@gmail.com";
+    github = "lostnet";
+    githubId = 1422781;
+    name = "Will Young";
+  };
+  louisdk1 = {
+    email = "louis@louis.dk";
+    github = "LouisDK1";
+    githubId = 4969294;
+    name = "Louis Tim Larsen";
+  };
+  loveisgrief = {
+    name = "LoveIsGrief";
+    email = "loveisgrief@tuta.io";
+    github = "LoveIsGrief";
+    githubId = 2829538;
+    keys = [{
+      fingerprint = "9847 4F48 18C6 4E0A F0C5  3529 E96D 1EDF A053 45EB";
+    }];
+  };
+  lovek323 = {
+    email = "jason@oconal.id.au";
+    github = "lovek323";
+    githubId = 265084;
+    name = "Jason O'Conal";
+  };
+  lovesegfault = {
+    email = "meurerbernardo@gmail.com";
+    matrix = "@lovesegfault:matrix.org";
+    github = "lovesegfault";
+    githubId = 7243783;
+    name = "Bernardo Meurer";
+    keys = [{
+      fingerprint = "F193 7596 57D5 6DA4 CCD4  786B F4C0 D53B 8D14 C246";
+    }];
+  };
+  lowfatcomputing = {
+    email = "andreas.wagner@lowfatcomputing.org";
+    github = "lowfatcomputing";
+    githubId = 10626;
+    name = "Andreas Wagner";
+  };
+  lrewega = {
+    email = "lrewega@c32.ca";
+    github = "lrewega";
+    githubId = 639066;
+    name = "Luke Rewega";
+  };
+  lromor = {
+    email = "leonardo.romor@gmail.com";
+    github = "lromor";
+    githubId = 1597330;
+    name = "Leonardo Romor";
+  };
+  lschuermann = {
+    email = "leon.git@is.currently.online";
+    matrix = "@leons:is.currently.online";
+    github = "lschuermann";
+    githubId = 5341193;
+    name = "Leon Schuermann";
+  };
+  lsix = {
+    email = "lsix@lancelotsix.com";
+    github = "lsix";
+    githubId = 724339;
+    name = "Lancelot SIX";
+  };
+  ltavard = {
+    email = "laure.tavard@univ-grenoble-alpes.fr";
+    github = "ltavard";
+    githubId = 8555953;
+    name = "Laure Tavard";
+  };
+  ltstf1re = {
+    email = "ltstf1re@disroot.org";
+    github = "lsf1re";
+    githubId = 153414530;
+    matrix = "@ltstf1re:converser.eu";
+    name = "Little Starfire";
+    keys = [{
+      fingerprint = "FE6C C3C9 2ACF 4367 2B56  5B22 8603 2ACC 051A 873D";
+    }];
+  };
+  lu15w1r7h = {
+    email = "lwirth2000@gmail.com";
+    github = "LU15W1R7H";
+    githubId = 37505890;
+    name = "Luis Wirth";
+  };
+  luc65r = {
+    email = "lucas@ransan.tk";
+    github = "luc65r";
+    githubId = 59375051;
+    name = "Lucas Ransan";
+  };
+  LucaGuerra = {
+    email = "luca@guerra.sh";
+    github = "LucaGuerra";
+    githubId = 35580196;
+    name = "Luca Guerra";
+  };
+  lucasbergman = {
+    email = "lucas@bergmans.us";
+    github = "lucasbergman";
+    githubId = 3717454;
+    name = "Lucas Bergman";
+  };
+  lucasew = {
+    email = "lucas59356@gmail.com";
+    github = "lucasew";
+    githubId = 15693688;
+    name = "Lucas Eduardo Wendt";
+  };
+  lucc = {
+    email = "lucc+nix@posteo.de";
+    github = "lucc";
+    githubId = 1104419;
+    name = "Lucas Hoffmann";
+  };
+  lucperkins = {
+    email = "lucperkins@gmail.com";
+    github = "lucperkins";
+    githubId = 1523104;
+    name = "Luc Perkins";
+  };
+  lucus16 = {
+    email = "lars.jellema@gmail.com";
+    github = "Lucus16";
+    githubId = 2487922;
+    name = "Lars Jellema";
+  };
+  ludat = {
+    email = "lucas6246@gmail.com";
+    github = "ludat";
+    githubId = 4952044;
+    name = "Lucas David Traverso";
+  };
+  ludo = {
+    email = "ludo@gnu.org";
+    github = "civodul";
+    githubId = 1168435;
+    name = "Ludovic Courtès";
+  };
+  ludovicopiero = {
+    email = "lewdovico@gnuweeb.org";
+    github = "ludovicopiero";
+    githubId = 44255157;
+    name = "Ludovico Piero";
+    keys = [{
+      fingerprint = "72CA 4F61 46C6 0DAB 6193  4D35 3911 DD27 6CFE 779C";
+    }];
+  };
+  lufia = {
+    email = "lufia@lufia.org";
+    github = "lufia";
+    githubId = 1784379;
+    name = "Kyohei Kadota";
+  };
+  Luflosi = {
+    name = "Luflosi";
+    email = "luflosi@luflosi.de";
+    github = "Luflosi";
+    githubId = 15217907;
+    keys = [{
+      fingerprint = "66D1 3048 2B5F 2069 81A6  6B83 6F98 7CCF 224D 20B9";
+    }];
+  };
+  lugarun = {
+    email = "lfschmidt.me@gmail.com";
+    github = "lugarun";
+    githubId = 5767106;
+    name = "Lukas Schmidt";
+  };
+  luis = {
+    email = "luis.nixos@gmail.com";
+    github = "Luis-Hebendanz";
+    githubId = 22085373;
+    name = "Luis Hebendanz";
+  };
+  luisdaranda = {
+    email = "luisdomingoaranda@gmail.com";
+    github = "propet";
+    githubId = 8515861;
+    name = "Luis D. Aranda Sánchez";
+    keys = [{
+      fingerprint = "AB7C 81F4 9E07 CC64 F3E7  BC25 DCAC C6F4 AAFC C04E";
+    }];
+  };
+  luisnquin = {
+    email = "lpaandres2020@gmail.com";
+    matrix = "@luisnquin:matrix.org";
+    github = "luisnquin";
+    githubId = 86449787;
+    name = "Luis Quiñones";
+  };
+  luispedro = {
+    email = "luis@luispedro.org";
+    github = "luispedro";
+    githubId = 79334;
+    name = "Luis Pedro Coelho";
+  };
+  luizirber = {
+    email = "nixpkgs@luizirber.org";
+    github = "luizirber";
+    githubId = 6642;
+    name = "Luiz Irber";
+  };
+  luizribeiro = {
+    email = "nixpkgs@l9o.dev";
+    matrix = "@luizribeiro:matrix.org";
+    name = "Luiz Ribeiro";
+    github = "luizribeiro";
+    githubId = 112069;
+    keys = [{
+      fingerprint = "97A0 AE5E 03F3 499B 7D7A  65C6 76A4 1432 37EF 5817";
+    }];
+  };
+  lukas-heiligenbrunner = {
+    email = "lukas.heiligenbrunner@gmail.com";
+    github = "lukas-heiligenbrunner";
+    githubId = 30468956;
+    name = "Lukas Heiligenbrunner";
+  };
+  lukaswrz = {
+    email = "lukas@wrz.one";
+    github = "lukaswrz";
+    githubId = 84395723;
+    name = "Lukas Wurzinger";
+  };
+  lukebfox = {
+    email = "lbentley-fox1@sheffield.ac.uk";
+    github = "lukebfox";
+    githubId = 34683288;
+    name = "Luke Bentley-Fox";
+  };
+  lukegb = {
+    email = "nix@lukegb.com";
+    matrix = "@lukegb:zxcvbnm.ninja";
+    github = "lukegb";
+    githubId = 246745;
+    name = "Luke Granger-Brown";
+  };
+  lukego = {
+    email = "luke@snabb.co";
+    github = "lukego";
+    githubId = 13791;
+    name = "Luke Gorrie";
+  };
+  luker = {
+    email = "luker@fenrirproject.org";
+    github = "LucaFulchir";
+    githubId = 2486026;
+    name = "Luca Fulchir";
+  };
+  luleyleo = {
+    email = "git@leopoldluley.de";
+    github = "luleyleo";
+    githubId = 10746692;
+    name = "Leopold Luley";
+  };
+  lumi = {
+    email = "lumi@pew.im";
+    github = "lumi-me-not";
+    githubId = 26020062;
+    name = "lumi";
+  };
+  lunarequest = {
+    email = "nullarequest@vivlaid.net";
+    github = "Lunarequest";
+    githubId = 30698906;
+    name = "Luna D Dragon";
+  };
+  lunik1 = {
+    email = "ch.nixpkgs@themaw.xyz";
+    matrix = "@lunik1:lunik.one";
+    github = "lunik1";
+    githubId = 13547699;
+    name = "Corin Hoad";
+    keys = [{
+      # fingerprint = "BA3A 5886 AE6D 526E 20B4  57D6 6A37 DF94 8318 8492"; # old key, superseded
+      fingerprint = "6E69 6A19 4BD8 BFAE 7362  ACDB 6437 4619 95CA 7F16";
+    }];
+  };
+  LunNova = {
+    email = "nixpkgs-maintainer@lunnova.dev";
+    github = "LunNova";
+    githubId = 782440;
+    name = "Luna Nova";
+  };
+  luochen1990 = {
+    email = "luochen1990@gmail.com";
+    github = "luochen1990";
+    githubId = 2309868;
+    name = "Luo Chen";
+  };
+  lurkki = {
+    email = "jussi.kuokkanen@protonmail.com";
+    github = "Lurkki14";
+    githubId = 44469719;
+    name = "Jussi Kuokkanen";
+  };
+  lux = {
+    email = "lux@lux.name";
+    github = "luxzeitlos";
+    githubId = 1208273;
+    matrix = "@lux:ontheblueplanet.com";
+    name = "Lux";
+  };
+  luz = {
+    email = "luz666@daum.net";
+    github = "Luz";
+    githubId = 208297;
+    name = "Luz";
+  };
+  lw = {
+    email = "lw@fmap.me";
+    github = "lolwat97";
+    githubId = 2057309;
+    name = "Sergey Sofeychuk";
+  };
+  lx = {
+    email = "alex@adnab.me";
+    github = "Alexis211";
+    githubId = 101484;
+    matrix = "@lx:deuxfleurs.fr";
+    name = "Alex Auvolat";
+  };
+  lxea = {
+    email = "nix@amk.ie";
+    github = "lxea";
+    githubId = 7910815;
+    name = "Alex McGrath";
+  };
+  lychee = {
+    email = "itslychee+nixpkgs@protonmail.com";
+    githubId = 82718618;
+    github = "itslychee";
+    name = "Lychee";
+  };
+  lynty = {
+    email = "ltdong93+nix@gmail.com";
+    github = "Lynty";
+    githubId = 39707188;
+    name = "Lynn Dong";
+  };
+  m00wl = {
+    name = "Moritz Lumme";
+    email = "moritz.lumme@gmail.com";
+    github = "m00wl";
+    githubId = 46034439;
+  };
+  m1cr0man = {
+    email = "lucas+nix@m1cr0man.com";
+    github = "m1cr0man";
+    githubId = 3044438;
+    name = "Lucas Savva";
+  };
+  ma27 = {
+    email = "maximilian@mbosch.me";
+    matrix = "@ma27:nicht-so.sexy";
+    github = "Ma27";
+    githubId = 6025220;
+    name = "Maximilian Bosch";
+  };
+  ma9e = {
+    email = "sean@lfo.team";
+    github = "furrycatherder";
+    githubId = 36235154;
+    name = "Sean Haugh";
+  };
+  maaslalani = {
+    email = "maaslalani0@gmail.com";
+    github = "maaslalani";
+    githubId = 42545625;
+    name = "Maas Lalani";
+  };
+  mabster314 = {
+    name = "Max Haland";
+    email = "max@haland.org";
+    github = "mabster314";
+    githubId = 5741741;
+    keys = [{
+      fingerprint = "71EF 8F1F 0C24 8B4D 5CDC 1B47 74B3 D790 77EE 37A8";
+    }];
+  };
+  macalinao = {
+    email = "me@ianm.com";
+    name = "Ian Macalinao";
+    github = "macalinao";
+    githubId = 401263;
+    keys = [{
+      fingerprint = "1147 43F1 E707 6F3E 6F4B  2C96 B9A8 B592 F126 F8E8";
+    }];
+  };
+  mac-chaffee = {
+    name = "Mac Chaffee";
+    github = "mac-chaffee";
+    githubId = 7581860;
+  };
+  madjar = {
+    email = "georges.dubus@compiletoi.net";
+    github = "madjar";
+    githubId = 109141;
+    name = "Georges Dubus";
+  };
+  madonius = {
+    email = "nixos@madoni.us";
+    github = "madonius";
+    githubId = 1246752;
+    name = "madonius";
+    matrix = "@madonius:entropia.de";
+  };
+  Madouura = {
+    email = "madouura@gmail.com";
+    github = "Madouura";
+    githubId = 93990818;
+    name = "Madoura";
+  };
+  maeve = {
+    email = "mrey@mailbox.org";
+    matrix = "@maeve:catgirl.cloud";
+    github = "m-rey";
+    githubId = 42996147;
+    name = "Mæve";
+    keys = [{
+      fingerprint = "96C9 D086 CC9D 7BD7 EF24  80E2 9168 796A 1CC3 AEA2";
+    }];
+  };
+  mafo = {
+    email = "Marc.Fontaine@gmx.de";
+    github = "MarcFontaine";
+    githubId = 1433367;
+    name = "Marc Fontaine";
+  };
+  magenbluten = {
+    email = "magenbluten@codemonkey.cc";
+    github = "magenbluten";
+    githubId = 1140462;
+    name = "magenbluten";
+  };
+  maggesi = {
+    email = "marco.maggesi@gmail.com";
+    github = "maggesi";
+    githubId = 1809783;
+    name = "Marco Maggesi";
+  };
+  magnetophon = {
+    email = "bart@magnetophon.nl";
+    github = "magnetophon";
+    githubId = 7645711;
+    name = "Bart Brouns";
+  };
+  magnouvean = {
+    email = "rg0zjsyh@anonaddy.me";
+    github = "magnouvean";
+    githubId = 85435692;
+    name = "Maxwell Berg";
+  };
+  mahe = {
+    email = "matthias.mh.herrmann@gmail.com";
+    github = "2chilled";
+    githubId = 1238350;
+    name = "Matthias Herrmann";
+  };
+  mahmoudk1000 = {
+    email = "mahmoudk1000@gmail.com";
+    github = "mahmoudk1000";
+    githubId = 24735185;
+    name = "Mahmoud Ayman";
+  };
+  majesticmullet = {
+    email = "hoccthomas@gmail.com.au";
+    github = "MajesticMullet";
+    githubId = 31056089;
+    name = "Tom Ho";
+  };
+  majewsky = {
+    email = "majewsky@gmx.net";
+    github = "majewsky";
+    githubId = 24696;
+    name = "Stefan Majewsky";
+  };
+  majiir = {
+    email = "majiir@nabaal.net";
+    github = "Majiir";
+    githubId = 963511;
+    name = "Majiir Paktu";
+  };
+  makefu = {
+    email = "makefu@syntax-fehler.de";
+    github = "makefu";
+    githubId = 115218;
+    name = "Felix Richter";
+  };
+  MakiseKurisu = {
+    github = "MakiseKurisu";
+    githubId = 2321672;
+    name = "Makise Kurisu";
+  };
+  malbarbo = {
+    email = "malbarbo@gmail.com";
+    github = "malbarbo";
+    githubId = 1678126;
+    name = "Marco A L Barbosa";
+  };
+  malo = {
+    email = "mbourgon@gmail.com";
+    github = "malob";
+    githubId = 2914269;
+    name = "Malo Bourgon";
+  };
+  malt3 = {
+    github = "malt3";
+    githubId = 1780588;
+    name = "Malte Poll";
+  };
+  malte-v = {
+    email = "nixpkgs@mal.tc";
+    github = "malte-v";
+    githubId = 34393802;
+    name = "Malte Voos";
+  };
+  malyn = {
+    email = "malyn@strangeGizmo.com";
+    github = "malyn";
+    githubId = 346094;
+    name = "Michael Alyn Miller";
+  };
+  mandos = {
+    email = "marek.maksimczyk@mandos.net.pl";
+    github = "mandos";
+    githubId = 115060;
+    name = "Marek Maksimczyk";
+  };
+  mangoiv = {
+    email = "contact@mangoiv.com";
+    github = "mangoiv";
+    githubId = 40720523;
+    name = "MangoIV";
+  };
+  manipuladordedados = {
+    email = "manipuladordedados@gmail.com";
+    github = "manipuladordedados";
+    githubId = 1189862;
+    name = "Valter Nazianzeno";
+  };
+  manojkarthick = {
+    email = "smanojkarthick@gmail.com";
+    github = "manojkarthick";
+    githubId = 7802795;
+    name = "Manoj Karthick";
+  };
+  manveru = {
+    email = "m.fellinger@gmail.com";
+    matrix = "@manveru:matrix.org";
+    github = "manveru";
+    githubId = 3507;
+    name = "Michael Fellinger";
+  };
+  maolonglong = {
+    email = "shaolong.chen@outlook.it";
+    github = "maolonglong";
+    githubId = 50797868;
+    name = "Shaolong Chen";
+  };
+  maralorn = {
+    email = "mail@maralorn.de";
+    matrix = "@maralorn:maralorn.de";
+    github = "maralorn";
+    githubId = 1651325;
+    name = "maralorn";
+  };
+  marble = {
+    email = "nixpkgs@computer-in.love";
+    github = "cyber-murmel";
+    githubId = 30078229;
+    name = "marble";
+  };
+  marcovergueira = {
+    email = "vergueira.marco@gmail.com";
+    github = "marcovergueira";
+    githubId = 929114;
+    name = "Marco Vergueira";
+  };
+  marcus7070 = {
+    email = "marcus@geosol.com.au";
+    github = "marcus7070";
+    githubId = 50230945;
+    name = "Marcus Boyd";
+  };
+  marcusramberg = {
+    email = "marcus@means.no";
+    github = "marcusramberg";
+    githubId = 5526;
+    name = "Marcus Ramberg";
+  };
+  marcweber = {
+    email = "marco-oweber@gmx.de";
+    github = "MarcWeber";
+    githubId = 34086;
+    name = "Marc Weber";
+  };
+  marenz = {
+    email = "marenz@arkom.men";
+    github = "marenz2569";
+    githubId = 12773269;
+    name = "Markus Schmidl";
+  };
+  mariaa144 = {
+    email = "speechguard_intensivist@aleeas.com";
+    github = "mariaa144";
+    githubId = 105451387;
+    name = "Maria";
+  };
+  marie = {
+    email = "tabmeier12+nix@gmail.com";
+    github = "nycodeghg";
+    githubId = 37078297;
+    matrix = "@marie:marie.cologne";
+    name = "Marie Ramlow";
+  };
+  marijanp = {
+    name = "Marijan Petričević";
+    email = "marijan.petricevic94@gmail.com";
+    github = "marijanp";
+    githubId = 13599169;
+  };
+  marius851000 = {
+    email = "mariusdavid@laposte.net";
+    name = "Marius David";
+    github = "marius851000";
+    githubId = 22586596;
+  };
+  mariuskimmina = {
+    email = "mar.kimmina@gmail.com";
+    name = "Marius Kimmina";
+    github = "mariuskimmina";
+    githubId = 38843153;
+  };
+  markbeep = {
+    email = "mrkswrn@gmail.com";
+    github = "markbeep";
+    githubId = 20665331;
+    name = "Mark";
+  };
+  markus1189 = {
+    email = "markus1189@gmail.com";
+    github = "markus1189";
+    githubId = 591567;
+    name = "Markus Hauck";
+  };
+  markuskowa = {
+    email = "markus.kowalewski@gmail.com";
+    github = "markuskowa";
+    githubId = 26470037;
+    name = "Markus Kowalewski";
+  };
+  marsam = {
+    github = "marsam";
+    githubId = 65531;
+    name = "Mario Rodas";
+  };
+  marsupialgutz = {
+    email = "mars@possums.xyz";
+    github = "pupbrained";
+    githubId = 33522919;
+    name = "Marshall Arruda";
+  };
+  martfont = {
+    name = "Martino Fontana";
+    email = "tinozzo123@tutanota.com";
+    github = "SuperSamus";
+    githubId = 40663462;
+  };
+  martijnvermaat = {
+    email = "martijn@vermaat.name";
+    github = "martijnvermaat";
+    githubId = 623509;
+    name = "Martijn Vermaat";
+  };
+  martinetd = {
+    email = "f.ktfhrvnznqxacf@noclue.notk.org";
+    github = "martinetd";
+    githubId = 1729331;
+    name = "Dominique Martinet";
+  };
+  martinjlowm = {
+    email = "martin@martinjlowm.dk";
+    github = "martinjlowm";
+    githubId = 110860;
+    name = "Martin Jesper Low Madsen";
+  };
+  martinramm = {
+    email = "martin-ramm@gmx.de";
+    github = "MartinRamm";
+    githubId = 31626748;
+    name = "Martin Ramm";
+  };
+  marzipankaiser = {
+    email = "nixos@gaisseml.de";
+    github = "marzipankaiser";
+    githubId = 2551444;
+    name = "Marcial Gaißert";
+    keys = [{
+      fingerprint = "B573 5118 0375 A872 FBBF  7770 B629 036B E399 EEE9";
+    }];
+  };
+  masaeedu = {
+    email = "masaeedu@gmail.com";
+    github = "masaeedu";
+    githubId = 3674056;
+    name = "Asad Saeeduddin";
+  };
+  masipcat = {
+    email = "jordi@masip.cat";
+    github = "masipcat";
+    githubId = 775189;
+    name = "Jordi Masip";
+  };
+  MaskedBelgian = {
+    email = "michael.colicchia@imio.be";
+    github = "MaskedBelgian";
+    githubId = 29855073;
+    name = "Michael Colicchia";
+  };
+  massimogengarelli = {
+    email = "massimo.gengarelli@gmail.com";
+    github = "massix";
+    githubId = 585424;
+    name = "Massimo Gengarelli";
+  };
+  matdibu = {
+    email = "contact@mateidibu.dev";
+    github = "matdibu";
+    githubId = 24750154;
+    name = "Matei Dibu";
+  };
+  matejc = {
+    email = "cotman.matej@gmail.com";
+    github = "matejc";
+    githubId = 854770;
+    name = "Matej Cotman";
+  };
+  mateodd25 = {
+    email = "mateodd@icloud.com";
+    github = "mateodd25";
+    githubId = 7878181;
+    name = "Mateo Diaz";
+  };
+  materus = {
+    email = "materus@podkos.pl";
+    github = "materusPL";
+    githubId = 28183516;
+    name = "Mateusz Słodkowicz";
+  };
+  math-42 = {
+    email = "matheus.4200@gmail.com";
+    github = "Math-42";
+    githubId = 43853194;
+    name = "Matheus Vieira";
+  };
+  mathiassven = {
+    email = "github@mathiassven.com";
+    github = "MathiasSven";
+    githubId = 24759037;
+    name = "Mathias Sven";
+  };
+  mathnerd314 = {
+    email = "mathnerd314.gph+hs@gmail.com";
+    github = "Mathnerd314";
+    githubId = 322214;
+    name = "Mathnerd314";
+  };
+  matklad = {
+    email = "aleksey.kladov@gmail.com";
+    github = "matklad";
+    githubId = 1711539;
+    name = "matklad";
+  };
+  matrss = {
+    name = "Matthias Riße";
+    email = "matthias.risze@t-online.de";
+    github = "matrss";
+    githubId = 9308656;
+  };
+  mattchrist = {
+    email = "nixpkgs-matt@christ.systems";
+    github = "mattchrist";
+    githubId = 952712;
+    name = "Matt Christ";
+  };
+  matthewbauer = {
+    email = "mjbauer95@gmail.com";
+    github = "matthewbauer";
+    githubId = 19036;
+    name = "Matthew Bauer";
+  };
+  matthewcroughan = {
+    email = "matt@croughan.sh";
+    github = "MatthewCroughan";
+    githubId = 26458780;
+    name = "Matthew Croughan";
+  };
+  matthew-levan = {
+    email = "matthew@coeli.network";
+    github = "matthew-levan";
+    githubId = 91502660;
+    name = "Matthew LeVan";
+  };
+  matthewpi = {
+    email = "me+nix@matthewp.io";
+    github = "matthewpi";
+    githubId = 26559841;
+    name = "Matthew Penner";
+    keys = [{
+      fingerprint = "5118 F1CC B7B0 6C17 4DD1  5267 3131 1906 AD4C F6D6";
+    }];
+  };
+  matthiasbenaets = {
+    email = "matthias.benaets@gmail.com";
+    github = "MatthiasBenaets";
+    githubId = 89214559;
+    name = "Matthias Benaets";
+  };
+  matthiasbeyer = {
+    email = "mail@beyermatthias.de";
+    matrix = "@musicmatze:beyermatthi.as";
+    github = "matthiasbeyer";
+    githubId = 427866;
+    name = "Matthias Beyer";
+  };
+  MatthieuBarthel = {
+    email = "matthieu@imatt.ch";
+    name = "Matthieu Barthel";
+    github = "MatthieuBarthel";
+    githubId = 435534;
+    keys = [{
+      fingerprint = "80EB 0F2B 484A BB80 7BEF  4145 BA23 F10E AADC 2E26";
+    }];
+  };
+  matthuszagh = {
+    email = "huszaghmatt@gmail.com";
+    github = "matthuszagh";
+    githubId = 7377393;
+    name = "Matt Huszagh";
+  };
+  matti-kariluoma = {
+    email = "matti@kariluo.ma";
+    github = "matti-kariluoma";
+    githubId = 279868;
+    name = "Matti Kariluoma";
+  };
+  mattpolzin = {
+    email = "matt.polzin@gmail.com";
+    github = "mattpolzin";
+    githubId = 2075353;
+    name = "Matt Polzin";
+  };
+  matt-snider = {
+    email = "matt.snider@protonmail.com";
+    github = "matt-snider";
+    githubId = 11810057;
+    name = "Matt Snider";
+  };
+  matusf = {
+    email = "matus.ferech@gmail.com";
+    github = "matusf";
+    githubId = 18228995;
+    name = "Matúš Ferech";
+  };
+  maurer = {
+    email = "matthew.r.maurer+nix@gmail.com";
+    github = "maurer";
+    githubId = 136037;
+    name = "Matthew Maurer";
+  };
+  mausch = {
+    email = "mauricioscheffer@gmail.com";
+    github = "mausch";
+    githubId = 95194;
+    name = "Mauricio Scheffer";
+  };
+  mawis = {
+    email = "m@tthias.eu";
+    github = "mawis";
+    githubId = 2042030;
+    name = "Matthias Wimmer";
+    keys = [{
+      fingerprint = "CAEC A12D CE23 37A6 6DFD  17B0 7AC7 631D 70D6 C898";
+    }];
+  };
+  max-amb = {
+    email = "max_a@e.email";
+    github = "max-amb";
+    githubId = 137820334;
+    name = "Max Ambaum";
+  };
+  maxbrunet = {
+    email = "max@brnt.mx";
+    github = "maxbrunet";
+    githubId = 32458727;
+    name = "Maxime Brunet";
+    keys = [{
+      fingerprint = "E9A2 EE26 EAC6 B3ED 6C10  61F3 4379 62FF 87EC FE2B";
+    }];
+  };
+  maxdamantus = {
+    email = "maxdamantus@gmail.com";
+    github = "Maxdamantus";
+    githubId = 502805;
+    name = "Max Zerzouri";
+  };
+  maxhbr = {
+    email = "nixos@maxhbr.dev";
+    github = "maxhbr";
+    githubId = 1187050;
+    name = "Maximilian Huber";
+  };
+  maxhearnden = {
+    email = "max@hearnden.org.uk";
+    github = "MaxHearnden";
+    githubId = 8320393;
+    name = "Max Hearnden";
+  };
+  maxhero = {
+    email = "contact@maxhero.dev";
+    github = "themaxhero";
+    githubId = 4708337;
+    name = "Marcelo A. de L. Santos";
+  };
+  maximsmol = {
+    email = "maximsmol@gmail.com";
+    github = "maximsmol";
+    githubId = 1472826;
+    name = "Max Smolin";
+  };
+  max-niederman = {
+    email = "max@maxniederman.com";
+    github = "max-niederman";
+    githubId = 19580458;
+    name = "Max Niederman";
+    keys = [{
+      fingerprint = "1DE4 424D BF77 1192 5DC4  CF5E 9AED 8814 81D8 444E";
+    }];
+  };
+  maxux = {
+    email = "root@maxux.net";
+    github = "maxux";
+    githubId = 4141584;
+    name = "Maxime Daniel";
+  };
+  maxwell-lt = {
+    email = "maxwell.lt@live.com";
+    github = "Maxwell-lt";
+    githubId = 17859747;
+    name = "Maxwell L-T";
+  };
+  maxwilson = {
+    email = "nixpkgs@maxwilson.dev";
+    github = "mwilsoncoding";
+    githubId = 43796009;
+    name = "Max Wilson";
+  };
+  maxxk = {
+    email = "maxim.krivchikov@gmail.com";
+    github = "maxxk";
+    githubId = 1191859;
+    name = "Maxim Krivchikov";
+  };
+  MayNiklas = {
+    email = "info@niklas-steffen.de";
+    github = "MayNiklas";
+    githubId = 44636701;
+    name = "Niklas Steffen";
+  };
+  mazurel = {
+    email = "mateusz.mazur@yahoo.com";
+    github = "Mazurel";
+    githubId = 22836301;
+    name = "Mateusz Mazur";
+  };
+  mbaeten = {
+    github = "mbaeten";
+    githubId = 2649304;
+    name = "M. Baeten";
+  };
+  mbaillie = {
+    email = "martin@baillie.id";
+    github = "martinbaillie";
+    githubId = 613740;
+    name = "Martin Baillie";
+  };
+  mbalatsko = {
+    email = "mbalatsko@gmail.com";
+    github = "mbalatsko";
+    githubId = 15967073;
+    name = "Maksym Balatsko";
+  };
+  mbbx6spp = {
+    email = "me@susanpotter.net";
+    github = "mbbx6spp";
+    githubId = 564;
+    name = "Susan Potter";
+  };
+  mbe = {
+    email = "brandonedens@gmail.com";
+    github = "brandonedens";
+    githubId = 396449;
+    name = "Brandon Edens";
+  };
+  mbode = {
+    email = "maxbode@gmail.com";
+    github = "mbode";
+    githubId = 9051309;
+    name = "Maximilian Bode";
+  };
+  mboes = {
+    email = "mboes@tweag.net";
+    github = "mboes";
+    githubId = 51356;
+    name = "Mathieu Boespflug";
+  };
+  mbprtpmnr = {
+    name = "mbprtpmnr";
+    email = "mbprtpmnr@pm.me";
+    github = "mbprtpmnr";
+    githubId = 88109321;
+  };
+  mbrgm = {
+    email = "marius@yeai.de";
+    github = "mbrgm";
+    githubId = 2971615;
+    name = "Marius Bergmann";
+  };
+  mcaju = {
+    email = "cajum.bugs@yandex.com";
+    github = "CajuM";
+    githubId = 10420834;
+    name = "Mihai-Drosi Caju";
+  };
+  mccurdyc = {
+    email = "mccurdyc22@gmail.com";
+    github = "mccurdyc";
+    githubId = 5546264;
+    name = "Colton J. McCurdy";
+    keys = [{
+      fingerprint = "D709 03C8 0BE9 ACDC 14F0  3BFB 77BF E531 397E DE94";
+    }];
+  };
+  mcmtroffaes = {
+    email = "matthias.troffaes@gmail.com";
+    github = "mcmtroffaes";
+    githubId = 158568;
+    name = "Matthias C. M. Troffaes";
+  };
+  McSinyx = {
+    email = "cnx@loang.net";
+    github = "McSinyx";
+    githubId = 13689192;
+    matrix = "@cnx:loang.net";
+    name = "Nguyễn Gia Phong";
+    keys = [
+      { fingerprint = "E90E 11B8 0493 343B 6132  E394 2714 8B2C 06A2 224B"; }
+      { fingerprint = "838A FE0D 55DC 074E 360F  943A 84B6 9CE6 F3F6 B767"; }
+    ];
+  };
+  mcwitt = {
+    email = "mcwitt@gmail.com";
+    github = "mcwitt";
+    githubId = 319411;
+    name = "Matt Wittmann";
+  };
+  mdaiter = {
+    email = "mdaiter8121@gmail.com";
+    github = "mdaiter";
+    githubId = 1377571;
+    name = "Matthew S. Daiter";
+  };
+  mdarocha = {
+    email = "marek@mdarocha.pl";
+    github = "mdarocha";
+    githubId = 11572618;
+    name = "Marek Darocha";
+  };
+  mdevlamynck = {
+    email = "matthias.devlamynck@mailoo.org";
+    github = "mdevlamynck";
+    githubId = 4378377;
+    name = "Matthias Devlamynck";
+  };
+  mdlayher = {
+    email = "mdlayher@gmail.com";
+    github = "mdlayher";
+    githubId = 1926905;
+    name = "Matt Layher";
+    keys = [{
+      fingerprint = "D709 03C8 0BE9 ACDC 14F0  3BFB 77BF E531 397E DE94";
+    }];
+  };
+  mdr = {
+    email = "MattRussellUK@gmail.com";
+    github = "mdr";
+    githubId = 241257;
+    name = "Matt Russell";
+  };
+  meain = {
+    email = "mail@meain.io";
+    matrix = "@meain:matrix.org";
+    github = "meain";
+    githubId = 14259816;
+    name = "Abin Simon";
+  };
+  meatcar = {
+    email = "nixpkgs@denys.me";
+    github = "meatcar";
+    githubId = 191622;
+    name = "Denys Pavlov";
+  };
+  meditans = {
+    email = "meditans@gmail.com";
+    github = "meditans";
+    githubId = 4641445;
+    name = "Carlo Nucera";
+  };
+  medv = {
+    email = "mikhail.advent@gmail.com";
+    github = "medv";
+    githubId = 1631737;
+    name = "Mikhail Medvedev";
+  };
+  megheaiulian = {
+    email = "iulian.meghea@gmail.com";
+    github = "megheaiulian";
+    githubId = 1788114;
+    name = "Meghea Iulian";
+  };
+  meisternu = {
+    email = "meister@krutt.org";
+    github = "meisternu";
+    githubId = 8263431;
+    name = "Matt Miemiec";
+  };
+  melchips = {
+    email = "truphemus.francois@gmail.com";
+    github = "melchips";
+    githubId = 365721;
+    name = "Francois Truphemus";
+  };
+  melias122 = {
+    name = "Martin Elias";
+    email = "martin+nixpkgs@elias.sx";
+    github = "melias122";
+    githubId = 1027766;
+  };
+  melkor333 = {
+    email = "samuel@ton-kunst.ch";
+    github = "Melkor333";
+    githubId = 6412377;
+    name = "Samuel Ruprecht";
+  };
+  melling = {
+    email = "mattmelling@fastmail.com";
+    github = "mattmelling";
+    githubId = 1215331;
+    name = "Matt Melling";
+  };
+  melsigl = {
+    email = "melanie.bianca.sigl@gmail.com";
+    github = "melsigl";
+    githubId = 15093162;
+    name = "Melanie B. Sigl";
+  };
+  mephistophiles = {
+    email = "mussitantesmortem@gmail.com";
+    name = "Maxim Zhukov";
+    github = "Mephistophiles";
+    githubId = 4850908;
+  };
+  mevatron = {
+    email = "mevatron@gmail.com";
+    name = "mevatron";
+    github = "mevatron";
+    githubId = 714585;
+  };
+  mfossen = {
+    email = "msfossen@gmail.com";
+    github = "mfossen";
+    githubId = 3300322;
+    name = "Mitchell Fossen";
+  };
+  mfrw = {
+    email = "falakreyaz@gmail.com";
+    github = "mfrw";
+    githubId = 4929861;
+    name = "Muhammad Falak R Wani";
+  };
+  mgdelacroix = {
+    email = "mgdelacroix@gmail.com";
+    github = "mgdelacroix";
+    githubId = 223323;
+    name = "Miguel de la Cruz";
+  };
+  mgdm = {
+    email = "michael@mgdm.net";
+    github = "mgdm";
+    githubId = 71893;
+    name = "Michael Maclean";
+  };
+  mglolenstine = {
+    email = "mglolenstine@gmail.com";
+    github = "MGlolenstine";
+    githubId = 9406770;
+    matrix = "@mglolenstine:matrix.org";
+    name = "MGlolenstine";
+  };
+  mgregoire = {
+    email = "gregoire@martinache.net";
+    github = "M-Gregoire";
+    githubId = 9469313;
+    name = "Gregoire Martinache";
+  };
+  mgregson = {
+    github = "mgregson";
+    githubId = 333572;
+    name = "Michael Gregson";
+  };
+  mgttlinger = {
+    email = "megoettlinger@gmail.com";
+    github = "mgttlinger";
+    githubId = 5120487;
+    name = "Merlin Humml";
+  };
+  mguentner = {
+    email = "code@klandest.in";
+    github = "mguentner";
+    githubId = 668926;
+    name = "Maximilian Güntner";
+  };
+  mh = {
+    github = "markus-heinrich";
+    githubId = 68288772;
+    name = "Markus Heinrich";
+  };
+  mh182 = {
+    email = "mh182@chello.at";
+    github = "mh182";
+    githubId = 9980864;
+    name = "Max Hofer";
+  };
+  mhaselsteiner = {
+    email = "magdalena.haselsteiner@gmx.at";
+    github = "mhaselsteiner";
+    githubId = 20536514;
+    name = "Magdalena Haselsteiner";
+  };
+  miangraham = {
+    github = "miangraham";
+    githubId = 704580;
+    name = "M. Ian Graham";
+    keys = [{
+      fingerprint = "8CE3 2906 516F C4D8 D373  308A E189 648A 55F5 9A9F";
+    }];
+  };
+  mib = {
+    name = "mib";
+    email = "mib@kanp.ai";
+    matrix = "@mib:kanp.ai";
+    github = "mibmo";
+    githubId = 87388017;
+    keys = [{
+      fingerprint = "AB0D C647 B2F7 86EB 045C 7EFE CF6E 67DE D6DC 1E3F";
+    }];
+  };
+  mic92 = {
+    email = "joerg@thalheim.io";
+    matrix = "@mic92:nixos.dev";
+    github = "Mic92";
+    githubId = 96200;
+    name = "Jörg Thalheim";
+    keys = [{
+      # compare with https://keybase.io/Mic92
+      fingerprint = "3DEE 1C55 6E1C 3DC5 54F5  875A 003F 2096 411B 5F92";
+    }];
+  };
+  michaeladler = {
+    email = "therisen06@gmail.com";
+    github = "michaeladler";
+    githubId = 1575834;
+    name = "Michael Adler";
+  };
+  michaelBelsanti = {
+    email = "mbels03@protonmail.com";
+    name = "Mike Belsanti";
+    github = "michaelBelsanti";
+    githubId = 62124625;
+  };
+  michaelBrunner = {
+    email = "michael.brunn3r@gmail.com";
+    name = "Michael Brunner";
+    github = "MichaelBrunn3r";
+    githubId = 19626539;
+  };
+  michaelCTS = {
+    email = "michael.vogel@cts.co";
+    name = "Michael Vogel";
+    github = "michaelCTS";
+    githubId = 132582212;
+  };
+  michaeldonovan = {
+    email = "michael@mdonovan.dev";
+    name = "Michael Donovan";
+    github = "michaeldonovan";
+    githubId = 14077230;
+  };
+  michaelgrahamevans = {
+    email = "michaelgrahamevans@gmail.com";
+    name = "Michael Evans";
+    github = "michaelgrahamevans";
+    githubId = 5932424;
+  };
+  michaelpachec0 = {
+    email = "michaelpacheco@protonmail.com";
+    name = "Michael Pacheco";
+    github = "MichaelPachec0";
+    githubId = 48970112;
+    keys = [{
+      fingerprint = "8D12 991F 5558 C501 70B2  779C 7811 46B0 B5F9 5F64";
+    }];
+  };
+  michaelpj = {
+    email = "michaelpj@gmail.com";
+    github = "michaelpj";
+    githubId = 1699466;
+    name = "Michael Peyton Jones";
+  };
+  michaelshmitty = {
+    name = "Michael Smith";
+    email = "shmitty@protonmail.com";
+    github = "michaelshmitty";
+    githubId = 114845;
+  };
+  michalrus = {
+    email = "m@michalrus.com";
+    github = "michalrus";
+    githubId = 4366292;
+    name = "Michal Rus";
+  };
+  michelk = {
+    email = "michel@kuhlmanns.info";
+    github = "michelk";
+    githubId = 1404919;
+    name = "Michel Kuhlmann";
+  };
+  michojel = {
+    email = "mic.liamg@gmail.com";
+    github = "michojel";
+    githubId = 21156022;
+    name = "Michal Minář";
+  };
+  michzappa = {
+    email = "me@michzappa.com";
+    github = "michzappa";
+    githubId = 59343378;
+    name = "Michael Zappa";
+  };
+  mickours = {
+    email = "mickours@gmail.com<";
+    github = "mickours";
+    githubId = 837312;
+    name = "Michael Mercier";
+  };
+  midchildan = {
+    email = "git@midchildan.org";
+    matrix = "@midchildan:matrix.org";
+    github = "midchildan";
+    githubId = 7343721;
+    name = "midchildan";
+    keys = [{
+      fingerprint = "FEF0 AE2D 5449 3482 5F06  40AA 186A 1EDA C5C6 3F83";
+    }];
+  };
+  mig4ng = {
+    email = "mig4ng@gmail.com";
+    github = "mig4ng";
+    githubId = 5817039;
+    name = "Miguel Carneiro";
+  };
+  mightyiam = {
+    email = "mightyiampresence@gmail.com";
+    github = "mightyiam";
+    githubId = 635591;
+    name = "Shahar Dawn Or";
+  };
+  mihnea-s = {
+    email = "mihn.stn@gmail.com";
+    github = "mihnea-s";
+    githubId = 43088426;
+    name = "Mihnea Stoian";
+  };
+  mikaelfangel = {
+    email = "nixpkgs.bottle597@passfwd.com";
+    github = "MikaelFangel";
+    githubId = 34864484;
+    name = "Mikael Fangel";
+  };
+  mikecm = {
+    email = "mikecmcleod@gmail.com";
+    github = "MaxwellDupre";
+    githubId = 14096356;
+    name = "Michael McLeod";
+  };
+  mikefaille = {
+    email = "michael@faille.io";
+    github = "mikefaille";
+    githubId = 978196;
+    name = "Michaël Faille";
+  };
+  mikesperber = {
+    email = "sperber@deinprogramm.de";
+    github = "mikesperber";
+    githubId = 1387206;
+    name = "Mike Sperber";
+  };
+  mikoim = {
+    email = "ek@esh.ink";
+    github = "mikoim";
+    githubId = 3958340;
+    name = "Eshin Kunishima";
+  };
+  mikroskeem = {
+    email = "mikroskeem@mikroskeem.eu";
+    github = "mikroskeem";
+    githubId = 3490861;
+    name = "Mark Vainomaa";
+    keys = [{
+      fingerprint = "DB43 2895 CF68 F0CE D4B7  EF60 DA01 5B05 B5A1 1B22";
+    }];
+  };
+  milahu = {
+    email = "milahu@gmail.com";
+    github = "milahu";
+    githubId = 12958815;
+    name = "Milan Hauth";
+  };
+  milesbreslin = {
+    email = "milesbreslin@gmail.com";
+    github = "MilesBreslin";
+    githubId = 38543128;
+    name = "Miles Breslin";
+  };
+  milibopp = {
+    email = "contact@ebopp.de";
+    github = "milibopp";
+    githubId = 3098430;
+    name = "Emilia Bopp";
+  };
+  millerjason = {
+    email = "mailings-github@millerjason.com";
+    github = "millerjason";
+    githubId = 7610974;
+    name = "Jason Miller";
+  };
+  milogert = {
+    email = "milo@milogert.com";
+    github = "milogert";
+    githubId = 5378535;
+    name = "Milo Gertjejansen";
+  };
+  milran = {
+    email = "milranmike@protonmail.com";
+    github = "wattmto";
+    githubId = 93639059;
+    name = "Milran Mike";
+  };
+  mimame = {
+    email = "miguel.madrid.mencia@gmail.com";
+    github = "mimame";
+    githubId = 3269878;
+    name = "Miguel Madrid Mencía";
+  };
+  mindavi = {
+    email = "rol3517@gmail.com";
+    github = "Mindavi";
+    githubId = 9799623;
+    name = "Rick van Schijndel";
+  };
+  mindstorms6 = {
+    email = "breland@bdawg.org";
+    github = "mindstorms6";
+    githubId = 92937;
+    name = "Breland Miley";
+  };
+  minersebas = {
+    email = "scherthan_sebastian@web.de";
+    github = "MinerSebas";
+    githubId = 66798382;
+    name = "Sebastian Maximilian Scherthan";
+  };
+  minijackson = {
+    email = "minijackson@riseup.net";
+    github = "minijackson";
+    githubId = 1200507;
+    name = "Rémi Nicole";
+    keys = [{
+      fingerprint = "3196 83D3 9A1B 4DE1 3DC2  51FD FEA8 88C9 F5D6 4F62";
+    }];
+  };
+  minion3665 = {
+    name = "Skyler Grey";
+    email = "skyler3665@gmail.com";
+    matrix = "@minion3665:matrix.org";
+    github = "Minion3665";
+    githubId = 34243578;
+    keys = [{
+      fingerprint = "D520 AC8D 7C96 9212 5B2B  BD3A 1AFD 1025 6B3C 714D";
+    }];
+  };
+  minizilla = {
+    email = "m.billyzaelani@gmail.com";
+    github = "minizilla";
+    githubId = 20436235;
+    name = "Billy Zaelani Malik";
+  };
+  mir06 = {
+    email = "armin.leuprecht@uni-graz.at";
+    github = "mir06";
+    githubId = 8479244;
+    name = "Armin Leuprecht";
+  };
+  mirdhyn = {
+    email = "mirdhyn@gmail.com";
+    github = "mirdhyn";
+    githubId = 149558;
+    name = "Merlin Gaillard";
+  };
+  mirkolenz = {
+    name = "Mirko Lenz";
+    email = "mirko@mirkolenz.com";
+    matrix = "@mlenz:matrix.org";
+    github = "mirkolenz";
+    githubId = 5160954;
+  };
+  mirrexagon = {
+    email = "mirrexagon@mirrexagon.com";
+    github = "mirrexagon";
+    githubId = 1776903;
+    name = "Andrew Abbott";
+  };
+  mirrorwitch = {
+    email = "mirrorwitch@transmom.love";
+    github = "mirrorwitch";
+    githubId = 146672255;
+    name = "mirrorwitch";
+    keys = [{
+        fingerprint = "C3E7 F8C4 9CBC 9320 D360  B117 8516 D0FA 7D8F 58FC";
+    }];
+  };
+  Misaka13514 = {
+    name = "Misaka13514";
+    email = "Misaka13514@gmail.com";
+    matrix = "@misaka13514:matrix.org";
+    github = "Misaka13514";
+    githubId = 54669781;
+    keys =
+      [{ fingerprint = "293B 93D8 A471 059F 85D7  16A6 5BA9 2099 D9BE 2DAA"; }];
+  };
+  mislavzanic = {
+    email = "mislavzanic3@gmail.com";
+    github = "mislavzanic";
+    githubId = 48838244;
+    name = "Mislav Zanic";
+  };
+  misterio77 = {
+    email = "eu@misterio.me";
+    github = "Misterio77";
+    githubId = 5727578;
+    matrix = "@misterio:matrix.org";
+    name = "Gabriel Fontes";
+    keys = [{
+      fingerprint = "7088 C742 1873 E0DB 97FF  17C2 245C AB70 B4C2 25E9";
+    }];
+  };
+  mistydemeo = {
+    email = "misty@axo.dev";
+    github = "mistydemeo";
+    githubId = 780485;
+    name = "Misty De Méo";
+  };
+  misuzu = {
+    email = "bakalolka@gmail.com";
+    github = "misuzu";
+    githubId = 248143;
+    name = "misuzu";
+  };
+  mitchmindtree = {
+    email = "mail@mitchellnordine.com";
+    github = "mitchmindtree";
+    githubId = 4587373;
+    name = "Mitchell Nordine";
+  };
+  mjanczyk = {
+    email = "m@dragonvr.pl";
+    github = "mjanczyk";
+    githubId = 1001112;
+    name = "Marcin Janczyk";
+  };
+  mjm = {
+    email = "matt@mattmoriarity.com";
+    github = "mjm";
+    githubId = 1181;
+    matrix = "@mjm:beeper.com";
+    name = "Matt Moriarity";
+  };
+  mjp = {
+    email = "mike@mythik.co.uk";
+    github = "MikePlayle";
+    githubId = 16974598;
+    name = "Mike Playle";
+  };
+  mkaito = {
+    email = "chris@mkaito.net";
+    github = "mkaito";
+    githubId = 20434;
+    name = "Christian Höppner";
+  };
+  mkazulak = {
+    email = "kazulakm@gmail.com";
+    github = "mulderr";
+    githubId = 5698461;
+    name = "Maciej Kazulak";
+  };
+  mkf = {
+    email = "m@mikf.pl";
+    github = "mkf";
+    githubId = 7753506;
+    name = "Michał Krzysztof Feiler";
+    keys = [{
+      fingerprint = "1E36 9940 CC7E 01C4 CFE8  F20A E35C 2D7C 2C6A C724";
+    }];
+  };
+  mkg = {
+    email = "mkg@vt.edu";
+    github = "mkgvt";
+    githubId = 22477669;
+    name = "Mark K Gardner";
+  };
+  mkg20001 = {
+    email = "mkg20001+nix@gmail.com";
+    matrix = "@mkg20001:matrix.org";
+    github = "mkg20001";
+    githubId = 7735145;
+    name = "Maciej Krüger";
+    keys = [{
+      fingerprint = "E90C BA34 55B3 6236 740C  038F 0D94 8CE1 9CF4 9C5F";
+    }];
+  };
+  mktip = {
+    email = "mo.issa.ok+nix@gmail.com";
+    github = "mktip";
+    githubId = 45905717;
+    name = "Mohammad Issa";
+    keys = [{
+      fingerprint = "64BE BF11 96C3 DD7A 443E  8314 1DC0 82FA DE5B A863";
+    }];
+  };
+  mlatus = {
+    email = "wqseleven@gmail.com";
+    github = "Ninlives";
+    githubId = 17873203;
+    name = "mlatus";
+  };
+  mlieberman85 = {
+    email = "mlieberman85@gmail.com";
+    github = "mlieberman85";
+    githubId = 622577;
+    name = "Michael Lieberman";
+  };
+  mlvzk = {
+    name = "mlvzk";
+    github = "mlvzk";
+    githubId = 44906333;
+  };
+  mmahut = {
+    email = "marek.mahut@gmail.com";
+    github = "mmahut";
+    githubId = 104795;
+    name = "Marek Mahut";
+  };
+  mmai = {
+    email = "henri.bourcereau@gmail.com";
+    github = "mmai";
+    githubId = 117842;
+    name = "Henri Bourcereau";
+  };
+  mmesch = {
+    github = "MMesch";
+    githubId = 2597803;
+    name = "Matthias Meschede";
+  };
+  mmilata = {
+    email = "martin@martinmilata.cz";
+    github = "mmilata";
+    githubId = 85857;
+    name = "Martin Milata";
+  };
+  mmlb = {
+    email = "i@m.mmlb.dev";
+    github = "mmlb";
+    githubId = 708570;
+    name = "Manuel Mendez";
+  };
+  mmusnjak = {
+    email = "marko.musnjak@gmail.com";
+    github = "mmusnjak";
+    githubId = 668956;
+    name = "Marko Mušnjak";
+  };
+  mnacamura = {
+    email = "m.nacamura@gmail.com";
+    github = "mnacamura";
+    githubId = 45770;
+    name = "Mitsuhiro Nakamura";
+  };
+  moaxcp = {
+    email = "moaxcp@gmail.com";
+    github = "moaxcp";
+    githubId = 7831184;
+    name = "John Mercier";
+  };
+  modulistic = {
+    email = "modulistic@gmail.com";
+    github = "modulistic";
+    githubId = 1902456;
+    name = "Pablo Costa";
+  };
+  mog = {
+    email = "mog-lists@rldn.net";
+    github = "mogorman";
+    githubId = 64710;
+    name = "Matthew O'Gorman";
+  };
+  Mogria = {
+    email = "m0gr14@gmail.com";
+    github = "mogria";
+    githubId = 754512;
+    name = "Mogria";
+  };
+  mohe2015 = {
+    name = "Moritz Hedtke";
+    email = "Moritz.Hedtke@t-online.de";
+    matrix = "@moritz.hedtke:matrix.org";
+    github = "mohe2015";
+    githubId = 13287984;
+    keys = [{
+      fingerprint = "1248 D3E1 1D11 4A85 75C9  8934 6794 D45A 488C 2EDE";
+    }];
+  };
+  monaaraj = {
+    name = "Mon Aaraj";
+    email = "owo69uwu69@gmail.com";
+    matrix = "@mon:tchncs.de";
+    github = "ribosomerocker";
+    githubId = 46468162;
+  };
+  moni = {
+    email = "lythe1107@gmail.com";
+    matrix = "@fortuneteller2k:matrix.org";
+    github = "moni-dz";
+    githubId = 20619776;
+    name = "moni";
+  };
+  monsieurp = {
+    email = "monsieurp@gentoo.org";
+    github = "monsieurp";
+    githubId = 350116;
+    name = "Patrice Clement";
+  };
+  montag451 = {
+    email = "montag451@laposte.net";
+    github = "montag451";
+    githubId = 249317;
+    name = "montag451";
+  };
+  montchr = {
+    name = "Chris Montgomery";
+    email = "chris@cdom.io";
+    github = "montchr";
+    githubId = 1757914;
+    keys = [{
+      fingerprint = "6460 4147 C434 F65E C306  A21F 135E EDD0 F719 34F3";
+    }];
+  };
+  moody = {
+    email = "moody@posixcafe.org";
+    github = "majiru";
+    githubId = 3579600;
+    name = "Jacob Moody";
+  };
+  moosingin3space = {
+    email = "moosingin3space@gmail.com";
+    github = "moosingin3space";
+    githubId = 830082;
+    name = "Nathan Moos";
+  };
+  moredread = {
+    email = "code@apb.name";
+    github = "Moredread";
+    githubId = 100848;
+    name = "André-Patrick Bubel";
+    keys = [{
+      fingerprint = "4412 38AD CAD3 228D 876C  5455 118C E7C4 24B4 5728";
+    }];
+  };
+  moretea = {
+    email = "maarten@moretea.nl";
+    github = "moretea";
+    githubId = 99988;
+    name = "Maarten Hoogendoorn";
+  };
+  MoritzBoehme = {
+    email = "mail@moritzboeh.me";
+    github = "MoritzBoehme";
+    githubId = 42215704;
+    name = "Moritz Böhme";
+  };
+  MostAwesomeDude = {
+    email = "cds@corbinsimpson.com";
+    github = "MostAwesomeDude";
+    githubId = 118035;
+    name = "Corbin Simpson";
+  };
+  mothsart = {
+    email = "jerem.ferry@gmail.com";
+    github = "mothsART";
+    githubId = 10601196;
+    name = "Jérémie Ferry";
+  };
+  motiejus = {
+    email = "motiejus@jakstys.lt";
+    github = "motiejus";
+    githubId = 107720;
+    keys = [{
+      fingerprint = "5F6B 7A8A 92A2 60A4 3704  9BEB 6F13 3A0C 1C28 48D7";
+    }];
+    matrix = "@motiejus:jakstys.lt";
+    name = "Motiejus Jakštys";
+  };
+  mounium = {
+    email = "muoniurn@gmail.com";
+    github = "Mounium";
+    githubId = 20026143;
+    name = "Katona László";
+  };
+  MP2E = {
+    email = "MP2E@archlinux.us";
+    github = "MP2E";
+    githubId = 167708;
+    name = "Cray Elliott";
+  };
+  mpcsh = {
+    email = "m@mpc.sh";
+    github = "mpcsh";
+    githubId = 2894019;
+    name = "Mark Cohen";
+  };
+  mpickering = {
+    email = "matthewtpickering@gmail.com";
+    github = "mpickering";
+    githubId = 1216657;
+    name = "Matthew Pickering";
+  };
+  mpoquet = {
+    email = "millian.poquet@gmail.com";
+    github = "mpoquet";
+    githubId = 3502831;
+    name = "Millian Poquet";
+  };
+  mpscholten = {
+    email = "marc@digitallyinduced.com";
+    github = "mpscholten";
+    githubId = 2072185;
+    name = "Marc Scholten";
+  };
+  mrcjkb = {
+    email = "marc@jakobi.dev";
+    matrix = "@mrcjk:matrix.org";
+    name = "Marc Jakobi";
+    github = "mrcjkb";
+    githubId = 12857160;
+  };
+  mredaelli = {
+    email = "massimo@typish.io";
+    github = "mredaelli";
+    githubId = 3073833;
+    name = "Massimo Redaelli";
+  };
+  mrene = {
+    email = "mathieu.rene@gmail.com";
+    github = "mrene";
+    githubId = 254443;
+    name = "Mathieu Rene";
+  };
+  mrfreezeex = {
+    email = "arthur@cri.epita.fr";
+    github = "MrFreezeex";
+    name = "Arthur Outhenin-Chalandre";
+    githubId = 3845213;
+  };
+  mrityunjaygr8 = {
+    email = "mrityunjaysaxena1996@gmail.com";
+    github = "mrityunjaygr8";
+    name = "Mrityunjay Saxena";
+    githubId = 14573967;
+  };
+  mrkkrp = {
+    email = "markkarpov92@gmail.com";
+    github = "mrkkrp";
+    githubId = 8165792;
+    name = "Mark Karpov";
+  };
+  mrmebelman = {
+    email = "burzakovskij@protonmail.com";
+    github = "MrMebelMan";
+    githubId = 15896005;
+    name = "Vladyslav Burzakovskyy";
+  };
+  mrtarantoga = {
+    email = "goetz-dev@web.de";
+    name = "Götz Grimmer";
+    github = "MrTarantoga";
+    githubId = 53876219;
+  };
+  mrtnvgr = {
+    name = "Egor Martynov";
+    github = "mrtnvgr";
+    githubId = 48406064;
+    keys = [{
+      fingerprint = "6FAD DB43 D5A5 FE52 6835  0943 5B33 79E9 81EF 48B1";
+    }];
+  };
+  mrVanDalo = {
+    email = "contact@ingolf-wagner.de";
+    github = "mrVanDalo";
+    githubId = 839693;
+    name = "Ingolf Wanger";
+  };
+  msanft = {
+    email = "moritz.sanft@outlook.de";
+    matrix = "@msanft:matrix.org";
+    name = "Moritz Sanft";
+    github = "msanft";
+    githubId = 58110325;
+    keys = [{
+      fingerprint = "3CAC 1D21 3D97 88FF 149A  E116 BB8B 30F5 A024 C31C";
+    }];
+  };
+  mschristiansen = {
+    email = "mikkel@rheosystems.com";
+    github = "mschristiansen";
+    githubId = 437005;
+    name = "Mikkel Christiansen";
+  };
+  mschuwalow = {
+    github = "mschuwalow";
+    githubId = 16665913;
+    name = "Maxim Schuwalow";
+    email = "maxim.schuwalow@gmail.com";
+  };
+  mschwaig = {
+    name = "Martin Schwaighofer";
+    github = "mschwaig";
+    githubId = 3856390;
+    email = "mschwaig+nixpkgs@eml.cc";
+  };
+  msfjarvis = {
+    github = "msfjarvis";
+    githubId = 13348378;
+    name = "Harsh Shandilya";
+    email = "nixos@msfjarvis.dev";
+    keys = [{
+      fingerprint = "8F87 050B 0F9C B841 1515  7399 B784 3F82 3355 E9B9";
+    }];
+  };
+  msiedlarek = {
+    email = "mikolaj@siedlarek.pl";
+    github = "msiedlarek";
+    githubId = 133448;
+    name = "Mikołaj Siedlarek";
+  };
+  mslingsby = {
+    email = "morten.slingsby@eviny.no";
+    github = "MortenSlingsby";
+    githubId = 111859550;
+    name = "Morten Slingsby";
+  };
+  msm = {
+    email = "msm@tailcall.net";
+    github = "msm-code";
+    githubId = 7026881;
+    name = "Jarosław Jedynak";
+  };
+  mstarzyk = {
+    email = "mstarzyk@gmail.com";
+    github = "mstarzyk";
+    githubId = 111304;
+    name = "Maciek Starzyk";
+  };
+  msteen = {
+    email = "emailmatthijs@gmail.com";
+    github = "msteen";
+    githubId = 788953;
+    name = "Matthijs Steen";
+  };
+  mstrangfeld = {
+    email = "marvin@strangfeld.io";
+    github = "mstrangfeld";
+    githubId = 36842980;
+    name = "Marvin Strangfeld";
+  };
+  mt-caret = {
+    email = "mtakeda.enigsol@gmail.com";
+    github = "mt-caret";
+    githubId = 4996739;
+    name = "Masayuki Takeda";
+  };
+  mtesseract = {
+    email = "moritz@stackrox.com";
+    github = "mtesseract";
+    githubId = 11706080;
+    name = "Moritz Clasmeier";
+  };
+  mtoohey = {
+    name = "Matthew Toohey";
+    email = "contact@mtoohey.com";
+    github = "mtoohey31";
+    githubId = 36740602;
+  };
+  MtP = {
+    email = "marko.nixos@poikonen.de";
+    github = "MtP76";
+    githubId = 2176611;
+    name = "Marko Poikonen";
+  };
+  mtreca = {
+    email = "maxime.treca@gmail.com";
+    github = "mtreca";
+    githubId = 16440823;
+    name = "Maxime Tréca";
+  };
+  mtreskin = {
+    email = "zerthurd@gmail.com";
+    github = "Zert";
+    githubId = 39034;
+    name = "Max Treskin";
+  };
+  mtrsk = {
+    email = "marcos.schonfinkel@protonmail.com";
+    github = "mtrsk";
+    githubId = 16356569;
+    name = "Marcos Benevides";
+  };
+  mudri = {
+    email = "lamudri@gmail.com";
+    github = "laMudri";
+    githubId = 5139265;
+    name = "James Wood";
+  };
+  mudrii = {
+    email = "mudreac@gmail.com";
+    github = "mudrii";
+    githubId = 220262;
+    name = "Ion Mudreac";
+  };
+  multisn8 = {
+    email = "all-things-nix@multisamplednight.com";
+    github = "MultisampledNight";
+    githubId = 80128916;
+    name = "MultisampledNight";
+  };
+  multun = {
+    email = "victor.collod@epita.fr";
+    github = "multun";
+    githubId = 5047140;
+    name = "Victor Collod";
+  };
+  munksgaard = {
+    name = "Philip Munksgaard";
+    email = "philip@munksgaard.me";
+    github = "Munksgaard";
+    githubId = 230613;
+    matrix = "@philip:matrix.munksgaard.me";
+    keys = [{
+      fingerprint = "5658 4D09 71AF E45F CC29 6BD7 4CE6 2A90 EFC0 B9B2";
+    }];
+  };
+  mupdt = {
+    email = "nix@pdtpartners.com";
+    github = "mupdt";
+    githubId = 25388474;
+    name = "Matej Urbas";
+  };
+  muscaln = {
+    email = "muscaln@protonmail.com";
+    github = "muscaln";
+    githubId = 96225281;
+    name = "Mustafa Çalışkan";
+  };
+  mvisonneau = {
+    name = "Maxime VISONNEAU";
+    email = "maxime@visonneau.fr";
+    matrix = "@maxime:visonneau.fr";
+    github = "mvisonneau";
+    githubId = 1761583;
+    keys = [{
+      fingerprint = "EC63 0CEA E8BC 5EE5 5C58  F2E3 150D 6F0A E919 8D24";
+    }];
+  };
+  mvnetbiz = {
+    email = "mvnetbiz@gmail.com";
+    matrix = "@mvtva:matrix.org";
+    github = "mvnetbiz";
+    githubId = 6455574;
+    name = "Matt Votava";
+  };
+  mvs = {
+    email = "mvs@nya.yt";
+    github = "illdefined";
+    githubId = 772914;
+    name = "Mikael Voss";
+  };
+  mwdomino = {
+    email = "matt@dominey.io";
+    github = "mwdomino";
+    githubId = 46284538;
+    name = "Matt Dominey";
+  };
+  mwolfe = {
+    email = "corp@m0rg.dev";
+    github = "m0rg-dev";
+    githubId = 38578268;
+    name = "Morgan Wolfe";
+  };
+  mxkrsv = {
+    email = "mxkrsv@disroot.org";
+    github = "mxkrsv";
+    githubId = 59313755;
+    name = "Maxim Karasev";
+  };
+  mxmlnkn = {
+    github = "mxmlnkn";
+    githubId = 6842824;
+    name = "Maximilian Knespel";
+  };
+  myaats = {
+    email = "mats@mats.sh";
+    github = "Myaats";
+    githubId = 6295090;
+    name = "Mats";
+  };
+  mynacol = {
+    github = "Mynacol";
+    githubId = 26695166;
+    name = "Paul Prechtel";
+  };
+  myrl = {
+    email = "myrl.0xf@gmail.com";
+    github = "Myrl";
+    githubId = 9636071;
+    name = "Myrl Hex";
+  };
+  n00b0ss = {
+    email = "nixpkgs@n00b0ss.de";
+    github = "n00b0ss";
+    githubId = 61601147;
+    name = "basti n00b0ss";
+  };
+  n0emis = {
+    email = "nixpkgs@n0emis.network";
+    github = "n0emis";
+    githubId = 22817873;
+    name = "Ember Keske";
+  };
+  n3oney = {
+    name = "Michał Minarowski";
+    email = "nixpkgs@neoney.dev";
+    github = "n3oney";
+    githubId = 30625554;
+    matrix = "@neoney:matrix.org";
+    keys = [{
+      fingerprint = "9E6A 25F2 C1F2 9D76 ED00  1932 1261 173A 01E1 0298";
+    }];
+  };
+  nadir-ishiguro = {
+    github = "nadir-ishiguro";
+    githubId = 23151917;
+    name = "nadir-ishiguro";
+  };
+  nadrieril = {
+    email = "nadrieril@gmail.com";
+    github = "Nadrieril";
+    githubId = 6783654;
+    name = "Nadrieril Feneanar";
+  };
+  nagisa = {
+    name = "Simonas Kazlauskas";
+    email = "nixpkgs@kazlauskas.me";
+    github = "nagisa";
+    githubId = 679122;
+  };
+  nagy = {
+    email = "danielnagy@posteo.de";
+    github = "nagy";
+    githubId = 692274;
+    name = "Daniel Nagy";
+    keys = [{
+      fingerprint = "F6AE 2C60 9196 A1BC ECD8  7108 1B8E 8DCB 576F B671";
+    }];
+  };
+  nalbyuites = {
+    email = "ashijit007@gmail.com";
+    github = "nalbyuites";
+    githubId = 1009523;
+    name = "Ashijit Pramanik";
+  };
+  name-snrl = {
+    github = "name-snrl";
+    githubId = 72071763;
+    name = "Yusup Urazaev";
+  };
+  namore = {
+    email = "namor@hemio.de";
+    github = "namore";
+    githubId = 1222539;
+    name = "Roman Naumann";
+  };
+  nanotwerp = {
+    email = "nanotwerp@gmail.com";
+    github = "nanotwerp";
+    githubId = 17240342;
+    name = "Nano Twerpus";
+  };
+  naphta = {
+    github = "naphta";
+    githubId = 6709831;
+    name = "Jake Hill";
+  };
+  nasageek = {
+    github = "NasaGeek";
+    githubId = 474937;
+    name = "Chris Roberts";
+  };
+  nasirhm = {
+    email = "nasirhussainm14@gmail.com";
+    github = "nasirhm";
+    githubId = 35005234;
+    name = "Nasir Hussain";
+    keys = [{
+      fingerprint = "7A10 AB8E 0BEC 566B 090C  9BE3 D812 6E55 9CE7 C35D";
+    }];
+  };
+  nat-418 = {
+    github = "nat-418";
+    githubId = 93013864;
+    name = "nat-418";
+  };
+  nathan-gs = {
+    email = "nathan@nathan.gs";
+    github = "nathan-gs";
+    githubId = 330943;
+    name = "Nathan Bijnens";
+  };
+  nathanielbrough = {
+    github = "silvergasp";
+    githubId = 7277663;
+    email = "nathaniel.brough@gmail.com";
+    name = "Nathaniel Brough";
+  };
+  nathanruiz = {
+    email = "nathanruiz@protonmail.com";
+    github = "nathanruiz";
+    githubId = 18604892;
+    name = "Nathan Ruiz";
+  };
+  nathyong = {
+    github = "nathyong";
+    githubId = 818502;
+    name = "Nathan Yong";
+  };
+  natsukium = {
+    email = "nixpkgs@natsukium.com";
+    github = "natsukium";
+    githubId = 25083790;
+    name = "Tomoya Otabi";
+    keys = [{
+      fingerprint = "3D14 6004 004C F882 D519  6CD4 9EA4 5A31 DB99 4C53";
+    }];
+  };
+  natto1784 = {
+    email = "natto@weirdnatto.in";
+    github = "natto1784";
+    githubId = 56316606;
+    name = "Amneesh Singh";
+  };
+  nazarewk = {
+    name = "Krzysztof Nazarewski";
+    matrix = "@nazarewk:matrix.org";
+    github = "nazarewk";
+    githubId = 3494992;
+    keys = [{
+      fingerprint = "4BFF 0614 03A2 47F0 AA0B 4BC4 916D 8B67 2418 92AE";
+    }];
+  };
+  nbr = {
+    github = "nbr";
+    githubId = 3819225;
+    name = "Nick Braga";
+  };
+  nbren12 = {
+    email = "nbren12@gmail.com";
+    github = "nbren12";
+    githubId = 1386642;
+    name = "Noah Brenowitz";
+  };
+  nbsp = {
+    email = "aoife@enby.space";
+    matrix = "@nbsp:enby.space";
+    github = "enbyspace";
+    githubId = 57151943;
+    name = "aoife cassidy";
+  };
+  ncfavier = {
+    email = "n@monade.li";
+    matrix = "@ncfavier:matrix.org";
+    github = "ncfavier";
+    githubId = 4323933;
+    name = "Naïm Favier";
+    keys = [{
+      fingerprint = "F3EB 4BBB 4E71 99BC 299C  D4E9 95AF CE82 1190 8325";
+    }];
+  };
+  nckx = {
+    email = "github@tobias.gr";
+    github = "nckx";
+    githubId = 364510;
+    name = "Tobias Geerinckx-Rice";
+  };
+  ndl = {
+    email = "ndl@endl.ch";
+    github = "ndl";
+    githubId = 137805;
+    name = "Alexander Tsvyashchenko";
+  };
+  ne9z = {
+    email = "yuchen@apvc.uk";
+    github = "ne9z";
+    githubId = 77314501;
+    name = "Maurice Zhou";
+  };
+  Nebucatnetzer = {
+    email = "andreas+nixpkgs@zweili.ch";
+    github = "Nebucatnetzer";
+    githubId = 2287221;
+    name = "Andreas Zweili";
+  };
+  Necior = {
+    email = "adrian@sadlocha.eu";
+    github = "Necior";
+    githubId = 2404518;
+    matrix = "@n3t:matrix.org";
+    name = "Adrian Sadłocha";
+  };
+  necrophcodr = {
+    email = "nc@scalehost.eu";
+    github = "necrophcodr";
+    githubId = 575887;
+    name = "Steffen Rytter Postas";
+  };
+  neeasade = {
+    email = "nathanisom27@gmail.com";
+    github = "neeasade";
+    githubId = 3747396;
+    name = "Nathan Isom";
+  };
+  neilmayhew = {
+    email = "nix@neil.mayhew.name";
+    github = "neilmayhew";
+    githubId = 166791;
+    name = "Neil Mayhew";
+  };
+  nek0 = {
+    email = "nek0@nek0.eu";
+    github = "nek0";
+    githubId = 1859691;
+    name = "Amedeo Molnár";
+  };
+  nelsonjeppesen = {
+    email = "nix@jeppesen.io";
+    github = "NelsonJeppesen";
+    githubId = 50854675;
+    name = "Nelson Jeppesen";
+  };
+  neonfuz = {
+    email = "neonfuz@gmail.com";
+    github = "neonfuz";
+    githubId = 2590830;
+    name = "Sage Raflik";
+  };
+  neosimsim = {
+    email = "me@abn.sh";
+    github = "neosimsim";
+    githubId = 1771772;
+    name = "Alexander Ben Nasrallah";
+  };
+  nequissimus = {
+    email = "tim@nequissimus.com";
+    github = "NeQuissimus";
+    githubId = 628342;
+    name = "Tim Steinbach";
+  };
+  nerdypepper = {
+    email = "nerdy@peppe.rs";
+    github = "nerdypepper";
+    githubId = 23743547;
+    name = "Akshay Oppiliappan";
+  };
+  ners = {
+    name = "ners";
+    email = "ners@gmx.ch";
+    matrix = "@ners:ners.ch";
+    github = "ners";
+    githubId = 50560955;
+  };
+  nessdoor = {
+    name = "Tomas Antonio Lopez";
+    email = "entropy.overseer@protonmail.com";
+    github = "nessdoor";
+    githubId = 25993494;
+  };
+  netali = {
+    name = "Jennifer Graul";
+    email = "me@netali.de";
+    github = "NetaliDev";
+    githubId = 15304894;
+    keys = [{
+      fingerprint = "F729 2594 6F58 0B05 8FB3  F271 9C55 E636 426B 40A9";
+    }];
+  };
+  netcrns = {
+    email = "jason.wing@gmx.de";
+    github = "netcrns";
+    githubId = 34162313;
+    name = "Jason Wing";
+  };
+  netfox = {
+    name = "netfox";
+    email = "say-hi@netfox.rip";
+    matrix = "@netfox:catgirl.cloud";
+    github = "0xnetfox";
+    githubId = 97521402;
+    keys = [{
+      fingerprint = "E8E9 43D7 EB83 DB77 E41C  D87F 9C77 CB70 F2E6 3EF7";
+    }];
+  };
+  netixx = {
+    email = "dev.espinetfrancois@gmail.com";
+    github = "netixx";
+    githubId = 1488603;
+    name = "François Espinet";
+  };
+  net-mist = {
+    email = "archimist.linux@gmail.com";
+    github = "Net-Mist";
+    githubId = 13920346;
+    name = "Sébastien Iooss";
+  };
+  netthier = {
+    email = "netthier@proton.me";
+    name = "nett_hier";
+    github = "netthier";
+    githubId = 66856670;
+  };
+  networkexception = {
+    name = "networkException";
+    email = "nix@nwex.de";
+    matrix = "@networkexception:chat.upi.li";
+    github = "networkException";
+    githubId = 42888162;
+    keys = [{
+      fingerprint = "A0B9 48C5 A263 55C2 035F  8567 FBB7 2A94 52D9 1A72";
+    }];
+  };
+  neverbehave = {
+    email = "i@never.pet";
+    github = "NeverBehave";
+    githubId = 17120571;
+    name = "Xinhao Luo";
+  };
+  nevivurn = {
+    email = "nevivurn@nevi.dev";
+    github = "nevivurn";
+    githubId = 7698349;
+    name = "Yongun Seong";
+  };
+  newam = {
+    email = "alex@thinglab.org";
+    github = "newAM";
+    githubId = 7845120;
+    name = "Alex Martens";
+  };
+  ngerstle = {
+    name = "Nicholas Gerstle";
+    email = "ngerstle@gmail.com";
+    github = "ngerstle";
+    githubId = 1023752;
+  };
+  ngiger = {
+    email = "niklaus.giger@member.fsf.org";
+    github = "ngiger";
+    githubId = 265800;
+    name = "Niklaus Giger";
+  };
+  nh2 = {
+    email = "mail@nh2.me";
+    matrix = "@nh2:matrix.org";
+    github = "nh2";
+    githubId = 399535;
+    name = "Niklas Hambüchen";
+  };
+  nhooyr = {
+    email = "anmol@aubble.com";
+    github = "nhooyr";
+    githubId = 10180857;
+    name = "Anmol Sethi";
+  };
+  nialov = {
+    email = "nikolasovaskainen@gmail.com";
+    github = "nialov";
+    githubId = 47318483;
+    name = "Nikolas Ovaskainen";
+  };
+  nicbk = {
+    email = "nicolas@nicbk.com";
+    github = "nicbk";
+    githubId = 77309427;
+    name = "Nicolás Kennedy";
+    keys = [{
+      fingerprint = "7BC1 77D9 C222 B1DC FB2F  0484 C061 089E FEBF 7A35";
+    }];
+  };
+  nicegamer7 = {
+    name = "Kermina Awad";
+    email = "kerminaawad@gmail.com";
+    github = "nicegamer7";
+    githubId = 8083772;
+  };
+  nickcao = {
+    name = "Nick Cao";
+    email = "nickcao@nichi.co";
+    github = "NickCao";
+    githubId = 15247171;
+  };
+  nickgerace = {
+    name = "Nick Gerace";
+    github = "nickgerace";
+    githubId = 39320683;
+  };
+  nickhu = {
+    email = "me@nickhu.co.uk";
+    github = "NickHu";
+    githubId = 450276;
+    name = "Nick Hu";
+  };
+  nicknovitski = {
+    email = "nixpkgs@nicknovitski.com";
+    github = "nicknovitski";
+    githubId = 151337;
+    name = "Nick Novitski";
+  };
+  nico202 = {
+    email = "anothersms@gmail.com";
+    github = "nico202";
+    githubId = 8214542;
+    name = "Nicolò Balzarotti";
+  };
+  nicolas-goudry = {
+    email = "goudry.nicolas@gmail.com";
+    github = "nicolas-goudry";
+    githubId = 8753998;
+    name = "Nicolas Goudry";
+    keys = [{
+      fingerprint = "21B6 A59A 4E89 0B1B 83E3 0CDB 01C8 8C03 5450 9AA9";
+    }];
+  };
+  nicoo = {
+    email = "nicoo@debian.org";
+    github = "nbraud";
+    githubId = 1155801;
+    name = "nicoo";
+    keys = [{
+      fingerprint = "E44E 9EA5 4B8E 256A FB73 49D3 EC9D 3708 72BC 7A8C";
+    }];
+  };
+  nidabdella = {
+    name = "Mohamed Nidabdella";
+    email = "nidabdella.mohamed@gmail.com";
+    github = "nidabdella";
+    githubId = 8083813;
+  };
+  NieDzejkob = {
+    email = "kuba@kadziolka.net";
+    github = "meithecatte";
+    githubId = 23580910;
+    name = "Jakub Kądziołka";
+    keys = [{
+      fingerprint = "E576 BFB2 CF6E B13D F571  33B9 E315 A758 4613 1564";
+    }];
+  };
+  nielsegberts = {
+    email = "nix@nielsegberts.nl";
+    github = "nielsegberts";
+    githubId = 368712;
+    name = "Niels Egberts";
+  };
+  nigelgbanks = {
+    name = "Nigel Banks";
+    email = "nigel.g.banks@gmail.com";
+    github = "nigelgbanks";
+    githubId = 487373;
+  };
+  nikitavoloboev = {
+    email = "nikita.voloboev@gmail.com";
+    github = "nikitavoloboev";
+    githubId = 6391776;
+    name = "Nikita Voloboev";
+  };
+  niklaskorz = {
+    name = "Niklas Korz";
+    email = "niklas@niklaskorz.de";
+    matrix = "@niklaskorz:korz.dev";
+    github = "niklaskorz";
+    githubId = 590517;
+  };
+  NikolaMandic = {
+    email = "nikola@mandic.email";
+    github = "NikolaMandic";
+    githubId = 4368690;
+    name = "Ratko Mladic";
+  };
+  nikstur = {
+    email = "nikstur@outlook.com";
+    name = "nikstur";
+    github = "nikstur";
+    githubId = 61635709;
+  };
+  nilp0inter = {
+    email = "robertomartinezp@gmail.com";
+    github = "nilp0inter";
+    githubId = 1224006;
+    name = "Roberto Abdelkader Martínez Pérez";
+  };
+  nils-degroot = {
+    email = "nils@peeko.nl";
+    github = "nils-degroot";
+    githubId = 53556985;
+    name = "Nils de Groot";
+  };
+  nilsirl = {
+    email = "nils@nilsand.re";
+    github = "NilsIrl";
+    githubId = 26231126;
+    name = "Nils ANDRÉ-CHANG";
+  };
+  nim65s = {
+    email = "guilhem.saurel@laas.fr";
+    matrix = "@gsaurel:laas.fr";
+    github = "nim65s";
+    githubId = 131929;
+    name = "Guilhem Saurel";
+    keys = [{
+      fingerprint = "9B1A 7906 5D2F 2B80 6C8A  5A1C 7D2A CDAF 4653 CF28";
+    }];
+  };
+  ninjafb = {
+    email = "oscar@oronberg.com";
+    github = "NinjaFB";
+    githubId = 54169044;
+    name = "NinjaFB";
+  };
+  nintron = {
+    email = "nintron@sent.com";
+    github = "Nintron27";
+    githubId = 47835714;
+    name = "Nintron";
+  };
+  niols = {
+    email = "niols@niols.fr";
+    github = "niols";
+    githubId = 5920602;
+    name = "Nicolas Jeannerod";
+  };
+  nioncode = {
+    email = "nioncode+github@gmail.com";
+    github = "nioncode";
+    githubId = 3159451;
+    name = "Nicolas Schneider";
+  };
+  nitsky = {
+    name = "nitsky";
+    github = "nitsky";
+    githubId = 492793;
+  };
+  nixbitcoin = {
+    email = "nixbitcoin@i2pmail.org";
+    github = "nixbitcoin";
+    githubId = 45737139;
+    name = "nixbitcoindev";
+    keys = [{
+      fingerprint = "577A 3452 7F3E 2A85 E80F  E164 DD11 F9AD 5308 B3BA";
+    }];
+  };
+  nixinator = {
+    email = "33lockdown33@protonmail.com";
+    matrix = "@nixinator:nixos.dev";
+    github = "nixinator";
+    githubId = 66913205;
+    name = "Rick Sanchez";
+  };
+  nix-julia = {
+    name = "nix-julia";
+    github = "nix-julia";
+    githubId = 149073815;
+  };
+  nixy = {
+    email = "nixy@nixy.moe";
+    github = "nixy";
+    githubId = 7588406;
+    name = "Andrew R. M.";
+  };
+  nkalupahana = {
+    email = "hello@nisa.la";
+    github = "nkalupahana";
+    githubId = 7347290;
+    name = "Nisala Kalupahana";
+  };
+  nkje = {
+    name = "Niels Kristian Lyshøj Jensen";
+    email = "n@nk.je";
+    github = "NKJe";
+    githubId = 1102306;
+    keys = [{
+      fingerprint = "B956 C6A4 22AF 86A0 8F77  A8CA DE3B ADFE CD31 A89D";
+    }];
+  };
+  nkpvk = {
+    email = "niko.pavlinek@gmail.com";
+    github = "npavlinek";
+    githubId = 16385648;
+    name = "Niko Pavlinek";
+  };
+  nloomans = {
+    email = "noah@nixos.noahloomans.com";
+    github = "nloomans";
+    githubId = 7829481;
+    name = "Noah Loomans";
+  };
+  nmattia = {
+    email = "nicolas@nmattia.com";
+    github = "nmattia";
+    githubId = 6930756;
+    name = "Nicolas Mattia";
+  };
+  nobbz = {
+    name = "Norbert Melzer";
+    email = "timmelzer+nixpkgs@gmail.com";
+    github = "NobbZ";
+    githubId = 58951;
+  };
+  nocoolnametom = {
+    email = "nocoolnametom@gmail.com";
+    github = "nocoolnametom";
+    githubId = 810877;
+    name = "Tom Doggett";
+  };
+  noisersup = {
+    email = "patryk@kwiatek.xyz";
+    github = "noisersup";
+    githubId = 42322511;
+    name = "Patryk Kwiatek";
+  };
+  nomeata = {
+    email = "mail@joachim-breitner.de";
+    github = "nomeata";
+    githubId = 148037;
+    name = "Joachim Breitner";
+  };
+  nomisiv = {
+    email = "simon@nomisiv.com";
+    github = "NomisIV";
+    githubId = 47303199;
+    name = "Simon Gutgesell";
+  };
+  noneucat = {
+    email = "andy@lolc.at";
+    matrix = "@noneucat:lolc.at";
+    github = "noneucat";
+    githubId = 40049608;
+    name = "Andy Chun";
+  };
+  noodlez1232 = {
+    email = "contact@nathanielbarragan.xyz";
+    matrix = "@noodlez1232:matrix.org";
+    github = "Noodlez1232";
+    githubId = 12480453;
+    name = "Nathaniel Barragan";
+  };
+  nook = {
+    name = "Tom Nook";
+    email = "0xnook@protonmail.com";
+    github = "0xnook";
+    githubId = 88323754;
+  };
+  noreferences = {
+    email = "norkus@norkus.net";
+    github = "jozuas";
+    githubId = 13085275;
+    name = "Juozas Norkus";
+  };
+  norfair = {
+    email = "syd@cs-syd.eu";
+    github = "NorfairKing";
+    githubId = 3521180;
+    name = "Tom Sydney Kerckhove";
+  };
+  nosewings = {
+    name = "Nicholas Coltharp";
+    email = "coltharpnicholas@gmail.com";
+    github = "nosewings";
+    githubId = 24929858;
+  };
+  NotAShelf = {
+    name = "NotAShelf";
+    email = "raf@notashelf.dev";
+    github = "NotAShelf";
+    githubId = 62766066;
+    matrix = "@raf:notashelf.dev";
+  };
+  notbandali = {
+    name = "Amin Bandali";
+    email = "bandali@gnu.org";
+    github = "bandali0";
+    githubId = 1254858;
+    keys = [{
+      fingerprint = "BE62 7373 8E61 6D6D 1B3A  08E8 A21A 0202 4881 6103";
+    }];
+  };
+  not-my-segfault = {
+    email = "michal@tar.black";
+    matrix = "@michal:tar.black";
+    github = "not-my-segfault";
+    githubId = 30374463;
+    name = "Michal S.";
+  };
+  notthemessiah = {
+    email = "brian.cohen.88@gmail.com";
+    github = "NOTtheMessiah";
+    githubId = 2946283;
+    name = "Brian Cohen";
+  };
+  nova-madeline = {
+    matrix = "@nova:tchncs.de";
+    github = "nova-r";
+    githubId = 126072875;
+    name = "nova madeline";
+  };
+  novenary = {
+    email = "streetwalkermc@gmail.com";
+    github = "9ary";
+    githubId = 1155030;
+    name = "novenary";
+  };
+  novoxd = {
+    email = "radnovox@gmail.com";
+    github = "novoxd";
+    githubId = 6052922;
+    name = "Kirill Struokov";
+  };
+  np = {
+    email = "np.nix@nicolaspouillard.fr";
+    github = "np";
+    githubId = 5548;
+    name = "Nicolas Pouillard";
+  };
+  npatsakula = {
+    email = "nikita.patsakula@gmail.com";
+    name = "Patsakula Nikita";
+    github = "npatsakula";
+    githubId = 23001619;
+  };
+  nphilou = {
+    email = "nphilou@gmail.com";
+    github = "nphilou";
+    githubId = 9939720;
+    name = "Philippe Nguyen";
+  };
+  npulidomateo = {
+    matrix = "@npulidomateo:matrix.org";
+    github = "npulidomateo";
+    githubId = 13149442;
+    name = "Nico Pulido-Mateo";
+  };
+  nrabulinski = {
+    email = "1337-nix@nrab.lol";
+    matrix = "@niko:nrab.lol";
+    github = "nrabulinski";
+    githubId = 24574288;
+    name = "Nikodem Rabuliński";
+  };
+  nrdxp = {
+    email = "tim.deh@pm.me";
+    matrix = "@timdeh:matrix.org";
+    github = "nrdxp";
+    githubId = 34083928;
+    name = "Tim DeHerrera";
+  };
+  nrhelmi = {
+    email = "helmiinour@gmail.com";
+    github = "NRHelmi";
+    githubId = 15707703;
+    name = "Helmi Nour";
+  };
+  nrhtr = {
+    email = "jeremy@jenga.xyz";
+    github = "nrhtr";
+    githubId = 74261;
+    name = "Jeremy Parker";
+  };
+  nshalman = {
+    email = "nahamu@gmail.com";
+    github = "nshalman";
+    githubId = 20391;
+    name = "Nahum Shalman";
+  };
+  nsnelson = {
+    email = "noah.snelson@protonmail.com";
+    github = "peeley";
+    githubId = 30942198;
+    name = "Noah Snelson";
+  };
+  nthorne = {
+    email = "notrupertthorne@gmail.com";
+    github = "nthorne";
+    githubId = 1839979;
+    name = "Niklas Thörne";
+  };
+  nudelsalat = {
+    email = "nudelsalat@clouz.de";
+    name = "Fabian Dreßler";
+    github = "Noodlesalat";
+    githubId = 12748782;
+  };
+  nukaduka = {
+    email = "ksgokte@gmail.com";
+    github = "NukaDuka";
+    githubId = 22592293;
+    name = "Kartik Gokte";
+  };
+  nullishamy = {
+    email = "spam@amyerskine.me";
+    name = "nullishamy";
+    github = "nullishamy";
+    githubId = 99221043;
+  };
+  nullx76 = {
+    email = "nix@xirion.net";
+    github = "NULLx76";
+    githubId = 1809198;
+    name = "Victor Roest";
+  };
+  numinit = {
+    email = "me@numin.it";
+    github = "numinit";
+    githubId = 369111;
+    name = "Morgan Jones";
+  };
+  numkem = {
+    name = "Sebastien Bariteau";
+    email = "numkem@numkem.org";
+    matrix = "@numkem:matrix.org";
+    github = "numkem";
+    githubId = 332423;
+  };
+  nu-nu-ko = {
+    email = "host@nuko.city";
+    github = "nu-nu-ko";
+    githubId = 153512689;
+    name = "nuko";
+  };
+  nviets = {
+    email = "nathan.g.viets@gmail.com";
+    github = "nviets";
+    githubId = 16027994;
+    name = "Nathan Viets";
+  };
+  nyanbinary = {
+    email = "nyanbinary@keemail.me";
+    matrix = "@niko:conduit.rs";
+    github = "nyabinary";
+    githubId = 97130632;
+    name = "Niko";
+  };
+  nyanloutre = {
+    email = "paul@nyanlout.re";
+    github = "nyanloutre";
+    githubId = 7677321;
+    name = "Paul Trehiou";
+  };
+  nyanotech = {
+    name = "nyanotech";
+    email = "nyanotechnology@gmail.com";
+    github = "nyanotech";
+    githubId = 33802077;
+  };
+  nyarly = {
+    email = "nyarly@gmail.com";
+    github = "nyarly";
+    githubId = 127548;
+    name = "Judson Lester";
+  };
+  nzbr = {
+    email = "nixos@nzbr.de";
+    github = "nzbr";
+    githubId = 7851175;
+    name = "nzbr";
+    matrix = "@nzbr:nzbr.de";
+    keys = [{
+      fingerprint = "BF3A 3EE6 3144 2C5F C9FB  39A7 6C78 B50B 97A4 2F8A";
+    }];
+  };
+  nzhang-zh = {
+    email = "n.zhang.hp.au@gmail.com";
+    github = "nzhang-zh";
+    githubId = 30825096;
+    name = "Ning Zhang";
+  };
+  oaksoaj = {
+    email = "oaksoaj@riseup.net";
+    name = "Oaksoaj";
+    github = "oaksoaj";
+    githubId = 103952141;
+  };
+  obadz = {
+    email = "obadz-nixos@obadz.com";
+    github = "obadz";
+    githubId = 3359345;
+    name = "obadz";
+  };
+  oberblastmeister = {
+    email = "littlebubu.shu@gmail.com";
+    github = "oberblastmeister";
+    githubId = 61095988;
+    name = "Brian Shu";
+  };
+  obfusk = {
+    email = "flx@obfusk.net";
+    matrix = "@obfusk:matrix.org";
+    github = "obfusk";
+    githubId = 1260687;
+    name = "FC Stegerman";
+    keys = [{
+      fingerprint = "D5E4 A51D F8D2 55B9 FAC6  A9BB 2F96 07F0 9B36 0F2D";
+    }];
+  };
+  obsidian-systems-maintenance = {
+    name = "Obsidian Systems Maintenance";
+    email = "maintainer@obsidian.systems";
+    github = "obsidian-systems-maintenance";
+    githubId = 80847921;
+  };
+  ocfox = {
+    email = "i@ocfox.me";
+    github = "ocfox";
+    githubId = 47410251;
+    name = "ocfox";
+    keys = [{
+      fingerprint = "939E F8A5 CED8 7F50 5BB5  B2D0 24BC 2738 5F70 234F";
+    }];
+  };
+  octodi = {
+    name = "octodi";
+    email = "octodi@proton.me";
+    matrix = "@octodi:matrix.org";
+    github = "octodi";
+    githubId = 127038896;
+  };
+  oddlama = {
+    email = "oddlama@oddlama.org";
+    github = "oddlama";
+    githubId = 31919558;
+    name = "oddlama";
+    keys = [{
+      fingerprint = "680A A614 E988 DE3E 84E0  DEFA 503F 6C06 8410 4B0A";
+    }];
+  };
+  odi = {
+    email = "oliver.dunkl@gmail.com";
+    github = "odi";
+    githubId = 158758;
+    name = "Oliver Dunkl";
+  };
+  ofek = {
+    email = "oss@ofek.dev";
+    github = "ofek";
+    githubId = 9677399;
+    name = "Ofek Lev";
+  };
+  offline = {
+    email = "jaka@x-truder.net";
+    github = "offlinehacker";
+    githubId = 585547;
+    name = "Jaka Hudoklin";
+  };
+  offsetcyan = {
+    github = "offsetcyan";
+    githubId = 49906709;
+    name = "Dakota";
+  };
+  oida = {
+    email = "oida@posteo.de";
+    github = "oida";
+    githubId = 7249506;
+    name = "oida";
+  };
+  olcai = {
+    email = "dev@timan.info";
+    github = "olcai";
+    githubId = 20923;
+    name = "Erik Timan";
+  };
+  olebedev = {
+    email = "ole6edev@gmail.com";
+    github = "olebedev";
+    githubId = 848535;
+    name = "Oleg Lebedev";
+  };
+  olejorgenb = {
+    email = "olejorgenb@yahoo.no";
+    github = "olejorgenb";
+    githubId = 72201;
+    name = "Ole Jørgen Brønner";
+  };
+  oliver-koss = {
+    email = "oliver.koss06@gmail.com";
+    github = "oliver-koss";
+    githubId = 39134647;
+    name = "Oliver Koss";
+  };
+  ollieB = {
+    github = "oliverbunting";
+    githubId = 1237862;
+    name = "Ollie Bunting";
+  };
+  oluceps = {
+    email = "nixos@oluceps.uk";
+    github = "oluceps";
+    githubId = 35628088;
+    name = "oluceps";
+  };
+  olynch = {
+    email = "owen@olynch.me";
+    github = "olynch";
+    githubId = 4728903;
+    name = "Owen Lynch";
+  };
+  omasanori = {
+    github = "omasanori";
+    githubId = 167209;
+    name = "Masanori Ogino";
+  };
+  omgbebebe = {
+    email = "omgbebebe@gmail.com";
+    github = "omgbebebe";
+    githubId = 588167;
+    name = "Sergey Bubnov";
+  };
+  omnipotententity = {
+    email = "omnipotententity@gmail.com";
+    github = "OmnipotentEntity";
+    githubId = 1538622;
+    name = "Michael Reilly";
+  };
+  onedragon = {
+    name = "YiLong Liu";
+    email = "18922251299@163.com";
+    github = "jackyliu16";
+    githubId = 50787361;
+  };
+  onemoresuza = {
+    name = "Coutinho de Souza";
+    email = "dev@onemoresuza.mailer.me";
+    github = "onemoresuza";
+    githubId = 106456302;
+    keys = [{
+      fingerprint = "484F D3B8 BAD7 BF5D 8B68  2AEA A2ED 1159 935E 4D7E";
+    }];
+  };
+  onixie = {
+    email = "onixie@gmail.com";
+    github = "onixie";
+    githubId = 817073;
+    name = "Yc. Shen";
+  };
+  onny = {
+    email = "onny@project-insanity.org";
+    github = "onny";
+    githubId = 757752;
+    name = "Jonas Heinrich";
+  };
+  onsails = {
+    email = "andrey@onsails.com";
+    github = "onsails";
+    githubId = 107261;
+    name = "Andrey Kuznetsov";
+  };
+  onthestairs = {
+    email = "austinplatt@gmail.com";
+    github = "onthestairs";
+    githubId = 915970;
+    name = "Austin Platt";
+  };
+  onur-ozkan = {
+    name = "Onur Ozkan";
+    email = "contact@onurozkan.dev";
+    github = "onur-ozkan";
+    githubId = 39852038;
+  };
+  ony = {
+    name = "Mykola Orliuk";
+    email = "virkony@gmail.com";
+    github = "ony";
+    githubId = 11265;
+  };
+  ooliver1 = {
+    name = "Oliver Wilkes";
+    email = "oliverwilkes2006@icloud.com";
+    github = "ooliver1";
+    githubId = 34910574;
+    keys = [{
+      fingerprint = "D055 8A23 3947 B7A0 F966  B07F 0B41 0348 9833 7273";
+    }];
+  };
+  opeik = {
+    email = "sandro@stikic.com";
+    github = "opeik";
+    githubId = 11566773;
+    name = "Sandro Stikić";
+  };
+  OPNA2608 = {
+    email = "opna2608@protonmail.com";
+    github = "OPNA2608";
+    githubId = 23431373;
+    name = "Cosima Neidahl";
+  };
+  orbekk = {
+    email = "kjetil.orbekk@gmail.com";
+    github = "orbekk";
+    githubId = 19862;
+    name = "KJ Ørbekk";
+  };
+  orbitz = {
+    email = "mmatalka@gmail.com";
+    github = "orbitz";
+    githubId = 75299;
+    name = "Malcolm Matalka";
+  };
+  orhun = {
+    email = "orhunparmaksiz@gmail.com";
+    github = "orhun";
+    githubId = 24392180;
+    name = "Orhun Parmaksız";
+    keys = [{
+      fingerprint = "165E 0FF7 C48C 226E 1EC3 63A7 F834 2482 4B3E 4B90";
+    }];
+  };
+  orichter = {
+    email = "richter-oliver@gmx.net";
+    github = "ORichterSec";
+    githubId = 135209509;
+    name = "Oliver Richter";
+  };
+  orivej = {
+    email = "orivej@gmx.fr";
+    github = "orivej";
+    githubId = 101514;
+    name = "Orivej Desh";
+  };
+  ornxka = {
+    email = "ornxka@littledevil.sh";
+    github = "ornxka";
+    githubId = 52086525;
+    name = "ornxka";
+  };
+  oro = {
+    email = "marco@orovecchia.at";
+    github = "Oro";
+    githubId = 357005;
+    name = "Marco Orovecchia";
+  };
+  orthros = {
+    github = "orthros";
+    githubId = 7820716;
+    name = "orthros";
+  };
+  osener = {
+    email = "ozan@ozansener.com";
+    github = "osener";
+    githubId = 111265;
+    name = "Ozan Sener";
+  };
+  ostrolucky = {
+    email = "gabriel.ostrolucky@gmail.com";
+    github = "ostrolucky";
+    githubId = 496233;
+    name = "Gabriel Ostrolucký";
+    keys = [{
+      fingerprint = "6611 22A7 B778 6E4A E99A  9D6E C79A D015 19EF B134";
+    }];
+  };
+  otavio = {
+    email = "otavio.salvador@ossystems.com.br";
+    github = "otavio";
+    githubId = 25278;
+    name = "Otavio Salvador";
+  };
+  otini = {
+    name = "Olivier Nicole";
+    email = "olivier@chnik.fr";
+    github = "OlivierNicole";
+    githubId = 14031333;
+  };
+  otwieracz = {
+    email = "slawek@otwiera.cz";
+    github = "otwieracz";
+    githubId = 108072;
+    name = "Slawomir Gonet";
+  };
+  ovlach = {
+    email = "ondrej@vlach.xyz";
+    name = "Ondrej Vlach";
+    github = "ovlach";
+    githubId = 4405107;
+  };
+  oxalica = {
+    email = "oxalicc@pm.me";
+    github = "oxalica";
+    githubId = 14816024;
+    name = "oxalica";
+    keys = [{
+      fingerprint = "F90F FD6D 585C 2BA1 F13D  E8A9 7571 654C F88E 31C2";
+    }];
+  };
+  oxapentane = {
+    email = "blame@oxapentane.com";
+    github = "oxapentane";
+    githubId = 1297357;
+    name = "Grigory Shipunov";
+    keys = [{
+      fingerprint = "DD09 98E6 CDF2 9453 7FC6  04F9 91FA 5E5B F9AA 901C";
+    }];
+  };
+  oxij = {
+    email = "oxij@oxij.org";
+    github = "oxij";
+    githubId = 391919;
+    name = "Jan Malakhovski";
+    keys = [{
+      fingerprint = "514B B966 B46E 3565 0508  86E8 0E6C A66E 5C55 7AA8";
+    }];
+  };
+  oxzi = {
+    email = "post@0x21.biz";
+    github = "oxzi";
+    githubId = 8402811;
+    name = "Alvar Penning";
+    keys = [{
+      fingerprint = "EB14 4E67 E57D 27E2 B5A4  CD8C F32A 4563 7FA2 5E31";
+    }];
+  };
+  oyren = {
+    email = "m.scheuren@oyra.eu";
+    github = "oyren";
+    githubId = 15930073;
+    name = "Moritz Scheuren";
+  };
+  ozkutuk = {
+    email = "ozkutuk@protonmail.com";
+    github = "ozkutuk";
+    githubId = 5948762;
+    name = "Berk Özkütük";
+  };
+  p3psi = {
+    name = "Elliot Boo";
+    email = "p3psi.boo@gmail.com";
+    github = "p3psi-boo";
+    githubId = 43925055;
+  };
+  pabloaul = {
+    email = "contact@nojus.org";
+    github = "pabloaul";
+    githubId = 35423980;
+    name = "Nojus Dulskis";
+  };
+  pablovsky = {
+    email = "dealberapablo07@gmail.com";
+    github = "Pablo1107";
+    githubId = 17091659;
+    name = "Pablo Andres Dealbera";
+  };
+  pacien = {
+    email = "b4gx3q.nixpkgs@pacien.net";
+    github = "pacien";
+    githubId = 1449319;
+    name = "Pacien Tran-Girard";
+  };
+  pacman99 = {
+    email = "pachum99@gmail.com";
+    matrix = "@pachumicchu:myrdd.info";
+    github = "Pacman99";
+    githubId = 16345849;
+    name = "Parthiv Seetharaman";
+  };
+  paddygord = {
+    email = "pgpatrickgordon@gmail.com";
+    github = "avaunit02";
+    githubId = 10776658;
+    name = "Patrick Gordon";
+  };
+  paholg = {
+    email = "paho@paholg.com";
+    github = "paholg";
+    githubId = 4908217;
+    name = "Paho Lurie-Gregg";
+  };
+  pakhfn = {
+    email = "pakhfn@gmail.com";
+    github = "pakhfn";
+    githubId = 11016164;
+    name = "Fedor Pakhomov";
+  };
+  pallix = {
+    email = "pierre.allix.work@gmail.com";
+    github = "pallix";
+    githubId = 676838;
+    name = "Pierre Allix";
+  };
+  paluh = {
+    email = "paluho@gmail.com";
+    github = "paluh";
+    githubId = 190249;
+    name = "Tomasz Rybarczyk";
+  };
+  pamplemousse = {
+    email = "xav.maso@gmail.com";
+    matrix = "@pamplemouss_:matrix.org";
+    github = "Pamplemousse";
+    githubId = 2647236;
+    name = "Xavier Maso";
+  };
+  panaeon = {
+    email = "vitalii.voloshyn@gmail.com";
+    github = "PanAeon";
+    githubId = 686076;
+    name = "Vitalii Voloshyn";
+  };
+  panda2134 = {
+    email = "me+nixpkgs@panda2134.site";
+    github = "panda2134";
+    githubId = 7239200;
+    name = "panda2134";
+  };
+  pandaman = {
+    email = "kointosudesuyo@infoseek.jp";
+    github = "pandaman64";
+    githubId = 1788628;
+    name = "pandaman";
+  };
+  panicgh = {
+    email = "nbenes.gh@xandea.de";
+    github = "panicgh";
+    githubId = 79252025;
+    name = "Nicolas Benes";
+  };
+  paperdigits = {
+    email = "mica@silentumbrella.com";
+    github = "paperdigits";
+    githubId = 71795;
+    name = "Mica Semrick";
+  };
+  paraseba = {
+    email = "paraseba@gmail.com";
+    github = "paraseba";
+    githubId = 20792;
+    name = "Sebastian Galkin";
+  };
+  parasrah = {
+    email = "nixos@parasrah.com";
+    github = "Parasrah";
+    githubId = 14935550;
+    name = "Brad Pfannmuller";
+  };
+  parras = {
+    email = "c@philipp-arras.de";
+    github = "phiadaarr";
+    githubId = 33826198;
+    name = "Philipp Arras";
+  };
+  pashashocky = {
+    email = "pashashocky@gmail.com";
+    github = "pashashocky";
+    githubId = 673857;
+    name = "Pash Shocky";
+  };
+  pashev = {
+    email = "pashev.igor@gmail.com";
+    github = "ip1981";
+    githubId = 131844;
+    name = "Igor Pashev";
+  };
+  pasqui23 = {
+    email = "p3dimaria@hotmail.it";
+    github = "pasqui23";
+    githubId = 6931743;
+    name = "pasqui23";
+  };
+  passivelemon = {
+    email = "jeremyseber@gmail.com";
+    github = "PassiveLemon";
+    githubId = 72527881;
+    name = "PassiveLemon";
+  };
+  patka = {
+    email = "patka@patka.dev";
+    github = "patka-123";
+    githubId = 69802930;
+    name = "patka";
+  };
+  patricksjackson = {
+    email = "patrick@jackson.dev";
+    github = "patricksjackson";
+    githubId = 160646;
+    name = "Patrick Jackson";
+  };
+  patryk27 = {
+    email = "pwychowaniec@pm.me";
+    github = "Patryk27";
+    githubId = 3395477;
+    name = "Patryk Wychowaniec";
+    keys = [{
+      fingerprint = "196A BFEC 6A1D D1EC 7594  F8D1 F625 47D0 75E0 9767";
+    }];
+  };
+  patryk4815 = {
+    email = "patryk.sondej@gmail.com";
+    github = "patryk4815";
+    githubId = 3074260;
+    name = "Patryk Sondej";
+  };
+  patternspandemic = {
+    email = "patternspandemic@live.com";
+    github = "patternspandemic";
+    githubId = 15645854;
+    name = "Brad Christensen";
+  };
+  patwid = {
+    email = "patrick.widmer@tbwnet.ch";
+    github = "patwid";
+    githubId = 25278658;
+    name = "Patrick Widmer";
+  };
+  paulsmith = {
+    email = "paulsmith@pobox.com";
+    github = "paulsmith";
+    name = "Paul Smith";
+    githubId = 1210;
+  };
+  paumr = {
+    github = "paumr";
+    name = "Michael Bergmeister";
+    githubId = 53442728;
+  };
+  paveloom = {
+    email = "paveloom@riseup.net";
+    github = "paveloom";
+    githubId = 49961859;
+    name = "Pavel Sobolev";
+  };
+  pawelpacana = {
+    email = "pawel.pacana@gmail.com";
+    github = "pawelpacana";
+    githubId = 116740;
+    name = "Paweł Pacana";
+  };
+  payas = {
+    email = "relekarpayas@gmail.com";
+    github = "bhankas";
+    githubId = 24254289;
+    name = "Payas Relekar";
+  };
+  pb- = {
+    email = "pbaecher@gmail.com";
+    github = "pb-";
+    githubId = 84886;
+    name = "Paul Baecher";
+  };
+  pbar = {
+    email = "piercebartine@gmail.com";
+    github = "pbar1";
+    githubId = 26949935;
+    name = "Pierce Bartine";
+  };
+  pbek = {
+    email = "patrizio@bekerle.com";
+    matrix = "@patrizio:bekerle.com";
+    github = "pbek";
+    githubId = 1798101;
+    name = "Patrizio Bekerle";
+    keys = [{
+      fingerprint = "E005 48D5 D6AC 812C AAD2  AFFA 9C42 B05E 5913 60DC";
+    }];
+  };
+  pblkt = {
+    email = "pebblekite@gmail.com";
+    github = "pblkt";
+    githubId = 6498458;
+    name = "pebble kite";
+  };
+  pbogdan = {
+    email = "ppbogdan@gmail.com";
+    github = "pbogdan";
+    githubId = 157610;
+    name = "Piotr Bogdan";
+  };
+  pborzenkov = {
+    email = "pavel@borzenkov.net";
+    github = "pborzenkov";
+    githubId = 434254;
+    name = "Pavel Borzenkov";
+  };
+  pbsds = {
+    name = "Peder Bergebakken Sundt";
+    email = "pbsds@hotmail.com";
+    matrix = "@pederbs:pvv.ntnu.no";
+    github = "pbsds";
+    githubId = 140964;
+  };
+  pca006132 = {
+    name = "pca006132";
+    email = "john.lck40@gmail.com";
+    github = "pca006132";
+    githubId = 12198657;
+  };
+  pcarrier = {
+    email = "pc@rrier.ca";
+    github = "pcarrier";
+    githubId = 8641;
+    name = "Pierre Carrier";
+  };
+  pedrohlc = {
+    email = "root@pedrohlc.com";
+    github = "PedroHLC";
+    githubId = 1368952;
+    name = "Pedro Lara Campos";
+  };
+  peelz = {
+    email = "peelz.dev+nixpkgs@gmail.com";
+    github = "notpeelz";
+    githubId = 920910;
+    name = "peelz";
+  };
+  pelme = {
+    email = "andreas@pelme.se";
+    github = "pelme";
+    githubId = 20529;
+    name = "Andreas Pelme";
+  };
+  penalty1083 = {
+    email = "penalty1083@outlook.com";
+    github = "penalty1083";
+    githubId = 121009904;
+    name = "penalty1083";
+  };
+  penguwin = {
+    email = "penguwin@penguwin.eu";
+    github = "penguwin";
+    githubId = 13225611;
+    name = "Nicolas Martin";
+  };
+  pennae = {
+    name = "pennae";
+    email = "github@quasiparticle.net";
+    github = "pennae";
+    githubId = 82953136;
+  };
+  peret = {
+    name = "Peter Retzlaff";
+    github = "peret";
+    githubId = 617977;
+  };
+  periklis = {
+    email = "theopompos@gmail.com";
+    github = "periklis";
+    githubId = 152312;
+    name = "Periklis Tsirakidis";
+  };
+  perstark = {
+    email = "perstark.se@gmail.com";
+    github = "perstarkse";
+    githubId = 63069986;
+    name = "Per Stark";
+  };
+  petercommand = {
+    email = "petercommand@gmail.com";
+    github = "petercommand";
+    githubId = 1260660;
+    name = "petercommand";
+  };
+  peterhoeg = {
+    email = "peter@hoeg.com";
+    matrix = "@peter:hoeg.com";
+    github = "peterhoeg";
+    githubId = 722550;
+    name = "Peter Hoeg";
+  };
+  peterromfeldhk = {
+    email = "peter.romfeld.hk@gmail.com";
+    github = "peterromfeldhk";
+    githubId = 5515707;
+    name = "Peter Romfeld";
+  };
+  petersjt014 = {
+    email = "petersjt014@gmail.com";
+    github = "petersjt014";
+    githubId = 29493551;
+    name = "Josh Peters";
+  };
+  peterwilli = {
+    email = "peter@codebuffet.co";
+    github = "peterwilli";
+    githubId = 1212814;
+    name = "Peter Willemsen";
+    keys = [{
+      fingerprint = "A37F D403 88E2 D026 B9F6  9617 5C9D D4BF B96A 28F0";
+    }];
+  };
+  peti = {
+    email = "simons@cryp.to";
+    github = "peti";
+    githubId = 28323;
+    name = "Peter Simons";
+  };
+  petrosagg = {
+    email = "petrosagg@gmail.com";
+    github = "petrosagg";
+    githubId = 939420;
+    name = "Petros Angelatos";
+  };
+  petterstorvik = {
+    email = "petterstorvik@gmail.com";
+    github = "storvik";
+    githubId = 3438604;
+    name = "Petter Storvik";
+  };
+  p-h = {
+    email = "p@hurlimann.org";
+    github = "p-h";
+    githubId = 645664;
+    name = "Philippe Hürlimann";
+  };
+  phaer = {
+    name = "Paul Haerle";
+    email = "nix@phaer.org";
+
+    matrix = "@phaer:matrix.org";
+    github = "phaer";
+    githubId = 101753;
+    keys = [{
+      fingerprint = "5D69 CF04 B7BC 2BC1 A567  9267 00BC F29B 3208 0700";
+    }];
+  };
+  phdcybersec = {
+    name = "Léo Lavaur";
+    email = "phdcybersec@pm.me";
+
+    github = "phdcybersec";
+    githubId = 82591009;
+    keys = [{
+      fingerprint = "7756 E88F 3C6A 47A5 C5F0  CDFB AB54 6777 F93E 20BF";
+    }];
+  };
+  phfroidmont = {
+    name = "Paul-Henri Froidmont";
+    email = "nix.contact-j9dw4d@froidmont.org";
+
+    github = "phfroidmont";
+    githubId = 8150907;
+    keys = [{
+      fingerprint = "3AC6 F170 F011 33CE 393B  CD94 BE94 8AFD 7E78 73BE";
+    }];
+  };
+  phijor = {
+    name = "Philipp Joram";
+    email = "nixpkgs@phijor.me";
+    github = "phijor";
+    githubId = 10487782;
+  };
+  philandstuff = {
+    email = "philip.g.potter@gmail.com";
+    github = "philandstuff";
+    githubId = 581269;
+    name = "Philip Potter";
+  };
+  philclifford = {
+    email = "philip.clifford@gmail.com";
+    matrix = "@phil8o:matrix.org";
+    github = "philclifford";
+    githubId = 8797027;
+    keys = [{
+      fingerprint = "FC15 E59F 0CFA 9329 101B  71D9 92F7 A790 E9BA F1F7";
+    }];
+    name = "Phil Clifford";
+  };
+  phile314 = {
+    email = "nix@314.ch";
+    github = "phile314";
+    githubId = 1640697;
+    name = "Philipp Hausmann";
+  };
+  Philipp-M = {
+    email = "philipp@mildenberger.me";
+    github = "Philipp-M";
+    githubId = 9267430;
+    name = "Philipp Mildenberger";
+  };
+  philiptaron = {
+    email = "philip.taron@gmail.com";
+    github = "philiptaron";
+    githubId = 43863;
+    name = "Philip Taron";
+  };
+  phip1611 = {
+    email = "phip1611@gmail.com";
+    github = "phip1611";
+    githubId = 5737016;
+    name = "Philipp Schuster";
+  };
+  phlip9 = {
+    email = "philiphayes9@gmail.com";
+    github = "phlip9";
+    githubId = 918989;
+    name = "Philip Hayes";
+  };
+  Phlogistique = {
+    email = "noe.rubinstein@gmail.com";
+    github = "Phlogistique";
+    githubId = 421510;
+    name = "Noé Rubinstein";
+  };
+  pho = {
+    email = "phofin@gmail.com";
+    github = "pho";
+    githubId = 88469;
+    name = "Jaime Breva";
+  };
+  photex = {
+    email = "photex@gmail.com";
+    github = "photex";
+    githubId = 301903;
+    name = "Chip Collier";
+  };
+  phrogg = {
+    name = "Phil Roggenbuck";
+    email = "nixpkgs@phrogg.de";
+    github = "phrogg";
+    githubId = 1367949;
+  };
+  phryneas = {
+    email = "mail@lenzw.de";
+    github = "phryneas";
+    githubId = 4282439;
+    name = "Lenz Weber";
+  };
+  phunehehe = {
+    email = "phunehehe@gmail.com";
+    github = "phunehehe";
+    githubId = 627831;
+    name = "Hoang Xuan Phu";
+  };
+  picnoir = {
+    email = "felix@alternativebit.fr";
+    matrix = "@picnoir:alternativebit.fr";
+    github = "picnoir";
+    githubId = 1219785;
+    name = "Félix Baylac-Jacqué";
+  };
+  piegames = {
+    name = "piegames";
+    email = "nix@piegames.de";
+    matrix = "@piegames:matrix.org";
+    github = "piegamesde";
+    githubId = 14054505;
+  };
+  pierrechevalier83 = {
+    email = "pierrechevalier83@gmail.com";
+    github = "pierrechevalier83";
+    githubId = 5790907;
+    name = "Pierre Chevalier";
+  };
+  pierreis = {
+    email = "pierre@pierre.is";
+    github = "pierreis";
+    githubId = 203973;
+    name = "Pierre Matri";
+  };
+  pierrer = {
+    email = "pierrer@pi3r.be";
+    github = "PierreR";
+    githubId = 93115;
+    name = "Pierre Radermecker";
+  };
+  pierron = {
+    email = "nixos@nbp.name";
+    github = "nbp";
+    githubId = 1179566;
+    name = "Nicolas B. Pierron";
+  };
+  pimeys = {
+    email = "julius@nauk.io";
+    github = "pimeys";
+    githubId = 34967;
+    name = "Julius de Bruijn";
+  };
+  pineapplehunter = {
+    email = "peshogo+nixpkgs@gmail.com";
+    github = "pineapplehunter";
+    githubId = 8869894;
+    name = "Shogo Takata";
+  };
+  pingiun = {
+    email = "nixos@pingiun.com";
+    github = "pingiun";
+    githubId = 1576660;
+    name = "Jelle Besseling";
+    keys = [{
+      fingerprint = "A3A3 65AE 16ED A7A0 C29C  88F1 9712 452E 8BE3 372E";
+    }];
+  };
+  pinkcreeper100 = {
+    email = "benmoreosm@gmail.com";
+    github = "pinkcreeper100";
+    githubId = 35699052;
+    name = "Oliver Samuel Morris";
+  };
+  pinpox = {
+    email = "mail@pablo.tools";
+    github = "pinpox";
+    githubId = 1719781;
+    name = "Pablo Ovelleiro Corral";
+    keys = [{
+      fingerprint = "D03B 218C AE77 1F77 D7F9  20D9 823A 6154 4264 08D3";
+    }];
+  };
+  piperswe = {
+    email = "contact@piperswe.me";
+    github = "piperswe";
+    githubId = 1830959;
+    name = "Piper McCorkle";
+  };
+  piturnah = {
+    email = "peterhebden6@gmail.com";
+    github = "Piturnah";
+    githubId = 20472367;
+    name = "Peter Hebden";
+  };
+  pjbarnoy = {
+    email = "pjbarnoy@gmail.com";
+    github = "waaamb";
+    githubId = 119460;
+    name = "Perry Barnoy";
+  };
+  pjjw = {
+    email = "peter@shortbus.org";
+    github = "pjjw";
+    githubId = 638;
+    name = "Peter Woodman";
+  };
+  pjones = {
+    email = "pjones@devalot.com";
+    github = "pjones";
+    githubId = 3737;
+    name = "Peter Jones";
+  };
+  pjrm = {
+    email = "pedrojrmagalhaes@gmail.com";
+    github = "pjrm";
+    githubId = 4622652;
+    name = "Pedro Magalhães";
+  };
+  pkharvey = {
+    email = "kayharvey@protonmail.com";
+    github = "pkharvey";
+    githubId = 50750875;
+    name = "Paul Harvey";
+  };
+  pkmx = {
+    email = "pkmx.tw@gmail.com";
+    github = "PkmX";
+    githubId = 610615;
+    name = "Chih-Mao Chen";
+  };
+  pkosel = {
+    name = "pkosel";
+    email = "philipp.kosel@gmail.com";
+    github = "pkosel";
+    githubId = 170943;
+  };
+  pks = {
+    email = "ps@pks.im";
+    github = "pks-t";
+    githubId = 4056630;
+    name = "Patrick Steinhardt";
+  };
+  plabadens = {
+    name = "Pierre Labadens";
+    email = "labadens.pierre+nixpkgs@gmail.com";
+    github = "plabadens";
+    githubId = 4303706;
+    keys = [{
+      fingerprint = "B00F E582 FD3F 0732 EA48  3937 F558 14E4 D687 4375";
+    }];
+  };
+  plchldr = {
+    email = "mail@oddco.de";
+    github = "plchldr";
+    githubId = 11639001;
+    name = "Jonas Beyer";
+  };
+  plcplc = {
+    email = "plcplc@gmail.com";
+    github = "plcplc";
+    githubId = 358550;
+    name = "Philip Lykke Carlsen";
+  };
+  pleshevskiy = {
+    email = "dmitriy@pleshevski.ru";
+    github = "pleshevskiy";
+    githubId = 7839004;
+    name = "Dmitriy Pleshevskiy";
+  };
+  pluiedev = {
+    email = "hi@pluie.me";
+    github = "pluiedev";
+    githubId = 22406910;
+    name = "Leah Amelia Chen";
+  };
+  plumps = {
+    email = "maks.bronsky@web.de";
+    github = "plumps";
+    githubId = 13000278;
+    name = "Maksim Bronsky";
+  };
+  plusgut = {
+    name = "Carlo Jeske";
+    email = "carlo.jeske+nixpkgs@webentwickler2-0.de";
+    github = "plusgut";
+    githubId = 277935;
+    matrix = "@plusgut5:matrix.org";
+  };
+  PlushBeaver = {
+    name = "Dmitry Kozlyuk";
+    email = "dmitry.kozliuk+nixpkgs@gmail.com";
+    github = "PlushBeaver";
+    githubId = 8988269;
+  };
+  pmahoney = {
+    email = "pat@polycrystal.org";
+    github = "pmahoney";
+    githubId = 103822;
+    name = "Patrick Mahoney";
+  };
+  pmenke = {
+    email = "nixos@pmenke.de";
+    github = "pmenke-de";
+    githubId = 898922;
+    name = "Philipp Menke";
+    keys = [{
+      fingerprint = "ED54 5EFD 64B6 B5AA EC61 8C16 EB7F 2D4C CBE2 3B69";
+    }];
+  };
+  pmeunier = {
+    email = "pierre-etienne.meunier@inria.fr";
+    github = "P-E-Meunier";
+    githubId = 17021304;
+    name = "Pierre-Étienne Meunier";
+  };
+  pmiddend = {
+    email = "pmidden@secure.mailbox.org";
+    github = "pmiddend";
+    githubId = 178496;
+    name = "Philipp Middendorf";
+  };
+  pmw = {
+    email = "philip@mailworks.org";
+    matrix = "@philip4g:matrix.org";
+    name = "Philip White";
+    github = "philipmw";
+    githubId = 1379645;
+    keys = [{
+      fingerprint = "9AB0 6C94 C3D1 F9D0 B9D9  A832 BC54 6FB3 B16C 8B0B";
+    }];
+  };
+  pmy = {
+    email = "pmy@xqzp.net";
+    github = "pmeiyu";
+    githubId = 8529551;
+    name = "Peng Mei Yu";
+  };
+  pmyjavec = {
+    email = "pauly@myjavec.com";
+    github = "pmyjavec";
+    githubId = 315096;
+    name = "Pauly Myjavec";
+  };
+  pnelson = {
+    email = "me@pnelson.ca";
+    github = "pnelson";
+    githubId = 579773;
+    name = "Philip Nelson";
+  };
+  pneumaticat = {
+    email = "kevin@potatofrom.space";
+    github = "kliu128";
+    githubId = 11365056;
+    name = "Kevin Liu";
+  };
+  pnmadelaine = {
+    name = "Paul-Nicolas Madelaine";
+    email = "pnm@pnm.tf";
+    github = "pnmadelaine";
+    githubId = 21977014;
+  };
+  pnotequalnp = {
+    email = "kevin@pnotequalnp.com";
+    github = "pnotequalnp";
+    githubId = 46154511;
+    name = "Kevin Mullins";
+    keys = [{
+      fingerprint = "2CD2 B030 BD22 32EF DF5A  008A 3618 20A4 5DB4 1E9A";
+    }];
+  };
+  podocarp = {
+    email = "xdjiaxd@gmail.com";
+    github = "podocarp";
+    githubId = 10473184;
+    name = "Jia Xiaodong";
+  };
+  poelzi = {
+    email = "nix@poelzi.org";
+    github = "poelzi";
+    githubId = 66107;
+    name = "Daniel Poelzleithner";
+  };
+  pogobanane = {
+    email = "mail@peter-okelmann.de";
+    github = "pogobanane";
+    githubId = 38314551;
+    name = "Peter Okelmann";
+  };
+  pokon548 = {
+    email = "nix@bukn.uk";
+    github = "pokon548";
+    githubId = 65808665;
+    name = "Bu Kun";
+  };
+  polarmutex = {
+    email = "brian@brianryall.xyz";
+    github = "polarmutex";
+    githubId = 115141;
+    name = "Brian Ryall";
+  };
+  polendri = {
+    email = "paul@ijj.li";
+    github = "polendri";
+    githubId = 1829032;
+    name = "Paul Hendry";
+  };
+  polygon = {
+    email = "polygon@wh2.tu-dresden.de";
+    name = "Polygon";
+    github = "polygon";
+    githubId = 51489;
+  };
+  polykernel = {
+    github = "polykernel";
+    githubId = 81340136;
+    name = "polykernel";
+  };
+  polyrod = {
+    email = "dc1mdp@gmail.com";
+    github = "polyrod";
+    githubId = 24878306;
+    name = "Maurizio Di Pietro";
+  };
+  pombeirp = {
+    email = "nix@endgr.33mail.com";
+    github = "pedropombeiro";
+    githubId = 138074;
+    name = "Pedro Pombeiro";
+  };
+  pongo1231 = {
+    email = "pongo12310@gmail.com";
+    github = "pongo1231";
+    githubId = 4201956;
+    name = "pongo1231";
+  };
+  portothree = {
+    name = "Gustavo Porto";
+    email = "gus@p8s.co";
+    github = "portothree";
+    githubId = 3718120;
+  };
+  poscat = {
+    email = "poscat@mail.poscat.moe";
+    github = "poscat0x04";
+    githubId = 53291983;
+    name = "Poscat Tarski";
+    keys = [{
+      fingerprint = "48AD DE10 F27B AFB4 7BB0  CCAF 2D25 95A0 0D08 ACE0";
+    }];
+  };
+  posch = {
+    email = "tp@fonz.de";
+    github = "posch";
+    githubId = 146413;
+    name = "Tobias Poschwatta";
+  };
+  poweredbypie = {
+    name = "poweredbypie";
+    github = "poweredbypie";
+    githubId = 67135060;
+  };
+  PowerUser64 = {
+    email = "blakelysnorth@gmail.com";
+    github = "PowerUser64";
+    githubId = 24578572;
+    name = "Blake North";
+  };
+  ppenguin = {
+    name = "Jeroen Versteeg";
+    email = "hieronymusv@gmail.com";
+    github = "ppenguin";
+    githubId = 17690377;
+  };
+  ppom = {
+    name = "ppom";
+    email = "ppom@ecomail.fr";
+    github = "ppom0";
+    githubId = 38916722;
+  };
+  pradeepchhetri = {
+    email = "pradeep.chhetri89@gmail.com";
+    github = "pradeepchhetri";
+    githubId = 2232667;
+    name = "Pradeep Chhetri";
+  };
+  pradyuman = {
+    email = "me@pradyuman.co";
+    github = "pradyuman";
+    githubId = 9904569;
+    name = "Pradyuman Vig";
+    keys = [{
+      fingerprint = "240B 57DE 4271 2480 7CE3  EAC8 4F74 D536 1C4C A31E";
+    }];
+  };
+  preisschild = {
+    email = "florian@florianstroeger.com";
+    github = "Preisschild";
+    githubId = 11898437;
+    name = "Florian Ströger";
+  };
+  presto8 = {
+    name = "Preston Hunt";
+    email = "me@prestonhunt.com";
+    matrix = "@presto8:matrix.org";
+    github = "presto8";
+    githubId = 246631;
+    keys = [{
+      fingerprint = "3E46 7EF1 54AA A1D0 C7DF  A694 E45C B17F 1940 CA52";
+    }];
+  };
+  priegger = {
+    email = "philipp@riegger.name";
+    github = "priegger";
+    githubId = 228931;
+    name = "Philipp Riegger";
+  };
+  prikhi = {
+    email = "pavan.rikhi@gmail.com";
+    github = "prikhi";
+    githubId = 1304102;
+    name = "Pavan Rikhi";
+  };
+  primeos = {
+    email = "dev.primeos@gmail.com";
+    matrix = "@primeos:matrix.org";
+    github = "primeos";
+    githubId = 7537109;
+    name = "Michael Weiss";
+    keys = [
+      {
+        # Git only
+        fingerprint = "86A7 4A55 07D0 58D1 322E  37FD 1308 26A6 C2A3 89FD";
+      }
+      {
+        # Email, etc.
+        fingerprint = "AF85 991C C950 49A2 4205  1933 BCA9 943D D1DF 4C04";
+      }
+    ];
+  };
+  princemachiavelli = {
+    name = "Josh Hoffer";
+    email = "jhoffer@sansorgan.es";
+    matrix = "@princemachiavelli:matrix.org";
+    github = "Princemachiavelli";
+    githubId = 2730968;
+    keys = [{
+      fingerprint = "DD54 130B ABEC B65C 1F6B  2A38 8312 4F97 A318 EA18";
+    }];
+  };
+  p-rintz = {
+    email = "nix@rintz.net";
+    github = "p-rintz";
+    githubId = 13933258;
+    name = "Philipp Rintz";
+    matrix = "@philipp:srv.icu";
+  };
+  prit342 = {
+    email = "prithak342@gmail.com";
+    github = "prit342";
+    githubId = 20863431;
+    name = "Prithak S.";
+  };
+  ProducerMatt = {
+    name = "Matthew Pherigo";
+    email = "ProducerMatt42@gmail.com";
+    github = "ProducerMatt";
+    githubId = 58014742;
+  };
+  Profpatsch = {
+    email = "mail@profpatsch.de";
+    github = "Profpatsch";
+    githubId = 3153638;
+    name = "Profpatsch";
+  };
+  proglodyte = {
+    email = "proglodyte23@gmail.com";
+    github = "proglodyte";
+    githubId = 18549627;
+    name = "Proglodyte";
+  };
+  proglottis = {
+    email = "proglottis@gmail.com";
+    github = "proglottis";
+    githubId = 74465;
+    name = "James Fargher";
+  };
+  progval = {
+    email = "progval+nix@progval.net";
+    github = "progval";
+    githubId = 406946;
+    name = "Valentin Lorentz";
+  };
+  prominentretail = {
+    email = "me@jakepark.me";
+    github = "ProminentRetail";
+    githubId = 94048404;
+    name = "Jake Park";
+  };
+  proofconstruction = {
+    email = "source@proof.construction";
+    github = "proofconstruction";
+    githubId = 74747193;
+    name = "Alexander Groleau";
+  };
+  proofofkeags = {
+    email = "keagan.mcclelland@gmail.com";
+    github = "ProofOfKeags";
+    githubId = 4033651;
+    name = "Keagan McClelland";
+  };
+  protoben = {
+    email = "protob3n@gmail.com";
+    github = "protoben";
+    githubId = 4633847;
+    name = "Ben Hamlin";
+  };
+  prrlvr = {
+    email = "po@prrlvr.fr";
+    github = "prrlvr";
+    githubId = 33699501;
+    name = "Pierre-Olivier Rey";
+    keys = [{
+      fingerprint = "40A0 78FD 297B 0AC1 E6D8  A119 4D38 49D9 9555 1307";
+    }];
+  };
+  prtzl = {
+    email = "matej.blagsic@protonmail.com";
+    github = "prtzl";
+    githubId = 32430344;
+    name = "Matej Blagsic";
+  };
+  prusnak = {
+    email = "pavol@rusnak.io";
+    github = "prusnak";
+    githubId = 42201;
+    name = "Pavol Rusnak";
+    keys = [{
+      fingerprint = "86E6 792F C27B FD47 8860  C110 91F3 B339 B9A0 2A3D";
+    }];
+  };
+  psanford = {
+    email = "psanford@sanford.io";
+    github = "psanford";
+    githubId = 33375;
+    name = "Peter Sanford";
+  };
+  pschmitt = {
+    email = "philipp@schmitt.co";
+    github = "pschmitt";
+    githubId = 37886;
+    name = "Philipp Schmitt";
+    matrix = "@pschmitt:one.ems.host";
+    keys = [{
+      fingerprint = "9FBF 2ABF FB37 F7F3 F502  44E5 DC43 9C47 EACB 17F9";
+    }];
+  };
+  pshirshov = {
+    email = "pshirshov@eml.cc";
+    github = "pshirshov";
+    githubId = 295225;
+    name = "Pavel Shirshov";
+  };
+  psibi = {
+    email = "sibi@psibi.in";
+    matrix = "@psibi:matrix.org";
+    github = "psibi";
+    githubId = 737477;
+    name = "Sibi Prabakaran";
+  };
+  pstn = {
+    email = "philipp@xndr.de";
+    github = "pstn";
+    githubId = 1329940;
+    name = "Philipp Steinpaß";
+  };
+  pSub = {
+    email = "mail@pascal-wittmann.de";
+    github = "pSub";
+    githubId = 83842;
+    name = "Pascal Wittmann";
+  };
+  psyanticy = {
+    email = "iuns@outlook.fr";
+    github = "PsyanticY";
+    githubId = 20524473;
+    name = "Psyanticy";
+  };
+  psydvl = {
+    email = "psydvl@fea.st";
+    github = "psydvl";
+    githubId = 43755002;
+    name = "Dmitriy P";
+  };
+  ptival = {
+    email = "valentin.robert.42@gmail.com";
+    github = "Ptival";
+    githubId = 478606;
+    name = "Valentin Robert";
+  };
+  ptrhlm = {
+    email = "ptrhlm0@gmail.com";
+    github = "ptrhlm";
+    githubId = 9568176;
+    name = "Piotr Halama";
+  };
+  puckipedia = {
+    email = "puck@puckipedia.com";
+    github = "puckipedia";
+    githubId = 488734;
+    name = "Puck Meerburg";
+  };
+  puffnfresh = {
+    email = "brian@brianmckenna.org";
+    github = "puffnfresh";
+    githubId = 37715;
+    name = "Brian McKenna";
+  };
+  pulsation = {
+    name = "Philippe Sam-Long";
+    github = "pulsation";
+    githubId = 1838397;
+  };
+  purcell = {
+    email = "steve@sanityinc.com";
+    github = "purcell";
+    githubId = 5636;
+    name = "Steve Purcell";
+  };
+  putchar = {
+    email = "slim.cadoux@gmail.com";
+    matrix = "@putch4r:matrix.org";
+    github = "putchar";
+    githubId = 8208767;
+    name = "Slim Cadoux";
+  };
+  puzzlewolf = {
+    email = "nixos@nora.pink";
+    github = "puzzlewolf";
+    githubId = 23097564;
+    name = "Nora Widdecke";
+  };
+  pwoelfel = {
+    name = "Philipp Woelfel";
+    email = "philipp.woelfel@gmail.com";
+    github = "PhilippWoelfel";
+    githubId = 19400064;
+  };
+  pyrolagus = {
+    email = "pyrolagus@gmail.com";
+    github = "PyroLagus";
+    githubId = 4579165;
+    name = "Danny Bautista";
+  };
+  pyxels = {
+    email = "pyxels.dev@gmail.com";
+    github = "Pyxels";
+    githubId = 39232833;
+    name = "Jonas";
+  };
+  q3k = {
+    email = "q3k@q3k.org";
+    github = "q3k";
+    githubId = 315234;
+    name = "Serge Bazanski";
+  };
+  qbit = {
+    name = "Aaron Bieber";
+    email = "aaron@bolddaemon.com";
+    github = "qbit";
+    githubId = 68368;
+    matrix = "@qbit:tapenet.org";
+    keys = [{
+      fingerprint = "3586 3350 BFEA C101 DB1A 4AF0 1F81 112D 62A9 ADCE";
+    }];
+  };
+  qdlmcfresh = {
+    name = "Philipp Urlbauer";
+    email = "qdlmcfresh@gmail.com";
+    github = "qdlmcfresh";
+    githubId = 10837173;
+  };
+  qjoly = {
+    email = "github@thoughtless.eu";
+    github = "qjoly";
+    githubId = 82603435;
+    name = "Quentin JOLY";
+  };
+  qknight = {
+    email = "js@lastlog.de";
+    github = "qknight";
+    githubId = 137406;
+    name = "Joachim Schiele";
+  };
+  qoelet = {
+    email = "kenny@machinesung.com";
+    github = "qoelet";
+    githubId = 115877;
+    name = "Kenny Shen";
+  };
+  quadradical = {
+    email = "nixos@henryhiles.com";
+    github = "Henry-Hiles";
+    githubId = 71790868;
+    name = "Henry Hiles";
+  };
+  quag = {
+    email = "quaggy@gmail.com";
+    github = "quag";
+    githubId = 35086;
+    name = "Jonathan Wright";
+  };
+  quantenzitrone = {
+    email = "nix@dev.quantenzitrone.eu";
+    github = "quantenzitrone";
+    githubId = 74491719;
+    matrix = "@quantenzitrone:matrix.org";
+    name = "quantenzitrone";
+  };
+  queezle = {
+    email = "git@queezle.net";
+    github = "queezle42";
+    githubId = 1024891;
+    name = "Jens Nolte";
+  };
+  quentin = {
+    email = "quentin@mit.edu";
+    github = "quentinmit";
+    githubId = 115761;
+    name = "Quentin Smith";
+    keys = [{
+      fingerprint = "1C71 A066 5400 AACD 142E  B1A0 04EE 05A8 FCEF B697";
+    }];
+  };
+  quentini = {
+    email = "quentini@airmail.cc";
+    github = "QuentinI";
+    githubId = 18196237;
+    name = "Quentin Inkling";
+  };
+  quentin-m = {
+    email = "me+nix@quentin-machu.fr";
+    github = "Quentin-M";
+    githubId = 1332289;
+    name = "Quentin Machu";
+  };
+  quinn-dougherty = {
+    email = "quinnd@riseup.net";
+    github = "quinn-dougherty";
+    githubId = 39039420;
+    name = "Quinn Dougherty";
+  };
+  qyliss = {
+    email = "hi@alyssa.is";
+    github = "alyssais";
+    githubId = 2768870;
+    name = "Alyssa Ross";
+    matrix = "@qyliss:fairydust.space";
+    keys = [{
+      fingerprint = "7573 56D7 79BB B888 773E  415E 736C CDF9 EF51 BD97";
+    }];
+  };
+  r3dl3g = {
+    email = "redleg@rothfuss-web.de";
+    github = "r3dl3g";
+    githubId = 35229674;
+    name = "Armin Rothfuss";
+  };
+  raboof = {
+    email = "arnout@bzzt.net";
+    matrix = "@raboof:matrix.org";
+    github = "raboof";
+    githubId = 131856;
+    name = "Arnout Engelen";
+  };
+  raehik = {
+    email = "thefirstmuffinman@gmail.com";
+    github = "raehik";
+    githubId = 3764592;
+    name = "Ben Orchard";
+  };
+  rafael = {
+    name = "Rafael";
+    email = "pr9@tuta.io";
+    github = "rafa-dot-el";
+    githubId = 104688305;
+    keys = [{
+      fingerprint = "5F0B 3EAC F1F9 8155 0946 CDF5 469E 3255 A40D 2AD6";
+    }];
+  };
+  rafaelgg = {
+    email = "rafael.garcia.gallego@gmail.com";
+    github = "rafaelgg";
+    githubId = 1016742;
+    name = "Rafael García";
+  };
+  rafaelrc = {
+    email = "contact@rafaelrc.com";
+    name = "Rafael Carvalho";
+    github = "rafaelrc7";
+    githubId = 5376043;
+  };
+  ragge = {
+    email = "r.dahlen@gmail.com";
+    github = "ragnard";
+    githubId = 882;
+    name = "Ragnar Dahlen";
+  };
+  RaghavSood = {
+    email = "r@raghavsood.com";
+    github = "RaghavSood";
+    githubId = 903072;
+    name = "Raghav Sood";
+  };
+  ragingpastry = {
+    email = "senior.crepe@gmail.com";
+    github = "ragingpastry";
+    githubId = 6778250;
+    name = "Nick Wilburn";
+  };
+  raitobezarius = {
+    email = "ryan@lahfa.xyz";
+    matrix = "@raitobezarius:matrix.org";
+    github = "RaitoBezarius";
+    githubId = 314564;
+    name = "Ryan Lahfa";
+  };
+  rake5k = {
+    email = "christian@harke.ch";
+    github = "rake5k";
+    githubId = 13007345;
+    name = "Christian Harke";
+    keys = [{
+      fingerprint = "4EBB 30F1 E89A 541A A7F2 52BE 830A 9728 6309 66F4";
+    }];
+  };
+  rakesh4g = {
+    email = "rakeshgupta4u@gmail.com";
+    github = "Rakesh4G";
+    githubId = 50867187;
+    name = "Rakesh Gupta";
+  };
+  ralismark = {
+    email = "nixpkgs@ralismark.xyz";
+    github = "ralismark";
+    githubId = 13449732;
+    name = "Temmie";
+  };
+  ralith = {
+    email = "ben.e.saunders@gmail.com";
+    matrix = "@ralith:ralith.com";
+    github = "Ralith";
+    githubId = 104558;
+    name = "Benjamin Saunders";
+  };
+  ramkromberg = {
+    email = "ramkromberg@mail.com";
+    github = "RamKromberg";
+    githubId = 14829269;
+    name = "Ram Kromberg";
+  };
+  rampoina = {
+    email = "rampoina@protonmail.com";
+    matrix = "@rampoina:matrix.org";
+    github = "Rampoina";
+    githubId = 5653911;
+    name = "Rampoina";
+  };
+  ranfdev = {
+    email = "ranfdev@gmail.com";
+    name = "Lorenzo Miglietta";
+    github = "ranfdev";
+    githubId = 23294184;
+  };
+  raphaelr = {
+    email = "raphael-git@tapesoftware.net";
+    matrix = "@raphi:tapesoftware.net";
+    github = "raphaelr";
+    githubId = 121178;
+    name = "Raphael Robatsch";
+  };
+  rapiteanu = {
+    email = "rapiteanu.catalin@gmail.com";
+    github = "Steinhagen";
+    githubId = 4029937;
+    name = "Viorel-Cătălin Răpițeanu";
+  };
+  raquelgb = {
+    email = "raquel.garcia.bautista@gmail.com";
+    github = "raquelgb";
+    githubId = 1246959;
+    name = "Raquel García";
+  };
+  rardiol = {
+    email = "ricardo.ardissone@gmail.com";
+    github = "rardiol";
+    githubId = 11351304;
+    name = "Ricardo Ardissone";
+  };
+  rasendubi = {
+    email = "rasen.dubi@gmail.com";
+    github = "rasendubi";
+    githubId = 1366419;
+    name = "Alexey Shmalko";
+  };
+  raskin = {
+    email = "7c6f434c@mail.ru";
+    github = "7c6f434c";
+    githubId = 1891350;
+    name = "Michael Raskin";
+  };
+  raspher = {
+    email = "raspher@protonmail.com";
+    github = "raspher";
+    githubId = 23345803;
+    name = "Szymon Scholz";
+  };
+  ratcornu = {
+    email = "ratcornu@skaven.org";
+    github = "RatCornu";
+    githubId = 98173832;
+    name = "Balthazar Patiachvili";
+    matrix = "@ratcornu:skweel.skaven.org";
+    keys = [{
+      fingerprint = "1B91 F087 3D06 1319 D3D0  7F91 FA47 BDA2 6048 9ADA";
+    }];
+  };
+  ratsclub = {
+    email = "victor@freire.dev.br";
+    github = "ratsclub";
+    githubId = 25647735;
+    name = "Victor Freire";
+  };
+  rawkode = {
+    email = "david.andrew.mckay@gmail.com";
+    github = "rawkode";
+    githubId = 145816;
+    name = "David McKay";
+  };
+  rayslash = {
+    email = "stevemathewjoy@tutanota.com";
+    github = "rayslash";
+    githubId = 45141270;
+    name = "Steve Mathew Joy";
+  };
+  razvan = {
+    email = "razvan.panda@gmail.com";
+    github = "freeman42x";
+    githubId = 1758708;
+    name = "Răzvan Flavius Panda";
+  };
+  rb = {
+    email = "maintainers@cloudposse.com";
+    github = "nitrocode";
+    githubId = 7775707;
+    name = "RB";
+  };
+  rb2k = {
+    email = "nix@marc-seeger.com";
+    github = "rb2k";
+    githubId = 9519;
+    name = "Marc Seeger";
+  };
+  rbasso = {
+    email = "rbasso@sharpgeeks.net";
+    github = "rbasso";
+    githubId = 16487165;
+    name = "Rafael Basso";
+  };
+  rbreslow = {
+    name = "Rocky Breslow";
+    github = "rbreslow";
+    githubId = 1774125;
+    keys = [{
+      fingerprint = "B5B7 BCA0 EE6F F31E 263A  69E3 A0D3 2ACC A38B 88ED";
+    }];
+  };
+  rbrewer = {
+    email = "rwb123@gmail.com";
+    github = "rbrewer123";
+    githubId = 743058;
+    name = "Rob Brewer";
+  };
+  r-burns = {
+    email = "rtburns@protonmail.com";
+    github = "r-burns";
+    githubId = 52847440;
+    name = "Ryan Burns";
+  };
+  rdnetto = {
+    email = "rdnetto@gmail.com";
+    github = "rdnetto";
+    githubId = 1973389;
+    name = "Reuben D'Netto";
+  };
+  realsnick = {
+    name = "Ido Samuelson";
+    email = "ido.samuelson@gmail.com";
+    github = "realsnick";
+    githubId = 1440852;
+  };
+  reckenrode = {
+    name = "Randy Eckenrode";
+    email = "randy@largeandhighquality.com";
+    matrix = "@reckenrode:matrix.org";
+    github = "reckenrode";
+    githubId = 7413633;
+    keys = [
+      # compare with https://keybase.io/reckenrode
+      {
+        fingerprint = "01D7 5486 3A6D 64EA AC77 0D26 FBF1 9A98 2CCE 0048";
+      }
+    ];
+  };
+  redbaron = {
+    email = "ivanov.maxim@gmail.com";
+    github = "redbaron";
+    githubId = 16624;
+    name = "Maxim Ivanov";
+  };
+  redfish64 = {
+    email = "engler@gmail.com";
+    github = "redfish64";
+    githubId = 1922770;
+    name = "Tim Engler";
+  };
+  redvers = {
+    email = "red@infect.me";
+    github = "redvers";
+    githubId = 816465;
+    name = "Redvers Davies";
+  };
+  redxtech = {
+    email = "gabe@gabedunn.dev";
+    github = "redxtech";
+    githubId = 18155001;
+    name = "Gabe Dunn";
+  };
+  reedrw = {
+    email = "reedrw5601@gmail.com";
+    github = "reedrw";
+    githubId = 21069876;
+    name = "Reed Williams";
+  };
+  refi64 = {
+    name = "Ryan Gonzalez";
+    email = "git@refi64.dev";
+    matrix = "@refi64:linuxcafe.chat";
+    github = "refi64";
+    githubId = 1690697;
+  };
+  refnil = {
+    email = "broemartino@gmail.com";
+    github = "refnil";
+    githubId = 1142322;
+    name = "Martin Lavoie";
+  };
+  regadas = {
+    email = "oss@regadas.email";
+    name = "Filipe Regadas";
+    github = "regadas";
+    githubId = 163899;
+  };
+  regnat = {
+    email = "regnat@regnat.ovh";
+    github = "thufschmitt";
+    githubId = 7226587;
+    name = "Théophane Hufschmitt";
+  };
+  rehno-lindeque = {
+    email = "rehno.lindeque+code@gmail.com";
+    github = "rehno-lindeque";
+    githubId = 337811;
+    name = "Rehno Lindeque";
+  };
+  relrod = {
+    email = "ricky@elrod.me";
+    github = "relrod";
+    githubId = 43930;
+    name = "Ricky Elrod";
+  };
+  rembo10 = {
+    github = "rembo10";
+    githubId = 801525;
+    name = "rembo10";
+  };
+  remexre = {
+    email = "nathan+nixpkgs@remexre.com";
+    github = "remexre";
+    githubId = 4196789;
+    name = "Nathan Ringo";
+  };
+  renatoGarcia = {
+    email = "fgarcia.renato@gmail.com";
+    github = "renatoGarcia";
+    githubId = 220211;
+    name = "Renato Garcia";
+  };
+  renesat = {
+    name = "Ivan Smolyakov";
+    email = "smol.ivan97@gmail.com";
+    github = "renesat";
+    githubId = 11363539;
+  };
+  renzo = {
+    email = "renzocarbonara@gmail.com";
+    github = "k0001";
+    githubId = 3302;
+    name = "Renzo Carbonara";
+  };
+  rettetdemdativ = {
+    email = "michael@koeppl.dev";
+    github = "rettetdemdativ";
+    githubId = 5265630;
+    name = "Michael Köppl";
+  };
+  revol-xut = {
+    email = "revol-xut@protonmail.com";
+    name = "Tassilo Tanneberger";
+    github = "tanneberger";
+    githubId = 32239737;
+    keys = [{
+      fingerprint = "91EB E870 1639 1323 642A  6803 B966 009D 57E6 9CC6";
+    }];
+  };
+  rewine = {
+    email = "lhongxu@outlook.com";
+    github = "wineee";
+    githubId = 22803888;
+    name = "Lu Hongxu";
+  };
+  rexim = {
+    email = "reximkut@gmail.com";
+    github = "rexim";
+    githubId = 165283;
+    name = "Alexey Kutepov";
+  };
+  rexxDigital = {
+    email = "joellarssonpriv@gmail.com";
+    github = "rexxDigital";
+    githubId = 44014925;
+    name = "Rexx Larsson";
+  };
+  RGBCube = {
+    name = "RGBCube";
+    email = "nixpkgs@rgbcu.be";
+    github = "RGBCube";
+    githubId = 78925721;
+    keys = [{
+      fingerprint = "jPaU3Vpm/GN0tUuDg72n2+bd9dDMWe4bnKM325eP7eI";
+    }];
+  };
+  rgnns = {
+    email = "jglievano@gmail.com";
+    github = "rgnns";
+    githubId = 811827;
+    name = "Gabriel Lievano";
+  };
+  rgri = {
+    name = "shortcut";
+    github = "rgri";
+    githubId = 45253749;
+  };
+  rgrinberg = {
+    name = "Rudi Grinberg";
+    email = "me@rgrinberg.com";
+    github = "rgrinberg";
+    githubId = 139003;
+  };
+  rgrunbla = {
+    email = "remy@grunblatt.org";
+    github = "rgrunbla";
+    githubId = 42433779;
+    name = "Rémy Grünblatt";
+  };
+  rguevara84 = {
+    email = "fuzztkd@gmail.com";
+    github = "rguevara84";
+    githubId = 12279531;
+    name = "Ricardo Guevara";
+  };
+  rhendric = {
+    name = "Ryan Hendrickson";
+    github = "rhendric";
+    githubId = 1570964;
+  };
+  rhoriguchi = {
+    email = "ryan.horiguchi@gmail.com";
+    github = "rhoriguchi";
+    githubId = 6047658;
+    name = "Ryan Horiguchi";
+  };
+  rht = {
+    email = "rhtbot@protonmail.com";
+    github = "rht";
+    githubId = 395821;
+    name = "rht";
+  };
+  rhysmdnz = {
+    email = "rhys@memes.nz";
+    matrix = "@rhys:memes.nz";
+    github = "rhysmdnz";
+    githubId = 2162021;
+    name = "Rhys Davies";
+  };
+  ribose-jeffreylau = {
+    name = "Jeffrey Lau";
+    email = "jeffrey.lau@ribose.com";
+    github = "ribose-jeffreylau";
+    githubId = 2649467;
+  };
+  ricarch97 = {
+    email = "ricardo.steijn97@gmail.com";
+    github = "RicArch97";
+    githubId = 61013287;
+    name = "Ricardo Steijn";
+  };
+  richardipsum = {
+    email = "richardipsum@fastmail.co.uk";
+    github = "richardipsum";
+    githubId = 10631029;
+    name = "Richard Ipsum";
+  };
+  rick68 = {
+    email = "rick68@gmail.com";
+    github = "rick68";
+    githubId = 42619;
+    name = "Wei-Ming Yang";
+  };
+  rickvanprim = {
+    email = "me@rickvanprim.com";
+    github = "rickvanprim";
+    githubId = 13792812;
+    name = "James Leitch";
+  };
+  rickynils = {
+    email = "rickynils@gmail.com";
+    github = "rickynils";
+    githubId = 16779;
+    name = "Rickard Nilsson";
+  };
+  ricochet = {
+    email = "behayes2@gmail.com";
+    github = "ricochet";
+    githubId = 974323;
+    matrix = "@ricochetcode:matrix.org";
+    name = "Bailey Hayes";
+  };
+  riey = {
+    email = "creeper844@gmail.com";
+    github = "Riey";
+    githubId = 14910534;
+    name = "Riey";
+  };
+  rika = {
+    email = "rika@paymentswit.ch";
+    github = "ScarletHg";
+    githubId = 1810487;
+    name = "Rika";
+  };
+  rileyinman = {
+    email = "rileyminman@gmail.com";
+    github = "rileyinman";
+    githubId = 37246692;
+    name = "Riley Inman";
+  };
+  riotbib = {
+    email = "lennart@cope.cool";
+    github = "riotbib";
+    githubId = 43172581;
+    name = "Lennart Mühlenmeier";
+  };
+  ris = {
+    email = "code@humanleg.org.uk";
+    github = "risicle";
+    githubId = 807447;
+    name = "Robert Scott";
+  };
+  risson = {
+    name = "Marc Schmitt";
+    email = "marc.schmitt@risson.space";
+    matrix = "@risson:lama-corp.space";
+    github = "rissson";
+    githubId = 18313093;
+    keys = [
+      {
+        fingerprint = "8A0E 6A7C 08AB B9DE 67DE  2A13 F6FD 87B1 5C26 3EC9";
+      }
+      {
+        fingerprint = "C0A7 A9BB 115B C857 4D75  EA99 BBB7 A680 1DF1 E03F";
+      }
+    ];
+  };
+  rixed = {
+    email = "rixed-github@happyleptic.org";
+    github = "rixed";
+    githubId = 449990;
+    name = "Cedric Cellier";
+  };
+  rizary = {
+    email = "andika@numtide.com";
+    github = "Rizary";
+    githubId = 7221768;
+    name = "Andika Demas Riyandi";
+  };
+  rjpcasalino = {
+    email = "ryan@rjpc.net";
+    github = "rjpcasalino";
+    githubId = 12821230;
+    name = "Ryan J.P. Casalino";
+  };
+  rkitover = {
+    email = "rkitover@gmail.com";
+    github = "rkitover";
+    githubId = 77611;
+    name = "Rafael Kitover";
+  };
+  rkoe = {
+    email = "rk@simple-is-better.org";
+    github = "rkoe";
+    githubId = 2507744;
+    name = "Roland Koebler";
+  };
+  rkrzr = {
+    email = "ops+nixpkgs@channable.com";
+    github = "rkrzr";
+    githubId = 82817;
+    name = "Robert Kreuzer";
+  };
+  rlupton20 = {
+    email = "richard.lupton@gmail.com";
+    github = "rlupton20";
+    githubId = 13752145;
+    name = "Richard Lupton";
+  };
+  rmcgibbo = {
+    email = "rmcgibbo@gmail.com";
+    matrix = "@rmcgibbo:matrix.org";
+    github = "rmcgibbo";
+    githubId = 641278;
+    name = "Robert T. McGibbon";
+  };
+  rnhmjoj = {
+    email = "rnhmjoj@inventati.org";
+    matrix = "@rnhmjoj:maxwell.ydns.eu";
+    github = "rnhmjoj";
+    githubId = 2817565;
+    name = "Michele Guerini Rocco";
+    keys = [{
+      fingerprint = "92B2 904F D293 C94D C4C9  3E6B BFBA F4C9 75F7 6450";
+    }];
+  };
+  roastiek = {
+    email = "r.dee.b.b@gmail.com";
+    github = "roastiek";
+    githubId = 422802;
+    name = "Rostislav Beneš";
+  };
+  rob = {
+    email = "rob.vermaas@gmail.com";
+    github = "rbvermaa";
+    githubId = 353885;
+    name = "Rob Vermaas";
+  };
+  robaca = {
+    email = "carsten@r0hrbach.de";
+    github = "robaca";
+    githubId = 580474;
+    name = "Carsten Rohrbach";
+  };
+  robberer = {
+    email = "robberer@freakmail.de";
+    github = "robberer";
+    githubId = 6204883;
+    name = "Longrin Wischnewski";
+  };
+  robbinch = {
+    email = "robbinch33@gmail.com";
+    github = "robbinch";
+    githubId = 12312980;
+    name = "Robbin C.";
+  };
+  robbins = {
+    email = "nejrobbins@gmail.com";
+    github = "robbins";
+    githubId = 31457698;
+    name = "Nathanael Robbins";
+  };
+  roberth = {
+    email = "nixpkgs@roberthensing.nl";
+    matrix = "@roberthensing:matrix.org";
+    github = "roberth";
+    githubId = 496447;
+    name = "Robert Hensing";
+  };
+  robertodr = {
+    email = "roberto.diremigio@gmail.com";
+    github = "robertodr";
+    githubId = 3708689;
+    name = "Roberto Di Remigio";
+  };
+  robertoszek = {
+    email = "robertoszek@robertoszek.xyz";
+    github = "robertoszek";
+    githubId = 1080963;
+    name = "Roberto";
+  };
+  robgssp = {
+    email = "robgssp@gmail.com";
+    github = "robgssp";
+    githubId = 521306;
+    name = "Rob Glossop";
+  };
+  roblabla = {
+    email = "robinlambertz+dev@gmail.com";
+    github = "roblabla";
+    githubId = 1069318;
+    name = "Robin Lambertz";
+  };
+  robwalt = {
+    email = "robwalter96@gmail.com";
+    github = "robwalt";
+    githubId = 26892280;
+    name = "Robert Walter";
+  };
+  roconnor = {
+    email = "roconnor@r6.ca";
+    github = "roconnor";
+    githubId = 852967;
+    name = "Russell O'Connor";
+  };
+  rodrgz = {
+    email = "erik@rodgz.com";
+    github = "rodrgz";
+    githubId = 53882428;
+    name = "Erik Rodriguez";
+  };
+  roelvandijk = {
+    email = "roel@lambdacube.nl";
+    github = "roelvandijk";
+    githubId = 710906;
+    name = "Roel van Dijk";
+  };
+  rogarb = {
+    email = "rogarb@rgarbage.fr";
+    github = "rogarb";
+    githubId = 69053978;
+    name = "rogarb";
+  };
+  rollf = {
+    email = "rolf.schroeder@limbus-medtec.com";
+    github = "rollf";
+    githubId = 58295931;
+    name = "Rolf Schröder";
+  };
+  roman = {
+    email = "open-source@roman-gonzalez.info";
+    github = "roman";
+    githubId = 7335;
+    name = "Roman Gonzalez";
+  };
+  romildo = {
+    email = "malaquias@gmail.com";
+    github = "romildo";
+    githubId = 1217934;
+    name = "José Romildo Malaquias";
+  };
+  ronanmacf = {
+    email = "macfhlar@tcd.ie";
+    github = "RonanMacF";
+    githubId = 25930627;
+    name = "Ronan Mac Fhlannchadha";
+  };
+  rongcuid = {
+    email = "rongcuid@outlook.com";
+    github = "rongcuid";
+    githubId = 1312525;
+    name = "Rongcui Dong";
+  };
+  roosemberth = {
+    email = "roosembert.palacios+nixpkgs@posteo.ch";
+    matrix = "@roosemberth:orbstheorem.ch";
+    github = "roosemberth";
+    githubId = 3621083;
+    name = "Roosembert (Roosemberth) Palacios";
+    keys = [{
+      fingerprint = "78D9 1871 D059 663B 6117  7532 CAAA ECE5 C224 2BB7";
+    }];
+  };
+  rople380 = {
+    name = "rople380";
+    github = "rople380";
+    githubId = 55679162;
+    keys = [{
+      fingerprint = "1401 1B63 393D 16C1 AA9C  C521 8526 B757 4A53 6236";
+    }];
+  };
+  rossabaker = {
+    name = "Ross A. Baker";
+    email = "ross@rossabaker.com";
+    github = "rossabaker";
+    githubId = 142698;
+  };
+  RossComputerGuy = {
+    name = "Tristan Ross";
+    email = "tristan.ross@midstall.com";
+    github = "RossComputerGuy";
+    githubId = 19699320;
+  };
+  rotaerk = {
+    name = "Matthew Stewart";
+    email = "m.scott.stewart@gmail.com";
+    github = "rotaerk";
+    githubId = 17690823;
+  };
+  rowanG077 = {
+    email = "goemansrowan@gmail.com";
+    github = "rowanG077";
+    githubId = 7439756;
+    name = "Rowan Goemans";
+  };
+  royneary = {
+    email = "christian@ulrich.earth";
+    github = "royneary";
+    githubId = 1942810;
+    name = "Christian Ulrich";
+  };
+  rpearce = {
+    email = "me@robertwpearce.com";
+    github = "rpearce";
+    githubId = 592876;
+    name = "Robert W. Pearce";
+  };
+  rprecenth = {
+    email = "rasmus@precenth.eu";
+    github = "Prillan";
+    githubId = 1675190;
+    name = "Rasmus Précenth";
+  };
+  rprospero = {
+    email = "rprospero+nix@gmail.com";
+    github = "rprospero";
+    githubId = 1728853;
+    name = "Adam Washington";
+  };
+  rps = {
+    email = "robbpseaton@gmail.com";
+    github = "robertseaton";
+    githubId = 221121;
+    name = "Robert P. Seaton";
+  };
+  rraval = {
+    email = "ronuk.raval@gmail.com";
+    github = "rraval";
+    githubId = 373566;
+    name = "Ronuk Raval";
+  };
+  rrbutani = {
+    email = "rrbutani+nix@gmail.com";
+    github = "rrbutani";
+    githubId = 7833358;
+    matrix = "@rbutani:matrix.org";
+    keys = [{
+      fingerprint = "7DCA 5615 8AB2 621F 2F32  9FF4 1C7C E491 479F A273";
+    }];
+    name = "Rahul Butani";
+  };
+  rski = {
+    name = "rski";
+    email = "rom.skiad+nix@gmail.com";
+    github = "rski";
+    githubId = 2960312;
+  };
+  rsynnest = {
+    email = "contact@rsynnest.com";
+    github = "rsynnest";
+    githubId = 4392850;
+    name = "Roland Synnestvedt";
+  };
+  rszibele = {
+    email = "richard@szibele.com";
+    github = "rszibele";
+    githubId = 1387224;
+    name = "Richard Szibele";
+  };
+  rtburns-jpl = {
+    email = "rtburns@jpl.nasa.gov";
+    github = "rtburns-jpl";
+    githubId = 47790121;
+    name = "Ryan Burns";
+  };
+  rtimush = {
+    email = "rtimush@gmail.com";
+    github = "rtimush";
+    githubId = 831307;
+    name = "Roman Timushev";
+  };
+  rtreffer = {
+    email = "treffer+nixos@measite.de";
+    github = "rtreffer";
+    githubId = 61306;
+    name = "Rene Treffer";
+  };
+  ruby0b = {
+    github = "ruby0b";
+    githubId = 106119328;
+    name = "ruby0b";
+  };
+  rubyowo = {
+    name = "Rei Star";
+    email = "perhaps-you-know@what-is.ml";
+    github = "rubyowo";
+    githubId = 105302757;
+  };
+  rucadi = {
+    email = "ruben.canodiaz@gmail.com";
+    github = "rucadi";
+    githubId = 6445619;
+    name = "Ruben Cano Diaz";
+  };
+  rudolfvesely = {
+    name = "Rudolf Vesely";
+    email = "i@rudolfvesely.com";
+    github = "rudolfvesely";
+    githubId = 13966949;
+  };
+  Ruixi-rebirth = {
+    name = "Ruixi-rebirth";
+    email = "ruixirebirth@gmail.com";
+    github = "Ruixi-rebirth";
+    githubId = 75824585;
+  };
+  rumpelsepp = {
+    name = "Stefan Tatschner";
+    email = "stefan@rumpelsepp.org";
+    github = "rumpelsepp";
+    githubId = 1961699;
+  };
+  running-grass = {
+    name = "Leo Liu";
+    email = "hi@grass.show";
+    github = "running-grass";
+    githubId = 17241154;
+    keys = [{
+      fingerprint = "5156 0FAB FF32 83EC BC8C  EA13 9344 3660 9397 0138";
+    }];
+  };
+  rushmorem = {
+    email = "rushmore@webenchanter.com";
+    github = "rushmorem";
+    githubId = 4958190;
+    name = "Rushmore Mushambi";
+  };
+  russell = {
+    email = "russell.sim@gmail.com";
+    github = "russell";
+    githubId = 2660;
+    name = "Russell Sim";
+  };
+  ruuda = {
+    email = "dev+nix@veniogames.com";
+    github = "ruuda";
+    githubId = 506953;
+    name = "Ruud van Asseldonk";
+  };
+  rvarago = {
+    email = "rafael.varago@gmail.com";
+    github = "rvarago";
+    githubId = 7365864;
+    name = "Rafael Varago";
+  };
+  rvdp = {
+    email = "ramses@well-founded.dev";
+    github = "R-VdP";
+    githubId = 141248;
+    name = "Ramses";
+  };
+  rvl = {
+    email = "dev+nix@rodney.id.au";
+    github = "rvl";
+    githubId = 1019641;
+    name = "Rodney Lorrimar";
+  };
+  rvlander = {
+    email = "rvlander@gaetanandre.eu";
+    github = "rvlander";
+    githubId = 5236428;
+    name = "Gaëtan André";
+  };
+  rvnstn = {
+    email = "github@rvnstn.de";
+    github = "rvnstn";
+    githubId = 2364742;
+    name = "Tobias Ravenstein";
+  };
+  rvolosatovs = {
+    email = "rvolosatovs@riseup.net";
+    github = "rvolosatovs";
+    githubId = 12877905;
+    name = "Roman Volosatovs";
+  };
+  rxiao = {
+    email = "ben.xiao@me.com";
+    github = "benxiao";
+    githubId = 10908495;
+    name = "Ran Xiao";
+  };
+  ryanartecona = {
+    email = "ryanartecona@gmail.com";
+    github = "ryanartecona";
+    githubId = 889991;
+    name = "Ryan Artecona";
+  };
+  ryanccn = {
+    email = "hello@ryanccn.dev";
+    github = "ryanccn";
+    githubId = 70191398;
+    name = "Ryan Cao";
+  };
+  ryane = {
+    email = "ryanesc@gmail.com";
+    github = "ryane";
+    githubId = 7346;
+    name = "Ryan Eschinger";
+    keys = [{
+      fingerprint = "E4F4 1EAB BF0F C785 06D8  62EF EF68 CF41 D42A 593D";
+    }];
+  };
+  ryangibb = {
+    email = "ryan@freumh.org";
+    github = "ryangibb";
+    githubId = 22669046;
+    name = "Ryan Gibb";
+  };
+  ryanorendorff = {
+    github = "ryanorendorff";
+    githubId = 12442942;
+    name = "Ryan Orendorff";
+  };
+  ryansydnor = {
+    email = "ryan.t.sydnor@gmail.com";
+    github = "ryansydnor";
+    githubId = 1832096;
+    name = "Ryan Sydnor";
+  };
+  ryantm = {
+    email = "ryan@ryantm.com";
+    matrix = "@ryantm:matrix.org";
+    github = "ryantm";
+    githubId = 4804;
+    name = "Ryan Mulligan";
+  };
+  ryantrinkle = {
+    email = "ryan.trinkle@gmail.com";
+    github = "ryantrinkle";
+    githubId = 1156448;
+    name = "Ryan Trinkle";
+  };
+  rybern = {
+    email = "ryan.bernstein@columbia.edu";
+    github = "rybern";
+    githubId = 4982341;
+    name = "Ryan Bernstein";
+  };
+  rycee = {
+    email = "robert@rycee.net";
+    github = "rycee";
+    githubId = 798147;
+    name = "Robert Helgesson";
+    keys = [{
+      fingerprint = "36CA CF52 D098 CC0E 78FB  0CB1 3573 356C 25C4 24D4";
+    }];
+  };
+  ryneeverett = {
+    email = "ryneeverett@gmail.com";
+    github = "ryneeverett";
+    githubId = 3280280;
+    name = "Ryne Everett";
+  };
+  ryota-ka = {
+    email = "ok@ryota-ka.me";
+    github = "ryota-ka";
+    githubId = 7309170;
+    name = "Ryota Kameoka";
+  };
+  rytone = {
+    email = "max@ryt.one";
+    github = "rastertail";
+    githubId = 8082305;
+    name = "Maxwell Beck";
+    keys = [{
+      fingerprint = "D260 79E3 C2BC 2E43 905B  D057 BB3E FA30 3760 A0DB";
+    }];
+  };
+  rzetterberg = {
+    email = "richard.zetterberg@gmail.com";
+    github = "rzetterberg";
+    githubId = 766350;
+    name = "Richard Zetterberg";
+  };
+  s1341 = {
+    email = "s1341@shmarya.net";
+    matrix = "@s1341:matrix.org";
+    name = "Shmarya Rubenstein";
+    github = "s1341";
+    githubId = 5682183;
+  };
+  sagikazarmark = {
+    name = "Mark Sagi-Kazar";
+    email = "mark.sagikazar@gmail.com";
+    matrix = "@mark.sagikazar:matrix.org";
+    github = "sagikazarmark";
+    githubId = 1226384;
+    keys = [{
+      fingerprint = "E628 C811 6FB8 1657 F706  4EA4 F251 ADDC 9D04 1C7E";
+    }];
+  };
+  samalws = {
+    email = "sam@samalws.com";
+    name = "Sam Alws";
+    github = "samalws";
+    githubId = 20981725;
+  };
+  samb96 = {
+    email = "samb96@gmail.com";
+    github = "samb96";
+    githubId = 819426;
+    name = "Sam Bickley";
+  };
+  samdoshi = {
+    email = "sam@metal-fish.co.uk";
+    github = "samdoshi";
+    githubId = 112490;
+    name = "Sam Doshi";
+  };
+  samdroid-apps = {
+    email = "sam@sam.today";
+    github = "samdroid-apps";
+    githubId = 6022042;
+    name = "Sam Parkinson";
+  };
+  samhug = {
+    email = "s@m-h.ug";
+    github = "samhug";
+    githubId = 171470;
+    name = "Sam Hug";
+  };
+  SamirTalwar = {
+    email = "lazy.git@functional.computer";
+    github = "SamirTalwar";
+    githubId = 47582;
+    name = "Samir Talwar";
+  };
+  samlich = {
+    email = "nixos@samli.ch";
+    github = "samlich";
+    githubId = 1349989;
+    name = "samlich";
+    keys = [{
+      fingerprint = "AE8C 0836 FDF6 3FFC 9580  C588 B156 8953 B193 9F1C";
+    }];
+  };
+  samlukeyes123 = {
+    email = "samlukeyes123@gmail.com";
+    github = "SamLukeYes";
+    githubId = 12882091;
+    name = "Sam L. Yes";
+  };
+  samrose = {
+    email = "samuel.rose@gmail.com";
+    github = "samrose";
+    githubId = 115821;
+    name = "Sam Rose";
+  };
+  samuela = {
+    email = "skainsworth@gmail.com";
+    github = "samuela";
+    githubId = 226872;
+    name = "Samuel Ainsworth";
+  };
+  samueldr = {
+    email = "samuel@dionne-riel.com";
+    matrix = "@samueldr:matrix.org";
+    github = "samueldr";
+    githubId = 132835;
+    name = "Samuel Dionne-Riel";
+  };
+  samuel-martineau = {
+    name = "Samuel Martineau";
+    email = "samuel@smartineau.me";
+    github = "Samuel-Martineau";
+    githubId = 44237969;
+    keys = [{
+      fingerprint = "79A1 CC17 67C7 32B6 A8A2  BF4F 71E0 8761 642D ACD2";
+    }];
+  };
+  samuelrivas = {
+    email = "samuelrivas@gmail.com";
+    github = "samuelrivas";
+    githubId = 107703;
+    name = "Samuel Rivas";
+  };
+  samueltardieu = {
+    email = "nixpkgs@sam.rfc1149.net";
+    github = "samueltardieu";
+    githubId = 44656;
+    name = "Samuel Tardieu";
+  };
+  samw = {
+    email = "sam@wlcx.cc";
+    github = "wlcx";
+    githubId = 3065381;
+    name = "Sam Willcocks";
+  };
+  samyak = {
+    name = "Samyak Sarnayak";
+    email = "samyak201@gmail.com";
+    github = "Samyak2";
+    githubId = 34161949;
+    keys = [{
+      fingerprint = "155C F413 0129 C058 9A5F  5524 3658 73F2 F0C6 153B";
+    }];
+  };
+  sander = {
+    email = "s.vanderburg@tudelft.nl";
+    github = "svanderburg";
+    githubId = 1153271;
+    name = "Sander van der Burg";
+  };
+  sarcasticadmin = {
+    email = "rob@sarcasticadmin.com";
+    github = "sarcasticadmin";
+    githubId = 30531572;
+    name = "Robert James Hernandez";
+  };
+  sargon = {
+    email = "danielehlers@mindeye.net";
+    github = "sargon";
+    githubId = 178904;
+    name = "Daniel Ehlers";
+  };
+  saschagrunert = {
+    email = "mail@saschagrunert.de";
+    github = "saschagrunert";
+    githubId = 695473;
+    name = "Sascha Grunert";
+  };
+  saulecabrera = {
+    name = "Saúl Cabrera";
+    email = "saulecabrera@gmail.com";
+    github = "saulecabrera";
+    githubId = 1423601;
+  };
+  sauyon = {
+    email = "s@uyon.co";
+    github = "sauyon";
+    githubId = 2347889;
+    name = "Sauyon Lee";
+  };
+  savannidgerinel = {
+    email = "savanni@luminescent-dreams.com";
+    github = "savannidgerinel";
+    githubId = 8534888;
+    name = "Savanni D'Gerinel";
+  };
+  savyajha = {
+    email = "savya.jha@hawkradius.com";
+    github = "savyajha";
+    githubId = 3996019;
+    name = "Savyasachee Jha";
+  };
+  sayanarijit = {
+    email = "sayanarijit@gmail.com";
+    github = "sayanarijit";
+    githubId = 11632726;
+    name = "Arijit Basu";
+  };
+  sb0 = {
+    email = "sb@m-labs.hk";
+    github = "sbourdeauducq";
+    githubId = 720864;
+    name = "Sébastien Bourdeauducq";
+  };
+  sbellem = {
+    email = "sbellem@gmail.com";
+    github = "sbellem";
+    githubId = 125458;
+    name = "Sylvain Bellemare";
+  };
+  sbond75 = {
+    name = "sbond75";
+    github = "sbond75";
+    githubId = 43617712;
+  };
+  sboosali = {
+    email = "SamBoosalis@gmail.com";
+    github = "sboosali";
+    githubId = 2320433;
+    name = "Sam Boosalis";
+  };
+  sbruder = {
+    email = "nixos@sbruder.de";
+    github = "sbruder";
+    githubId = 15986681;
+    name = "Simon Bruder";
+  };
+  scalavision = {
+    email = "scalavision@gmail.com";
+    github = "scalavision";
+    githubId = 3958212;
+    name = "Tom Sorlie";
+  };
+  schinmai-akamai = {
+    email = "schinmai@akamai.com";
+    github = "schinmai-akamai";
+    githubId = 70169773;
+    name = "Tarun Chinmai Sekar";
+  };
+  schmitthenner = {
+    email = "development@schmitthenner.eu";
+    github = "fkz";
+    githubId = 354463;
+    name = "Fabian Schmitthenner";
+  };
+  schmittlauch = {
+    name = "Trolli Schmittlauch";
+    email = "t.schmittlauch+nixos@orlives.de";
+    github = "schmittlauch";
+    githubId = 1479555;
+  };
+  schneefux = {
+    email = "schneefux+nixos_pkg@schneefux.xyz";
+    github = "schneefux";
+    githubId = 15379000;
+    name = "schneefux";
+  };
+  schnusch = {
+    github = "schnusch";
+    githubId = 5104601;
+    name = "schnusch";
+  };
+  Schweber = {
+    github = "Schweber";
+    githubId = 64630479;
+    name = "Schweber";
+  };
+  sciencentistguy = {
+    email = "jamie@quigley.xyz";
+    name = "Jamie Quigley";
+    github = "Sciencentistguy";
+    githubId = 4983935;
+    keys = [{
+      fingerprint = "30BB FF3F AB0B BB3E 0435  F83C 8E8F F66E 2AE8 D970";
+    }];
+  };
+  scm2342 = {
+    name = "Sven Mattsen";
+    email = "nix@sven.cc";
+    matrix = "@scm:matrix.sven.cc";
+    github = "scm2342";
+    githubId = 154108;
+  };
+  scode = {
+    email = "peter.schuller@infidyne.com";
+    github = "scode";
+    githubId = 59476;
+    name = "Peter Schuller";
+  };
+  scoder12 = {
+    name = "Spencer Pogorzelski";
+    github = "Scoder12";
+    githubId = 34356756;
+  };
+  scolobb = {
+    email = "sivanov@colimite.fr";
+    github = "scolobb";
+    githubId = 11320;
+    name = "Sergiu Ivanov";
+  };
+  screendriver = {
+    email = "nix@echooff.de";
+    github = "screendriver";
+    githubId = 149248;
+    name = "Christian Rackerseder";
+  };
+  Scriptkiddi = {
+    email = "nixos@scriptkiddi.de";
+    matrix = "@fritz.otlinghaus:helsinki-systems.de";
+    github = "Scriptkiddi";
+    githubId = 3598650;
+    name = "Fritz Otlinghaus";
+  };
+  Scrumplex = {
+    name = "Sefa Eyeoglu";
+    email = "contact@scrumplex.net";
+    matrix = "@Scrumplex:duckhub.io";
+    github = "Scrumplex";
+    githubId = 11587657;
+    keys = [{
+      fingerprint = "E173 237A C782 296D 98F5  ADAC E13D FD4B 4712 7951";
+    }];
+  };
+  sdier = {
+    email = "scott@dier.name";
+    matrix = "@sdier:matrix.org";
+    github = "sdier";
+    githubId = 11613056;
+    name = "Scott Dier";
+  };
+  SeanZicari = {
+    email = "sean.zicari@gmail.com";
+    github = "SeanZicari";
+    githubId = 2343853;
+    name = "Sean Zicari";
+  };
+  seb314 = {
+    email = "sebastian@seb314.com";
+    github = "seb314";
+    githubId = 19472270;
+    name = "Sebastian";
+  };
+  sebastianblunt = {
+    name = "Sebastian Blunt";
+    email = "nix@sebastianblunt.com";
+    github = "sebastianblunt";
+    githubId = 47431204;
+  };
+  sebbadk = {
+    email = "sebastian@sebba.dk";
+    github = "SEbbaDK";
+    githubId = 1567527;
+    name = "Sebastian Hyberts";
+  };
+  sebbel = {
+    email = "hej@sebastian-ball.de";
+    github = "sebbel";
+    githubId = 1940568;
+    name = "Sebastian Ball";
+  };
+  seberm = {
+    email = "seberm@seberm.com";
+    github = "seberm";
+    githubId = 212597;
+    name = "Otto Sabart";
+    keys = [{
+      fingerprint = "0AF6 4C3B 1F12 14B3 8C8C  5786 1FA2 DBE6 7438 7CC3";
+    }];
+  };
+  sebtm = {
+    email = "mail@sebastian-sellmeier.de";
+    github = "SebTM";
+    githubId = 17243347;
+    name = "Sebastian Sellmeier";
+  };
+  sefidel = {
+    name = "sefidel";
+    email = "contact@sefidel.net";
+    matrix = "@sef:exotic.sh";
+    github = "sefidel";
+    githubId = 71049646;
+    keys = [{
+      fingerprint = "8BDF DFB5 6842 2393 82A0  441B 9238 BC70 9E05 516A";
+    }];
+  };
+  sei40kr = {
+    name = "Seong Yong-ju";
+    email = "sei40kr@gmail.com";
+    github = "sei40kr";
+    githubId = 11665236;
+  };
+  seirl = {
+    name = "Antoine Pietri";
+    email = "antoine.pietri1@gmail.com";
+    github = "seirl";
+    githubId = 4927883;
+    matrix = "@seirl:matrix.org";
+  };
+  selfuryon = {
+    name = "Sergei Iakovlev";
+    email = "siakovlev@pm.me";
+    github = "selfuryon";
+    githubId = 2993917;
+  };
+  sellout = {
+    email = "greg@technomadic.org";
+    github = "sellout";
+    githubId = 33031;
+    name = "Greg Pfeil";
+  };
+  sengaya = {
+    email = "tlo@sengaya.de";
+    github = "sengaya";
+    githubId = 1286668;
+    name = "Thilo Uttendorfer";
+  };
+  sents = {
+    email = "finn@krein.moe";
+    github = "sents";
+    githubId = 26575793;
+    matrix = "@sents:matrix.org";
+    name = "Finn Krein";
+  };
+  sephalon = {
+    email = "me@sephalon.net";
+    github = "sephalon";
+    githubId = 893474;
+    name = "Stefan Wiehler";
+  };
+  sephi = {
+    name = "Sylvain Fankhauser";
+    email = "sephi@fhtagn.top";
+    github = "sephii";
+    githubId = 754333;
+    keys = [{
+      fingerprint = "2A9D 8E76 5EE2 237D 7B6B  A2A5 4228 AB9E C061 2ADA";
+    }];
+  };
+  sepi = {
+    email = "raffael@mancini.lu";
+    github = "sepi";
+    githubId = 529649;
+    name = "Raffael Mancini";
+  };
+  seppeljordan = {
+    email = "sebastian.jordan.mail@googlemail.com";
+    github = "seppeljordan";
+    githubId = 4805746;
+    name = "Sebastian Jordan";
+  };
+  septem9er = {
+  name = "Septem9er";
+  email = "develop@septem9er.de";
+  matrix = "@septem9er:fairydust.space";
+  github = "septem9er";
+  githubId = 33379902;
+  keys = [{
+    fingerprint = "C408 07F9 8677 3D98 EFF3 0980 355A 9AFB FD8E AD33";
+  }];
+};
+  seqizz = {
+    email = "seqizz@gmail.com";
+    github = "seqizz";
+    githubId = 307899;
+    name = "Gurkan Gur";
+  };
+  serge = {
+    email = "sb@canva.com";
+    github = "serge-belov";
+    githubId = 38824235;
+    name = "Serge Belov";
+  };
+  serge_sans_paille = {
+    email = "serge.guelton@telecom-bretagne.eu";
+    github = "serge-sans-paille";
+    githubId = 863807;
+    name = "Serge Guelton";
+  };
+  sersorrel = {
+    email = "ash@sorrel.sh";
+    github = "sersorrel";
+    githubId = 9433472;
+    name = "ash";
+  };
+  servalcatty = {
+    email = "servalcat@pm.me";
+    github = "servalcatty";
+    githubId = 51969817;
+    name = "Serval";
+    keys = [{
+      fingerprint = "A317 37B3 693C 921B 480C  C629 4A2A AAA3 82F8 294C";
+    }];
+  };
+  sestrella = {
+    email = "sestrella.me@gmail.com";
+    github = "sestrella";
+    githubId = 2049686;
+    name = "Sebastián Estrella";
+  };
+  seylerius = {
+    name = "Sable Seyler";
+    email = "sable@seyleri.us";
+    github = "seylerius";
+    githubId = 1145981;
+    keys = [{
+      fingerprint = "7246 B6E1 ABB9 9A48 4395  FD11 DC26 B921 A9E9 DBDE";
+    }];
+  };
+  sfrijters = {
+    email = "sfrijters@gmail.com";
+    github = "SFrijters";
+    githubId = 918365;
+    name = "Stefan Frijters";
+  };
+  sgo = {
+    email = "stig@stig.io";
+    github = "stigtsp";
+    githubId = 75371;
+    name = "Stig Palmquist";
+  };
+  sg-qwt = {
+    email = "hello@edgerunners.eu.org";
+    matrix = "@dhl:edgerunners.eu.org";
+    github = "sg-qwt";
+    name = "sg-qwt";
+    githubId = 115715554;
+  };
+  sgraf = {
+    email = "sgraf1337@gmail.com";
+    github = "sgraf812";
+    githubId = 1151264;
+    name = "Sebastian Graf";
+  };
+  shadaj = {
+    github = "shadaj";
+    githubId = 543055;
+    name = "Shadaj Laddad";
+  };
+  shaddydc = {
+    email = "nixpkgs@shaddy.dev";
+    github = "ShaddyDC";
+    githubId = 18403034;
+    name = "Shaddy";
+  };
+  shadowrz = {
+    email = "shadowrz+nixpkgs@disroot.org";
+    matrix = "@ShadowRZ:matrixim.cc";
+    github = "ShadowRZ";
+    githubId = 23130178;
+    name = "夜坂雅";
+  };
+  shahrukh330 = {
+    email = "shahrukh330@gmail.com";
+    github = "shahrukh330";
+    githubId = 1588288;
+    name = "Shahrukh Khan";
+  };
+  shamilton = {
+    email = "sgn.hamilton@protonmail.com";
+    github = "SCOTT-HAMILTON";
+    githubId = 24496705;
+    name = "Scott Hamilton";
+  };
+  ShamrockLee = {
+    email = "shamrocklee@posteo.net";
+    github = "ShamrockLee";
+    githubId = 44064051;
+    matrix = "@shamrocklee:matrix.org";
+    name = "Yueh-Shun Li";
+  };
+  shanesveller = {
+    email = "shane@sveller.dev";
+    github = "shanesveller";
+    githubId = 831;
+    keys = [{
+      fingerprint = "F83C 407C ADC4 5A0F 1F2F  44E8 9210 C218 023C 15CD";
+    }];
+    name = "Shane Sveller";
+  };
+  shard7 = {
+    email = "sh7user@gmail.com";
+    github = "shard77";
+    githubId = 106669955;
+    name = "Léon Gessner";
+  };
+  shardy = {
+    email = "shardul@baral.ca";
+    github = "shardulbee";
+    githubId = 16765155;
+    name = "Shardul Baral";
+  };
+  sharzy = {
+    email = "me@sharzy.in";
+    github = "SharzyL";
+    githubId = 46294732;
+    name = "Sharzy";
+  };
+  shawn8901 = {
+    email = "shawn8901@googlemail.com";
+    github = "Shawn8901";
+    githubId = 12239057;
+    name = "Shawn8901";
+  };
+  shawndellysse = {
+    email = "sdellysse@gmail.com";
+    github = "sdellysse";
+    githubId = 293035;
+    name = "Shawn Dellysse";
+  };
+  shayne = {
+    email = "shaynesweeney@gmail.com";
+    github = "shayne";
+    githubId = 79330;
+    name = "Shayne Sweeney";
+    keys = [{
+      fingerprint = "AFCB 29A0 F12E F367 9575  DABE 69DA 13E8 6BF4 03B0";
+    }];
+  };
+  shazow = {
+    email = "andrey.petrov@shazow.net";
+    github = "shazow";
+    githubId = 6292;
+    name = "Andrey Petrov";
+  };
+  sheenobu = {
+    email = "sheena.artrip@gmail.com";
+    github = "sheenobu";
+    githubId = 1443459;
+    name = "Sheena Artrip";
+  };
+  sheepforce = {
+    email = "phillip.seeber@googlemail.com";
+    github = "sheepforce";
+    githubId = 16844216;
+    name = "Phillip Seeber";
+  };
+  sheganinans = {
+    email = "sheganinans@gmail.com";
+    github = "sheganinans";
+    githubId = 2146203;
+    name = "Aistis Raulinaitis";
+  };
+  shell = {
+    email = "cam.turn@gmail.com";
+    github = "VShell";
+    githubId = 251028;
+    name = "Shell Turner";
+  };
+  shhht = {
+    name = "shhht";
+    email = "stp.tjeerd@gmail.com";
+    github = "shhht";
+    githubId = 118352823;
+  };
+  shikanime = {
+    name = "William Phetsinorath";
+    email = "deva.shikanime@protonmail.com";
+    github = "shikanime";
+    githubId = 22115108;
+  };
+  shiryel = {
+    email = "contact@shiryel.com";
+    name = "Shiryel";
+    github = "shiryel";
+    githubId = 35617139;
+    keys = [{
+      fingerprint = "AB63 4CD9 3322 BD42 6231  F764 C404 1EA6 B326 33DE";
+    }];
+  };
+  shivaraj-bh = {
+    email = "sbh69840@gmail.com";
+    name = "Shivaraj B H";
+    github = "shivaraj-bh";
+    githubId = 23645788;
+  };
+  shlevy = {
+    email = "shea@shealevy.com";
+    github = "shlevy";
+    githubId = 487050;
+    name = "Shea Levy";
+  };
+  shlok = {
+    email = "sd-nix-maintainer@quant.is";
+    github = "shlok";
+    githubId = 3000933;
+    name = "Shlok Datye";
+  };
+  shmish111 = {
+    email = "shmish111@gmail.com";
+    github = "shmish111";
+    githubId = 934267;
+    name = "David Smith";
+  };
+  shnarazk = {
+    email = "shujinarazaki@protonmail.com";
+    github = "shnarazk";
+    githubId = 997855;
+    name = "Narazaki Shuji";
+  };
+  shofius = {
+    name = "Sam Hofius";
+    email = "sam@samhofi.us";
+    github = "kf5grd";
+    githubId = 18297490;
+  };
+  shortcord = {
+    name = "Short Cord";
+    email = "short@shortcord.com";
+    github = "shortcord";
+    githubId = 3823744;
+  };
+  shou = {
+    email = "x+g@shou.io";
+    github = "Shou";
+    githubId = 819413;
+    name = "Benedict Aas";
+  };
+  shreerammodi = {
+    name = "Shreeram Modi";
+    email = "shreerammodi10@gmail.com";
+    github = "shrimpram";
+    githubId = 67710369;
+    keys = [{
+      fingerprint = "EA88 EA07 26E9 6CBF 6365  3966 163B 16EE 76ED 24CE";
+    }];
+  };
+  shyim = {
+    email = "s.sayakci@gmail.com";
+    github = "shyim";
+    githubId = 6224096;
+    name = "Soner Sayakci";
+  };
+  shymega = {
+    name = "Dom Rodriguez";
+    github = "shymega";
+    githubId = 1334592;
+  };
+  siddarthkay = {
+    email = "siddarthkay@gmail.com";
+    github = "siddarthkay";
+    githubId = 64726664;
+    name = "Siddarth Kumar";
+  };
+  siddharthdhakane = {
+    email = "siddharthdhakane@gmail.com";
+    github = "siddharthdhakane";
+    githubId = 28101092;
+    name = "Siddharth Dhakane";
+  };
+  siddharthist = {
+    email = "langston.barrett@gmail.com";
+    github = "langston-barrett";
+    githubId = 4294323;
+    name = "Langston Barrett";
+  };
+  sielicki = {
+    name = "Nicholas Sielicki";
+    email = "nix@opensource.nslick.com";
+    github = "sielicki";
+    githubId = 4522995;
+    matrix = "@sielicki:matrix.org";
+  };
+  siers = {
+    email = "veinbahs+nixpkgs@gmail.com";
+    github = "siers";
+    githubId = 235147;
+    name = "Raitis Veinbahs";
+  };
+  sifmelcara = {
+    email = "ming@culpring.com";
+    github = "sifmelcara";
+    githubId = 10496191;
+    name = "Ming Chuan";
+  };
+  sigma = {
+    email = "yann.hodique@gmail.com";
+    github = "sigma";
+    githubId = 16090;
+    name = "Yann Hodique";
+  };
+  sigmanificient = {
+    email = "sigmanificient@gmail.com";
+    github = "Sigmanificient";
+    githubId = 53050011;
+    name = "Yohann Boniface";
+  };
+  sikmir = {
+    email = "sikmir@disroot.org";
+    github = "sikmir";
+    githubId = 688044;
+    name = "Nikolay Korotkiy";
+    keys = [{
+      fingerprint = "ADF4 C13D 0E36 1240 BD01  9B51 D1DE 6D7F 6936 63A5";
+    }];
+  };
+  Silver-Golden = {
+    name = "Brendan Golden";
+    email = "github+nixpkgs@brendan.ie";
+    github = "Silver-Golden";
+    githubId = 7858375;
+  };
+  simarra = {
+    name = "simarra";
+    email = "loic.martel@protonmail.com";
+    github = "Simarra";
+    githubId = 14372987;
+  };
+  simonchatts = {
+    email = "code@chatts.net";
+    github = "simonchatts";
+    githubId = 11135311;
+    name = "Simon Chatterjee";
+  };
+  simoneruffini = {
+    email = "simone.ruffini@tutanota.com";
+    github = "simoneruffini";
+    githubId = 50401154;
+    name = "Simone Ruffini";
+  };
+  simonhammes = {
+    github = "simonhammes";
+    githubId = 10352679;
+    name = "Simon Hammes";
+  };
+  simonkampe = {
+    email = "simon.kampe+nix@gmail.com";
+    github = "simonkampe";
+    githubId = 254799;
+    name = "Simon Kämpe";
+  };
+  simonvandel = {
+    email = "simon.vandel@gmail.com";
+    github = "simonvandel";
+    githubId = 2770647;
+    name = "Simon Vandel Sillesen";
+  };
+  sinanmohd = {
+    name = "Sinan Mohd";
+    email = "sinan@firemail.cc";
+    matrix = "@sinan:sinanmohd.com";
+    github = "sinanmohd";
+    githubId = 69694713;
+  };
+  sioodmy = {
+    name = "Antoni Sokołowski";
+    github = "sioodmy";
+    githubId = 81568712;
+  };
+  siph = {
+    name = "Chris Dawkins";
+    email = "dawkins.chris.dev@gmail.com";
+    github = "siph";
+    githubId = 6619112;
+  };
+  sir4ur0n = {
+    github = "sir4ur0n";
+    githubId = 1204125;
+    name = "sir4ur0n";
+  };
+  siraben = {
+    email = "bensiraphob@gmail.com";
+    matrix = "@siraben:matrix.org";
+    github = "siraben";
+    githubId = 8219659;
+    name = "Siraphob Phipathananunth";
+  };
+  siriobalmelli = {
+    email = "sirio@b-ad.ch";
+    github = "siriobalmelli";
+    githubId = 23038812;
+    name = "Sirio Balmelli";
+    keys = [{
+      fingerprint = "B234 EFD4 2B42 FE81 EE4D  7627 F72C 4A88 7F9A 24CA";
+    }];
+  };
+  sironheart = {
+    email = "git@beisenherz.dev";
+    github = "Sironheart";
+    githubId = 13799656;
+    name = "Steffen Beisenherz";
+  };
+  sirseruju = {
+    email = "sir.seruju@yandex.ru";
+    github = "SirSeruju";
+    githubId = 74881555;
+    name = "Fofanov Sergey";
+  };
+  sitaaax = {
+    email = "johannes@kle1n.com";
+    github = "SitAAAx";
+    githubId = 74413170;
+    name = "Johannes Klein";
+  };
+  sivteck = {
+    email = "sivaram1992@gmail.com";
+    github = "sivteck";
+    githubId = 8017899;
+    name = "Sivaram Balakrishnan";
+  };
+  sixstring982 = {
+    email = "sixstring982@gmail.com";
+    github = "sixstring982";
+    githubId = 1328977;
+    name = "Trent Small";
+  };
+  sjagoe = {
+    email = "simon@simonjagoe.com";
+    github = "sjagoe";
+    githubId = 80012;
+    name = "Simon Jagoe";
+  };
+  sjau = {
+    email = "nixos@sjau.ch";
+    github = "sjau";
+    githubId = 848812;
+    name = "Stephan Jau";
+  };
+  sjfloat = {
+    email = "steve+nixpkgs@jonescape.com";
+    github = "sjfloat";
+    githubId = 216167;
+    name = "Steve Jones";
+  };
+  sjmackenzie = {
+    email = "setori88@gmail.com";
+    github = "sjmackenzie";
+    githubId = 158321;
+    name = "Stewart Mackenzie";
+  };
+  skovati = {
+    github = "skovati";
+    githubId = 49844593;
+    name = "skovati";
+  };
+  skykanin = {
+    github = "skykanin";
+    githubId = 3789764;
+    name = "skykanin";
+  };
+  skyrina = {
+    email = "sorryu02@gmail.com";
+    github = "skyrina";
+    githubId = 116099351;
+    name = "Skylar";
+  };
+  slam-bert = {
+    github = "slam-bert";
+    githubId = 106779009;
+    name = "Slambert";
+  };
+  slbtty = {
+    email = "shenlebantongying@gmail.com";
+    github = "shenlebantongying";
+    githubId = 20123683;
+    name = "Shenleban Tongying";
+  };
+  sleexyz = {
+    email = "freshdried@gmail.com";
+    github = "sleexyz";
+    githubId = 1505617;
+    name = "Sean Lee";
+  };
+  SlothOfAnarchy = {
+    email = "slothofanarchy1@gmail.com";
+    matrix = "@michel.weitbrecht:helsinki-systems.de";
+    github = "SlothOfAnarchy";
+    githubId = 12828415;
+    name = "Michel Weitbrecht";
+  };
+  slwst = {
+    email = "email@slw.st";
+    github = "slwst";
+    githubId = 11047377;
+    name = "slwst";
+    keys = [{
+      fingerprint = "6CEB 4A2F E6DC C345 1B2B  4733 AD52 C5FB 3EFE CC7A";
+    }];
+  };
+  smakarov = {
+    email = "setser200018@gmail.com";
+    github = "SeTSeR";
+    githubId = 12733495;
+    name = "Sergey Makarov";
+    keys = [{
+      fingerprint = "6F8A 18AE 4101 103F 3C54  24B9 6AA2 3A11 93B7 064B";
+    }];
+  };
+  smancill = {
+    email = "smancill@smancill.dev";
+    github = "smancill";
+    githubId = 238528;
+    name = "Sebastián Mancilla";
+  };
+  smaret = {
+    email = "sebastien.maret@icloud.com";
+    github = "smaret";
+    githubId = 95471;
+    name = "Sébastien Maret";
+    keys = [{
+      fingerprint = "4242 834C D401 86EF 8281  4093 86E3 0E5A 0F5F C59C";
+    }];
+  };
+  smasher164 = {
+    email = "aindurti@gmail.com";
+    github = "smasher164";
+    githubId = 12636891;
+    name = "Akhil Indurti";
+  };
+  smironov = {
+    email = "grrwlf@gmail.com";
+    github = "grwlf";
+    githubId = 4477729;
+    name = "Sergey Mironov";
+  };
+  smitop = {
+    name = "Smitty van Bodegom";
+    email = "me@smitop.com";
+    matrix = "@smitop:kde.org";
+    github = "syvb";
+    githubId = 10530973;
+  };
+  smona = {
+    name = "Mel Bourgeois";
+    email = "mason.bourgeois@gmail.com";
+    github = "Smona";
+    githubId = 7091399;
+    keys = [{
+      fingerprint = "897E 6BE3 0345 B43D CADD  05B7 290F CF08 1AED B3EC";
+    }];
+  };
+  smrehman = {
+    name = "Syed Moiz Ur Rehman";
+    email = "smrehman@proton.me";
+    github = "syedmoizurrehman";
+    githubId = 17818950;
+  };
+  sna = {
+    email = "abouzahra.9@wright.edu";
+    github = "S-NA";
+    githubId = 20214715;
+    name = "S. Nordin Abouzahra";
+  };
+  snaar = {
+    email = "snaar@snaar.net";
+    github = "snaar";
+    githubId = 602439;
+    name = "Serguei Narojnyi";
+  };
+  snapdgn = {
+    email = "snapdgn@proton.me";
+    name = "Nitish Kumar";
+    github = "snapdgn";
+    githubId = 85608760;
+  };
+  snglth = {
+    email = "illia@ishestakov.com";
+    github = "snglth";
+    githubId = 8686360;
+    name = "Illia Shestakov";
+  };
+  snicket2100 = {
+    github = "snicket2100";
+    githubId = 57048005;
+    name = "snicket2100";
+  };
+  sno2wman = {
+    name = "SnO2WMaN";
+    email = "me@sno2wman.net";
+    github = "SnO2WMaN";
+    githubId = 15155608;
+  };
+  snowflake = {
+    email = "snowflake@pissmail.com";
+    name = "Snowflake";
+    github = "snf1k";
+    githubId = 149651684;
+    matrix = "@snowflake:mozilla.org";
+    keys = [{
+      fingerprint = "8223 7B6F 2FF4 8F16 B652  6CA3 934F 9E5F 9701 2C0B";
+    }];
+  };
+  snpschaaf = {
+    email = "philipe.schaaf@secunet.com";
+    name = "Philippe Schaaf";
+    github = "snpschaaf";
+    githubId = 105843013;
+  };
+  snyh = {
+    email = "snyh@snyh.org";
+    github = "snyh";
+    githubId = 1437166;
+    name = "Xia Bin";
+  };
+  sochotnicky = {
+    email = "stanislav+github@ochotnicky.com";
+    github = "sochotnicky";
+    githubId = 55726;
+    name = "Stanislav Ochotnický";
+  };
+  softinio = {
+    email = "code@softinio.com";
+    github = "softinio";
+    githubId = 3371635;
+    name = "Salar Rahmanian";
+  };
+  sohalt = {
+    email = "nixos@sohalt.net";
+    github = "Sohalt";
+    githubId = 2157287;
+    name = "sohalt";
+  };
+  SohamG = {
+    email = "sohamg2@gmail.com";
+    name = "Soham S Gumaste";
+    github = "SohamG";
+    githubId = 7116239;
+    keys = [{
+      fingerprint = "E067 520F 5EF2 C175 3F60  50C0 BA46 725F 6A26 7442";
+    }];
+  };
+  soispha = {
+    name = "Soispha";
+    email = "soispha@vhack.eu";
+    matrix = "@soispha:vhack.eu";
+    github = "soispha";
+    githubId = 132207423;
+    keys = [{
+      fingerprint = "9606 FC74 9FCE 1636 0723  D4AD A5E9 4010 C3A6 42AD";
+    }];
+  };
+  solson = {
+    email = "scott@solson.me";
+    matrix = "@solson:matrix.org";
+    github = "solson";
+    githubId = 26806;
+    name = "Scott Olson";
+  };
+  somasis = {
+    email = "kylie@somas.is";
+    github = "somasis";
+    githubId = 264788;
+    name = "Kylie McClain";
+  };
+  SomeoneSerge = {
+    email = "sergei.kozlukov@aalto.fi";
+    matrix = "@ss:someonex.net";
+    github = "SomeoneSerge";
+    githubId = 9720532;
+    name = "Sergei K";
+  };
+  sontek = {
+    email = "sontek@gmail.com";
+    github = "sontek";
+    githubId = 151924;
+    name = "John Anderson";
+  };
+  soopyc = {
+    name = "Cassie Cheung";
+    email = "me@soopy.moe";
+    github = "soopyc";
+    githubId = 13762043;
+    matrix = "@sophie:nue.soopy.moe";
+  };
+  sophrosyne = {
+    email = "joshuaortiz@tutanota.com";
+    github = "sophrosyne97";
+    githubId = 53029739;
+    name = "Joshua Ortiz";
+  };
+  Sorixelle = {
+    email = "ruby+nixpkgs@srxl.me";
+    matrix = "@ruby:isincredibly.gay";
+    name = "Ruby Iris Juric";
+    github = "Sorixelle";
+    githubId = 38685302;
+    keys = [{
+      fingerprint = "2D76 76C7 A28E 16FC 75C7  268D 1B55 6ED8 4B0E 303A";
+    }];
+  };
+  sorki = {
+    email = "srk@48.io";
+    github = "sorki";
+    githubId = 115308;
+    name = "Richard Marko";
+  };
+  sorpaas = {
+    email = "hi@that.world";
+    github = "sorpaas";
+    githubId = 6277322;
+    name = "Wei Tang";
+  };
+  soupglasses = {
+    email = "sofi+git@mailbox.org";
+    github = "soupglasses";
+    githubId = 20756843;
+    name = "Sofi";
+  };
+  soywod = {
+    name = "Clément DOUIN";
+    email = "clement.douin@posteo.net";
+    matrix = "@soywod:matrix.org";
+    github = "soywod";
+    githubId = 10437171;
+    keys = [{
+      fingerprint = "75F0 AB7C FE01 D077 AEE6  CAFD 353E 4A18 EE0F AB72";
+    }];
+  };
+  spacefault = {
+    github = "spacefault";
+    githubId = 74156492;
+    name = "spacefault";
+  };
+  spacefrogg = {
+    email = "spacefrogg-nixos@meterriblecrew.net";
+    github = "spacefrogg";
+    githubId = 167881;
+    name = "Michael Raitza";
+  };
+  spacekookie = {
+    email = "kookie@spacekookie.de";
+    github = "spacekookie";
+    githubId = 7669898;
+    name = "Katharina Fey";
+  };
+  spalf = {
+    email = "tom@tombarrett.xyz";
+    name = "tom barrett";
+    github = "70m6";
+    githubId = 105207964;
+  };
+  spease = {
+    email = "peasteven@gmail.com";
+    github = "spease";
+    githubId = 2825204;
+    name = "Steven Pease";
+  };
+  spectre256 = {
+    name = "Ellis Gibbons";
+    email = "egibbons256@gmail.com";
+    github = "spectre256";
+    githubId = 72505298;
+  };
+  spencerjanssen = {
+    email = "spencerjanssen@gmail.com";
+    matrix = "@sjanssen:matrix.org";
+    github = "spencerjanssen";
+    githubId = 2600039;
+    name = "Spencer Janssen";
+  };
+  spikespaz = {
+    name = "Jacob Birkett";
+    email = "support@birkett.dev";
+    github = "spikespaz";
+    githubId = 12502988;
+  };
+  spinus = {
+    email = "tomasz.czyz@gmail.com";
+    github = "spinus";
+    githubId = 950799;
+    name = "Tomasz Czyż";
+  };
+  sprock = {
+    email = "rmason@mun.ca";
+    github = "sprock";
+    githubId = 6391601;
+    name = "Roger Mason";
+  };
+  sputn1ck = {
+    email = "kon@kon.ninja";
+    github = "sputn1ck";
+    githubId = 8904314;
+    name = "Konstantin Nick";
+  };
+  squalus = {
+    email = "squalus@squalus.net";
+    github = "squalus";
+    githubId = 36899624;
+    name = "squalus";
+  };
+  squarepear = {
+    email = "contact@jeffreyharmon.dev";
+    github = "SquarePear";
+    githubId = 16364318;
+    name = "Jeffrey Harmon";
+  };
+  srapenne = {
+    email = "solene@perso.pw";
+    github = "rapenne-s";
+    githubId = 248016;
+    name = "Solène Rapenne";
+  };
+  srghma = {
+    email = "srghma@gmail.com";
+    github = "srghma";
+    githubId = 7573215;
+    name = "Sergei Khoma";
+  };
+  srgom = {
+    github = "SRGOM";
+    githubId = 8103619;
+    name = "SRGOM";
+  };
+  srhb = {
+    email = "sbrofeldt@gmail.com";
+    matrix = "@srhb:matrix.org";
+    github = "srhb";
+    githubId = 219362;
+    name = "Sarah Brofeldt";
+  };
+  srid = {
+    email = "srid@srid.ca";
+    matrix = "@srid:matrix.org";
+    github = "srid";
+    githubId = 3998;
+    name = "Sridhar Ratnakumar";
+  };
+  srounce = {
+    name = "Samuel Rounce";
+    email = "me@samuelrounce.co.uk";
+    github = "srounce";
+    githubId = 60792;
+  };
+  SShrike = {
+    email = "severen@shrike.me";
+    github = "severen";
+    githubId = 4061736;
+    name = "Severen Redwood";
+  };
+  sstef = {
+    email = "stephane@nix.frozenid.net";
+    github = "haskelious";
+    githubId = 8668915;
+    name = "Stephane Schitter";
+  };
+  staccato = {
+    name = "staccato";
+    email = "moveq@riseup.net";
+    github = "braaandon";
+    githubId = 86573128;
+  };
+  stackshadow = {
+    email = "stackshadow@evilbrain.de";
+    github = "stackshadow";
+    githubId = 7512804;
+    name = "Martin Langlotz";
+  };
+  starcraft66 = {
+    name = "Tristan Gosselin-Hane";
+    email = "starcraft66@gmail.com";
+    github = "starcraft66";
+    githubId = 1858154;
+    keys = [{
+      fingerprint = "8597 4506 EC69 5392 0443  0805 9D98 CDAC FF04 FD78";
+    }];
+  };
+  stargate01 = {
+    email = "christoph.honal@web.de";
+    github = "StarGate01";
+    githubId = 6362238;
+    name = "Christoph Honal";
+  };
+  star-szr = {
+    email = "nixpkgs@szr.fastmail.com";
+    github = "star-szr";
+    githubId = 327943;
+    name = "Scott Zhu Reeves";
+  };
+  starzation = {
+    email = "nixpkgs@starzation.net";
+    github = "starzation";
+    githubId = 145975416;
+    name = "Starzation";
+  };
+  stasjok = {
+    name = "Stanislav Asunkin";
+    email = "nixpkgs@stasjok.ru";
+    github = "stasjok";
+    githubId = 1353637;
+  };
+  steamwalker = {
+    email = "steamwalker@xs4all.nl";
+    github = "steamwalker";
+    githubId = 94006354;
+    name = "steamwalker";
+  };
+  steell = {
+    email = "steve@steellworks.com";
+    github = "Steell";
+    githubId = 1699155;
+    name = "Steve Elliott";
+  };
+  stefanfehrenbach = {
+    email = "stefan.fehrenbach@gmail.com";
+    github = "fehrenbach";
+    githubId = 203168;
+    name = "Stefan Fehrenbach";
+  };
+  stehessel = {
+    email = "stephan@stehessel.de";
+    github = "stehessel";
+    githubId = 55607356;
+    name = "Stephan Heßelmann";
+  };
+  steinybot = {
+    name = "Jason Pickens";
+    email = "jasonpickensnz@gmail.com";
+    matrix = "@steinybot:matrix.org";
+    github = "steinybot";
+    githubId = 4659562;
+    keys = [{
+      fingerprint = "2709 1DEC CC42 4635 4299  569C 21DE 1CAE 5976 2A0F";
+    }];
+  };
+  stelcodes = {
+    email = "stel@stel.codes";
+    github = "stelcodes";
+    githubId = 22163194;
+    name = "Stel Abrego";
+  };
+  stepbrobd = {
+    name = "Yifei Sun";
+    email = "ysun@hey.com";
+    github = "stepbrobd";
+    githubId = 81826728;
+    keys = [{
+      fingerprint = "AC7C 52E6 BA2F E8DE 8F0F  5D78 D973 170F 9B86 DB70";
+    }];
+  };
+  stephank = {
+    email = "nix@stephank.nl";
+    matrix = "@skochen:matrix.org";
+    github = "stephank";
+    githubId = 89950;
+    name = "Stéphan Kochen";
+  };
+  stephenmw = {
+    email = "stephen@q5comm.com";
+    github = "stephenmw";
+    githubId = 231788;
+    name = "Stephen Weinberg";
+  };
+  stephenwithph = {
+    name = "StephenWithPH";
+    github = "StephenWithPH";
+    githubId = 2990492;
+  };
+  sterfield = {
+    email = "sterfield@gmail.com";
+    github = "sterfield";
+    githubId = 5747061;
+    name = "Guillaume Loetscher";
+  };
+  sternenseemann = {
+    email = "sternenseemann@systemli.org";
+    github = "sternenseemann";
+    githubId = 3154475;
+    name = "Lukas Epple";
+  };
+  steshaw = {
+    name = "Steven Shaw";
+    email = "steven@steshaw.org";
+    github = "steshaw";
+    githubId = 45735;
+    keys = [{
+      fingerprint = "0AFE 77F7 474D 1596 EE55  7A29 1D9A 17DF D23D CB91";
+    }];
+  };
+  stesie = {
+    email = "stesie@brokenpipe.de";
+    github = "stesie";
+    githubId = 113068;
+    name = "Stefan Siegl";
+  };
+  stevebob = {
+    email = "stephen@sherra.tt";
+    github = "gridbugs";
+    githubId = 417118;
+    name = "Stephen Sherratt";
+  };
+  steve-chavez = {
+    email = "stevechavezast@gmail.com";
+    github = "steve-chavez";
+    githubId = 1829294;
+    name = "Steve Chávez";
+  };
+  steveej = {
+    email = "mail@stefanjunker.de";
+    github = "steveeJ";
+    githubId = 1181362;
+    name = "Stefan Junker";
+  };
+  stevenroose = {
+    email = "github@stevenroose.org";
+    github = "stevenroose";
+    githubId = 853468;
+    name = "Steven Roose";
+  };
+  stianlagstad = {
+    email = "stianlagstad@gmail.com";
+    github = "stianlagstad";
+    githubId = 4340859;
+    name = "Stian Lågstad";
+  };
+  StijnDW = {
+    email = "nixdev@rinsa.eu";
+    github = "Stekke";
+    githubId = 1751956;
+    name = "Stijn DW";
+  };
+  StillerHarpo = {
+    email = "engelflorian@posteo.de";
+    github = "StillerHarpo";
+    githubId = 25526706;
+    name = "Florian Engel";
+    keys = [{ fingerprint = "4E2D9B26940E0DABF376B7AF76762421D45837DE"; }];
+    matrix = "@qe7ftcyrpg:matrix.org";
+  };
+  stites = {
+    email = "sam@stites.io";
+    github = "stites";
+    githubId = 1694705;
+    name = "Sam Stites";
+  };
+  stnley = {
+    email = "michael@stnley.io";
+    github = "stnley";
+    githubId = 64174376;
+    name = "Michael Stanley";
+  };
+  strager = {
+    email = "strager.nds@gmail.com";
+    github = "strager";
+    githubId = 48666;
+    name = "Matthew \"strager\" Glazar";
+  };
+  strikerlulu = {
+    email = "strikerlulu7@gmail.com";
+    github = "strikerlulu";
+    githubId = 38893265;
+    name = "StrikerLulu";
+  };
+  struan = {
+    email = "contact@struanrobertson.co.uk";
+    github = "struan-robertson";
+    githubId = 7543617;
+    name = "Struan Robertson";
+  };
+  stteague = {
+    email = "stteague505@yahoo.com";
+    github = "stteague";
+    githubId = 77596767;
+    name = "Scott Teague";
+  };
+  stumoss = {
+    email = "samoss@gmail.com";
+    github = "stumoss";
+    githubId = 638763;
+    name = "Stuart Moss";
+  };
+  stunkymonkey = {
+    email = "account@buehler.rocks";
+    github = "Stunkymonkey";
+    githubId = 1315818;
+    name = "Felix Bühler";
+  };
+  stupremee = {
+    email = "jutus.k@protonmail.com";
+    github = "Stupremee";
+    githubId = 39732259;
+    name = "Justus K";
+  };
+  SubhrajyotiSen = {
+    email = "subhrajyoti12@gmail.com";
+    github = "SubhrajyotiSen";
+    githubId = 12984845;
+    name = "Subhrajyoti Sen";
+  };
+  sudosubin = {
+    email = "sudosubin@gmail.com";
+    github = "sudosubin";
+    githubId = 32478597;
+    name = "Subin Kim";
+  };
+  suhr = {
+    email = "suhr@i2pmail.org";
+    github = "suhr";
+    githubId = 65870;
+    name = "Сухарик";
+  };
+  sumnerevans = {
+    email = "me@sumnerevans.com";
+    github = "sumnerevans";
+    githubId = 16734772;
+    name = "Sumner Evans";
+  };
+  sund3RRR = {
+    email = "evenquantity@gmail.com";
+    github = "sund3RRR";
+    githubId = 73298492;
+    name = "Mikhail Kiselev";
+  };
+  suominen = {
+    email = "kimmo@suominen.com";
+    github = "suominen";
+    githubId = 1939855;
+    name = "Kimmo Suominen";
+  };
+  superbo = {
+    email = "supernbo@gmail.com";
+    github = "SuperBo";
+    githubId = 2666479;
+    name = "Y Nguyen";
+  };
+  superherointj = {
+    email = "sergiomarcelo@yandex.com";
+    github = "superherointj";
+    githubId = 5861043;
+    matrix = "@superherointj:matrix.org";
+    name = "Sérgio Marcelo";
+  };
+  SuperSandro2000 = {
+    email = "sandro.jaeckel@gmail.com";
+    matrix = "@sandro:supersandro.de";
+    github = "SuperSandro2000";
+    githubId = 7258858;
+    name = "Sandro Jäckel";
+  };
+  SuprDewd = {
+    email = "suprdewd@gmail.com";
+    github = "SuprDewd";
+    githubId = 187109;
+    name = "Bjarki Ágúst Guðmundsson";
+  };
+  surfaceflinger = {
+    email = "nat@nekopon.pl";
+    github = "surfaceflinger";
+    githubId = 44725111;
+    name = "nat";
+  };
+  suryasr007 = {
+    email = "94suryateja@gmail.com";
+    github = "suryasr007";
+    githubId = 10533926;
+    name = "Surya Teja V";
+  };
+  suvash = {
+    email = "suvash+nixpkgs@gmail.com";
+    github = "suvash";
+    githubId = 144952;
+    name = "Suvash Thapaliya";
+  };
+  sveitser = {
+    email = "sveitser@gmail.com";
+    github = "sveitser";
+    githubId = 1040871;
+    name = "Mathis Antony";
+  };
+  svend = {
+    email = "svend@svends.net";
+    github = "svend";
+    githubId = 306190;
+    name = "Svend Sorensen";
+  };
+  sven-of-cord = {
+    email = "sven@cord.com";
+    github = "sven-of-cord";
+    githubId = 98333944;
+    name = "Sven Over";
+  };
+  svrana = {
+    email = "shaw@vranix.com";
+    github = "svrana";
+    githubId = 850665;
+    name = "Shaw Vrana";
+  };
+  svsdep = {
+    email = "svsdep@gmail.com";
+    github = "svsdep";
+    githubId = 36695359;
+    name = "Vasyl Solovei";
+  };
+  swarren83 = {
+    email = "shawn.w.warren@gmail.com";
+    github = "swarren83";
+    githubId = 4572854;
+    name = "Shawn Warren";
+  };
+  swdunlop = {
+    email = "swdunlop@gmail.com";
+    github = "swdunlop";
+    githubId = 120188;
+    name = "Scott W. Dunlop";
+  };
+  sweber = {
+    email = "sweber2342+nixpkgs@gmail.com";
+    github = "sweber83";
+    githubId = 19905904;
+    name = "Simon Weber";
+  };
+  sweenu = {
+    name = "sweenu";
+    email = "contact@sweenu.xyz";
+    github = "sweenu";
+    githubId = 7051978;
+  };
+  swesterfeld = {
+    email = "stefan@space.twc.de";
+    github = "swesterfeld";
+    githubId = 14840066;
+    name = "Stefan Westerfeld";
+  };
+  swflint = {
+    email = "swflint@flintfam.org";
+    github = "swflint";
+    githubId = 1771109;
+    name = "Samuel W. Flint";
+  };
+  swistak35 = {
+    email = "me@swistak35.com";
+    github = "swistak35";
+    githubId = 332289;
+    name = "Rafał Łasocha";
+  };
+  syberant = {
+    email = "sybrand@neuralcoding.com";
+    github = "syberant";
+    githubId = 20063502;
+    name = "Sybrand Aarnoutse";
+  };
+  syboxez = {
+    email = "syboxez@gmail.com";
+    matrix = "@Syboxez:matrix.org";
+    github = "syboxez";
+    githubId = 12841859;
+    name = "Syboxez Blank";
+  };
+  symphorien = {
+    email = "symphorien_nixpkgs@xlumurb.eu";
+    matrix = "@symphorien:xlumurb.eu";
+    github = "symphorien";
+    githubId = 12595971;
+    name = "Guillaume Girol";
+  };
+  synthetica = {
+    email = "nix@hilhorst.be";
+    github = "Synthetica9";
+    githubId = 7075751;
+    name = "Patrick Hilhorst";
+  };
+  sysedwinistrator = {
+    email = "edwin.mowen@gmail.com";
+    github = "sysedwinistrator";
+    githubId = 71331875;
+    name = "Edwin Mackenzie-Owen";
+  };
+  szczyp = {
+    email = "qb@szczyp.com";
+    github = "Szczyp";
+    githubId = 203195;
+    name = "Szczyp";
+  };
+  szlend = {
+    email = "pub.nix@zlender.si";
+    github = "szlend";
+    githubId = 7301807;
+    name = "Simon Žlender";
+  };
+  sztupi = {
+    email = "attila.sztupak@gmail.com";
+    github = "sztupi";
+    githubId = 143103;
+    name = "Attila Sztupak";
+  };
+  t184256 = {
+    email = "monk@unboiled.info";
+    github = "t184256";
+    githubId = 5991987;
+    name = "Alexander Sosedkin";
+  };
+  t4ccer = {
+    email = "t4ccer@gmail.com";
+    github = "t4ccer";
+    githubId = 64430288;
+    name = "Tomasz Maciosowski";
+    keys = [{
+      fingerprint = "6866 981C 4992 4D64 D154  E1AC 19E5 A2D8 B1E4 3F19";
+    }];
+  };
+  tadeokondrak = {
+    email = "me@tadeo.ca";
+    github = "tadeokondrak";
+    githubId = 4098453;
+    name = "Tadeo Kondrak";
+    keys = [{
+      fingerprint = "0F2B C0C7 E77C 5B42 AC5B  4C18 FBE6 07FC C495 16D3";
+    }];
+  };
+  tadfisher = {
+    email = "tadfisher@gmail.com";
+    github = "tadfisher";
+    githubId = 129148;
+    name = "Tad Fisher";
+  };
+  taeer = {
+    email = "taeer@necsi.edu";
+    github = "Radvendii";
+    githubId = 1239929;
+    name = "Taeer Bar-Yam";
+  };
+  taha = {
+    email = "xrcrod@gmail.com";
+    github = "tgharib";
+    githubId = 6457015;
+    name = "Taha Gharib";
+  };
+  taikx4 = {
+    email = "taikx4@taikx4szlaj2rsdupcwabg35inbny4jk322ngeb7qwbbhd5i55nf5yyd.onion";
+    github = "taikx4";
+    githubId = 94917129;
+    name = "taikx4";
+    keys = [{
+      fingerprint = "6B02 8103 C4E5 F68C D77C  9E54 CCD5 2C7B 37BB 837E";
+    }];
+  };
+  tailhook = {
+    email = "paul@colomiets.name";
+    github = "tailhook";
+    githubId = 321799;
+    name = "Paul Colomiets";
+  };
+  takagiy = {
+    email = "takagiy.4dev@gmail.com";
+    github = "takagiy";
+    githubId = 18656090;
+    name = "Yuki Takagi";
+  };
+  taketwo = {
+    email = "alexandrov88@gmail.com";
+    github = "taketwo";
+    githubId = 1241736;
+    name = "Sergey Alexandrov";
+  };
+  takikawa = {
+    email = "asumu@igalia.com";
+    github = "takikawa";
+    githubId = 64192;
+    name = "Asumu Takikawa";
+  };
+  taktoa = {
+    email = "taktoa@gmail.com";
+    matrix = "@taktoa:matrix.org";
+    github = "taktoa";
+    githubId = 553443;
+    name = "Remy Goldschmidt";
+  };
+  taku0 = {
+    email = "mxxouy6x3m_github@tatapa.org";
+    github = "taku0";
+    githubId = 870673;
+    name = "Takuo Yonezawa";
+  };
+  talkara = {
+    email = "taito.horiuchi@relexsolutions.com";
+    github = "talkara";
+    githubId = 51232929;
+    name = "Taito Horiuchi";
+  };
+  talyz = {
+    email = "kim.lindberger@gmail.com";
+    matrix = "@talyz:matrix.org";
+    github = "talyz";
+    githubId = 63433;
+    name = "Kim Lindberger";
+  };
+  taneb = {
+    email = "nvd1234@gmail.com";
+    github = "Taneb";
+    githubId = 1901799;
+    name = "Nathan van Doorn";
+  };
+  taranarmo = {
+    email = "taranarmo@gmail.com";
+    github = "taranarmo";
+    githubId = 11619234;
+    name = "Sergey Volkov";
+  };
+  tarantoj = {
+    email = "taranto.james@gmail.com";
+    github = "tarantoj";
+    githubId = 13129552;
+    name = "James Taranto";
+  };
+  tari = {
+    email = "peter@taricorp.net";
+    github = "tari";
+    githubId = 506181;
+    name = "Peter Marheine";
+  };
+  tasmo = {
+    email = "tasmo@tasmo.de";
+    github = "tasmo";
+    githubId = 102685;
+    name = "Thomas Friese";
+  };
+  taylor1791 = {
+    email = "nixpkgs@tayloreverding.com";
+    github = "taylor1791";
+    githubId = 555003;
+    name = "Taylor Everding";
+  };
+  tazjin = {
+    email = "mail@tazj.in";
+    github = "tazjin";
+    githubId = 1552853;
+    name = "Vincent Ambo";
+  };
+  tbenst = {
+    email = "nix@tylerbenster.com";
+    github = "tbenst";
+    githubId = 863327;
+    name = "Tyler Benster";
+  };
+  tbidne = {
+    email = "tbidne@protonmail.com";
+    github = "tbidne";
+    githubId = 2856188;
+    name = "Thomas Bidne";
+  };
+  tboerger = {
+    email = "thomas@webhippie.de";
+    matrix = "@tboerger:matrix.org";
+    github = "tboerger";
+    githubId = 156964;
+    name = "Thomas Boerger";
+  };
+  tcbravo = {
+    email = "tomas.bravo@protonmail.ch";
+    github = "tcbravo";
+    githubId = 66133083;
+    name = "Tomas Bravo";
+  };
+  tchab = {
+    email = "dev@chabs.name";
+    github = "t-chab";
+    githubId = 2120966;
+    name = "t-chab";
+  };
+  tchekda = {
+    email = "contact@tchekda.fr";
+    github = "Tchekda";
+    githubId = 23559888;
+    keys = [{
+      fingerprint = "44CE A8DD 3B31 49CD 6246  9D8F D0A0 07ED A4EA DA0F";
+    }];
+    name = "David Tchekachev";
+  };
+  tcheronneau = {
+    email = "nix@mcth.fr";
+    github = "tcheronneau";
+    githubId = 7914437;
+    name = "Thomas Cheronneau";
+  };
+  tc-kaluza = {
+    github = "tc-kaluza";
+    githubId = 101565936;
+    name = "Tautvydas Cerniauskas";
+  };
+  tckmn = {
+    email = "andy@tck.mn";
+    github = "tckmn";
+    githubId = 2389333;
+    name = "Andy Tockman";
+  };
+  teatwig = {
+    email = "nix@teatwig.net";
+    name = "tea";
+    github = "teatwig";
+    githubId = 18734648;
+  };
+  techknowlogick = {
+    email = "techknowlogick@gitea.com";
+    github = "techknowlogick";
+    githubId = 164197;
+    name = "techknowlogick";
+  };
+  Technical27 = {
+    github = "Technical27";
+    githubId = 38222826;
+    name = "Aamaruvi Yogamani";
+  };
+  teh = {
+    email = "tehunger@gmail.com";
+    github = "teh";
+    githubId = 139251;
+    name = "Tom Hunger";
+  };
+  tehmatt = {
+    name = "tehmatt";
+    email = "nix@programsareproofs.com";
+    github = "tehmatt";
+    githubId = 3358866;
+  };
+  tejasag = {
+    name = "Tejas Agarwal";
+    email = "tejasagarwalbly@gmail.com";
+    github = "tejasag";
+    githubId = 67542663;
+  };
+  tejing = {
+    name = "Jeff Huffman";
+    email = "tejing@tejing.com";
+    matrix = "@tejing:matrix.org";
+    github = "tejing1";
+    githubId = 5663576;
+    keys = [{ fingerprint = "6F0F D43B 80E5 583E 60FC  51DC 4936 D067 EB12 AB32"; }];
+  };
+  telotortium = {
+    email = "rirelan@gmail.com";
+    github = "telotortium";
+    githubId = 1755789;
+    name = "Robert Irelan";
+  };
+  tengkuizdihar = {
+    name = "Tengku Izdihar";
+    email = "tengkuizdihar@gmail.com";
+    matrix = "@tengkuizdihar:matrix.org";
+    github = "tengkuizdihar";
+    githubId = 22078730;
+  };
+  tennox = {
+    email = "tennox+nix@txlab.io";
+    github = "tennox";
+    githubId = 2084639;
+    name = "Manu";
+  };
+  teozkr = {
+    email = "teo@nullable.se";
+    github = "nightkr";
+    githubId = 649832;
+    name = "Teo Klestrup Röijezon";
+  };
+  terin = {
+    email = "terinjokes@gmail.com";
+    github = "terinjokes";
+    githubId = 273509;
+    name = "Terin Stock";
+  };
+  terlar = {
+    email = "terlar@gmail.com";
+    github = "terlar";
+    githubId = 280235;
+    name = "Terje Larsen";
+  };
+  terrorjack = {
+    email = "astrohavoc@gmail.com";
+    github = "TerrorJack";
+    githubId = 3889585;
+    name = "Cheng Shao";
+  };
+  tesq0 = {
+    email = "mikolaj.galkowski@gmail.com";
+    github = "tesq0";
+    githubId = 26417242;
+    name = "Mikolaj Galkowski";
+  };
+  TethysSvensson = {
+    email = "freaken@freaken.dk";
+    github = "TethysSvensson";
+    githubId = 4294434;
+    name = "Tethys Svensson";
+  };
+  teto = {
+    email = "mcoudron@hotmail.com";
+    github = "teto";
+    githubId = 886074;
+    name = "Matthieu Coudron";
+  };
+  teutat3s = {
+    email = "teutates@mailbox.org";
+    matrix = "@teutat3s:pub.solar";
+    github = "teutat3s";
+    githubId = 10206665;
+    name = "teutat3s";
+    keys = [{
+      fingerprint = "81A1 1C61 F413 8C84 9139  A4FA 18DA E600 A6BB E705";
+    }];
+  };
+  tex = {
+    email = "milan.svoboda@centrum.cz";
+    github = "tex";
+    githubId = 27386;
+    name = "Milan Svoboda";
+  };
+  tfc = {
+    email = "jacek@galowicz.de";
+    matrix = "@jonge:ukvly.org";
+    github = "tfc";
+    githubId = 29044;
+    name = "Jacek Galowicz";
+  };
+  tfmoraes = {
+    name = "Thiago Franco de Moraes";
+    github = "tfmoraes";
+    githubId = 351108;
+  };
+  tgunnoe = {
+    email = "t@gvno.net";
+    github = "tgunnoe";
+    githubId = 7254833;
+    name = "Taylor Gunnoe";
+  };
+  tg-x = {
+    email = "*@tg-x.net";
+    github = "tg-x";
+    githubId = 378734;
+    name = "TG ⊗ Θ";
+  };
+  th0rgal = {
+    email = "thomas.marchand@tuta.io";
+    github = "Th0rgal";
+    githubId = 41830259;
+    name = "Thomas Marchand";
+  };
+  thall = {
+    email = "niclas.thall@gmail.com";
+    github = "thall";
+    githubId = 102452;
+    name = "Niclas Thall";
+  };
+  thammers = {
+    email = "jawr@gmx.de";
+    github = "tobias-hammerschmidt";
+    githubId = 2543259;
+    name = "Tobias Hammerschmidt";
+  };
+  thanegill = {
+    email = "me@thanegill.com";
+    github = "thanegill";
+    githubId = 1141680;
+    name = "Thane Gill";
+  };
+  thblt = {
+    name = "Thibault Polge";
+    email = "thibault@thb.lt";
+    matrix = "@thbltp:matrix.org";
+    github = "thblt";
+    githubId = 2453136;
+    keys = [{
+      fingerprint = "D2A2 F0A1 E7A8 5E6F B711  DEE5 63A4 4817 A52E AB7B";
+    }];
+  };
+  theaninova = {
+    name = "Thea Schöbl";
+    email = "dev@theaninova.de";
+    github = "Theaninova";
+    githubId = 19289296;
+    keys = [{
+      fingerprint = "6C9E EFC5 1AE0 0131 78DE  B9C8 68FF FB1E C187 88CA";
+    }];
+  };
+  the-argus = {
+    email = "i.mcfarlane2002@gmail.com";
+    github = "the-argus";
+    name = "Ian McFarlane";
+    githubId = 70479099;
+    matrix = "@eyes1238:matrix.org";
+  };
+  TheBrainScrambler = {
+    email = "esthromeris@riseup.net";
+    github = "TheBrainScrambler";
+    githubId = 34945377;
+    name = "John Smith";
+  };
+  thedavidmeister = {
+    email = "thedavidmeister@gmail.com";
+    github = "thedavidmeister";
+    githubId = 629710;
+    name = "David Meister";
+  };
+  thefenriswolf = {
+    email = "stefan.rohrbacher97@gmail.com";
+    github = "thefenriswolf";
+    githubId = 8547242;
+    name = "Stefan Rohrbacher";
+  };
+  thefloweringash = {
+    email = "lorne@cons.org.nz";
+    github = "thefloweringash";
+    githubId = 42933;
+    name = "Andrew Childs";
+  };
+  thehedgeh0g = {
+    name = "The Hedgehog";
+    email = "hedgehog@mrhedgehog.xyz";
+    matrix = "@mrhedgehog:jupiterbroadcasting.com";
+    github = "pyrox0";
+    githubId = 35778371;
+    keys = [{
+      fingerprint = "38A0 29B0 4A7E 4C13 A4BB  86C8 7D51 0786 6B1C 6752";
+    }];
+  };
+  thekostins = {
+    name = "Konstantin";
+    email = "anisimovkosta19@gmail.com";
+    github = "TheKostins";
+    githubId = 39405421;
+    keys = [{
+      fingerprint = "B216 7B33 E248 097F D82A  991D C94D 589A 4D0D CDD2";
+    }];
+  };
+  thelegy = {
+    email = "mail+nixos@0jb.de";
+    github = "thelegy";
+    githubId = 3105057;
+    name = "Jan Beinke";
+  };
+  thenonameguy = {
+    email = "thenonameguy24@gmail.com";
+    name = "Krisztian Szabo";
+    github = "thenonameguy";
+    githubId = 2217181;
+  };
+  therealansh = {
+    email = "tyagiansh23@gmail.com";
+    github = "therealansh";
+    githubId = 57180880;
+    name = "Ansh Tyagi";
+  };
+  therealr5 = {
+    email = "rouven@rfive.de";
+    github = "therealr5";
+    githubId = 72568063;
+    name = "Rouven Seifert";
+    keys = [{
+      fingerprint = "1169 87A8 DD3F 78FF 8601  BF4D B95E 8FE6 B11C 4D09";
+    }];
+  };
+  therishidesai = {
+    email = "desai.rishi1@gmail.com";
+    github = "therishidesai";
+    githubId = 5409166;
+    name = "Rishi Desai";
+  };
+  thesola10 = {
+    email = "me@thesola.io";
+    github = "Thesola10";
+    githubId = 7287268;
+    keys = [{
+      fingerprint = "1D05 13A6 1AC4 0D8D C6D6  5F2C 8924 5619 BEBB 95BA";
+    }];
+    name = "Karim Vergnes";
+  };
+  thetallestjj = {
+    email = "me+nixpkgs@jeroen-jetten.com";
+    github = "TheTallestJJ";
+    githubId = 6579555;
+    name = "Jeroen Jetten";
+  };
+  theuni = {
+    email = "ct@flyingcircus.io";
+    github = "ctheune";
+    githubId = 1220572;
+    name = "Christian Theune";
+  };
+  thiagokokada = {
+    email = "thiagokokada@gmail.com";
+    github = "thiagokokada";
+    githubId = 844343;
+    name = "Thiago K. Okada";
+    matrix = "@k0kada:matrix.org";
+  };
+  thibaultlemaire = {
+    email = "thibault.lemaire@protonmail.com";
+    github = "ThibaultLemaire";
+    githubId = 21345269;
+    name = "Thibault Lemaire";
+  };
+  thibautmarty = {
+    email = "github@thibautmarty.fr";
+    matrix = "@thibaut:thibautmarty.fr";
+    github = "ThibautMarty";
+    githubId = 3268082;
+    name = "Thibaut Marty";
+  };
+  thielema = {
+    name = "Henning Thielemann";
+    email = "nix@henning-thielemann.de";
+    github = "thielema";
+    githubId = 898989;
+  };
+  thillux = {
+    name = "Markus Theil";
+    email = "theil.markus@gmail.com";
+    github = "thillux";
+    githubId = 2171995;
+  };
+  thilobillerbeck = {
+    name = "Thilo Billerbeck";
+    email = "thilo.billerbeck@officerent.de";
+    github = "thilobillerbeck";
+    githubId = 7442383;
+  };
+  thled = {
+    name = "Thomas Le Duc";
+    email = "dev@tleduc.de";
+    github = "thled";
+    githubId = 28220902;
+  };
+  thmzlt = {
+    email = "git@thomazleite.com";
+    github = "thmzlt";
+    githubId = 7709;
+    name = "Thomaz Leite";
+  };
+  thomasdesr = {
+    email = "git@hive.pw";
+    github = "thomasdesr";
+    githubId = 681004;
+    name = "Thomas Desrosiers";
+  };
+  thomasjm = {
+    email = "tom@codedown.io";
+    github = "thomasjm";
+    githubId = 1634990;
+    name = "Tom McLaughlin";
+  };
+  ThomasMader = {
+    email = "thomas.mader@gmail.com";
+    github = "ThomasMader";
+    githubId = 678511;
+    name = "Thomas Mader";
+  };
+  thornycrackers = {
+    email = "codyfh@gmail.com";
+    github = "thornycrackers";
+    githubId = 4313010;
+    name = "Cody Hiar";
+  };
+  thoughtpolice = {
+    email = "aseipp@pobox.com";
+    github = "thoughtpolice";
+    githubId = 3416;
+    name = "Austin Seipp";
+  };
+  thpham = {
+    email = "thomas.pham@ithings.ch";
+    github = "thpham";
+    githubId = 224674;
+    name = "Thomas Pham";
+  };
+  Thra11 = {
+    email = "tahall256@protonmail.ch";
+    github = "Thra11";
+    githubId = 1391883;
+    name = "Tom Hall";
+  };
+  thubrecht = {
+    email = "tom@hubrecht.ovh";
+    github = "Tom-Hubrecht";
+    githubId = 26650391;
+    name = "Tom Hubrecht";
+  };
+  Thunderbottom = {
+    email = "chinmaydpai@gmail.com";
+    github = "Thunderbottom";
+    githubId = 11243138;
+    name = "Chinmay D. Pai";
+    keys = [{
+      fingerprint = "7F3E EEAA EE66 93CC 8782  042A 7550 7BE2 56F4 0CED";
+    }];
+  };
+  thyol = {
+    name = "thyol";
+    email = "thyol@pm.me";
+    github = "thyol";
+    githubId = 81481634;
+  };
+  tiagolobocastro = {
+    email = "tiagolobocastro@gmail.com";
+    github = "tiagolobocastro";
+    githubId = 1618946;
+    name = "Tiago Castro";
+  };
+  tie = {
+    name = "Ivan Trubach";
+    email = "mr.trubach@icloud.com";
+    github = "tie";
+    githubId = 14792994;
+  };
+  tilcreator = {
+    name = "TilCreator";
+    email = "contact.nixos@tc-j.de";
+    matrix = "@tilcreator:matrix.org";
+    github = "TilCreator";
+    githubId = 18621411;
+  };
+  tillkruss = {
+    name = "Till Krüss";
+    email = "till@kruss.io";
+    github = "tillkruss";
+    githubId = 665029;
+  };
+  tilpner = {
+    name = "Till Höppner";
+    email = "nixpkgs@tilpner.com";
+    matrix = "@tilpner:tx0.co";
+    github = "tilpner";
+    githubId = 4322055;
+  };
+  timbertson = {
+    email = "tim@gfxmonk.net";
+    github = "timbertson";
+    githubId = 14172;
+    name = "Tim Cuthbertson";
+  };
+  timma = {
+    email = "kunduru.it.iitb@gmail.com";
+    github = "ktrsoft";
+    githubId = 12712927;
+    name = "Timma";
+  };
+  timokau = {
+    email = "timokau@zoho.com";
+    github = "timokau";
+    githubId = 3799330;
+    name = "Timo Kaufmann";
+  };
+  timor = {
+    email = "timor.dd@googlemail.com";
+    github = "timor";
+    githubId = 174156;
+    name = "timor";
+  };
+  timput = {
+    email = "tim@timput.com";
+    github = "TimPut";
+    githubId = 2845239;
+    name = "Tim Put";
+  };
+  timstott = {
+    email = "stott.timothy@gmail.com";
+    github = "timstott";
+    githubId = 1334474;
+    name = "Timothy Stott";
+  };
+  tiramiseb = {
+    email = "sebastien@maccagnoni.eu";
+    github = "tiramiseb";
+    githubId = 1292007;
+    name = "Sébastien Maccagnoni";
+  };
+  tiredofit = {
+    email = "dave@tiredofit.ca";
+    github = "tiredofit";
+    githubId = 23528985;
+    name = "Dave Conroy";
+    matrix = "@dave:tiredofit.ca";
+  };
+  tirex = {
+    email = "szymon@kliniewski.pl";
+    name = "Szymon Kliniewski";
+    github = "NoneTirex";
+    githubId = 26038207;
+  };
+  tirimia = {
+    name = "Theodor-Alexandru Irimia";
+    github = "tirimia";
+    githubId = 11174371;
+  };
+  titanous = {
+    email = "jonathan@titanous.com";
+    github = "titanous";
+    githubId = 13026;
+    name = "Jonathan Rudenberg";
+  };
+  tjni = {
+    email = "43ngvg@masqt.com";
+    matrix = "@tni:matrix.org";
+    name = "Theodore Ni";
+    github = "tjni";
+    githubId = 3806110;
+    keys = [{
+      fingerprint = "4384 B8E1 299F C028 1641  7B8F EC30 EFBE FA7E 84A4";
+    }];
+  };
+  tkerber = {
+    email = "tk@drwx.org";
+    github = "tkerber";
+    githubId = 5722198;
+    name = "Thomas Kerber";
+    keys = [{
+      fingerprint = "556A 403F B0A2 D423 F656  3424 8489 B911 F9ED 617B";
+    }];
+  };
+  tljuniper = {
+    email = "tljuniper1@gmail.com";
+    github = "tljuniper";
+    githubId = 48209000;
+    name = "Anna Gillert";
+  };
+  tmarkovski = {
+    email = "tmarkovski@gmail.com";
+    github = "tmarkovski";
+    githubId = 1280118;
+    name = "Tomislav Markovski";
+  };
+  tmarkus = {
+    email = "tobias@markus-regensburg.de";
+    github = "hesiod";
+    githubId = 3159881;
+    name = "Tobias Markus";
+  };
+  tm-drtina = {
+    email = "tm.drtina@gmail.com";
+    github = "tm-drtina";
+    githubId = 26902865;
+    name = "Tomas Drtina";
+  };
+  tmountain = {
+    email = "tinymountain@gmail.com";
+    github = "tmountain";
+    githubId = 135297;
+    name = "Travis Whitton";
+  };
+  tmplt = {
+    email = "tmplt@dragons.rocks";
+    github = "tmplt";
+    githubId = 6118602;
+    name = "Viktor";
+  };
+  tnias = {
+    email = "phil@grmr.de";
+    matrix = "@tnias:stratum0.org";
+    github = "tnias";
+    githubId = 9853194;
+    name = "Philipp Bartsch";
+  };
+  toastal = {
+    email = "toastal+nix@posteo.net";
+    matrix = "@toastal:mozilla.org";
+    github = "toastal";
+    githubId = 561087;
+    name = "toastal";
+    keys = [{
+      fingerprint = "7944 74B7 D236 DAB9 C9EF  E7F9 5CCE 6F14 66D4 7C9E";
+    }];
+  };
+  tobiasBora = {
+    email = "tobias.bora.list@gmail.com";
+    github = "tobiasBora";
+    githubId = 2164118;
+    name = "Tobias Bora";
+  };
+  tobim = {
+    email = "nix@tobim.fastmail.fm";
+    github = "tobim";
+    githubId = 858790;
+    name = "Tobias Mayer";
+  };
+  tochiaha = {
+    email = "tochiahan@proton.me";
+    github = "Tochiaha";
+    githubId = 74688871;
+    name = "Tochukwu Ahanonu";
+  };
+  tokudan = {
+    email = "git@danielfrank.net";
+    github = "tokudan";
+    githubId = 692610;
+    name = "Daniel Frank";
+  };
+  tomahna = {
+    email = "kevin.rauscher@tomahna.fr";
+    github = "Tomahna";
+    githubId = 8577941;
+    name = "Kevin Rauscher";
+  };
+  tomasajt = {
+    github = "TomaSajt";
+    githubId = 62384384;
+    matrix = "@tomasajt:matrix.org";
+    name = "TomaSajt";
+    keys = [{
+      fingerprint = "8CA9 8016 F44D B717 5B44  6032 F011 163C 0501 22A1";
+    }];
+  };
+  tomaskala = {
+    email = "public+nixpkgs@tomaskala.com";
+    github = "tomaskala";
+    githubId = 7727887;
+    name = "Tomas Kala";
+  };
+  tomberek = {
+    email = "tomberek@gmail.com";
+    matrix = "@tomberek:matrix.org";
+    github = "tomberek";
+    githubId = 178444;
+    name = "Thomas Bereknyei";
+  };
+  tomfitzhenry = {
+    email = "tom@tom-fitzhenry.me.uk";
+    github = "tomfitzhenry";
+    githubId = 61303;
+    name = "Tom Fitzhenry";
+  };
+  tomhoule = {
+    email = "secondary+nixpkgs@tomhoule.com";
+    github = "tomhoule";
+    githubId = 13155277;
+    name = "Tom Houle";
+  };
+  tomkoid = {
+    email = "tomaszierl@outlook.com";
+    name = "Tomkoid";
+  };
+  tomodachi94 = {
+    email = "tomodachi94+nixpkgs@protonmail.com";
+    matrix = "@tomodachi94:matrix.org";
+    github = "tomodachi94";
+    githubId = 68489118;
+    name = "Tomodachi94";
+  };
+  tomsiewert = {
+    email = "tom@siewert.io";
+    matrix = "@tom:frickel.earth";
+    github = "tomsiewert";
+    githubId = 8794235;
+    name = "Tom Siewert";
+  };
+  tomsmeets = {
+    email = "tom.tsmeets@gmail.com";
+    github = "TomSmeets";
+    githubId = 6740669;
+    name = "Tom Smeets";
+  };
+  tonyshkurenko = {
+    email = "support@twingate.com";
+    github = "antonshkurenko";
+    githubId = 8597964;
+    name = "Anton Shkurenko";
+  };
+  toonn = {
+    email = "nixpkgs@toonn.io";
+    matrix = "@toonn:matrix.org";
+    github = "toonn";
+    githubId = 1486805;
+    name = "Toon Nolten";
+  };
+  tornax = {
+    email = "tornax@pm.me";
+    github = "TornaxO7";
+    githubId = 50843046;
+    name = "tornax";
+  };
+  toschmidt = {
+    email = "tobias.schmidt@in.tum.de";
+    github = "toschmidt";
+    githubId = 27586264;
+    name = "Tobias Schmidt";
+  };
+  totalchaos = {
+    email = "basil.keeler@outlook.com";
+    github = "totalchaos05";
+    githubId = 70387628;
+    name = "Basil Keeler";
+  };
+  totoroot = {
+    name = "Matthias Thym";
+    email = "git@thym.at";
+    github = "totoroot";
+    githubId = 39650930;
+  };
+  ToxicFrog = {
+    email = "toxicfrog@ancilla.ca";
+    github = "ToxicFrog";
+    githubId = 90456;
+    name = "Rebecca (Bex) Kelly";
+  };
+  tpw_rules = {
+    name = "Thomas Watson";
+    email = "twatson52@icloud.com";
+    matrix = "@tpw_rules:matrix.org";
+    github = "tpwrules";
+    githubId = 208010;
+  };
+  travisbhartwell = {
+    email = "nafai@travishartwell.net";
+    github = "travisbhartwell";
+    githubId = 10110;
+    name = "Travis B. Hartwell";
+  };
+  traxys = {
+    email = "quentin+dev@familleboyer.net";
+    github = "traxys";
+    githubId = 5623227;
+    name = "Quentin Boyer";
+  };
+  TredwellGit = {
+    email = "tredwell@tutanota.com";
+    github = "TredwellGit";
+    githubId = 61860346;
+    name = "Tredwell";
+  };
+  treemo = {
+    email = "matthieu.chevrier@treemo.fr";
+    github = "treemo";
+    githubId = 207457;
+    name = "Matthieu Chevrier";
+  };
+  trepetti = {
+    email = "trepetti@cs.columbia.edu";
+    github = "trepetti";
+    githubId = 25440339;
+    name = "Tom Repetti";
+  };
+  trespaul = {
+    email = "paul@trespaul.com";
+    github = "trespaul";
+    githubId = 7453891;
+    name = "Paul Joubert";
+  };
+  trevdev = {
+    email = "trev@trevdev.ca";
+    matrix = "@trevdev:matrix.org";
+    github = "trev-dev";
+    githubId = 28788713;
+    name = "Trevor Richards";
+  };
+  trevorj = {
+    email = "nix@trevor.joynson.io";
+    github = "akatrevorjay";
+    githubId = 1312290;
+    name = "Trevor Joynson";
+  };
+  tricktron = {
+    email = "tgagnaux@gmail.com";
+    github = "tricktron";
+    githubId = 16036882;
+    name = "Thibault Gagnaux";
+  };
+  trino = {
+    email = "muehlhans.hubert@ekodia.de";
+    github = "hmuehlhans";
+    githubId = 9870613;
+    name = "Hubert Mühlhans";
+  };
+  trobert = {
+    email = "thibaut.robert@gmail.com";
+    github = "trobert";
+    githubId = 504580;
+    name = "Thibaut Robert";
+  };
+  troydm = {
+    email = "d.geurkov@gmail.com";
+    github = "troydm";
+    githubId = 483735;
+    name = "Dmitry Geurkov";
+  };
+  truh = {
+    email = "jakob-nixos@truh.in";
+    github = "truh";
+    githubId = 1183303;
+    name = "Jakob Klepp";
+  };
+  trundle = {
+    name = "Andreas Stührk";
+    email = "andy@hammerhartes.de";
+    github = "Trundle";
+    githubId = 332418;
+  };
+  tsandrini = {
+    email = "tomas.sandrini@seznam.cz";
+    name = "Tomáš Sandrini";
+    github = "tsandrini";
+    githubId = 21975189;
+  };
+  tscholak = {
+    email = "torsten.scholak@googlemail.com";
+    github = "tscholak";
+    githubId = 1568873;
+    name = "Torsten Scholak";
+  };
+  tshaynik = {
+    email = "tshaynik@protonmail.com";
+    github = "tshaynik";
+    githubId = 15064765;
+    name = "tshaynik";
+  };
+  tsowell = {
+    email = "tom@ldtlb.com";
+    github = "tsowell";
+    githubId = 4044033;
+    name = "Thomas Sowell";
+  };
+  ttuegel = {
+    email = "ttuegel@mailbox.org";
+    github = "ttuegel";
+    githubId = 563054;
+    name = "Thomas Tuegel";
+  };
+  tu-maurice = {
+    email = "valentin.gehrke+nixpkgs@zom.bi";
+    github = "tu-maurice";
+    githubId = 16151097;
+    name = "Valentin Gehrke";
+  };
+  Tungsten842 = {
+    name = "Tungsten842";
+    email = "886724vf@anonaddy.me";
+    github = "Tungsten842";
+    githubId = 24614168;
+  };
+  turbomack = {
+    email = "marek.faj@gmail.com";
+    github = "turboMaCk";
+    githubId = 2130305;
+    name = "Marek Fajkus";
+  };
+  turion = {
+    email = "programming@manuelbaerenz.de";
+    github = "turion";
+    githubId = 303489;
+    name = "Manuel Bärenz";
+  };
+  tuxinaut = {
+    email = "trash4you@tuxinaut.de";
+    github = "tuxinaut";
+    githubId = 722482;
+    name = "Denny Schäfer";
+    keys = [{
+      fingerprint = "C752 0E49 4D92 1740 D263  C467 B057 455D 1E56 7270";
+    }];
+  };
+  tv = {
+    email = "tv@krebsco.de";
+    github = "4z3";
+    githubId = 427872;
+    name = "Tomislav Viljetić";
+  };
+  tvestelind = {
+    email = "tomas.vestelind@fripost.org";
+    github = "tvestelind";
+    githubId = 699403;
+    name = "Tomas Vestelind";
+  };
+  tviti = {
+    email = "tviti@hawaii.edu";
+    github = "tviti";
+    githubId = 2251912;
+    name = "Taylor Viti";
+  };
+  tvorog = {
+    email = "marszaripov@gmail.com";
+    github = "TvoroG";
+    githubId = 1325161;
+    name = "Marsel Zaripov";
+  };
+  tweber = {
+    email = "tw+nixpkgs@360vier.de";
+    github = "thorstenweber83";
+    githubId = 9413924;
+    name = "Thorsten Weber";
+  };
+  twesterhout = {
+    name = "Tom Westerhout";
+    matrix = "@twesterhout:matrix.org";
+    github = "twesterhout";
+    githubId = 14264576;
+  };
+  twey = {
+    email = "twey@twey.co.uk";
+    github = "Twey";
+    githubId = 101639;
+    name = "James ‘Twey’ Kay";
+  };
+  twhitehead = {
+    name = "Tyson Whitehead";
+    email = "twhitehead@gmail.com";
+    github = "twhitehead";
+    githubId = 787843;
+    keys = [{
+      fingerprint = "E631 8869 586F 99B4 F6E6  D785 5942 58F0 389D 2802";
+    }];
+  };
+  twitchyliquid64 = {
+    name = "Tom";
+    email = "twitchyliquid64@ciphersink.net";
+    github = "twitchyliquid64";
+    githubId = 6328589;
+  };
+  twz123 = {
+    name = "Tom Wieczorek";
+    email = "tom@bibbu.net";
+    github = "twz123";
+    githubId = 1215104;
+    keys = [{
+      fingerprint = "B1FD 4E2A 84B2 2379 F4BF  2EF5 FE33 A228 2371 E831";
+    }];
+  };
+  tylerjl = {
+    email = "tyler+nixpkgs@langlois.to";
+    github = "tylerjl";
+    githubId = 1733846;
+    matrix = "@ty:tjll.net";
+    name = "Tyler Langlois";
+  };
+  tylervick = {
+    email = "nix@tylervick.com";
+    github = "tylervick";
+    githubId = 1395852;
+    name = "Tyler Vick";
+    matrix = "@tylervick:matrix.org";
+  };
+  tymscar = {
+    email = "oscar@tymscar.com";
+    github = "tymscar";
+    githubId = 3742502;
+    name = "Oscar Molnar";
+  };
+  typetetris = {
+    email = "ericwolf42@mail.com";
+    github = "typetetris";
+    githubId = 1983821;
+    name = "Eric Wolf";
+  };
+  u2x1 = {
+    email = "u2x1@outlook.com";
+    github = "u2x1";
+    githubId = 30677291;
+    name = "u2x1";
+  };
+  uakci = {
+    name = "uakci";
+    email = "git@uakci.space";
+    github = "uakci";
+    githubId = 6961268;
+  };
+  uartman = {
+    name = "Anton Gusev";
+    email = "uartman@mail.ru";
+    github = "UARTman";
+    githubId = 21099202;
+  };
+  udono = {
+    email = "udono@virtual-things.biz";
+    github = "udono";
+    githubId = 347983;
+    name = "Udo Spallek";
+  };
+  ufUNnxagpM = {
+    github = "ufUNnxagpM";
+    githubId = 12422133;
+    name = "Chromo-residuum-opec";
+  };
+  ulrikstrid = {
+    email = "ulrik.strid@outlook.com";
+    github = "ulrikstrid";
+    githubId = 1607770;
+    name = "Ulrik Strid";
+  };
+  umlx5h = {
+    github = "umlx5h";
+    githubId = 20206121;
+    name = "umlx5h";
+  };
+  unclamped = {
+    name = "Maru";
+    email = "clear6860@tutanota.com";
+    matrix = "@unhidden0174:matrix.org";
+    github = "unclamped";
+    githubId = 104658278;
+    keys = [{
+      fingerprint = "57A2 CC43 3068 CB62 89C1  F1DA 9137 BB2E 77AD DE7E";
+    }];
+  };
+  unclechu = {
+    name = "Viacheslav Lotsmanov";
+    email = "lotsmanov89@gmail.com";
+    github = "unclechu";
+    githubId = 799353;
+    keys = [{
+      fingerprint = "EE59 5E29 BB5B F2B3 5ED2  3F1C D276 FF74 6700 7335";
+    }];
+  };
+  undefined-moe = {
+    name = "undefined";
+    email = "i@undefined.moe";
+    github = "undefined-moe";
+    githubId = 29992205;
+    keys = [{
+      fingerprint = "6684 4E7D D213 C75D 8828  6215 C714 A58B 6C1E 0F52";
+    }];
+  };
+  unhammer = {
+    email = "unhammer@fsfe.org";
+    github = "unhammer";
+    githubId = 56868;
+    name = "Kevin Brubeck Unhammer";
+    keys = [{
+      fingerprint = "50D4 8796 0B86 3F05 4B6A  12F9 7426 06DE 766A C60C";
+    }];
+  };
+  uniquepointer = {
+    email = "uniquepointer@mailbox.org";
+    matrix = "@uniquepointer:matrix.org";
+    github = "uniquepointer";
+    githubId = 71751817;
+    name = "uniquepointer";
+  };
+  unode = {
+    email = "alves.rjc@gmail.com";
+    matrix = "@renato_alves:matrix.org";
+    github = "unode";
+    githubId = 122319;
+    name = "Renato Alves";
+  };
+  unrooted = {
+    name = "Konrad Klawikowski";
+    email = "konrad.root.klawikowski@gmail.com";
+    github = "unrooted";
+    githubId = 30440603;
+  };
+  unsolvedcypher = {
+    name = "Matthew M";
+    github = "UnsolvedCypher";
+    githubId = 3170853;
+  };
+  uralbash = {
+    email = "root@uralbash.ru";
+    github = "uralbash";
+    githubId = 619015;
+    name = "Svintsov Dmitry";
+  };
+  urandom = {
+    email = "colin@urandom.co.uk";
+    matrix = "@urandom0:matrix.org";
+    github = "urandom2";
+    githubId = 2526260;
+    keys = [{
+      fingerprint = "04A3 A2C6 0042 784A AEA7  D051 0447 A663 F7F3 E236";
+    }];
+    name = "Colin Arnott";
+  };
+  urbas = {
+    email = "matej.urbas@gmail.com";
+    github = "urbas";
+    githubId = 771193;
+    name = "Matej Urbas";
+  };
+  uri-canva = {
+    email = "uri@canva.com";
+    github = "uri-canva";
+    githubId = 33242106;
+    name = "Uri Baghin";
+  };
+  urlordjames = {
+    email = "urlordjames@gmail.com";
+    github = "urlordjames";
+    githubId = 32751441;
+    name = "urlordjames";
+  };
+  ursi = {
+    email = "masondeanm@aol.com";
+    github = "ursi";
+    githubId = 17836748;
+    name = "Mason Mackaman";
+  };
+  uskudnik = {
+    email = "urban.skudnik@gmail.com";
+    github = "uskudnik";
+    githubId = 120451;
+    name = "Urban Skudnik";
+  };
+  usrfriendly = {
+    name = "Arin Lares";
+    email = "arinlares@gmail.com";
+    github = "usrfriendly";
+    githubId = 2502060;
+  };
+  utdemir = {
+    email = "me@utdemir.com";
+    github = "utdemir";
+    githubId = 928084;
+    name = "Utku Demir";
+  };
+  uthar = {
+    email = "galkowskikasper@gmail.com";
+    github = "Uthar";
+    githubId = 15697697;
+    name = "Kasper Gałkowski";
+  };
+  utkarshgupta137 = {
+    email = "utkarshgupta137@gmail.com";
+    github = "utkarshgupta137";
+    githubId = 5155100;
+    name = "Utkarsh Gupta";
+  };
+  uvnikita = {
+    email = "uv.nikita@gmail.com";
+    github = "uvNikita";
+    githubId = 1084748;
+    name = "Nikita Uvarov";
+  };
+  uwap = {
+    email = "me@uwap.name";
+    github = "uwap";
+    githubId = 2212422;
+    name = "uwap";
+  };
+  V = {
+    name = "V";
+    email = "v@anomalous.eu";
+    github = "deviant";
+    githubId = 68829907;
+  };
+  vaci = {
+    email = "vaci@vaci.org";
+    github = "vaci";
+    githubId = 6882568;
+    name = "Vaci";
+  };
+  vaibhavsagar = {
+    email = "vaibhavsagar@gmail.com";
+    matrix = "@vaibhavsagar:matrix.org";
+    github = "vaibhavsagar";
+    githubId = 1525767;
+    name = "Vaibhav Sagar";
+  };
+  valebes = {
+    email = "valebes@gmail.com";
+    github = "valebes";
+    githubId = 10956211;
+    name = "Valerio Besozzi";
+  };
+  valeriangalliat = {
+    email = "val@codejam.info";
+    github = "valeriangalliat";
+    githubId = 3929133;
+    name = "Valérian Galliat";
+  };
+  valodim = {
+    email = "look@my.amazin.horse";
+    matrix = "@Valodim:stratum0.org";
+    github = "Valodim";
+    githubId = 27813;
+    name = "Vincent Breitmoser";
+  };
+  vamega = {
+    email = "github@madiathv.com";
+    github = "vamega";
+    githubId = 223408;
+    name = "Varun Madiath";
+  };
+  vancluever = {
+    email = "chrism@vancluevertech.com";
+    github = "vancluever";
+    githubId = 10704423;
+    name = "Chris Marchesi";
+  };
+  vandenoever = {
+    email = "jos@vandenoever.info";
+    github = "vandenoever";
+    githubId = 608417;
+    name = "Jos van den Oever";
+  };
+  vanilla = {
+    email = "osu_vanilla@126.com";
+    github = "VergeDX";
+    githubId = 25173827;
+    name = "Vanilla";
+    keys = [{
+      fingerprint = "2649 340C C909 F821 D251  6714 3750 028E D04F A42E";
+    }];
+  };
+  vanschelven = {
+    email = "klaas@vanschelven.com";
+    github = "vanschelven";
+    githubId = 223833;
+    name = "Klaas van Schelven";
+  };
+  vanzef = {
+    email = "vanzef@gmail.com";
+    github = "vanzef";
+    githubId = 12428837;
+    name = "Ivan Solyankin";
+  };
+  varunpatro = {
+    email = "varun.kumar.patro@gmail.com";
+    github = "varunpatro";
+    githubId = 6943308;
+    name = "Varun Patro";
+  };
+  vbgl = {
+    email = "Vincent.Laporte@gmail.com";
+    github = "vbgl";
+    githubId = 2612464;
+    name = "Vincent Laporte";
+  };
+  vbmithr = {
+    email = "vb@luminar.eu.org";
+    github = "vbmithr";
+    githubId = 797581;
+    name = "Vincent Bernardoff";
+  };
+  vbrandl = {
+    name = "Valentin Brandl";
+    email = "mail+nixpkgs@vbrandl.net";
+    github = "vbrandl";
+    githubId = 20639051;
+  };
+  vcanadi = {
+    email = "vito.canadi@gmail.com";
+    github = "vcanadi";
+    githubId = 8889722;
+    name = "Vitomir Čanadi";
+  };
+  vcunat = {
+    name = "Vladimír Čunát";
+    # vcunat@gmail.com predominated in commits before 2019/03
+    email = "v@cunat.cz";
+    matrix = "@vcunat:matrix.org";
+    github = "vcunat";
+    githubId = 1785925;
+    keys = [{
+      fingerprint = "B600 6460 B60A 80E7 8206  2449 E747 DF1F 9575 A3AA";
+    }];
+  };
+  vdemeester = {
+    email = "vincent@sbr.pm";
+    github = "vdemeester";
+    githubId = 6508;
+    name = "Vincent Demeester";
+  };
+  vdot0x23 = {
+    name = "Victor Büttner";
+    email = "nix.victor@0x23.dk";
+    github = "vdot0x23";
+    githubId = 40716069;
+  };
+  vector1dev = {
+    name = "vector1dev";
+    matrix = "@vector1dev:vector1.dev";
+    github = "vector1dev";
+    githubId = 127302590;
+  };
+  veehaitch = {
+    name = "Vincent Haupert";
+    email = "mail@vincent-haupert.de";
+    github = "veehaitch";
+    githubId = 15069839;
+    keys = [{
+      fingerprint = "4D23 ECDF 880D CADF 5ECA  4458 874B D6F9 16FA A742";
+    }];
+  };
+  vel = {
+    email = "llathasa@outlook.com";
+    github = "q60";
+    githubId = 61933599;
+    name = "vel";
+  };
+  velovix = {
+    email = "xaviosx@gmail.com";
+    github = "velovix";
+    githubId = 2856634;
+    name = "Tyler Compton";
+  };
+  veprbl = {
+    email = "veprbl@gmail.com";
+    github = "veprbl";
+    githubId = 245573;
+    name = "Dmitry Kalinkin";
+  };
+  vgskye = {
+    name = "Skye Green";
+    email = "me@skye.vg";
+    github = "vgskye";
+    githubId = 116078858;
+    keys = [{
+      fingerprint = "CDEA 7E04 69E3 0885 A754  4B05 0104 BC05 F41B 77B8";
+    }];
+  };
+  victormeriqui = {
+    name = "Victor Meriqui";
+    email = "victor.meriqui@ororatech.com";
+    github = "victormeriqui";
+    githubId = 1396008;
+  };
+  victormignot = {
+    email = "root@victormignot.fr";
+    github = "victormignot";
+    githubId = 58660971;
+    name = "Victor Mignot";
+    keys = [{
+      fingerprint = "CA5D F91A D672 683A 1F65  BBC9 0317 096D 20E0 067B";
+    }];
+  };
+  vidbina = {
+    email = "vid@bina.me";
+    github = "vidbina";
+    githubId = 335406;
+    name = "David Asabina";
+  };
+  vidister = {
+    email = "v@vidister.de";
+    github = "vidister";
+    githubId = 11413574;
+    name = "Fiona Weber";
+  };
+  vifino = {
+    email = "vifino@tty.sh";
+    github = "vifino";
+    githubId = 5837359;
+    name = "Adrian Pistol";
+  };
+  vikanezrimaya = {
+    email = "vika@fireburn.ru";
+    github = "vikanezrimaya";
+    githubId = 7953163;
+    name = "Vika Shleina";
+    keys = [{
+      fingerprint = "5814 50EB 6E17 E715 7C63  E7F1 9879 8C3C 4D68 8D6D";
+    }];
+  };
+  viktornordling = {
+    email = "antique_paler_0i@icloud.com";
+    github = "viktornordling";
+    githubId = 90482;
+    name = "Viktor Nordling";
+  };
+  vilsol = {
+    email = "me@vil.so";
+    github = "vilsol";
+    githubId = 1759390;
+    name = "Vilsol";
+  };
+  viluon = {
+    email = "nix@viluon.me";
+    github = "viluon";
+    githubId = 7235381;
+    name = "Ondřej Kvapil";
+  };
+  vincentbernat = {
+    email = "vincent@bernat.ch";
+    github = "vincentbernat";
+    githubId = 631446;
+    name = "Vincent Bernat";
+    keys = [{
+      fingerprint = "AEF2 3487 66F3 71C6 89A7  3600 95A4 2FE8 3535 25F9";
+    }];
+  };
+  vinetos = {
+    name = "vinetos";
+    email = "vinetosdev@gmail.com";
+    github = "vinetos";
+    githubId = 10145351;
+  };
+  vinnymeller = {
+    email = "vinnymeller@proton.me";
+    github = "vinnymeller";
+    githubId = 19894025;
+    name = "Vinny Meller";
+  };
+  vinymeuh = {
+    email = "vinymeuh@gmail.com";
+    github = "vinymeuh";
+    githubId = 118959;
+    name = "VinyMeuh";
+  };
+  viperML = {
+    email = "ayatsfer@gmail.com";
+    github = "viperML";
+    githubId = 11395853;
+    name = "Fernando Ayats";
+  };
+  viraptor = {
+    email = "nix@viraptor.info";
+    github = "viraptor";
+    githubId = 188063;
+    name = "Stanisław Pitucha";
+  };
+  virchau13 = {
+    email = "virchau13@hexular.net";
+    github = "virchau13";
+    githubId = 16955157;
+    name = "Vir Chaudhury";
+  };
+  viric = {
+    email = "viric@viric.name";
+    github = "viric";
+    githubId = 66664;
+    name = "Lluís Batlle i Rossell";
+  };
+  virusdave = {
+    email = "dave.nicponski@gmail.com";
+    github = "virusdave";
+    githubId = 6148271;
+    name = "Dave Nicponski";
+  };
+  vizanto = {
+    email = "danny@prime.vc";
+    github = "vizanto";
+    githubId = 326263;
+    name = "Danny Wilson";
+  };
+  vklquevs = {
+    email = "vklquevs@gmail.com";
+    github = "vklquevs";
+    githubId = 1771234;
+    name = "vklquevs";
+  };
+  vlaci = {
+    email = "laszlo.vasko@outlook.com";
+    github = "vlaci";
+    githubId = 1771332;
+    name = "László Vaskó";
+  };
+  vlinkz = {
+    email = "vmfuentes64@gmail.com";
+    github = "vlinkz";
+    githubId = 20145996;
+    name = "Victor Fuentes";
+  };
+  vlstill = {
+    email = "xstill@fi.muni.cz";
+    github = "vlstill";
+    githubId = 4070422;
+    name = "Vladimír Štill";
+  };
+  vmandela = {
+    email = "venkat.mandela@gmail.com";
+    github = "vmandela";
+    githubId = 849772;
+    name = "Venkateswara Rao Mandela";
+  };
+  vmchale = {
+    email = "tmchale@wisc.edu";
+    github = "vmchale";
+    githubId = 13259982;
+    name = "Vanessa McHale";
+  };
+  vncsb = {
+    email = "viniciusbernardino1@hotmail.com";
+    github = "vncsb";
+    githubId = 19562240;
+    name = "Vinicius Bernardino";
+    keys = [{
+      fingerprint = "F0D3 920C 722A 541F 0CCD  66E3 A7BA BA05 3D78 E7CA";
+    }];
+  };
+  voidless = {
+    email = "julius.schmitt@yahoo.de";
+    github = "voidIess";
+    githubId = 45292658;
+    name = "Julius Schmitt";
+  };
+  vojta001 = {
+    email = "vojtech.kane@gmail.com";
+    github = "vojta001";
+    githubId = 7038383;
+    name = "Vojta Káně";
+  };
+  volfyd = {
+    email = "lb.nix@lisbethmail.com";
+    github = "volfyd";
+    githubId = 3578382;
+    name = "Leif Huhn";
+  };
+  volhovm = {
+    email = "volhovm.cs@gmail.com";
+    github = "volhovm";
+    githubId = 5604643;
+    name = "Mikhail Volkhov";
+  };
+  vonfry = {
+    email = "nixos@vonfry.name";
+    github = "Vonfry";
+    githubId = 3413119;
+    name = "Vonfry";
+  };
+  vonixxx = {
+    email = "vonixxx@tuta.io";
+    github = "vonixxx";
+    githubId = 144771550;
+    name = "Luca Uricariu";
+  };
+  votava = {
+    email = "votava@gmail.com";
+    github = "janvotava";
+    githubId = 367185;
+    name = "Jan Votava";
+  };
+  vpetersson = {
+    email = "vpetersson@screenly.io";
+    github = "vpetersson";
+    githubId = 357664;
+    name = "Viktor Petersson";
+  };
+  vq = {
+    email = "vq@erq.se";
+    github = "vq";
+    githubId = 230381;
+    name = "Daniel Nilsson";
+  };
+  vrinek = {
+    email = "vrinek@hey.com";
+    github = "vrinek";
+    name = "Kostas Karachalios";
+    githubId = 81346;
+  };
+  vrthra = {
+    email = "rahul@gopinath.org";
+    github = "vrthra";
+    githubId = 70410;
+    name = "Rahul Gopinath";
+  };
+  vskilet = {
+    email = "victor@sene.ovh";
+    github = "Vskilet";
+    githubId = 7677567;
+    name = "Victor SENE";
+  };
+  vtuan10 = {
+    email = "mail@tuan-vo.de";
+    github = "vtuan10";
+    githubId = 16415673;
+    name = "Van Tuan Vo";
+  };
+  vuimuich = {
+    email = "vuimuich@quantentunnel.de";
+    github = "VuiMuich";
+    githubId = 4779365;
+    name = "Johannes Mayrhofer";
+  };
+  vyorkin = {
+    email = "vasiliy.yorkin@gmail.com";
+    github = "vyorkin";
+    githubId = 988849;
+    name = "Vasiliy Yorkin";
+  };
+  vyp = {
+    email = "elisp.vim@gmail.com";
+    github = "vyp";
+    githubId = 3889405;
+    name = "vyp";
+  };
+  wackbyte = {
+    name = "wackbyte";
+    email = "wackbyte@pm.me";
+    github = "wackbyte";
+    githubId = 29505620;
+    keys = [{
+      fingerprint = "E595 7FE4 FEF6 714B 1AD3  1483 937F 2AE5 CCEF BF59";
+    }];
+  };
+  waelwindows = {
+    email = "waelwindows9922@gmail.com";
+    github = "Waelwindows";
+    githubId = 5228243;
+    name = "waelwindows";
+  };
+  wahtique = {
+    name = "William Veal Phan";
+    email = "williamvphan@yahoo.fr";
+    github = "wahtique";
+    githubId = 55251330;
+    keys = [{
+      fingerprint = "9262 E3A7 D129 C4DD A7C1  26CE 370D D9BE 9121 F0B3";
+    }];
+  };
+  waiting-for-dev = {
+    email = "marc@lamarciana.com";
+    github = "waiting-for-dev";
+    githubId = 52650;
+    name = "Marc Busqué";
+  };
+  wakira = {
+    name = "Sheng Wang";
+    email = "sheng@a64.work";
+    github = "wakira";
+    githubId = 2338339;
+    keys = [{
+      fingerprint = "47F7 009E 3AE3 1DA7 988E  12E1 8C9B 0A8F C0C0 D862";
+    }];
+  };
+  wamirez = {
+    email = "wamirez@protonmail.com";
+    matrix = "@wamirez:matrix.org";
+    github = "wamirez";
+    githubId = 24505474;
+    name = "Daniel Ramirez";
+  };
+  wamserma = {
+    name = "Markus S. Wamser";
+    email = "github-dev@mail2013.wamser.eu";
+    github = "wamserma";
+    githubId = 60148;
+  };
+  water-sucks = {
+    email = "varun@snare.dev";
+    name = "Varun Narravula";
+    github = "water-sucks";
+    githubId = 68445574;
+  };
+  waynr = {
+    name = "Wayne Warren";
+    email = "wayne.warren.s@gmail.com";
+    github = "waynr";
+    githubId = 1441126;
+  };
+  wchresta = {
+    email = "wchresta.nix@chrummibei.ch";
+    github = "wchresta";
+    githubId = 34962284;
+    name = "wchresta";
+  };
+  wd15 = {
+    email = "daniel.wheeler2@gmail.com";
+    github = "wd15";
+    githubId = 1986844;
+    name = "Daniel Wheeler";
+  };
+  wdavidw = {
+    name = "David Worms";
+    email = "david@adaltas.com";
+    github = "wdavidw";
+    githubId = 46896;
+  };
+  weathercold = {
+    name = "Weathercold";
+    email = "weathercold.scr@proton.me";
+    matrix = "@weathercold:matrix.org";
+    github = "Weathercold";
+    githubId = 49368953;
+    keys = [{
+      fingerprint = "D20F C904 A145 8B28 53D8  FBA0 0422 0096 01E4 87FC";
+    }];
+  };
+  wegank = {
+    name = "Weijia Wang";
+    email = "contact@weijia.wang";
+    github = "wegank";
+    githubId = 9713184;
+  };
+  welteki = {
+    email = "welteki@pm.me";
+    github = "welteki";
+    githubId = 16267532;
+    name = "Han Verstraete";
+    keys = [{
+      fingerprint = "2145 955E 3F5E 0C95 3458  41B5 11F7 BAEA 8567 43FF";
+    }];
+  };
+  wenngle = {
+    name = "Zeke Stephens";
+    email = "zekestephens@gmail.com";
+    github = "wenngle";
+    githubId = 63376671;
+  };
+  wentam = {
+    name = "Matt Egeler";
+    email = "wentam42@gmail.com";
+    github = "wentam";
+    githubId = 901583;
+  };
+  wentasah = {
+    name = "Michal Sojka";
+    email = "wsh@2x.cz";
+    github = "wentasah";
+    githubId = 140542;
+  };
+  wesleyjrz = {
+    email = "dev@wesleyjrz.com";
+    name = "Wesley V. Santos Jr.";
+    github = "wesleyjrz";
+    githubId = 60184588;
+  };
+  wesnel = {
+    name = "Wesley Nelson";
+    email = "wgn@wesnel.dev";
+    github = "wesnel";
+    githubId = 43357387;
+    keys = [{
+      fingerprint = "F844 80B2 0CA9 D6CC C7F5  2479 A776 D2AD 099E 8BC0";
+    }];
+  };
+  wexder = {
+    email = "wexder19@gmail.com";
+    github = "wexder";
+    githubId = 24979302;
+    name = "Vladimír Zahradník";
+  };
+  wheelsandmetal = {
+    email = "jakob@schmutz.co.uk";
+    github = "wheelsandmetal";
+    githubId = 13031455;
+    name = "Jakob Schmutz";
+  };
+  WhiteBlackGoose = {
+    email = "wbg@angouri.org";
+    github = "WhiteBlackGoose";
+    githubId = 31178401;
+    name = "WhiteBlackGoose";
+    keys = [{
+      fingerprint = "640B EDDE 9734 310A BFA3  B257 52ED AE6A 3995 AFAB";
+    }];
+  };
+  whiteley = {
+    email = "mattwhiteley@gmail.com";
+    github = "whiteley";
+    githubId = 2215;
+    name = "Matt Whiteley";
+  };
+  WhittlesJr = {
+    email = "alex.joseph.whitt@gmail.com";
+    github = "WhittlesJr";
+    githubId = 19174984;
+    name = "Alex Whitt";
+  };
+  whonore = {
+    email = "wolfhonore@gmail.com";
+    github = "whonore";
+    githubId = 7121530;
+    name = "Wolf Honoré";
+  };
+  wietsedv = {
+    email = "wietsedv@proton.me";
+    github = "wietsedv";
+    githubId = 13139101;
+    name = "Wietse de Vries";
+  };
+  wigust = {
+    name = "Oleg Pykhalov";
+    email = "go.wigust@gmail.com";
+    github = "wigust";
+    githubId = 7709598;
+    keys = [{
+      # primary: "C955 CC5D C048 7FB1 7966  40A9 199A F6A3 67E9 4ABB"
+      fingerprint = "7238 7123 8EAC EB63 4548  5857 167F 8EA5 001A FA9C";
+    }];
+  };
+  wildsebastian = {
+    name = "Sebastian Wild";
+    email = "sebastian@wild-siena.com";
+    github = "wildsebastian";
+    githubId = 1215623;
+    keys = [{
+      fingerprint = "DA03 D6C6 3F58 E796 AD26  E99B 366A 2940 479A 06FC";
+    }];
+  };
+  willcohen = {
+    github = "willcohen";
+    githubId = 5185341;
+    name = "Will Cohen";
+  };
+  williamvds = {
+    email = "nixpkgs@williamvds.me";
+    github = "williamvds";
+    githubId = 26379999;
+    name = "William Vigolo";
+    keys = [{
+      fingerprint = "9848 B216 BCBE 29BB 1C6A  E0D5 7A4D F5A8 CDBD 49C7";
+    }];
+  };
+  willibutz = {
+    email = "willibutz@posteo.de";
+    github = "WilliButz";
+    githubId = 20464732;
+    name = "Willi Butz";
+  };
+  willswats = {
+    email = "williamstuwatson@gmail.com";
+    github = "willswats";
+    githubId = 86304139;
+    name = "William Watson";
+  };
+  wilsonehusin = {
+    name = "Wilson E. Husin";
+    email = "wilsonehusin@gmail.com";
+    github = "wilsonehusin";
+    githubId = 14004487;
+  };
+  winpat = {
+    email = "patrickwinter@posteo.ch";
+    github = "winpat";
+    githubId = 6016963;
+    name = "Patrick Winter";
+  };
+  winter = {
+    email = "nixos@winter.cafe";
+    github = "winterqt";
+    githubId = 78392041;
+    name = "Winter";
+  };
+  wintrmvte = {
+    name = "Jakub Lutczyn";
+    email = "kubalutczyn@gmail.com";
+    github = "wintrmvte";
+    githubId = 41823252;
+  };
+  wirew0rm = {
+    email = "alex@wirew0rm.de";
+    github = "wirew0rm";
+    githubId = 1202371;
+    name = "Alexander Krimm";
+  };
+  wishfort36 = {
+    github = "wishfort36";
+    githubId = 42300264;
+    name = "wishfort36";
+  };
+  witchof0x20 = {
+    name = "Jade";
+    email = "jade@witchof.space";
+    github = "witchof0x20";
+    githubId = 36118348;
+    keys = [{
+      fingerprint = "69C9 876B 5797 1B2E 11C5  7C39 80A1 F76F C9F9 54AE";
+    }];
+  };
+  wizeman = {
+    email = "rcorreia@wizy.org";
+    github = "wizeman";
+    githubId = 168610;
+    name = "Ricardo M. Correia";
+  };
+  wkral = {
+    email = "william.kral@gmail.com";
+    github = "wkral";
+    githubId = 105114;
+    name = "William Kral";
+  };
+  wladmis = {
+    email = "dev@wladmis.org";
+    github = "wladmis";
+    githubId = 5000261;
+    name = "Wladmis";
+  };
+  wldhx = {
+    email = "wldhx+nixpkgs@wldhx.me";
+    github = "wldhx";
+    githubId = 15619766;
+    name = "wldhx";
+  };
+  wmertens = {
+    email = "Wout.Mertens@gmail.com";
+    github = "wmertens";
+    githubId = 54934;
+    name = "Wout Mertens";
+  };
+  wnklmnn = {
+    email = "pascal@wnklmnn.de";
+    github = "wnklmnn";
+    githubId = 9423014;
+    name = "Pascal Winkelmann";
+  };
+  woffs = {
+    email = "github@woffs.de";
+    github = "woffs";
+    githubId = 895853;
+    name = "Frank Doepper";
+  };
+  wohanley = {
+    email = "me@wohanley.com";
+    github = "wohanley";
+    githubId = 1322287;
+    name = "William O'Hanley";
+  };
+  woky = {
+    email = "pampu.andrei@pm.me";
+    github = "andreisergiu98";
+    githubId = 11740700;
+    name = "Andrei Pampu";
+  };
+  wolfangaukang = {
+    email = "clone.gleeful135+nixpkgs@anonaddy.me";
+    github = "WolfangAukang";
+    githubId = 8378365;
+    name = "P. R. d. O.";
+  };
+  womfoo = {
+    email = "kranium@gikos.net";
+    github = "womfoo";
+    githubId = 1595132;
+    name = "Kranium Gikos Mendoza";
+  };
+  worldofpeace = {
+    email = "worldofpeace@protonmail.ch";
+    github = "worldofpeace";
+    githubId = 28888242;
+    name = "WORLDofPEACE";
+  };
+  wozeparrot = {
+    email = "wozeparrot@gmail.com";
+    github = "wozeparrot";
+    githubId = 25372613;
+    name = "Woze Parrot";
+  };
+  wr0belj = {
+    name = "Jakub Wróbel";
+    email = "wrobel.jakub@protonmail.com";
+    github = "wr0belj";
+    githubId = 40501814;
+  };
+  wraithm = {
+    name = "Matthew Wraith";
+    email = "wraithm@gmail.com";
+    github = "wraithm";
+    githubId = 1512913;
+  };
+  wrmilling = {
+    name = "Winston R. Milling";
+    email = "Winston@Milli.ng";
+    github = "wrmilling";
+    githubId = 6162814;
+    keys = [{
+      fingerprint = "21E1 6B8D 2EE8 7530 6A6C  9968 D830 77B9 9F8C 6643";
+    }];
+  };
+  wscott = {
+    email = "wsc9tt@gmail.com";
+    github = "wscott";
+    githubId = 31487;
+    name = "Wayne Scott";
+  };
+  wucke13 = {
+    email = "wucke13@gmail.com";
+    github = "wucke13";
+    githubId = 20400405;
+    name = "Wucke";
+  };
+  wulfsta = {
+    email = "wulfstawulfsta@gmail.com";
+    github = "Wulfsta";
+    githubId = 13378502;
+    name = "Wulfsta";
+  };
+  wunderbrick = {
+    name = "Andrew Phipps";
+    email = "lambdafuzz@tutanota.com";
+    github = "wunderbrick";
+    githubId = 52174714;
+  };
+  wuyoli = {
+    name = "wuyoli";
+    email = "wuyoli@tilde.team";
+    github = "wuyoli";
+    githubId = 104238274;
+  };
+  wykurz = {
+    email = "wykurz@gmail.com";
+    github = "wykurz";
+    githubId = 483465;
+    name = "Mateusz Wykurz";
+  };
+  wyndon = {
+    matrix = "@wyndon:envs.net";
+    github = "wyndon";
+    githubId = 72203260;
+    name = "wyndon";
+  };
+  wyvie = {
+    email = "elijahrum@gmail.com";
+    github = "alicerum";
+    githubId = 3992240;
+    name = "Elijah Rum";
+  };
+  x0ba = {
+    name = "x0ba";
+    email = "dax@omg.lol";
+    github = "x0ba";
+    githubId = 64868985;
+  };
+  x3ro = {
+    name = "^x3ro";
+    email = "nix@x3ro.dev";
+    github = "x3rAx";
+    githubId = 2268851;
+  };
+  xanderio = {
+    name = "Alexander Sieg";
+    email = "alex@xanderio.de";
+    github = "xanderio";
+    githubId = 6298052;
+  };
+  xaverdh = {
+    email = "hoe.dom@gmx.de";
+    github = "xaverdh";
+    githubId = 11050617;
+    name = "Dominik Xaver Hörl";
+  };
+  xavierzwirtz = {
+    email = "me@xavierzwirtz.com";
+    github = "xavierzwirtz";
+    githubId = 474343;
+    name = "Xavier Zwirtz";
+  };
+  xbreak = {
+    email = "xbreak@alphaware.se";
+    github = "xbreak";
+    githubId = 13489144;
+    name = "Calle Rosenquist";
+  };
+  xbz = {
+    email = "renatochavez7@gmail.com";
+    github = "Xbz-24";
+    githubId = 68678258;
+    name = "Renato German Chavez Chicoma";
+  };
+  xddxdd = {
+    email = "b980120@hotmail.com";
+    github = "xddxdd";
+    githubId = 5778879;
+    keys = [
+      { fingerprint = "2306 7C13 B6AE BDD7 C0BB  5673 27F3 1700 E751 EC22"; }
+      { fingerprint = "B195 E8FB 873E 6020 DCD1  C0C6 B50E C319 385F CB0D"; }
+    ];
+    name = "Yuhui Xu";
+  };
+  xdhampus = {
+    name = "Hampus";
+    github = "xdHampus";
+    githubId = 16954508;
+  };
+  xe = {
+    email = "me@christine.website";
+    matrix = "@withoutwithin:matrix.org";
+    github = "Xe";
+    githubId = 529003;
+    name = "Christine Dodrill";
+  };
+  xeji = {
+    email = "xeji@cat3.de";
+    github = "xeji";
+    githubId = 36407913;
+    name = "Uli Baum";
+  };
+  xfix = {
+    email = "kamila@borowska.pw";
+    github = "KamilaBorowska";
+    githubId = 1297598;
+    name = "Kamila Borowska";
+  };
+  xfnw = {
+    email = "xfnw+nixos@riseup.net";
+    github = "xfnw";
+    githubId = 66233223;
+    name = "Owen";
+  };
+  xgroleau = {
+    email = "xgroleau@gmail.com";
+    github = "xgroleau";
+    githubId = 31734358;
+    name = "Xavier Groleau";
+  };
+  xiorcale = {
+    email = "quentin.vaucher@pm.me";
+    github = "xiorcale";
+    githubId = 17534323;
+    name = "Quentin Vaucher";
+  };
+  xlambein = {
+    email = "xlambein@gmail.com";
+    github = "xlambein";
+    githubId = 5629059;
+    name = "Xavier Lambein";
+  };
+  xnaveira = {
+    email = "xnaveira@gmail.com";
+    github = "xnaveira";
+    githubId = 2534411;
+    name = "Xavier Naveira";
+  };
+  xnwdd = {
+    email = "nwdd+nixos@no.team";
+    github = "xNWDD";
+    githubId = 3028542;
+    name = "Guillermo NWDD";
+  };
+  xrelkd = {
+    github = "xrelkd";
+    githubId = 46590321;
+    name = "xrelkd";
+  };
+  xurei = {
+    email = "olivier.bourdoux@gmail.com";
+    github = "xurei";
+    githubId = 621695;
+    name = "Olivier Bourdoux";
+  };
+  xvapx = {
+    email = "marti.serra.coscollano@gmail.com";
+    github = "xvapx";
+    githubId = 11824817;
+    name = "Marti Serra";
+  };
+  xworld21 = {
+    github = "xworld21";
+    githubId = 1962985;
+    name = "Vincenzo Mantova";
+  };
+  xyenon = {
+    name = "XYenon";
+    email = "i@xyenon.bid";
+    github = "XYenon";
+    githubId = 20698483;
+  };
+  xyven1 = {
+    name = "Xyven";
+    email = "nix@xyven.dev";
+    github = "xyven1";
+    githubId = 35360746;
+  };
+  xzfc = {
+    email = "xzfcpw@gmail.com";
+    github = "xzfc";
+    githubId = 5121426;
+    name = "Albert Safin";
+  };
+  y0no = {
+    email = "y0no@y0no.fr";
+    github = "y0no";
+    githubId = 2242427;
+    name = "Yoann Ono";
+  };
+  yajo = {
+    email = "yajo.sk8@gmail.com";
+    github = "yajo";
+    githubId = 973709;
+    name = "Jairo Llopis";
+  };
+  yana = {
+    email = "yana@riseup.net";
+    github = "yanateras";
+    githubId = 1643293;
+    name = "Yana Timoshenko";
+  };
+  yanganto = {
+    name = "Antonio Yang";
+    email = "yanganto@gmail.com";
+    github = "yanganto";
+    githubId = 10803111;
+  };
+  yannip = {
+    email = "yPapandreou7@gmail.com";
+    github = "YanniPapandreou";
+    githubId = 15948162;
+    name = "Yanni Papandreou";
+  };
+  yarny = {
+    github = "Yarny0";
+    githubId = 41838844;
+    name = "Yarny";
+  };
+  yarr = {
+    email = "savraz@gmail.com";
+    github = "Eternity-Yarr";
+    githubId = 3705333;
+    name = "Dmitry V.";
+  };
+  yavko = {
+    name = "Yavor Kolev";
+    email = "yavornkolev@gmail.com";
+    matrix = "@yavor:nikolay.ems.host";
+    github = "yavko";
+    githubId = 15178513;
+    keys = [
+      {fingerprint = "DC05 7015 ECD7 E68A 6426  EFD8 F07D 19A3 2407 F857";}
+      {fingerprint = "2874 581F F832 C9E9 AEC6  8D84 E57B F27C 8BB0 80B0";}
+    ];
+  };
+  yayayayaka = {
+    email = "github@uwu.is";
+    matrix = "@yaya:uwu.is";
+    github = "yayayayaka";
+    githubId = 73759599;
+    name = "Yaya";
+  };
+  yboettcher = {
+    name = "Yannik Böttcher";
+    github = "yboettcher";
+    githubId = 39460066;
+    email = "yannikboettcher@outlook.de";
+  };
+  ydlr = {
+    name = "ydlr";
+    email = "ydlr@ydlr.io";
+    github = "ydlr";
+    githubId = 58453832;
+    keys = [{
+      fingerprint = "FD0A C425 9EF5 4084 F99F 9B47 2ACC 9749 7C68 FAD4";
+    }];
+  };
+  YellowOnion = {
+    name = "Daniel Hill";
+    email = "daniel@gluo.nz";
+    github   = "YellowOnion";
+    githubId = 364160;
+    matrix = "@woobilicious:matrix.org";
+  };
+  yesbox = {
+    email = "jesper.geertsen.jonsson@gmail.com";
+    github = "yesbox";
+    githubId = 4113027;
+    name = "Jesper Geertsen Jonsson";
+  };
+  yinfeng = {
+    email = "lin.yinfeng@outlook.com";
+    github = "linyinfeng";
+    githubId = 11229748;
+    name = "Lin Yinfeng";
+  };
+  yisraeldov = {
+    email = "lebow@lebowtech.com";
+    name = "Yisrael Dov Lebow";
+    github = "yisraeldov";
+    githubId = 138219;
+    matrix = "@yisraeldov:matrix.org";
+  };
+  yisuidenghua = {
+    email = "bileiner@gmail.com";
+    name = "Milena Yisui";
+    github = "YisuiDenghua";
+    githubId = 102890144;
+  };
+  yl3dy = {
+    email = "aleksandr.kiselyov@gmail.com";
+    github = "yl3dy";
+    githubId = 1311192;
+    name = "Alexander Kiselyov";
+  };
+  ylecornec = {
+    email = "yves.stan.lecornec@tweag.io";
+    github = "ylecornec";
+    githubId = 5978566;
+    name = "Yves-Stan Le Cornec";
+  };
+  ylh = {
+    email = "nixpkgs@ylh.io";
+    github = "ylh";
+    githubId = 9125590;
+    name = "Yestin L. Harrison";
+  };
+  ylwghst = {
+    email = "ylwghst@onionmail.info";
+    github = "ylwghst";
+    githubId = 26011724;
+    name = "Burim Augustin Berisa";
+  };
+  ymarkus = {
+    name = "Yannick Markus";
+    email = "nixpkgs@ymarkus.dev";
+    github = "ymarkus";
+    githubId = 62380378;
+  };
+  ymatsiuk = {
+    name = "Yurii Matsiuk";
+    github = "ymatsiuk";
+    githubId = 24990891;
+    keys = [{
+      fingerprint = "7BB8 84B5 74DA FDB1 E194  ED21 6130 2290 2986 01AA";
+    }];
+  };
+  ymeister = {
+    name = "Yuri Meister";
+    github = "ymeister";
+    githubId = 47071325;
+  };
+  ymstnt = {
+    name = "YMSTNT";
+    github = "ymstnt";
+    githubId = 21342713;
+  };
+  yoavlavi = {
+    email = "yoav@yoavlavi.com";
+    github = "yoav-lavi";
+    githubId = 14347895;
+    name = "Yoav Lavi";
+  };
+  yochai = {
+    email = "yochai@titat.info";
+    github = "yochai";
+    githubId = 1322201;
+    name = "Yochai";
+  };
+  yoctocell = {
+    email = "public@yoctocell.xyz";
+    github = "yoctocell";
+    githubId = 40352765;
+    name = "Yoctocell";
+  };
+  yorickvp = {
+    email = "yorickvanpelt@gmail.com";
+    matrix = "@yorickvp:matrix.org";
+    github = "yorickvP";
+    githubId = 647076;
+    name = "Yorick van Pelt";
+  };
+  YorikSar = {
+    name = "Yuriy Taraday";
+    email = "yorik.sar@gmail.com";
+    matrix = "@yorik.sar:matrix.org";
+    github = "YorikSar";
+    githubId = 428074;
+  };
+  YoshiRulz = {
+    name = "YoshiRulz";
+    email = "OSSYoshiRulz+Nixpkgs@gmail.com";
+    matrix = "@YoshiRulz:matrix.org";
+    github = "YoshiRulz";
+    githubId = 13409956;
+  };
+  yrashk = {
+    email = "yrashk@gmail.com";
+    github = "yrashk";
+    githubId = 452;
+    name = "Yurii Rashkovskii";
+  };
+  yrd = {
+    name = "Yannik Rödel";
+    email = "nix@yannik.info";
+    github = "yrd";
+    githubId = 1820447;
+  };
+  yshym = {
+    name = "Yevhen Shymotiuk";
+    email = "yshym@pm.me";
+    github = "yshym";
+    githubId = 44244245;
+  };
+  ysndr = {
+    email = "me@ysndr.de";
+    github = "ysndr";
+    githubId = 7040031;
+    name = "Yannik Sander";
+  };
+  yuka = {
+    email = "yuka@yuka.dev";
+    matrix = "@yuka:yuka.dev";
+    github = "yu-re-ka";
+    githubId = 86169957;
+    name = "Yureka";
+  };
+  Yumasi = {
+    email = "gpagnoux@gmail.com";
+    github = "Yumasi";
+    githubId = 24368641;
+    name = "Guillaume Pagnoux";
+    keys = [{
+      fingerprint = "85F8 E850 F8F2 F823 F934  535B EC50 6589 9AEA AF4C";
+    }];
+  };
+  yunfachi = {
+    email = "yunfachi@gmail.com";
+    github = "yunfachi";
+    githubId = 73419713;
+    name = "Yunfachi";
+  };
+  yureien = {
+    email = "contact@sohamsen.me";
+    github = "Yureien";
+    githubId = 17357089;
+    name = "Soham Sen";
+  };
+  yuriaisaka = {
+    email = "yuri.aisaka+nix@gmail.com";
+    github = "yuriaisaka";
+    githubId = 687198;
+    name = "Yuri Aisaka";
+  };
+  yurkobb = {
+    name = "Yury Bulka";
+    email = "setthemfree@privacyrequired.com";
+    github = "yurkobb";
+    githubId = 479389;
+  };
+  yurrriq = {
+    email = "eric@ericb.me";
+    github = "yurrriq";
+    githubId = 1866448;
+    name = "Eric Bailey";
+  };
+  yusdacra = {
+    email = "y.bera003.06@protonmail.com";
+    matrix = "@yusdacra:nixos.dev";
+    github = "yusdacra";
+    githubId = 19897088;
+    name = "Yusuf Bera Ertan";
+    keys = [{
+      fingerprint = "9270 66BD 8125 A45B 4AC4 0326 6180 7181 F60E FCB2";
+    }];
+  };
+  yuu = {
+    email = "yuunix@grrlz.net";
+    matrix = "@yuu:matrix.org";
+    github = "yuuyins";
+    githubId = 86538850;
+    name = "Yuu Yin";
+    keys = [{
+      fingerprint = "9F19 3AE8 AA25 647F FC31  46B5 416F 303B 43C2 0AC3";
+    }];
+  };
+  yvan-sraka = {
+    email = "yvan@sraka.xyz";
+    github = "yvan-sraka";
+    githubId = 705213;
+    keys = [{
+      fingerprint = "FE9A 953C 97E4 54FE 6598  BFDD A4FB 3EAA 6F45 2379";
+    }];
+    matrix = "@/yvan:matrix.org";
+    name = "Yvan Sraka";
+  };
+  yvesf = {
+    email = "yvesf+nix@xapek.org";
+    github = "yvesf";
+    githubId = 179548;
+    name = "Yves Fischer";
+  };
+  yvt = {
+    email = "i@yvt.jp";
+    github = "yvt";
+    githubId = 5253988;
+    name = "yvt";
+  };
+  zachcoyle = {
+    email = "zach.coyle@gmail.com";
+    github = "zachcoyle";
+    githubId = 908716;
+    name = "Zach Coyle";
+  };
+  Zaechus = {
+    email = "zaechus@proton.me";
+    github = "Zaechus";
+    githubId = 19353212;
+    name = "Maxwell Anderson";
+  };
+  zagy = {
+    email = "cz@flyingcircus.io";
+    github = "zagy";
+    githubId = 568532;
+    name = "Christian Zagrodnick";
+  };
+  zahrun = {
+    email = "zahrun@murena.io";
+    github = "zahrun";
+    githubId = 10415894;
+    name = "Zahrun";
+  };
+  zakame = {
+    email = "zakame@zakame.net";
+    github = "zakame";
+    githubId = 110625;
+    name = "Zak B. Elep";
+  };
+  zakkor = {
+    email = "edward.dalbon@gmail.com";
+    github = "zakkor";
+    githubId = 6191421;
+    name = "Edward d'Albon";
+  };
+  zalakain = {
+    email = "ping@umazalakain.info";
+    github = "umazalakain";
+    githubId = 1319905;
+    name = "Uma Zalakain";
+  };
+  zaldnoay = {
+    email = "zunway@outlook.com";
+    github = "zaldnoay";
+    githubId = 5986078;
+    name = "Zunway Liang";
+  };
+  zanculmarktum = {
+    name = "Azure Zanculmarktum";
+    email = "zanculmarktum@gmail.com";
+    github = "zanculmarktum";
+    githubId = 16958511;
+  };
+  zane = {
+    name = "Zane van Iperen";
+    email = "zane@zanevaniperen.com";
+    github = "vs49688";
+    githubId = 4423262;
+    keys = [{
+      fingerprint = "61AE D40F 368B 6F26 9DAE  3892 6861 6B2D 8AC4 DCC5";
+    }];
+  };
+  zaninime = {
+    email = "francesco@zanini.me";
+    github = "zaninime";
+    githubId = 450885;
+    name = "Francesco Zanini";
+  };
+  zarelit = {
+    email = "david@zarel.net";
+    github = "zarelit";
+    githubId = 3449926;
+    name = "David Costa";
+  };
+  zauberpony = {
+    email = "elmar@athmer.org";
+    github = "elmarx";
+    githubId = 250877;
+    name = "Elmar Athmer";
+  };
+  zbioe = {
+    name = "Iury Fukuda";
+    email = "zbioe@protonmail.com";
+    github = "zbioe";
+    githubId = 7332055;
+  };
+  zebreus = {
+    matrix = "@lennart:cicen.net";
+    email = "lennarteichhorn+nixpkgs@gmail.com";
+    github = "zebreus";
+    githubId = 1557253;
+    name = "Lennart Eichhorn";
+  };
+  zedseven = {
+    name = "Zacchary Dempsey-Plante";
+    email = "zacc@ztdp.ca";
+    github = "zedseven";
+    githubId = 25164338;
+    keys = [{
+      fingerprint = "065A 0A98 FE61 E1C1 41B0  AFE7 64FA BC62 F457 2875";
+    }];
+  };
+  zendo = {
+    name = "zendo";
+    email = "linzway@qq.com";
+    github = "zendo";
+    githubId = 348013;
+  };
+  zenithal = {
+    name = "zenithal";
+    email = "i@zenithal.me";
+    github = "ZenithalHourlyRate";
+    githubId = 19512674;
+    keys = [{
+      fingerprint = "1127 F188 280A E312 3619  3329 87E1 7EEF 9B18 B6C9";
+    }];
+  };
+  zeratax = {
+    email = "mail@zera.tax";
+    github = "zeratax";
+    githubId = 5024958;
+    name = "Jona Abdinghoff";
+    keys = [{
+      fingerprint = "44F7 B797 9D3A 27B1 89E0  841E 8333 735E 784D F9D4";
+    }];
+  };
+  zeri = {
+    name = "zeri";
+    matrix = "@zeri:matrix.org";
+    github = "zeri42";
+    githubId = 68825133;
+  };
+  zestsystem = {
+    email = "mk337337@gmail.com";
+    github = "zestsystem";
+    githubId = 39456023;
+    name = "Mike Yim";
+  };
+  zfnmxt = {
+    name = "zfnmxt";
+    email = "zfnmxt@zfnmxt.com";
+    github = "zfnmxt";
+    githubId = 37446532;
+  };
+  zhaofengli = {
+    email = "hello@zhaofeng.li";
+    matrix = "@zhaofeng:zhaofeng.li";
+    github = "zhaofengli";
+    githubId = 2189609;
+    name = "Zhaofeng Li";
+  };
+  zi3m5f = {
+    name = "zi3m5f";
+    email = "k7n3o3a6f@mozmail.com";
+    github = "zi3m5f";
+    githubId = 113244000;
+  };
+  ziguana = {
+    name = "Zig Uana";
+    email = "git@ziguana.dev";
+    github = "ziguana";
+    githubId = 45833444;
+  };
+  zimbatm = {
+    email = "zimbatm@zimbatm.com";
+    github = "zimbatm";
+    githubId = 3248;
+    name = "zimbatm";
+  };
+  Zimmi48 = {
+    email = "theo.zimmermann@telecom-paris.fr";
+    github = "Zimmi48";
+    githubId = 1108325;
+    name = "Théo Zimmermann";
+  };
+  zmitchell = {
+    name = "Zach Mitchell";
+    email = "zmitchell@fastmail.com";
+    matrix = "@zmitchell:matrix.org";
+    github = "zmitchell";
+    githubId = 10246891;
+  };
+  znaniye = {
+    email = "zn4niye@proton.me";
+    github = "znaniye";
+    githubId = 134703788;
+    name = "Samuel Silva";
+  };
+  znewman01 = {
+    email = "znewman01@gmail.com";
+    github = "znewman01";
+    githubId = 873857;
+    name = "Zack Newman";
+  };
+  zoedsoupe = {
+    github = "zoedsoupe";
+    githubId = 44469426;
+    name = "Zoey de Souza Pessanha";
+    email = "zoey.spessanha@outlook.com";
+    keys = [{
+      fingerprint = "EAA1 51DB 472B 0122 109A  CB17 1E1E 889C DBD6 A315";
+    }];
+  };
+  zohl = {
+    email = "zohl@fmap.me";
+    github = "zohl";
+    githubId = 6067895;
+    name = "Al Zohali";
+  };
+  zokrezyl = {
+    email = "zokrezyl@gmail.com";
+    github = "zokrezyl";
+    githubId = 51886259;
+    name = "Zokre Zyl";
+  };
+  zombiezen = {
+    name = "Ross Light";
+    email = "ross@zombiezen.com";
+    github = "zombiezen";
+    githubId = 181535;
+  };
+  zookatron = {
+    email = "tim@zookatron.com";
+    github = "zookatron";
+    githubId = 1772064;
+    name = "Tim Zook";
+  };
+  zopieux = {
+    email = "zopieux@gmail.com";
+    github = "zopieux";
+    githubId = 81353;
+    name = "Alexandre Macabies";
+  };
+  zoriya = {
+    email = "zoe.roux@zoriya.dev";
+    github = "zoriya";
+    githubId = 32224410;
+    name = "Zoe Roux";
+  };
+  zowoq = {
+    github = "zowoq";
+    githubId = 59103226;
+    name = "zowoq";
+  };
+  zraexy = {
+    email = "zraexy@gmail.com";
+    github = "zraexy";
+    githubId = 8100652;
+    name = "David Mell";
+  };
+  zshipko = {
+    email = "zachshipko@gmail.com";
+    github = "zshipko";
+    githubId = 332534;
+    name = "Zach Shipko";
+  };
+  ztzg = {
+    email = "dd@crosstwine.com";
+    github = "ztzg";
+    githubId = 393108;
+    name = "Damien Diederen";
+  };
+  zumorica = {
+    name = "Vera Aguilera Puerto";
+    email = "gradientvera+nix@outlook.com";
+    github = "Zumorica";
+    githubId = 6766154;
+  };
+  zupo = {
+    name = "Nejc Zupan";
+    email = "nejczupan+nix@gmail.com";
+    github = "zupo";
+    githubId = 311580;
+  };
+  zuzuleinen = {
+    email = "andrey.boar@gmail.com";
+    name = "Andrei Boar";
+    github = "zuzuleinen";
+    githubId = 944919;
+  };
+  zx2c4 = {
+    email = "Jason@zx2c4.com";
+    github = "zx2c4";
+    githubId = 10643;
+    name = "Jason A. Donenfeld";
+  };
+  zyansheep = {
+    email = "zyansheep@protonmail.com";
+    github = "zyansheep";
+    githubId = 20029431;
+    name = "Zyansheep";
+  };
+  zygot = {
+    email = "stefan.bordei13@gmail.com";
+    github = "stefan-bordei";
+    githubId = 71881325;
+    name = "Stefan Bordei";
+  };
+  zzamboni = {
+    email = "diego@zzamboni.org";
+    github = "zzamboni";
+    githubId = 32876;
+    name = "Diego Zamboni";
+  };
+  zzzsy = {
+    email = "me@zzzsy.top";
+    github = "zzzsyyy";
+    githubId = 	59917878;
+    name = "Mathias Zhang";
+  };
+}
+/* Keep the list alphabetically sorted. */
diff --git a/nixpkgs/maintainers/scripts/README.md b/nixpkgs/maintainers/scripts/README.md
new file mode 100644
index 000000000000..f8fc7aff955d
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/README.md
@@ -0,0 +1,62 @@
+# Maintainer scripts
+
+This folder contains various executable scripts for nixpkgs maintainers,
+and supporting data or nixlang files as needed.
+These scripts generally aren't a stable interface and may changed or be removed.
+
+What follows is a (very incomplete) overview of available scripts.
+
+
+## Metadata
+
+### `check-by-name.sh`
+
+An alias for `pkgs/test/nixpkgs-check-by-name/scripts/run-local.sh`, see [documentation](../../pkgs/test/nixpkgs-check-by-name/scripts/README.md).
+
+### `get-maintainer.sh`
+
+`get-maintainer.sh [selector] value` returns a JSON object describing
+a given nixpkgs maintainer, equivalent to `lib.maintainers.${x} // { handle = x; }`.
+
+This allows looking up a maintainer's attrset (including GitHub and Matrix
+handles, email address etc.) based on any of their handles, more correctly and
+robustly than text search through `maintainers-list.nix`.
+
+```
+❯ ./get-maintainer.sh nicoo
+{
+  "email": "nicoo@debian.org",
+  "github": "nbraud",
+  "githubId": 1155801,
+  "keys": [
+    {
+      "fingerprint": "E44E 9EA5 4B8E 256A FB73 49D3 EC9D 3708 72BC 7A8C"
+    }
+  ],
+  "name": "nicoo",
+  "handle": "nicoo"
+}
+
+❯ ./get-maintainer.sh name 'Silvan Mosberger'
+{
+  "email": "contact@infinisil.com",
+  "github": "infinisil",
+  "githubId": 20525370,
+  "keys": [
+    {
+      "fingerprint": "6C2B 55D4 4E04 8266 6B7D  DA1A 422E 9EDA E015 7170"
+    }
+  ],
+  "matrix": "@infinisil:matrix.org",
+  "name": "Silvan Mosberger",
+  "handle": "infinisil"
+}
+```
+
+The maintainer is designated by a `selector` which must be one of:
+- `handle` (default): the maintainer's attribute name in `lib.maintainers`;
+- `email`, `name`, `github`, `githubId`, `matrix`, `name`:
+  attributes of the maintainer's object, matched exactly;
+  see [`maintainer-list.nix`] for the fields' definition.
+
+[`maintainer-list.nix`]: ../maintainer-list.nix
diff --git a/nixpkgs/maintainers/scripts/all-tarballs.nix b/nixpkgs/maintainers/scripts/all-tarballs.nix
new file mode 100644
index 000000000000..83236e6fa91e
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/all-tarballs.nix
@@ -0,0 +1,16 @@
+/* Helper expression for copy-tarballs. This returns (nearly) all
+   tarballs used the free packages in Nixpkgs.
+
+   Typical usage:
+
+   $ copy-tarballs.pl --expr 'import <nixpkgs/maintainers/scripts/all-tarballs.nix>'
+*/
+
+import ../../pkgs/top-level/release.nix
+  { # Don't apply ‘hydraJob’ to jobs, because then we can't get to the
+    # dependency graph.
+    scrubJobs = false;
+    # No need to evaluate on i686.
+    supportedSystems = [ "x86_64-linux" ];
+    bootstrapConfigs = [];
+  }
diff --git a/nixpkgs/maintainers/scripts/bootstrap-files/README.md b/nixpkgs/maintainers/scripts/bootstrap-files/README.md
new file mode 100644
index 000000000000..ae385cbd6ce8
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/bootstrap-files/README.md
@@ -0,0 +1,85 @@
+# Bootstrap files
+
+Currently `nixpkgs` builds most of it's packages using bootstrap seed
+binaries (without the reliance on external inputs):
+
+- `bootstrap-tools`: an archive with the compiler toolchain and other
+  helper tools enough to build the rest of the `nixpkgs`.
+- initial binaries needed to unpack `bootstrap-tools.*`. On `linux`
+  it's just `busybox`, on `darwin` it's `sh`, `bzip2`, `mkdir` and
+  `cpio`. These binaries can be executed directly from the store.
+
+These are called "bootstrap files".
+
+Bootstrap files should always be fetched from hydra and uploaded to
+`tarballs.nixos.org` to guarantee that all the binaries were built from
+the code committed into `nixpkgs` repository.
+
+The uploads to `tarballs.nixos.org` are done by `@lovesegfault` today.
+
+This document describes the procedure of updating bootstrap files in
+`nixpkgs`.
+
+## How to request the bootstrap seed update
+
+To get the tarballs updated let's use an example `i686-unknown-linux-gnu`
+target:
+
+1. Create a local update:
+
+   ```
+   $ maintainers/scripts/bootstrap-files/refresh-tarballs.bash --commit --targets=i686-unknown-linux-gnu
+   ```
+
+2. Test the update locally. I'll build local `hello` derivation with
+   the result:
+
+   ```
+   $ nix-build -A hello --argstr system i686-linux
+   ```
+
+   To validate cross-targets `binfmt` `NixOS` helper can be useful.
+   For `riscv64-unknown-linux-gnu` the `/etc/nixox/configuraqtion.nix`
+   entry would be `boot.binfmt.emulatedSystems = [ "riscv64-linux" ]`.
+
+3. Propose the commit as a PR to update bootstrap tarballs, tag people
+   who can help you test the updated architecture and once reviewed tag
+  `@lovesegfault` to upload the tarballs.
+
+## Bootstrap files job definitions
+
+There are two types of bootstrap files:
+
+- natively built `stdenvBootstrapTools.build` hydra jobs in
+  [`nixpkgs:trunk`](https://hydra.nixos.org/jobset/nixpkgs/trunk#tabs-jobs)
+  jobset. Incomplete list of examples is:
+
+  * `aarch64-unknown-linux-musl.nix`
+  * `i686-unknown-linux-gnu.nix`
+
+  These are Tier 1 hydra platforms.
+
+- cross-built by `bootstrapTools.build` hydra jobs in
+  [`nixpkgs:cross-trunk`](https://hydra.nixos.org/jobset/nixpkgs/cross-trunk#tabs-jobs)
+  jobset. Incomplete list of examples is:
+
+  * `mips64el-unknown-linux-gnuabi64.nix`
+  * `mips64el-unknown-linux-gnuabin32.nix`
+  * `mipsel-unknown-linux-gnu.nix`
+  * `powerpc64le-unknown-linux-gnu.nix`
+  * `riscv64-unknown-linux-gnu.nix`
+
+  These are usually Tier 2 and lower targets.
+
+The `.build` job contains `/on-server/` subdirectory with binaries to
+be uploaded to `tarballs.nixos.org`.
+The files are uploaded to `tarballs.nixos.org` by writers to `S3` store.
+
+## TODOs
+
+- `pkgs/stdenv/darwin` file layout is slightly different from
+  `pkgs/stdenv/linux`. Once `linux` seed update becomes a routine we can
+  bring `darwin` in sync if it's feasible.
+- `darwin` definition of `.build` `on-server/` directory layout differs
+  and should be updated.
+
diff --git a/nixpkgs/maintainers/scripts/bootstrap-files/refresh-tarballs.bash b/nixpkgs/maintainers/scripts/bootstrap-files/refresh-tarballs.bash
new file mode 100755
index 000000000000..21c43ade27f1
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/bootstrap-files/refresh-tarballs.bash
@@ -0,0 +1,282 @@
+#!/usr/bin/env nix-shell
+#! nix-shell --pure
+#! nix-shell -i bash
+#! nix-shell -p curl cacert
+#! nix-shell -p git
+#! nix-shell -p nix
+#! nix-shell -p jq
+
+# How the refresher works:
+#
+# For a given list of <targets>:
+# 1. fetch latest successful '.build` job
+# 2. fetch oldest evaluation that contained that '.build', extract nixpkgs commit
+# 3. fetch all the `.build` artifacts from '$out/on-server/' directory
+# 4. calculate hashes and craft the commit message with the details on
+#    how to upload the result to 'tarballs.nixos.org'
+
+usage() {
+    cat >&2 <<EOF
+Usage:
+    $0 [ --commit ] --targets=<target>[,<target>,...]
+
+    The tool must be ran from the root directory of 'nixpkgs' repository.
+
+Synopsis:
+    'refresh-tarballs.bash' script fetches latest bootstrapFiles built
+    by hydra, registers them in 'nixpkgs' and provides commands to
+    upload seed files to 'tarballs.nixos.org'.
+
+    This is usually done in the following cases:
+
+    1. Single target fix: current bootstrap files for a single target
+       are problematic for some reason (target-specific bug). In this
+       case we can refresh just that target as:
+
+       \$ $0 --commit --targets=i686-unknown-linux-gnu
+
+    2. Routine refresh: all bootstrap files should be refreshed to avoid
+       debugging problems that only occur on very old binaries.
+
+       \$ $0 --commit --all-targets
+
+To get help on uploading refreshed binaries to 'tarballs.nixos.org'
+please have a look at <maintainers/scripts/bootstrap-files/README.md>.
+EOF
+    exit 1
+}
+
+# log helpers
+
+die() {
+    echo "ERROR: $*" >&2
+    exit 1
+}
+
+info() {
+    echo "INFO: $*" >&2
+}
+
+[[ ${#@} -eq 0 ]] && usage
+
+# known targets
+
+NATIVE_TARGETS=(
+    aarch64-unknown-linux-gnu
+    aarch64-unknown-linux-musl
+    i686-unknown-linux-gnu
+    x86_64-unknown-linux-gnu
+    x86_64-unknown-linux-musl
+
+    # TODO: add darwin here once a few prerequisites are satisfied:
+    #   - bootstrap-files are factored out into a separate file
+    #   - the build artifacts are factored out into an `on-server`
+    #     directory. Right onw if does not match `linux` layout.
+    #
+    #aarch64-apple-darwin
+    #x86_64-apple-darwin
+)
+
+is_native() {
+    local t target=$1
+    for t in "${NATIVE_TARGETS[@]}"; do
+        [[ $t == $target ]] && return 0
+    done
+    return 1
+}
+
+CROSS_TARGETS=(
+    armv5tel-unknown-linux-gnueabi
+    armv6l-unknown-linux-gnueabihf
+    armv6l-unknown-linux-musleabihf
+    armv7l-unknown-linux-gnueabihf
+    mips64el-unknown-linux-gnuabi64
+    mips64el-unknown-linux-gnuabin32
+    mipsel-unknown-linux-gnu
+    powerpc64le-unknown-linux-gnu
+    riscv64-unknown-linux-gnu
+)
+
+is_cross() {
+    local t target=$1
+    for t in "${CROSS_TARGETS[@]}"; do
+        [[ $t == $target ]] && return 0
+    done
+    return 1
+}
+
+# collect passed options
+
+targets=()
+commit=no
+
+for arg in "$@"; do
+    case "$arg" in
+        --all-targets)
+            targets+=(
+                ${CROSS_TARGETS[@]}
+                ${NATIVE_TARGETS[@]}
+            )
+            ;;
+        --targets=*)
+            # Convert "--targets=a,b,c" to targets=(a b c) bash array.
+            comma_targets=${arg#--targets=}
+            targets+=(${comma_targets//,/ })
+            ;;
+        --commit)
+            commit=yes
+            ;;
+        *)
+            usage
+            ;;
+    esac
+done
+
+for target in "${targets[@]}"; do
+    # Native and cross jobsets differ a bit. We'll have to pick the
+    # one based on target name:
+    if is_native $target; then
+        jobset=nixpkgs/trunk
+        job="stdenvBootstrapTools.${target}.build"
+    elif is_cross $target; then
+        jobset=nixpkgs/cross-trunk
+        job="bootstrapTools.${target}.build"
+    else
+        die "'$target' is not present in either of 'NATIVE_TARGETS' or 'CROSS_TARGETS'. Please add one."
+    fi
+
+    # 'nixpkgs' prefix where we will write new tarball hashes
+    case "$target" in
+        *linux*) nixpkgs_prefix="pkgs/stdenv/linux" ;;
+        *darwin*) nixpkgs_prefix="pkgs/stdenv/darwin" ;;
+        *) die "don't know where to put '$target'" ;;
+    esac
+
+    # We enforce s3 prefix for all targets here. This slightly differs
+    # from manual uploads targets where names were chosen inconsistently.
+    s3_prefix="stdenv/$target"
+
+    # resolve 'latest' build to the build 'id', construct the link.
+    latest_build_uri="https://hydra.nixos.org/job/$jobset/$job/latest"
+    latest_build="$target.latest-build"
+    info "Fetching latest successful build from '${latest_build_uri}'"
+    curl -s -H "Content-Type: application/json" -L "$latest_build_uri" > "$latest_build"
+    [[ $? -ne 0 ]] && die "Failed to fetch latest successful build"
+    latest_build_id=$(jq '.id' < "$latest_build")
+    [[ $? -ne 0 ]] && die "Did not find 'id' in latest build"
+    build_uri="https://hydra.nixos.org/build/${latest_build_id}"
+
+    # We pick oldest jobset evaluation and extract the 'nicpkgs' commit.
+    #
+    # We use oldest instead of latest to make the result more stable
+    # across unrelated 'nixpkgs' updates. Ideally two subsequent runs of
+    # this refresher should produce the same output (provided there are
+    # no bootstrapTools updates committed between the two runs).
+    oldest_eval_id=$(jq '.jobsetevals|min' < "$latest_build")
+    [[ $? -ne 0 ]] && die "Did not find 'jobsetevals' in latest build"
+    eval_uri="https://hydra.nixos.org/eval/${oldest_eval_id}"
+    eval_meta="$target.eval-meta"
+    info "Fetching oldest eval details from '${eval_uri}' (can take a minute)"
+    curl -s -H "Content-Type: application/json"  -L "${eval_uri}" > "$eval_meta"
+    [[ $? -ne 0 ]] && die "Failed to fetch eval metadata"
+    nixpkgs_revision=$(jq --raw-output ".jobsetevalinputs.nixpkgs.revision" < "$eval_meta")
+    [[ $? -ne 0 ]] && die "Failed to fetch revision"
+
+    # Extract the build paths out of the build metadata
+    drvpath=$(jq --raw-output '.drvpath' < "${latest_build}")
+    [[ $? -ne 0 ]] && die "Did not find 'drvpath' in latest build"
+    outpath=$(jq --raw-output '.buildoutputs.out.path' < "${latest_build}")
+    [[ $? -ne 0 ]] && die "Did not find 'buildoutputs' in latest build"
+    build_timestamp=$(jq --raw-output '.timestamp' < "${latest_build}")
+    [[ $? -ne 0 ]] && die "Did not find 'timestamp' in latest build"
+    build_time=$(TZ=UTC LANG=C date --date="@${build_timestamp}" --rfc-email)
+    [[ $? -ne 0 ]] && die "Failed to format timestamp"
+
+    info "Fetching bootstrap tools to calculate hashes from '${outpath}'"
+    nix-store --realize "$outpath"
+    [[ $? -ne 0 ]] && die "Failed to fetch '${outpath}' from hydra"
+
+    fnames=()
+
+    target_file="${nixpkgs_prefix}/bootstrap-files/${target}.nix"
+    info "Writing '${target_file}'"
+    {
+        # header
+        cat <<EOF
+# Autogenerated by maintainers/scripts/bootstrap-files/refresh-tarballs.bash as:
+# $ ./refresh-tarballs.bash --targets=${target}
+#
+# Metadata:
+# - nixpkgs revision: ${nixpkgs_revision}
+# - hydra build: ${latest_build_uri}
+# - resolved hydra build: ${build_uri}
+# - instantiated derivation: ${drvpath}
+# - output directory: ${outpath}
+# - build time: ${build_time}
+{
+EOF
+      for p in "${outpath}/on-server"/*; do
+          fname=$(basename "$p")
+          fnames+=("$fname")
+          case "$fname" in
+              bootstrap-tools.tar.xz) attr=bootstrapTools ;;
+              busybox) attr=$fname ;;
+              *) die "Don't know how to map '$fname' to attribute name. Please update me."
+          esac
+
+          executable_arg=
+          executable_nix=
+          if [[ -x "$p" ]]; then
+              executable_arg="--executable"
+              executable_nix="    executable = true;"
+          fi
+          sha256=$(nix-prefetch-url $executable_arg --name "$fname" "file://$p")
+          [[ $? -ne 0 ]] && die "Failed to get the hash for '$p'"
+          sri=$(nix-hash --to-sri "sha256:$sha256")
+          [[ $? -ne 0 ]] && die "Failed to convert '$sha256' hash to an SRI form"
+
+          # individual file entries
+          cat <<EOF
+  $attr = import <nix/fetchurl.nix> {
+    url = "http://tarballs.nixos.org/${s3_prefix}/${nixpkgs_revision}/$fname";
+    hash = "${sri}";$(printf "\n%s" "${executable_nix}")
+  };
+EOF
+      done
+      # footer
+      cat <<EOF
+}
+EOF
+    } > "${target_file}"
+
+        target_file_commit_msg=${target}.commit_message
+        cat > "$target_file_commit_msg" <<EOF
+${nixpkgs_prefix}: update ${target} bootstrap-files
+
+sha256sum of files to be uploaded:
+
+$(
+echo "$ sha256sum ${outpath}/on-server/*"
+sha256sum ${outpath}/on-server/*
+)
+
+Suggested commands to upload files to 'tarballs.nixos.org':
+
+    $ nix-store --realize ${outpath}
+    $ aws s3 cp --recursive --acl public-read ${outpath}/on-server/ s3://nixpkgs-tarballs/${s3_prefix}/${nixpkgs_revision}
+    $ aws s3 cp --recursive s3://nixpkgs-tarballs/${s3_prefix}/${nixpkgs_revision} ./
+    $ sha256sum ${fnames[*]}
+    $ sha256sum ${outpath}/on-server/*
+EOF
+
+    cat "$target_file_commit_msg"
+    if [[ $commit == yes ]]; then
+        git commit "${target_file}" -F "$target_file_commit_msg"
+    else
+        info "DRY RUN: git commit ${target_file} -F $target_file_commit_msg"
+    fi
+    rm -- "$target_file_commit_msg"
+
+    # delete temp files
+    rm -- "$latest_build" "$eval_meta"
+done
diff --git a/nixpkgs/maintainers/scripts/build.nix b/nixpkgs/maintainers/scripts/build.nix
new file mode 100644
index 000000000000..ca401700b4a6
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/build.nix
@@ -0,0 +1,55 @@
+{ maintainer
+, localSystem ? { system = args.system or builtins.currentSystem; }
+, system ? localSystem.system
+, crossSystem ? localSystem
+, ...
+}@args:
+
+# based on update.nix
+# nix-build build.nix --argstr maintainer <yourname>
+
+# to build for aarch64-linux using boot.binfmt.emulatedSystems:
+# nix-build build.nix --argstr maintainer <yourname> --argstr system aarch64-linux
+
+let
+  pkgs = import ./../../default.nix (removeAttrs args [ "maintainer" ]);
+  maintainer_ = pkgs.lib.maintainers.${maintainer};
+  packagesWith = cond: return: set:
+    (pkgs.lib.flatten
+      (pkgs.lib.mapAttrsToList
+        (name: pkg:
+          let
+            result = builtins.tryEval
+              (
+                if pkgs.lib.isDerivation pkg && cond name pkg then
+                  # Skip packages whose closure fails on evaluation.
+                  # This happens for pkgs like `python27Packages.djangoql`
+                  # that have disabled Python pkgs as dependencies.
+                  builtins.seq pkg.outPath
+                    [ (return name pkg) ]
+                else if pkg.recurseForDerivations or false || pkg.recurseForRelease or false
+                then packagesWith cond return pkg
+                else [ ]
+              );
+          in
+          if result.success then result.value
+          else [ ]
+        )
+        set
+      )
+    );
+in
+packagesWith
+  (name: pkg:
+    (
+      if builtins.hasAttr "meta" pkg && builtins.hasAttr "maintainers" pkg.meta
+      then (
+        if builtins.isList pkg.meta.maintainers
+        then builtins.elem maintainer_ pkg.meta.maintainers
+        else maintainer_ == pkg.meta.maintainers
+      )
+      else false
+    )
+  )
+  (name: pkg: pkg)
+  pkgs
diff --git a/nixpkgs/maintainers/scripts/check-by-name.sh b/nixpkgs/maintainers/scripts/check-by-name.sh
new file mode 120000
index 000000000000..545dbedf0a31
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/check-by-name.sh
@@ -0,0 +1 @@
+../../pkgs/test/nixpkgs-check-by-name/scripts/run-local.sh
\ No newline at end of file
diff --git a/nixpkgs/maintainers/scripts/check-hydra-by-maintainer.nix b/nixpkgs/maintainers/scripts/check-hydra-by-maintainer.nix
new file mode 100644
index 000000000000..c40729a3974e
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/check-hydra-by-maintainer.nix
@@ -0,0 +1,71 @@
+{ maintainer }:
+let
+  pkgs = import ./../../default.nix {
+    config.allowAliases = false;
+  };
+  inherit (pkgs) lib;
+  maintainer_ = pkgs.lib.maintainers.${maintainer};
+  packagesWith = cond: return: prefix: set:
+    (lib.flatten
+      (lib.mapAttrsToList
+        (name: pkg:
+          let
+            result = builtins.tryEval
+              (
+                if lib.isDerivation pkg && cond name pkg then
+                # Skip packages whose closure fails on evaluation.
+                # This happens for pkgs like `python27Packages.djangoql`
+                # that have disabled Python pkgs as dependencies.
+                  builtins.seq pkg.outPath
+                    [ (return "${prefix}${name}") ]
+                else if pkg.recurseForDerivations or false || pkg.recurseForRelease or false
+                # then packagesWith cond return pkg
+                then packagesWith cond return "${name}." pkg
+                else [ ]
+              );
+          in
+          if result.success then result.value
+          else [ ]
+        )
+        set
+      )
+    );
+
+  packages = packagesWith
+    (name: pkg:
+      (
+        if builtins.hasAttr "meta" pkg && builtins.hasAttr "maintainers" pkg.meta
+        then
+          (
+            if builtins.isList pkg.meta.maintainers
+            then builtins.elem maintainer_ pkg.meta.maintainers
+            else maintainer_ == pkg.meta.maintainers
+          )
+        else false
+      )
+    )
+    (name: name)
+    ""
+    pkgs;
+
+in
+pkgs.stdenv.mkDerivation {
+  name = "nixpkgs-update-script";
+  buildInputs = [ pkgs.hydra-check ];
+  buildCommand = ''
+    echo ""
+    echo "----------------------------------------------------------------"
+    echo ""
+    echo "nix-shell maintainers/scripts/check-hydra-by-maintainer.nix --argstr maintainer SuperSandro2000"
+    echo ""
+    echo "----------------------------------------------------------------"
+    exit 1
+  '';
+  shellHook = ''
+    unset shellHook # do not contaminate nested shells
+    echo "Please stand by"
+    echo nix-shell -p hydra-check --run "hydra-check ${builtins.concatStringsSep " " packages}"
+    nix-shell -p hydra-check --run "hydra-check ${builtins.concatStringsSep " " packages}"
+    exit $?
+  '';
+}
diff --git a/nixpkgs/maintainers/scripts/check-maintainer-github-handles.sh b/nixpkgs/maintainers/scripts/check-maintainer-github-handles.sh
new file mode 100755
index 000000000000..a5555ca9e909
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/check-maintainer-github-handles.sh
@@ -0,0 +1,66 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -i bash -p jq parallel
+
+# Example how to work with the `lib.maintainers` attrset.
+# Can be used to check whether all user handles are still valid.
+
+set -o errexit -o noclobber -o nounset -o pipefail
+shopt -s failglob inherit_errexit
+
+function checkCommits {
+    local ret status tmp user
+    user="$1"
+    tmp=$(mktemp)
+    curl --silent -w "%{http_code}" \
+         "https://github.com/NixOS/nixpkgs/commits?author=$user" \
+         > "$tmp"
+    # the last line of tmp contains the http status
+    status=$(tail -n1 "$tmp")
+    ret=
+    case $status in
+        200) if <"$tmp" grep -i "no commits found" > /dev/null; then
+                 ret=1
+             else
+                 ret=0
+             fi
+             ;;
+        # because of github’s hard request limits, this can take some time
+        429) sleep 2
+             printf "."
+             checkCommits "$user"
+             ret=$?
+             ;;
+        *)   printf "BAD STATUS: $(tail -n1 "$tmp") for %s\n" "$user"; ret=1
+             ret=1
+             ;;
+    esac
+    rm "$tmp"
+    return $ret
+}
+export -f checkCommits
+
+function checkUser {
+    local user="$1"
+    local status=
+    status="$(curl --silent --head "https://github.com/${user}" | grep Status)"
+    # checks whether a user handle can be found on github
+    if [[ "$status" =~ 404 ]]; then
+        printf "%s\t\t\t\t%s\n" "$status" "$user"
+    # checks whether the user handle has any nixpkgs commits
+    elif checkCommits "$user"; then
+        printf "OK!\t\t\t\t%s\n" "$user"
+    else
+        printf "No Commits!\t\t\t%s\n" "$user"
+    fi
+}
+export -f checkUser
+
+# output the maintainers set as json
+# and filter out the github username of each maintainer (if it exists)
+# then check some at the same time
+nix-instantiate -A lib.maintainers --eval --strict --json \
+    | jq -r '.[]|.github|select(.)' \
+    | parallel -j5 checkUser
+
+# To check some arbitrary users:
+# parallel -j100 checkUser ::: "eelco" "profpatsch" "Profpatsch" "a"
diff --git a/nixpkgs/maintainers/scripts/check-maintainers-sorted.nix b/nixpkgs/maintainers/scripts/check-maintainers-sorted.nix
new file mode 100644
index 000000000000..3de4e07550c4
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/check-maintainers-sorted.nix
@@ -0,0 +1,57 @@
+let
+  lib = import ../../lib;
+  inherit (lib)
+    add attrNames elemAt foldl' genList length replaceStrings sort toLower trace;
+
+  maintainers = import ../maintainer-list.nix;
+  simplify = replaceStrings [ "-" "_" ] [ "" "" ];
+  compare = a: b: simplify (toLower a) < simplify (toLower b);
+  namesSorted =
+    sort
+      (a: b: a.key < b.key)
+      (map
+        (n: let pos = builtins.unsafeGetAttrPos n maintainers;
+            in assert pos == null -> throw "maintainers entry ${n} is malformed";
+              { name = n; line = pos.line; key = toLower (simplify n); })
+        (attrNames maintainers));
+  before = { name, line, key }:
+    foldl'
+      (acc: n: if n.key < key && (acc == null || n.key > acc.key) then n else acc)
+      null
+      namesSorted;
+  errors = foldl' add 0
+    (map
+      (i: let a = elemAt namesSorted i;
+              b = elemAt namesSorted (i + 1);
+              lim = let t = before a; in if t == null then "the initial {" else t.name;
+          in if a.line >= b.line
+             then trace
+               ("maintainer ${a.name} (line ${toString a.line}) should be listed "
+                + "after ${lim}, not after ${b.name} (line ${toString b.line})")
+               1
+             else 0)
+      (genList (i: i) (length namesSorted - 1)));
+in
+assert errors == 0; "all good!"
+
+# generate edit commands to sort the list.
+# may everything following the last current entry (closing } ff) in the wrong place
+# with lib;
+# concatStringsSep
+#   "\n"
+#   (let first = foldl' (acc: n: if n.line < acc then n.line else acc) 999999999 namesSorted;
+#        commands = map
+#          (i: let e = elemAt namesSorted i;
+#                  begin = foldl'
+#                    (acc: n: if n.line < e.line && n.line > acc then n.line else acc)
+#                    1
+#                    namesSorted;
+#                  end =
+#                    foldl' (acc: n: if n.line > e.line && n.line < acc then n.line else acc)
+#                      999999999
+#                      namesSorted;
+#              in "${toString e.line},${toString (end - 1)} p")
+#          (genList (i: i) (length namesSorted));
+#    in map
+#      (c: "sed -ne '${c}' maintainers/maintainer-list.nix")
+#      ([ "1,${toString (first - 1)} p" ] ++ commands))
diff --git a/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock.sh b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock.sh
new file mode 100755
index 000000000000..b38825d4d3e0
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock.sh
@@ -0,0 +1,4 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -I nixpkgs=. -i bash -p "import ./maintainers/scripts/convert-to-import-cargo-lock" nix-prefetch-git
+
+convert-to-import-cargo-lock "$@"
diff --git a/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/.gitignore b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/.gitignore
new file mode 100644
index 000000000000..ea8c4bf7f35f
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/.gitignore
@@ -0,0 +1 @@
+/target
diff --git a/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/Cargo.lock b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/Cargo.lock
new file mode 100644
index 000000000000..b69fbc59ae84
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/Cargo.lock
@@ -0,0 +1,106 @@
+# This file is automatically @generated by Cargo.
+# It is not intended for manual editing.
+version = 3
+
+[[package]]
+name = "anyhow"
+version = "1.0.69"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "224afbd727c3d6e4b90103ece64b8d1b67fbb1973b1046c2281eed3f3803f800"
+
+[[package]]
+name = "basic-toml"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2e819b667739967cd44d308b8c7b71305d8bb0729ac44a248aa08f33d01950b4"
+dependencies = [
+ "serde",
+]
+
+[[package]]
+name = "convert-to-import-cargo-lock"
+version = "0.1.0"
+dependencies = [
+ "anyhow",
+ "basic-toml",
+ "serde",
+ "serde_json",
+]
+
+[[package]]
+name = "itoa"
+version = "1.0.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fad582f4b9e86b6caa621cabeb0963332d92eea04729ab12892c2533951e6440"
+
+[[package]]
+name = "proc-macro2"
+version = "1.0.51"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5d727cae5b39d21da60fa540906919ad737832fe0b1c165da3a34d6548c849d6"
+dependencies = [
+ "unicode-ident",
+]
+
+[[package]]
+name = "quote"
+version = "1.0.23"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8856d8364d252a14d474036ea1358d63c9e6965c8e5c1885c18f73d70bff9c7b"
+dependencies = [
+ "proc-macro2",
+]
+
+[[package]]
+name = "ryu"
+version = "1.0.12"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7b4b9743ed687d4b4bcedf9ff5eaa7398495ae14e61cba0a295704edbc7decde"
+
+[[package]]
+name = "serde"
+version = "1.0.152"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bb7d1f0d3021d347a83e556fc4683dea2ea09d87bccdf88ff5c12545d89d5efb"
+dependencies = [
+ "serde_derive",
+]
+
+[[package]]
+name = "serde_derive"
+version = "1.0.152"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "af487d118eecd09402d70a5d72551860e788df87b464af30e5ea6a38c75c541e"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "serde_json"
+version = "1.0.93"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cad406b69c91885b5107daf2c29572f6c8cdb3c66826821e286c533490c0bc76"
+dependencies = [
+ "itoa",
+ "ryu",
+ "serde",
+]
+
+[[package]]
+name = "syn"
+version = "1.0.107"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1f4064b5b16e03ae50984a5a8ed5d4f8803e6bc1fd170a3cda91a1be4b18e3f5"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "unicode-ident",
+]
+
+[[package]]
+name = "unicode-ident"
+version = "1.0.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "84a22b9f218b40614adcb3f4ff08b703773ad44fa9423e4e0d346d5db86e4ebc"
diff --git a/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/Cargo.toml b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/Cargo.toml
new file mode 100644
index 000000000000..41f5729f01a2
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/Cargo.toml
@@ -0,0 +1,12 @@
+[package]
+name = "convert-to-import-cargo-lock"
+version = "0.1.0"
+edition = "2021"
+
+# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
+
+[dependencies]
+anyhow = { version = "1.0.69" }
+basic-toml = "0.1.1"
+serde = { version = "1.0.152", features = ["derive"] }
+serde_json = "1.0.93"
diff --git a/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/default.nix b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/default.nix
new file mode 100644
index 000000000000..f4c1f553d64f
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/default.nix
@@ -0,0 +1,16 @@
+with import ../../../. { };
+
+rustPlatform.buildRustPackage {
+  name = "convert-to-import-cargo-lock";
+
+  src = lib.cleanSourceWith {
+    src = ./.;
+    filter = name: type:
+      let
+        name' = builtins.baseNameOf name;
+      in
+      name' != "default.nix" && name' != "target";
+  };
+
+  cargoLock.lockFile = ./Cargo.lock;
+}
diff --git a/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/shell.nix b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/shell.nix
new file mode 100644
index 000000000000..8e913fdcd8be
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/shell.nix
@@ -0,0 +1,5 @@
+with import ../../../. { };
+
+mkShell {
+  packages = [ rustc cargo clippy rustfmt ] ++ lib.optional stdenv.isDarwin libiconv;
+}
diff --git a/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/src/main.rs b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/src/main.rs
new file mode 100644
index 000000000000..6eb6768d14e9
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/convert-to-import-cargo-lock/src/main.rs
@@ -0,0 +1,241 @@
+#![warn(clippy::pedantic)]
+#![allow(clippy::too_many_lines)]
+
+use anyhow::anyhow;
+use serde::Deserialize;
+use std::{collections::HashMap, env, fs, path::PathBuf, process::Command};
+
+#[derive(Deserialize)]
+struct CargoLock<'a> {
+    #[serde(rename = "package", borrow)]
+    packages: Vec<Package<'a>>,
+    metadata: Option<HashMap<&'a str, &'a str>>,
+}
+
+#[derive(Deserialize)]
+struct Package<'a> {
+    name: &'a str,
+    version: &'a str,
+    source: Option<&'a str>,
+    checksum: Option<&'a str>,
+}
+
+#[derive(Deserialize)]
+struct PrefetchOutput {
+    sha256: String,
+}
+
+fn main() -> anyhow::Result<()> {
+    let mut hashes = HashMap::new();
+
+    let attr_count = env::args().len() - 1;
+
+    for (i, attr) in env::args().skip(1).enumerate() {
+        println!("converting {attr} ({}/{attr_count})", i + 1);
+
+        convert(&attr, &mut hashes)?;
+    }
+
+    Ok(())
+}
+
+fn convert(attr: &str, hashes: &mut HashMap<String, String>) -> anyhow::Result<()> {
+    let package_path = nix_eval(format!("{attr}.meta.position"))?
+        .and_then(|p| p.split_once(':').map(|(f, _)| PathBuf::from(f)));
+
+    if package_path.is_none() {
+        eprintln!("can't automatically convert {attr}: doesn't exist");
+        return Ok(());
+    }
+
+    let package_path = package_path.unwrap();
+
+    if package_path.with_file_name("Cargo.lock").exists() {
+        eprintln!("skipping {attr}: already has a vendored Cargo.lock");
+        return Ok(());
+    }
+
+    let mut src = PathBuf::from(
+        String::from_utf8(
+            Command::new("nix-build")
+                .arg("-A")
+                .arg(format!("{attr}.src"))
+                .output()?
+                .stdout,
+        )?
+        .trim(),
+    );
+
+    if !src.exists() {
+        eprintln!("can't automatically convert {attr}: src doesn't exist (bad attr?)");
+        return Ok(());
+    } else if !src.metadata()?.is_dir() {
+        eprintln!("can't automatically convert {attr}: src isn't a directory");
+        return Ok(());
+    }
+
+    if let Some(mut source_root) = nix_eval(format!("{attr}.sourceRoot"))?.map(PathBuf::from) {
+        source_root = source_root.components().skip(1).collect();
+        src.push(source_root);
+    }
+
+    let cargo_lock_path = src.join("Cargo.lock");
+
+    if !cargo_lock_path.exists() {
+        eprintln!("can't automatically convert {attr}: src doesn't contain Cargo.lock");
+        return Ok(());
+    }
+
+    let cargo_lock_content = fs::read_to_string(cargo_lock_path)?;
+
+    let cargo_lock: CargoLock = basic_toml::from_str(&cargo_lock_content)?;
+
+    let mut git_dependencies = Vec::new();
+
+    for package in cargo_lock.packages.iter().filter(|p| {
+        p.source.is_some()
+            && p.checksum
+                .or_else(|| {
+                    cargo_lock
+                        .metadata
+                        .as_ref()?
+                        .get(
+                            format!("checksum {} {} ({})", p.name, p.version, p.source.unwrap())
+                                .as_str(),
+                        )
+                        .copied()
+                })
+                .is_none()
+    }) {
+        let (typ, original_url) = package
+            .source
+            .unwrap()
+            .split_once('+')
+            .expect("dependency should have well-formed source url");
+
+        if let Some(hash) = hashes.get(original_url) {
+            continue;
+        }
+
+        assert_eq!(
+            typ, "git",
+            "packages without checksums should be git dependencies"
+        );
+
+        let (mut url, rev) = original_url
+            .split_once('#')
+            .expect("git dependency should have commit");
+
+        // TODO: improve
+        if let Some((u, _)) = url.split_once('?') {
+            url = u;
+        }
+
+        let prefetch_output: PrefetchOutput = serde_json::from_slice(
+            &Command::new("nix-prefetch-git")
+                .args(["--url", url, "--rev", rev, "--quiet", "--fetch-submodules"])
+                .output()?
+                .stdout,
+        )?;
+
+        let output_hash = String::from_utf8(
+            Command::new("nix")
+                .args([
+                    "--extra-experimental-features",
+                    "nix-command",
+                    "hash",
+                    "to-sri",
+                    "--type",
+                    "sha256",
+                    &prefetch_output.sha256,
+                ])
+                .output()?
+                .stdout,
+        )?;
+
+        let hash = output_hash.trim().to_string();
+
+        git_dependencies.push((
+            format!("{}-{}", package.name, package.version),
+            output_hash.trim().to_string().clone(),
+        ));
+
+        hashes.insert(original_url.to_string(), hash);
+    }
+
+    fs::write(
+        package_path.with_file_name("Cargo.lock"),
+        cargo_lock_content,
+    )?;
+
+    let mut package_lines: Vec<_> = fs::read_to_string(&package_path)?
+        .lines()
+        .map(String::from)
+        .collect();
+
+    let (cargo_deps_line_index, cargo_deps_line) = package_lines
+        .iter_mut()
+        .enumerate()
+        .find(|(_, l)| {
+            l.trim_start().starts_with("cargoHash") || l.trim_start().starts_with("cargoSha256")
+        })
+        .expect("package should contain cargoHash/cargoSha256");
+
+    let spaces = " ".repeat(cargo_deps_line.len() - cargo_deps_line.trim_start().len());
+
+    if git_dependencies.is_empty() {
+        *cargo_deps_line = format!("{spaces}cargoLock.lockFile = ./Cargo.lock;");
+    } else {
+        *cargo_deps_line = format!("{spaces}cargoLock = {{");
+
+        let mut index_iter = cargo_deps_line_index + 1..;
+
+        package_lines.insert(
+            index_iter.next().unwrap(),
+            format!("{spaces}  lockFile = ./Cargo.lock;"),
+        );
+
+        package_lines.insert(
+            index_iter.next().unwrap(),
+            format!("{spaces}  outputHashes = {{"),
+        );
+
+        for ((dep, hash), index) in git_dependencies.drain(..).zip(&mut index_iter) {
+            package_lines.insert(index, format!("{spaces}    {dep:?} = {hash:?};"));
+        }
+
+        package_lines.insert(index_iter.next().unwrap(), format!("{spaces}  }};"));
+        package_lines.insert(index_iter.next().unwrap(), format!("{spaces}}};"));
+    }
+
+    if package_lines.last().map(String::as_str) != Some("") {
+        package_lines.push(String::new());
+    }
+
+    fs::write(package_path, package_lines.join("\n"))?;
+
+    Ok(())
+}
+
+fn nix_eval(attr: impl AsRef<str>) -> anyhow::Result<Option<String>> {
+    let output = String::from_utf8(
+        Command::new("nix-instantiate")
+            .args(["--eval", "-A", attr.as_ref()])
+            .output()?
+            .stdout,
+    )?;
+
+    let trimmed = output.trim();
+
+    if trimmed.is_empty() || trimmed == "null" {
+        Ok(None)
+    } else {
+        Ok(Some(
+            trimmed
+                .strip_prefix('"')
+                .and_then(|p| p.strip_suffix('"'))
+                .ok_or_else(|| anyhow!("couldn't parse nix-instantiate output: {output:?}"))?
+                .to_string(),
+        ))
+    }
+}
diff --git a/nixpkgs/maintainers/scripts/copy-tarballs.pl b/nixpkgs/maintainers/scripts/copy-tarballs.pl
new file mode 100755
index 000000000000..b17cd82f4d1c
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/copy-tarballs.pl
@@ -0,0 +1,252 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i perl -p perl perlPackages.NetAmazonS3 perlPackages.FileSlurp perlPackages.JSON perlPackages.LWPProtocolHttps nixUnstable nixUnstable.perl-bindings
+
+# This command uploads tarballs to tarballs.nixos.org, the
+# content-addressed cache used by fetchurl as a fallback for when
+# upstream tarballs disappear or change. Usage:
+#
+# 1) To upload one or more files:
+#
+#    $ copy-tarballs.pl --file /path/to/tarball.tar.gz
+#
+# 2) To upload all files obtained via calls to fetchurl in a Nix derivation:
+#
+#    $ copy-tarballs.pl --expr '(import <nixpkgs> {}).hello'
+
+use strict;
+use warnings;
+use File::Basename;
+use File::Path;
+use File::Slurp;
+use JSON;
+use Net::Amazon::S3;
+use Nix::Store;
+
+isValidPath("/nix/store/aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa-foo"); # FIXME: forces Nix::Store initialisation
+
+sub usage {
+    die "Syntax: $0 [--dry-run] [--exclude REGEXP] [--expr EXPR | --file FILES...]\n";
+}
+
+my $dryRun = 0;
+my $expr;
+my @fileNames;
+my $exclude;
+
+while (@ARGV) {
+    my $flag = shift @ARGV;
+
+    if ($flag eq "--expr") {
+        $expr = shift @ARGV or die "--expr requires an argument";
+    } elsif ($flag eq "--file") {
+        @fileNames = @ARGV;
+        last;
+    } elsif ($flag eq "--dry-run") {
+        $dryRun = 1;
+    } elsif ($flag eq "--exclude") {
+        $exclude = shift @ARGV or die "--exclude requires an argument";
+    } else {
+        usage();
+    }
+}
+
+my $bucket;
+
+if (not defined $ENV{DEBUG}) {
+    # S3 setup.
+    my $aws_access_key_id = $ENV{'AWS_ACCESS_KEY_ID'} or die "AWS_ACCESS_KEY_ID not set\n";
+    my $aws_secret_access_key = $ENV{'AWS_SECRET_ACCESS_KEY'} or die "AWS_SECRET_ACCESS_KEY not set\n";
+
+    my $s3 = Net::Amazon::S3->new(
+        { aws_access_key_id     => $aws_access_key_id,
+          aws_secret_access_key => $aws_secret_access_key,
+          retry                 => 1,
+          host                  => "s3-eu-west-1.amazonaws.com",
+        });
+
+    $bucket = $s3->bucket("nixpkgs-tarballs") or die;
+}
+
+my $doWrite = 0;
+my $cacheFile = ($ENV{"HOME"} or die "\$HOME is not set") . "/.cache/nix/copy-tarballs";
+my %cache;
+$cache{$_} = 1 foreach read_file($cacheFile, err_mode => 'quiet', chomp => 1);
+$doWrite = 1;
+
+END() {
+    File::Path::mkpath(dirname($cacheFile), 0, 0755);
+    write_file($cacheFile, map { "$_\n" } keys %cache) if $doWrite;
+}
+
+sub alreadyMirrored {
+    my ($algo, $hash) = @_;
+    my $key = "$algo/$hash";
+    return 1 if defined $cache{$key};
+    my $res = defined $bucket->get_key($key);
+    $cache{$key} = 1 if $res;
+    return $res;
+}
+
+sub uploadFile {
+    my ($fn, $name) = @_;
+
+    my $md5_16 = hashFile("md5", 0, $fn) or die;
+    my $sha1_16 = hashFile("sha1", 0, $fn) or die;
+    my $sha256_32 = hashFile("sha256", 1, $fn) or die;
+    my $sha256_16 = hashFile("sha256", 0, $fn) or die;
+    my $sha512_32 = hashFile("sha512", 1, $fn) or die;
+    my $sha512_16 = hashFile("sha512", 0, $fn) or die;
+
+    my $mainKey = "sha512/$sha512_16";
+
+    # Create redirects from the other hash types.
+    sub redirect {
+        my ($name, $dest) = @_;
+        #print STDERR "linking $name to $dest...\n";
+        $bucket->add_key($name, "", {
+            'x-amz-website-redirect-location' => "/" . $dest,
+            'x-amz-acl' => "public-read"
+        })
+            or die "failed to create redirect from $name to $dest\n";
+        $cache{$name} = 1;
+    }
+    redirect "md5/$md5_16", $mainKey;
+    redirect "sha1/$sha1_16", $mainKey;
+    redirect "sha256/$sha256_32", $mainKey;
+    redirect "sha256/$sha256_16", $mainKey;
+    redirect "sha512/$sha512_32", $mainKey;
+
+    # Upload the file as sha512/<hash-in-base-16>.
+    print STDERR "uploading $fn to $mainKey...\n";
+    $bucket->add_key_filename($mainKey, $fn, {
+        'x-amz-meta-original-name' => $name,
+        'x-amz-acl' => "public-read"
+    })
+        or die "failed to upload $fn to $mainKey\n";
+    $cache{$mainKey} = 1;
+}
+
+if (scalar @fileNames) {
+    my $res = 0;
+    foreach my $fn (@fileNames) {
+        eval {
+            if (alreadyMirrored("sha512", hashFile("sha512", 0, $fn))) {
+                print STDERR "$fn is already mirrored\n";
+            } else {
+                uploadFile($fn, basename $fn);
+            }
+        };
+        if ($@) {
+            warn "$@";
+            $res = 1;
+        }
+    }
+    exit $res;
+}
+
+elsif (defined $expr) {
+
+    # Evaluate find-tarballs.nix.
+    my $pid = open(JSON, "-|", "nix-instantiate", "--eval", "--json", "--strict",
+                   "<nixpkgs/maintainers/scripts/find-tarballs.nix>",
+                   "--arg", "expr", $expr);
+    my $stdout = <JSON>;
+    waitpid($pid, 0);
+    die "$0: evaluation failed\n" if $?;
+    close JSON;
+
+    my $fetches = decode_json($stdout);
+
+    print STDERR "evaluation returned ", scalar(@{$fetches}), " tarballs\n";
+
+    # Check every fetchurl call discovered by find-tarballs.nix.
+    my $mirrored = 0;
+    my $have = 0;
+    foreach my $fetch (sort { $a->{urls}->[0] cmp $b->{urls}->[0] } @{$fetches}) {
+        my $urls = $fetch->{urls};
+        my $algo = $fetch->{type};
+        my $hash = $fetch->{hash};
+        my $name = $fetch->{name};
+        my $isPatch = $fetch->{isPatch};
+
+        if ($isPatch) {
+            print STDERR "skipping $urls->[0] (support for patches is missing)\n";
+            next;
+        }
+
+        if ($hash =~ /^([a-z0-9]+)-([A-Za-z0-9+\/=]+)$/) {
+            $algo = $1;
+            $hash = `nix hash to-base16 $hash` or die;
+            chomp $hash;
+        }
+
+        next unless $algo =~ /^[a-z0-9]+$/;
+
+        # Convert non-SRI base-64 to base-16.
+        if ($hash =~ /^[A-Za-z0-9+\/=]+$/) {
+            $hash = `nix hash to-base16 --type '$algo' $hash` or die;
+            chomp $hash;
+        }
+
+        my $storePath = makeFixedOutputPath(0, $algo, $hash, $name);
+
+        for my $url (@$urls) {
+            if (defined $ENV{DEBUG}) {
+                print "$url $algo $hash\n";
+                next;
+            }
+
+            if ($url !~ /^http:/ && $url !~ /^https:/ && $url !~ /^ftp:/ && $url !~ /^mirror:/) {
+                print STDERR "skipping $url (unsupported scheme)\n";
+                next;
+            }
+
+            next if defined $exclude && $url =~ /$exclude/;
+
+            if (alreadyMirrored($algo, $hash)) {
+                $have++;
+                last;
+            }
+
+            print STDERR "mirroring $url ($storePath, $algo, $hash)...\n";
+
+            if ($dryRun) {
+                $mirrored++;
+                last;
+            }
+
+            # Substitute the output.
+            if (!isValidPath($storePath)) {
+                system("nix-store", "-r", $storePath);
+            }
+
+            # Otherwise download the file using nix-prefetch-url.
+            if (!isValidPath($storePath)) {
+                $ENV{QUIET} = 1;
+                $ENV{PRINT_PATH} = 1;
+                my $fh;
+                my $pid = open($fh, "-|", "nix-prefetch-url", "--type", $algo, $url, $hash) or die;
+                waitpid($pid, 0) or die;
+                if ($? != 0) {
+                    print STDERR "failed to fetch $url: $?\n";
+                    next;
+                }
+                <$fh>; my $storePath2 = <$fh>; chomp $storePath2;
+                if ($storePath ne $storePath2) {
+                    warn "strange: $storePath != $storePath2\n";
+                    next;
+                }
+            }
+
+            uploadFile($storePath, $url);
+            $mirrored++;
+            last;
+        }
+    }
+
+    print STDERR "mirrored $mirrored files, already have $have files\n";
+}
+
+else {
+    usage();
+}
diff --git a/nixpkgs/maintainers/scripts/db-to-md.sh b/nixpkgs/maintainers/scripts/db-to-md.sh
new file mode 100755
index 000000000000..aa2a2775b6de
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/db-to-md.sh
@@ -0,0 +1,88 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -I nixpkgs=. -i bash -p pandoc
+
+# This script is temporarily needed while we transition the manual to
+# CommonMark. It converts DocBook files into our CommonMark flavour.
+
+debug=
+files=()
+
+while [ "$#" -gt 0 ]; do
+    i="$1"; shift 1
+    case "$i" in
+      --debug)
+        debug=1
+        ;;
+      *)
+        files+=("$i")
+        ;;
+    esac
+done
+
+echo "WARNING: This is an experimental script and might not preserve all formatting." > /dev/stderr
+echo "Please report any issues you discover." > /dev/stderr
+
+outExtension="md"
+if [[ $debug ]]; then
+    outExtension="json"
+fi
+
+DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" >/dev/null 2>&1 && pwd )"
+
+# NOTE: Keep in sync with Nixpkgs manual (/doc/Makefile).
+# TODO: Remove raw-attribute when we can get rid of DocBook altogether.
+pandoc_commonmark_enabled_extensions=+attributes+fenced_divs+footnotes+bracketed_spans+definition_lists+pipe_tables+raw_attribute
+targetLang="commonmark${pandoc_commonmark_enabled_extensions}+smart"
+if [[ $debug ]]; then
+    targetLang=json
+fi
+pandoc_flags=(
+    # Not needed:
+    # - diagram-generator.lua (we do not support that in NixOS manual to limit dependencies)
+    # - media extraction (was only required for diagram generator)
+    # - myst-reader/roles.lua (only relevant for MyST → DocBook)
+    # - link-manpages.lua (links should only be added to display output)
+    # - docbook-writer/rst-roles.lua (only relevant for → DocBook)
+    # - docbook-writer/labelless-link-is-xref.lua (only relevant for → DocBook)
+    "--lua-filter=$DIR/../../doc/build-aux/pandoc-filters/docbook-reader/citerefentry-to-rst-role.lua"
+    "--lua-filter=$DIR/../../doc/build-aux/pandoc-filters/myst-writer/roles.lua"
+    "--lua-filter=$DIR/doc/unknown-code-language.lua"
+    -f docbook
+    -t "$targetLang"
+    --tab-stop=2
+    --wrap=none
+)
+
+for file in "${files[@]}"; do
+    if [[ ! -f "$file" ]]; then
+        echo "db-to-md.sh: $file does not exist" > /dev/stderr
+        exit 1
+    else
+    rootElement=$(xmllint --xpath 'name(//*)' "$file")
+
+    if [[ $rootElement = chapter ]]; then
+        extension=".chapter.$outExtension"
+    elif [[ $rootElement = section ]]; then
+        extension=".section.$outExtension"
+    else
+        echo "db-to-md.sh: $file contains an unsupported root element $rootElement" > /dev/stderr
+        exit 1
+    fi
+
+    outFile="${file%".section.xml"}"
+    outFile="${outFile%".chapter.xml"}"
+    outFile="${outFile%".xml"}$extension"
+    temp1=$(mktemp)
+    $DIR/doc/escape-code-markup.py "$file" "$temp1"
+    if [[ $debug ]]; then
+        echo "Converted $file to $temp1" > /dev/stderr
+    fi
+    temp2=$(mktemp)
+    $DIR/doc/replace-xrefs-by-empty-links.py "$temp1" "$temp2"
+    if [[ $debug ]]; then
+        echo "Converted $temp1 to $temp2" > /dev/stderr
+    fi
+    pandoc "$temp2" -o "$outFile" "${pandoc_flags[@]}"
+    echo "Converted $file to $outFile" > /dev/stderr
+  fi
+done
diff --git a/nixpkgs/maintainers/scripts/debian-patches.sh b/nixpkgs/maintainers/scripts/debian-patches.sh
new file mode 100755
index 000000000000..1f021c224c3a
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/debian-patches.sh
@@ -0,0 +1,34 @@
+#!/usr/bin/env bash
+
+# Download patches from debian project
+# Usage $0 debian-patches.txt debian-patches.nix
+# An example input and output files can be found in tools/graphics/plotutils
+
+DEB_URL=https://sources.debian.org/data/main
+declare -a deb_patches
+mapfile -t deb_patches < $1
+
+# First letter
+deb_prefix="${deb_patches[0]:0:1}"
+prefix="${DEB_URL}/${deb_prefix}/${deb_patches[0]}/debian/patches"
+
+if [[ -n "$2" ]]; then
+    exec 1> $2
+fi
+
+cat <<EOF
+# Generated by $(basename $0) from $(basename $1)
+let
+  prefix = "${prefix}";
+in
+[
+EOF
+for ((i=1;i < ${#deb_patches[@]}; ++i)); do
+    url="${prefix}/${deb_patches[$i]}"
+    sha256=$(nix-prefetch-url $url)
+    echo "  {"
+    echo "    url = \"\${prefix}/${deb_patches[$i]}\";"
+    echo "    sha256 = \"$sha256\";"
+    echo "  }"
+done
+echo "]"
diff --git a/nixpkgs/maintainers/scripts/dep-licenses.sh b/nixpkgs/maintainers/scripts/dep-licenses.sh
new file mode 100755
index 000000000000..816dcf6d7f76
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/dep-licenses.sh
@@ -0,0 +1,57 @@
+#!/bin/sh
+
+attr=$1
+
+: ${NIXPKGS=/etc/nixos/nixpkgs}
+
+tmp=$(mktemp --tmpdir -d nixpkgs-dep-license.XXXXXX)
+
+exitHandler() {
+    exitCode=$?
+    rm -rf "$tmp"
+    return $exitCode
+}
+
+trap "exitHandler" EXIT
+
+# fetch the trace and the drvPath of the attribute.
+nix-instantiate $NIXPKGS -A $attr --show-trace > "$tmp/drvPath" 2> "$tmp/trace" || {
+  cat 1>&2 - "$tmp/trace" <<EOF
+An error occurred while evaluating $attr.
+EOF
+  exit 1
+}
+
+# generate a sed script based on the trace output.
+sed '
+  \,@:.*:@, {
+    # \1  *.drv file
+    # \2  License terms
+    s,.*@:drv:\(.*\):\(.*\):@.*,s!\1!\1: \2!; t;,
+    s!Str(\\\"\([^,]*\)\\\",\[\])!\1!g
+    b
+  }
+  d
+' "$tmp/trace" > "$tmp/filter.sed"
+
+if test $(wc -l "$tmp/filter.sed" | sed 's/ .*//') == 0; then
+  echo 1>&2 "
+No derivation mentionned in the stack trace.  Either your derivation does
+not use stdenv.mkDerivation or you forgot to use the stdenv adapter named
+traceDrvLicenses.
+
+-  defaultStdenv = allStdenvs.stdenv;
++  defaultStdenv = traceDrvLicenses allStdenvs.stdenv;
+"
+  exit 1
+fi
+
+
+# remove all dependencies which are using stdenv.mkDerivation
+echo '
+d
+' >> "$tmp/filter.sed"
+
+nix-store -q --tree $(cat "$tmp/drvPath") | sed -f "$tmp/filter.sed"
+
+exit 0;
diff --git a/nixpkgs/maintainers/scripts/doc/escape-code-markup.py b/nixpkgs/maintainers/scripts/doc/escape-code-markup.py
new file mode 100755
index 000000000000..015435b698e6
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/doc/escape-code-markup.py
@@ -0,0 +1,97 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -I nixpkgs=channel:nixos-unstable -i python3 -p python3 -p python3.pkgs.lxml
+
+"""
+Pandoc will strip any markup within code elements so
+let’s escape them so that they can be handled manually.
+"""
+
+import lxml.etree as ET
+import re
+import sys
+
+def replace_element_by_text(el: ET.Element, text: str) -> None:
+    """
+    Author: bernulf
+    Source: https://stackoverflow.com/a/10520552/160386
+    SPDX-License-Identifier: CC-BY-SA-3.0
+    """
+    text = text + (el.tail or "")
+    parent = el.getparent()
+    if parent is not None:
+        previous = el.getprevious()
+        if previous is not None:
+            previous.tail = (previous.tail or "") + text
+        else:
+            parent.text = (parent.text or "") + text
+        parent.remove(el)
+
+DOCBOOK_NS = "http://docbook.org/ns/docbook"
+
+# List of elements that pandoc’s DocBook reader strips markup from.
+# https://github.com/jgm/pandoc/blob/master/src/Text/Pandoc/Readers/DocBook.hs
+code_elements = [
+    # CodeBlock
+    "literallayout",
+    "screen",
+    "programlisting",
+    # Code (inline)
+    "classname",
+    "code",
+    "filename",
+    "envar",
+    "literal",
+    "computeroutput",
+    "prompt",
+    "parameter",
+    "option",
+    "markup",
+    "wordasword",
+    "command",
+    "varname",
+    "function",
+    "type",
+    "symbol",
+    "constant",
+    "userinput",
+    "systemitem",
+]
+
+XMLNS_REGEX = re.compile(r'\s+xmlns(?::[^=]+)?="[^"]*"')
+ROOT_ELEMENT_REGEX = re.compile(r'^\s*<[^>]+>')
+
+def remove_xmlns(match: re.Match) -> str:
+    """
+    Removes xmlns attributes.
+
+    Expects a match containing an opening tag.
+    """
+    return XMLNS_REGEX.sub('', match.group(0))
+
+if __name__ == '__main__':
+    assert len(sys.argv) >= 3, "usage: escape-code-markup.py <input> <output>"
+
+    tree = ET.parse(sys.argv[1])
+    name_predicate = " or ".join([f"local-name()='{el}'" for el in code_elements])
+
+    for markup in tree.xpath(f"//*[({name_predicate}) and namespace-uri()='{DOCBOOK_NS}']/*"):
+        text = ET.tostring(markup, encoding=str)
+
+        # tostring adds xmlns attributes to the element we want to stringify
+        # as if it was supposed to be usable standalone.
+        # We are just converting it to CDATA so we do not care.
+        # Let’s strip the namespace declarations to keep the code clean.
+        #
+        # Note that this removes even namespaces that were potentially
+        # in the original file. Though, that should be very rare –
+        # most of the time, we will stringify empty DocBook elements
+        # like <xref> or <co> or, at worst, <link> with xlink:href attribute.
+        #
+        # Also note that the regex expects the root element to be first
+        # thing in the string. But that should be fine, the tostring method
+        # does not produce XML declaration or doctype by default.
+        text = ROOT_ELEMENT_REGEX.sub(remove_xmlns, text)
+
+        replace_element_by_text(markup, text)
+
+    tree.write(sys.argv[2])
diff --git a/nixpkgs/maintainers/scripts/doc/list-systemd-manpages.zsh b/nixpkgs/maintainers/scripts/doc/list-systemd-manpages.zsh
new file mode 100755
index 000000000000..6737a4d3fef1
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/doc/list-systemd-manpages.zsh
@@ -0,0 +1,33 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -i zsh -p zsh
+set -euo pipefail
+
+# cd into nixpkgs' root, get the store path of `systemd.man`
+cd "$(dirname "$0")/../../.."
+SYSTEMD_MAN_DIR="$(nix-build -A systemd.man)/share/man"
+
+# For each manual section
+for section in {1..8}; do
+  sec_dir="${SYSTEMD_MAN_DIR}/man${section}"
+
+  # skip section 3 (library calls)
+  ! [[ $section -eq 3 ]] || continue
+
+  # for each manpage in that section (potentially none)
+  for manpage in ${sec_dir}/*(N); do
+    # strip the directory prefix and (compressed) manpage suffix
+    page="$(basename "$manpage" ".${section}.gz")"
+
+    # if this is the manpage of a service unit
+    if [[ "$page" =~ ".*\.service" ]]; then
+     # ... and a manpage exists without the `.service` suffix
+     potential_alias="${sec_dir}/${page%\.service}.${section}.gz"
+     ! [[ -e "${potential_alias}" &&
+              # ... which points to the same file, then skip
+              "$(gunzip -c "${potential_alias}")" == ".so ${page}.${section}" ]] || continue
+    fi
+
+    # else produce a JSON fragment, with the link to the upstream manpage (as HTML)
+    echo "  \"${page}(${section})\": \"https://www.freedesktop.org/software/systemd/man/${page}.html\","
+  done
+done
diff --git a/nixpkgs/maintainers/scripts/doc/replace-xrefs-by-empty-links.py b/nixpkgs/maintainers/scripts/doc/replace-xrefs-by-empty-links.py
new file mode 100755
index 000000000000..2006ef897f7a
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/doc/replace-xrefs-by-empty-links.py
@@ -0,0 +1,32 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -I nixpkgs=channel:nixos-unstable -i python3 -p python3 -p python3.pkgs.lxml
+
+"""
+Pandoc will try to resolve xrefs and replace them with regular links.
+let’s replace them with links with empty labels which MyST
+and our pandoc filters recognize as cross-references.
+"""
+
+import lxml.etree as ET
+import sys
+
+XLINK_NS = "http://www.w3.org/1999/xlink"
+
+ns = {
+    "db": "http://docbook.org/ns/docbook",
+}
+
+
+if __name__ == '__main__':
+    assert len(sys.argv) >= 3, "usage: replace-xrefs-by-empty-links.py <input> <output>"
+
+    tree = ET.parse(sys.argv[1])
+    for xref in tree.findall(".//db:xref", ns):
+        text = ET.tostring(xref, encoding=str)
+        parent = xref.getparent()
+        link = parent.makeelement('link')
+        target_name = xref.get("linkend")
+        link.set(f"{{{XLINK_NS}}}href", f"#{target_name}")
+        parent.replace(xref, link)
+
+    tree.write(sys.argv[2])
diff --git a/nixpkgs/maintainers/scripts/doc/unknown-code-language.lua b/nixpkgs/maintainers/scripts/doc/unknown-code-language.lua
new file mode 100644
index 000000000000..85d8df4690ba
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/doc/unknown-code-language.lua
@@ -0,0 +1,12 @@
+--[[
+Adds “unknown” class to CodeBlock AST nodes without any classes.
+
+This will cause Pandoc to use fenced code block, which we prefer.
+]]
+
+function CodeBlock(elem)
+  if #elem.classes == 0 then
+    elem.classes:insert('unknown')
+    return elem
+  end
+end
diff --git a/nixpkgs/maintainers/scripts/eval-release.nix b/nixpkgs/maintainers/scripts/eval-release.nix
new file mode 100644
index 000000000000..4f0ca2465025
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/eval-release.nix
@@ -0,0 +1,25 @@
+# Evaluate `release.nix' like Hydra would.  Too bad nix-instantiate
+# can't to do this.
+
+with import ../../lib;
+
+let
+  trace = if builtins.getEnv "VERBOSE" == "1" then builtins.trace else (x: y: y);
+
+  rel = removeAttrs (import ../../pkgs/top-level/release.nix { }) [ "tarball" "unstable" "xbursttools" ];
+
+  # Add the ‘recurseForDerivations’ attribute to ensure that
+  # nix-instantiate recurses into nested attribute sets.
+  recurse = path: attrs:
+    if (builtins.tryEval attrs).success then
+      if isDerivation attrs
+      then
+        if (builtins.tryEval attrs.drvPath).success
+        then { inherit (attrs) name drvPath; }
+        else { failed = true; }
+      else if attrs == null then {}
+      else { recurseForDerivations = true; } //
+           mapAttrs (n: v: let path' = path ++ [n]; in trace path' (recurse path' v)) attrs
+    else { };
+
+in recurse [] rel
diff --git a/nixpkgs/maintainers/scripts/eval-release.sh b/nixpkgs/maintainers/scripts/eval-release.sh
new file mode 100755
index 000000000000..b588c767b6ae
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/eval-release.sh
@@ -0,0 +1,11 @@
+#!/usr/bin/env bash
+
+if [[ -z "$VERBOSE" ]]; then
+  echo "You may set VERBOSE=1 to see debug output or to any other non-empty string to make this script completely silent"
+fi
+unset HOME NIXPKGS_CONFIG # Force empty config
+
+# With the default heap size (380MB), nix-instantiate fails:
+# Too many heap sections: Increase MAXHINCR or MAX_HEAP_SECTS
+export GC_INITIAL_HEAP_SIZE=${GC_INITIAL_HEAP_SIZE:-2000000000} # 2GB
+nix-instantiate --strict --eval-only --xml --show-trace "$(dirname "$0")"/eval-release.nix 2>&1 > /dev/null
diff --git a/nixpkgs/maintainers/scripts/feature-freeze-teams.pl b/nixpkgs/maintainers/scripts/feature-freeze-teams.pl
new file mode 100755
index 000000000000..1c1a5c00907d
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/feature-freeze-teams.pl
@@ -0,0 +1,98 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -i perl -p perl -p perlPackages.JSON perlPackages.LWPUserAgent perlPackages.LWPProtocolHttps perlPackages.TermReadKey
+
+# This script generates a list of teams to ping for the Feature Freeze announcement on Discourse.
+# It's intended to be used by Release Managers before creating such posts.
+#
+# The script interactively reads a GitHub username and a corresponding GitHub Personal Access token.
+# This is required to access the GitHub Teams API so the token needs at least the read:org privilege.
+
+## no critic (InputOutput::RequireCheckedSyscalls, InputOutput::ProhibitBacktickOperators)
+use strict;
+use warnings;
+use Carp;
+use Cwd 'abs_path';
+use File::Basename;
+use JSON qw(decode_json);
+use LWP::UserAgent;
+use Term::ReadKey qw(ReadLine ReadMode);
+
+sub github_team_members {
+    my ($team_name, $username, $token) = @_;
+    my @ret;
+
+    my $req = HTTP::Request->new('GET', "https://api.github.com/orgs/NixOS/teams/$team_name/members", [ 'Accept' => 'application/vnd.github.v3+json' ]);
+    $req->authorization_basic($username, $token);
+    my $response = LWP::UserAgent->new->request($req);
+
+    if ($response->is_success) {
+        my $content = decode_json($response->decoded_content);
+        foreach (@{$content}) {
+            push @ret, $_->{'login'};
+        }
+    } else {
+        print {*STDERR} "!! Requesting members of GitHub Team '$team_name' failed: " . $response->status_line;
+    }
+
+    return \@ret;
+}
+
+# Read GitHub credentials
+print {*STDERR} 'GitHub username: ';
+my $github_user = ReadLine(0);
+ReadMode('noecho');
+print {*STDERR} 'GitHub personal access token (no echo): ';
+my $github_token = ReadLine(0);
+ReadMode('restore');
+print {*STDERR} "\n";
+chomp $github_user;
+chomp $github_token;
+
+# Read nix output
+my $nix_version = `nix --version`;
+my $out;
+my $lib_path = abs_path(dirname(__FILE__)) . '../../../lib';
+if ($nix_version =~ m/2[.]3[.]/msx) {
+    $out = `nix eval --json '(import $lib_path).teams'` || croak 'nix eval failed';
+} else {
+    $out = `nix --extra-experimental-features nix-command eval --json --impure --expr '(import $lib_path).teams'` || croak('nix eval failed');
+}
+my $data = decode_json($out);
+
+# Process teams
+print {*STDERR} "\n";
+while (my ($team_nix_key, $team_config) = each %{$data}) {
+    # Ignore teams that don't want to be or can't be pinged
+    if (not defined $team_config->{enableFeatureFreezePing} or not $team_config->{enableFeatureFreezePing}) {
+        next;
+    }
+    if (not defined $team_config->{shortName}) {
+        print {*STDERR} "!! The team with the nix key '$team_nix_key' has no shortName set - ignoring";
+        next;
+    }
+    #  Team name
+    print {*STDERR} "$team_config->{shortName}:";
+    # GitHub Teams
+    my @github_members;
+    if (defined $team_config->{githubTeams}) {
+        foreach (@{$team_config->{githubTeams}}) {
+            print {*STDERR} " \@NixOS/${_}";
+            push @github_members, @{github_team_members($_, $github_user, $github_token)};
+        }
+    }
+    my %github_members = map { $_ => 1 } @github_members;
+    # Members
+    if (defined $team_config->{members}) {
+        foreach (@{$team_config->{members}}) {
+            my %user = %{$_};
+            my $github_handle = $user{'github'};
+            # Ensure we don't ping team members twice (as team member and directly)
+            if (defined $github_members{$github_handle}) {
+                next;
+            }
+            print {*STDERR} " \@$github_handle";
+        }
+    }
+
+    print {*STDERR} "\n";
+}
diff --git a/nixpkgs/maintainers/scripts/fetch-kde-qt.sh b/nixpkgs/maintainers/scripts/fetch-kde-qt.sh
new file mode 100755
index 000000000000..c43e8ad904d7
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/fetch-kde-qt.sh
@@ -0,0 +1,196 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p coreutils findutils gnused nix wget
+
+set -efuo pipefail
+export LC_COLLATE=C # fix sort order
+
+# parse files and folders from https://download.kde.org/ and https://download.qt.io/
+# you can override this function in fetch.sh
+function PARSE_INDEX() {
+    cat "$1" | grep -o -E -e '\s+href="[^"]+\.tar\.xz"' -e '\s+href="[-_a-zA-Z0-9]+/"' | cut -d'"' -f2 | sort | uniq
+}
+
+if [ $# != 1 ]; then
+    echo "example use:" >&2
+    echo "cd nixpkgs/" >&2
+    echo "./maintainers/scripts/fetch-kde-qt.sh pkgs/development/libraries/qt-5/5.12" >&2
+    exit 1
+fi
+
+if ! echo "$1" | grep -q '^pkgs/'; then
+    echo "error: path argument must start with pkgs/" >&2
+    exit 1
+fi
+
+# need absolute path for the pushd-popd block
+if [ -f "$1" ]; then
+    echo "ok: using fetchfile $1"
+    fetchfilerel="$1"
+    fetchfile="$(readlink -f "$fetchfilerel")" # resolve absolute path
+    basedir="$(dirname "$fetchfile")"
+    basedirrel="$(dirname "$fetchfilerel")"
+elif [ -d "$1" ]; then
+    echo "ok: using basedir $1"
+    basedirrel="$1"
+    basedir="$(readlink -f "$basedirrel")" # resolve absolute path
+    if ! [ -d "$basedir" ]; then
+        basedir="$(dirname "$basedir")"
+    fi
+    fetchfile="$basedir/fetch.sh"
+else
+    echo 'error: $1 must be file or dir' >&2
+    exit 1
+fi
+
+pkgname=$(basename "$basedir")
+SRCS="$basedir/srcs.nix"
+srcsrel="$basedirrel/srcs.nix"
+
+source "$fetchfile"
+
+if [ -n "$WGET_ARGS" ]; then # old format
+    BASE_URL="${WGET_ARGS[0]}" # convert to new format
+    # validate
+    if ! echo "$BASE_URL" | grep -q -E '^(http|https|ftp)://'; then
+        printf 'error: from WGET_ARGS, converted invalid BASE_URL: %q\n' "$BASE_URL" >&2
+        exit 1
+    fi
+    printf 'ok: from WGET_ARGS, converted BASE_URL: %q\n' "$BASE_URL"
+elif [ -n "$BASE_URL" ]; then # new format
+    :
+else
+    echo "error: fetch.sh must set either WGET_ARGS or BASE_URL" >&2
+    exit 1
+fi
+
+tmptpl=tmp.fetch-kde-qt.$pkgname.XXXXXXXXXX
+
+tmp=$(mktemp -d $tmptpl)
+pushd $tmp >/dev/null
+echo "tempdir is $tmp"
+
+wgetargs='--quiet --show-progress'
+#wgetargs='' # debug
+
+dirlist="$BASE_URL"
+filelist=""
+base_url_len=${#BASE_URL}
+
+clean_urls() {
+    # // -> /
+    sed -E 's,//+,/,g' | sed -E 's,^(http|https|ftp):/,&/,'
+}
+
+while [ -n "$dirlist" ]
+do
+    for dirurl in $dirlist
+    do
+        echo "fetching index.html from $dirurl"
+        relpath=$(echo "./${dirurl:$base_url_len}" | clean_urls)
+        mkdir -p "$relpath"
+        indexfile=$(echo "$relpath/index.html" | clean_urls)
+        wget $wgetargs -O "$indexfile" "$dirurl"
+        echo "parsing $indexfile"
+        filedirlist="$(PARSE_INDEX "$indexfile")"
+        filelist_next="$(echo "$filedirlist" | grep '\.tar\.xz$' | while read file; do echo "$dirurl/$file"; done)"
+        filelist_next="$(echo "$filelist_next" | clean_urls)"
+        [ -n "$filelist" ] && filelist+=$'\n'
+        filelist+="$filelist_next"
+        dirlist="$(echo "$filedirlist" | grep -v '\.tar\.xz$' | while read dir; do echo "$dirurl/$dir"; done || true)"
+        dirlist="$(echo "$dirlist" | clean_urls)"
+    done
+done
+
+filecount=$(echo "$filelist" | wc -l)
+
+if [ -z "$filelist" ]
+then
+    echo "error: no files parsed from $tmp/index.html"
+    exit 1
+fi
+
+echo "parsed $filecount tar.xz files:"; echo "$filelist"
+
+# most time is spent here
+echo "fetching $filecount sha256 files ..."
+urllist="$(echo "$filelist" | while read file; do echo "$file.sha256"; done)"
+# wget -r: keep directory structure
+echo "$urllist" | xargs wget $wgetargs -nH -r -c --no-parent && {
+    actual=$(find . -type f -name '*.sha256' | wc -l)
+    echo "fetching $filecount sha256 files done: got $actual files"
+} || {
+    # workaround: in rare cases, the server does not provide the sha256 files
+    # for example when the release is just a few hours old
+    # and the servers are not yet fully synced
+    actual=$(find . -type f -name '*.sha256' | wc -l)
+    echo "fetching $filecount sha256 files failed: got only $actual files"
+
+    # TODO fetch only missing tar.xz files
+    echo "fetching $filecount tar.xz files ..."
+    echo "$filelist" | xargs wget $wgetargs -nH -r -c --no-parent
+
+    echo "generating sha256 files ..."
+    find . -type f -name '*.tar.xz' | while read src; do
+        name=$(basename "$src")
+        sha256=$(sha256sum "$src" | cut -d' ' -f1)
+        echo "$sha256  $name" >"$src.sha256"
+    done
+}
+
+csv=$(mktemp $tmptpl.csv)
+echo "writing temporary file $csv ..."
+find . -type f -name '*.sha256' | while read sha256file; do
+    src="${sha256file%.*}" # remove extension
+    sha256=$(cat $sha256file | cut -d' ' -f1) # base16
+    sha256=$(nix-hash --type sha256 --to-base32 $sha256)
+    # Sanitize file name
+    filename=$(basename "$src" | tr '@' '_')
+    nameVersion="${filename%.tar.*}"
+    name=$(echo "$nameVersion" | sed -e 's,-[[:digit:]].*,,' | sed -e 's,-opensource-src$,,' | sed -e 's,-everywhere-src$,,')
+    version=$(echo "$nameVersion" | sed -e 's,^\([[:alpha:]][[:alnum:]]*-\)\+,,')
+    echo "$name,$version,$src,$filename,$sha256" >>$csv
+done
+
+files_before=$(grep -c 'src = ' "$SRCS")
+
+echo "writing output file $SRCS ..."
+cat >"$SRCS" <<EOF
+# DO NOT EDIT! This file is generated automatically.
+# Command: $0 $@
+{ fetchurl, mirror }:
+
+{
+EOF
+
+gawk -F , "{ print \$1 }" $csv | sort | uniq | while read name; do
+    versions=$(gawk -F , "/^$name,/ { print \$2 }" $csv)
+    latestVersion=$(echo "$versions" | sort -rV | head -n 1)
+    src=$(gawk -F , "/^$name,$latestVersion,/ { print \$3 }" $csv)
+    filename=$(gawk -F , "/^$name,$latestVersion,/ { print \$4 }" $csv)
+    sha256=$(gawk -F , "/^$name,$latestVersion,/ { print \$5 }" $csv)
+    url="${src:2}"
+    cat >>"$SRCS" <<EOF
+  $name = {
+    version = "$latestVersion";
+    src = fetchurl {
+      url = "\${mirror}/$url";
+      sha256 = "$sha256";
+      name = "$filename";
+    };
+  };
+EOF
+done
+
+echo "}" >>"$SRCS"
+
+files_after=$(grep -c 'src = ' "$SRCS")
+echo "files before: $files_before"
+echo "files after:  $files_after"
+
+echo "compare:"
+echo "git diff $srcsrel"
+
+popd >/dev/null
+rm -fr $tmp >/dev/null
+
+rm -f $csv >/dev/null
diff --git a/nixpkgs/maintainers/scripts/find-tarballs.nix b/nixpkgs/maintainers/scripts/find-tarballs.nix
new file mode 100644
index 000000000000..c47b5168abd9
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/find-tarballs.nix
@@ -0,0 +1,50 @@
+# This expression returns a list of all fetchurl calls used by ‘expr’.
+
+with import ../.. { };
+with lib;
+
+{ expr }:
+
+let
+
+  root = expr;
+
+  uniqueFiles = map (x: x.file) (genericClosure {
+    startSet = map (file: { key = with file; (if type == null then "" else type + "+") + hash; inherit file; }) files;
+    operator = const [ ];
+  });
+
+  files = map (drv: { urls = drv.urls or [ drv.url ]; hash = drv.outputHash; isPatch = (drv?postFetch && drv.postFetch != ""); type = drv.outputHashAlgo; name = drv.name; }) fetchurlDependencies;
+
+  fetchurlDependencies =
+    filter
+      (drv: drv.outputHash or "" != "" && drv.outputHashMode or "flat" == "flat"
+          && (drv ? url || drv ? urls))
+      dependencies;
+
+  dependencies = map (x: x.value) (genericClosure {
+    startSet = map keyDrv (derivationsIn' root);
+    operator = { key, value }: map keyDrv (immediateDependenciesOf value);
+  });
+
+  derivationsIn' = x:
+    if !canEval x then []
+    else if isDerivation x then optional (canEval x.drvPath) x
+    else if isList x then concatLists (map derivationsIn' x)
+    else if isAttrs x then concatLists (mapAttrsToList (n: v: addErrorContext "while finding tarballs in '${n}':" (derivationsIn' v)) x)
+    else [ ];
+
+  keyDrv = drv: if canEval drv.drvPath then { key = drv.drvPath; value = drv; } else { };
+
+  immediateDependenciesOf = drv:
+    concatLists (mapAttrsToList (n: v: derivationsIn v) (removeAttrs drv (["meta" "passthru"] ++ optionals (drv?passthru) (attrNames drv.passthru))));
+
+  derivationsIn = x:
+    if !canEval x then []
+    else if isDerivation x then optional (canEval x.drvPath) x
+    else if isList x then concatLists (map derivationsIn x)
+    else [ ];
+
+  canEval = val: (builtins.tryEval val).success;
+
+in uniqueFiles
diff --git a/nixpkgs/maintainers/scripts/fix-maintainers.pl b/nixpkgs/maintainers/scripts/fix-maintainers.pl
new file mode 100755
index 000000000000..c953cff5cc48
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/fix-maintainers.pl
@@ -0,0 +1,58 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -i perl -p perl -p perlPackages.LWP -p perlPackages.LWPProtocolHttps -p perlPackages.LWPUserAgent -p perlPackages.JSON -p perlPackages.PathTiny
+use LWP::UserAgent;
+use JSON;
+use Path::Tiny;
+use strict;
+use warnings;
+
+my $maintainers_list_nix = "../maintainer-list.nix";
+my $maintainers_json = from_json(`nix-instantiate --json --eval --expr 'builtins.fromJSON (builtins.toJSON (import $maintainers_list_nix))'`);
+
+STDOUT->autoflush(1);
+
+my $ua = LWP::UserAgent->new();
+
+if (!defined $ENV{GH_TOKEN}) {
+    die "Set GH_TOKEN before running this script";
+}
+
+keys %$maintainers_json; # reset the internal iterator so a prior each() doesn't affect the loop
+while(my($k, $v) = each %$maintainers_json) {
+    my $current_user = %$v{'github'};
+    if (!defined $current_user) {
+        print "$k has no github handle\n";
+    }
+    my $github_id = %$v{'githubId'};
+    if (!defined $github_id) {
+        print "$k has no githubId\n";
+        next;
+    }
+    my $url = 'https://api.github.com/user/' . $github_id;
+    my $resp = $ua->get(
+        $url,
+        "Authorization" => "Token $ENV{GH_TOKEN}"
+    );
+
+    if ($resp->header("X-RateLimit-Remaining") == 0) {
+        my $ratelimit_reset = $resp->header("X-RateLimit-Reset");
+        print "Request limit exceeded, waiting until " . scalar localtime $ratelimit_reset . "\n";
+        sleep($ratelimit_reset - time() + 5);
+    }
+    if ($resp->code != 200) {
+        print "$k likely deleted their github account\n";
+        next;
+    }
+    my $resp_json = from_json($resp->content);
+    my $api_user = %$resp_json{"login"};
+    if (!defined $current_user) {
+        print "$k is known on github as $api_user.\n";
+    }
+    elsif (lc($current_user) ne lc($api_user)) {
+        print "$k is now known on github as $api_user. Editing maintainer-list.nix…\n";
+        my $file = path($maintainers_list_nix);
+        my $data = $file->slurp_utf8;
+        $data =~ s/github = "$current_user";$/github = "$api_user";/m;
+        $file->spew_utf8($data);
+    }
+}
diff --git a/nixpkgs/maintainers/scripts/get-maintainer.sh b/nixpkgs/maintainers/scripts/get-maintainer.sh
new file mode 100755
index 000000000000..3061d2ccc72f
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/get-maintainer.sh
@@ -0,0 +1,73 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -i bash -p jq ncurses
+# shellcheck shell=bash
+
+# Get a nixpkgs maintainer's metadata as a JSON object
+#  see HELP_MESSAGE just below, or README.md.
+
+set -euo pipefail
+
+declare -A SELECTORS=( [handle]= [email]= [github]= [githubId]= [matrix]= [name]= )
+HELP_MESSAGE="usage: '$0' [selector] value
+examples:
+  get-maintainer.sh nicoo
+  get-maintainer.sh githubId 1155801
+
+\`selector\` defaults to 'handle', can be one of:
+  ${!SELECTORS[*]}
+"
+
+MAINTAINERS_DIR="$(dirname "$0")/.."
+
+die() {
+  tput setaf 1 # red
+  echo "'$0': $*"
+  tput setaf 0 # back to black
+  exit 1
+}
+
+listAsJSON() {
+  nix-instantiate --eval --strict --json "${MAINTAINERS_DIR}/maintainer-list.nix"
+}
+
+parseArgs() {
+  [ $# -gt 0 -a $# -lt 3 ] || {
+      echo "$HELP_MESSAGE"
+      die "invalid number of arguments (must be 1 or 2)"
+  }
+
+  if [ $# -eq 1 ]; then
+    selector=handle
+  else
+    selector="$1"
+    shift
+  fi
+  [ -z "${SELECTORS[$selector]-n}" ] || {
+    echo "Valid selectors are:" "${!SELECTORS[@]}" >&2
+    die "invalid selector '$selector'"
+  }
+
+  value="$1"
+  shift
+}
+
+query() {
+  # explode { a: A, b: B, ... } into A + {handle: a}, B + {handle: b}, ...
+  local explode="to_entries[] | .value + { \"handle\": .key }"
+
+  # select matching items from the list
+  # TODO(nicoo): Support approximate matching for `name` ?
+  local select
+  case "$selector" in
+    githubId)
+      select="select(.${selector} == $value)"
+      ;;
+    *)
+      select="select(.${selector} == \"$value\")"
+  esac
+
+  echo "$explode | $select"
+}
+
+parseArgs "$@"
+listAsJSON | jq -e "$(query)"
diff --git a/nixpkgs/maintainers/scripts/haskell/dependencies.nix b/nixpkgs/maintainers/scripts/haskell/dependencies.nix
new file mode 100644
index 000000000000..fd8338c0029a
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/dependencies.nix
@@ -0,0 +1,10 @@
+# Nix script to calculate the Haskell dependencies of every haskellPackage. Used by ./hydra-report.hs.
+let
+  pkgs = import ../../.. {};
+  inherit (pkgs) lib;
+  getDeps = _: pkg: {
+    deps = builtins.filter (x: x != null) (map (x: x.pname or null) (pkg.propagatedBuildInputs or []));
+    broken = (pkg.meta.hydraPlatforms or [null]) == [];
+  };
+in
+  lib.mapAttrs getDeps pkgs.haskellPackages
diff --git a/nixpkgs/maintainers/scripts/haskell/hydra-report.hs b/nixpkgs/maintainers/scripts/haskell/hydra-report.hs
new file mode 100755
index 000000000000..8b4f798cc543
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/hydra-report.hs
@@ -0,0 +1,819 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -p "haskellPackages.ghcWithPackages (p: [p.aeson p.req])"
+#! nix-shell -p hydra-unstable
+#! nix-shell -i runhaskell
+
+{-
+
+The purpose of this script is
+
+1) download the state of the nixpkgs/haskell-updates job from hydra (with get-report)
+2) print a summary of the state suitable for pasting into a github comment (with ping-maintainers)
+3) print a list of broken packages suitable for pasting into configuration-hackage2nix.yaml
+
+Because step 1) is quite expensive and takes roughly ~5 minutes the result is cached in a json file in XDG_CACHE.
+
+-}
+{-# LANGUAGE BlockArguments #-}
+{-# LANGUAGE DeriveAnyClass #-}
+{-# LANGUAGE DeriveGeneric #-}
+{-# LANGUAGE DerivingStrategies #-}
+{-# LANGUAGE DuplicateRecordFields #-}
+{-# LANGUAGE FlexibleContexts #-}
+{-# LANGUAGE GeneralizedNewtypeDeriving #-}
+{-# LANGUAGE LambdaCase #-}
+{-# LANGUAGE NamedFieldPuns #-}
+{-# LANGUAGE OverloadedStrings #-}
+{-# LANGUAGE ScopedTypeVariables #-}
+{-# LANGUAGE TupleSections #-}
+{-# LANGUAGE ViewPatterns #-}
+{-# OPTIONS_GHC -Wall #-}
+{-# LANGUAGE DataKinds #-}
+
+import Control.Monad (forM_, forM, (<=<))
+import Control.Monad.Trans (MonadIO (liftIO))
+import Data.Aeson (
+   FromJSON,
+   FromJSONKey,
+   ToJSON,
+   decodeFileStrict',
+   eitherDecodeStrict',
+   encodeFile,
+ )
+import Data.Foldable (Foldable (toList), foldl')
+import Data.List.NonEmpty (NonEmpty, nonEmpty)
+import qualified Data.List.NonEmpty as NonEmpty
+import Data.Map.Strict (Map)
+import qualified Data.Map.Strict as Map
+import Data.Maybe (fromMaybe, mapMaybe, isNothing)
+import Data.Monoid (Sum (Sum, getSum))
+import Data.Sequence (Seq)
+import qualified Data.Sequence as Seq
+import Data.Set (Set)
+import qualified Data.Set as Set
+import Data.Text (Text)
+import qualified Data.Text as Text
+import Data.Text.Encoding (encodeUtf8)
+import qualified Data.Text.IO as Text
+import Data.Time (defaultTimeLocale, formatTime, getCurrentTime)
+import Data.Time.Clock (UTCTime)
+import GHC.Generics (Generic)
+import Network.HTTP.Req (
+    GET (GET),
+    HttpResponse (HttpResponseBody),
+    NoReqBody (NoReqBody),
+    Option,
+    Req,
+    Scheme (Https),
+    bsResponse,
+    defaultHttpConfig,
+    header,
+    https,
+    jsonResponse,
+    req,
+    responseBody,
+    responseTimeout,
+    runReq,
+    (/:),
+ )
+import System.Directory (XdgDirectory (XdgCache), getXdgDirectory)
+import System.Environment (getArgs)
+import System.Process (readProcess)
+import Prelude hiding (id)
+import Data.List (sortOn)
+import Control.Concurrent.Async (concurrently)
+import Control.Exception (evaluate)
+import qualified Data.IntMap.Strict as IntMap
+import qualified Data.IntSet as IntSet
+import Data.Bifunctor (second)
+import Data.Data (Proxy)
+import Data.ByteString (ByteString)
+import qualified Data.ByteString.Char8 as ByteString
+import Distribution.Simple.Utils (safeLast, fromUTF8BS)
+
+newtype JobsetEvals = JobsetEvals
+   { evals :: Seq Eval
+   }
+   deriving stock (Generic, Show)
+   deriving anyclass (ToJSON, FromJSON)
+
+newtype Nixpkgs = Nixpkgs {revision :: Text}
+   deriving stock (Generic, Show)
+   deriving anyclass (ToJSON, FromJSON)
+
+newtype JobsetEvalInputs = JobsetEvalInputs {nixpkgs :: Nixpkgs}
+   deriving stock (Generic, Show)
+   deriving anyclass (ToJSON, FromJSON)
+
+data Eval = Eval
+   { id :: Int
+   , jobsetevalinputs :: JobsetEvalInputs
+   , builds :: Seq Int
+   }
+   deriving (Generic, ToJSON, FromJSON, Show)
+
+-- | Hydra job name.
+--
+-- Examples:
+-- - @"haskellPackages.lens.x86_64-linux"@
+-- - @"haskell.packages.ghc925.cabal-install.aarch64-darwin"@
+-- - @"pkgsMusl.haskell.compiler.ghc90.x86_64-linux"@
+-- - @"arion.aarch64-linux"@
+newtype JobName = JobName { unJobName :: Text }
+   deriving stock (Generic, Show)
+   deriving newtype (Eq, FromJSONKey, FromJSON, Ord, ToJSON)
+
+-- | Datatype representing the result of querying the build evals of the
+-- haskell-updates Hydra jobset.
+--
+-- The URL <https://hydra.nixos.org/eval/EVAL_ID/builds> (where @EVAL_ID@ is a
+-- value like 1792418) returns a list of 'Build'.
+data Build = Build
+   { job :: JobName
+   , buildstatus :: Maybe Int
+     -- ^ Status of the build.  See 'getBuildState' for the meaning of each state.
+   , finished :: Int
+     -- ^ Whether or not the build is finished.  @0@ if finished, non-zero otherwise.
+   , id :: Int
+   , nixname :: Text
+     -- ^ Nix name of the derivation.
+     --
+     -- Examples:
+     -- - @"lens-5.2.1"@
+     -- - @"cabal-install-3.8.0.1"@
+     -- - @"lens-static-x86_64-unknown-linux-musl-5.1.1"@
+   , system :: Text
+     -- ^ System
+     --
+     -- Examples:
+     -- - @"x86_64-linux"@
+     -- - @"aarch64-darwin"@
+   , jobsetevals :: Seq Int
+   }
+   deriving (Generic, ToJSON, FromJSON, Show)
+
+data HydraSlownessWorkaroundFlag = HydraSlownessWorkaround | NoHydraSlownessWorkaround
+data RequestLogsFlag = RequestLogs | NoRequestLogs
+
+main :: IO ()
+main = do
+   args <- getArgs
+   case args of
+      ["get-report", "--slow"] -> getBuildReports HydraSlownessWorkaround
+      ["get-report"] -> getBuildReports NoHydraSlownessWorkaround
+      ["ping-maintainers"] -> printMaintainerPing
+      ["mark-broken-list", "--no-request-logs"] -> printMarkBrokenList NoRequestLogs
+      ["mark-broken-list"] -> printMarkBrokenList RequestLogs
+      ["eval-info"] -> printEvalInfo
+      _ -> putStrLn "Usage: get-report [--slow] | ping-maintainers | mark-broken-list [--no-request-logs] | eval-info"
+
+reportFileName :: IO FilePath
+reportFileName = getXdgDirectory XdgCache "haskell-updates-build-report.json"
+
+showT :: Show a => a -> Text
+showT = Text.pack . show
+
+getBuildReports :: HydraSlownessWorkaroundFlag -> IO ()
+getBuildReports opt = runReq defaultHttpConfig do
+   evalMay <- Seq.lookup 0 . evals <$> hydraJSONQuery mempty ["jobset", "nixpkgs", "haskell-updates", "evals"]
+   eval@Eval{id} <- maybe (liftIO $ fail "No Evaluation found") pure evalMay
+   liftIO . putStrLn $ "Fetching evaluation " <> show id <> " from Hydra. This might take a few minutes..."
+   buildReports <- getEvalBuilds opt id
+   liftIO do
+      fileName <- reportFileName
+      putStrLn $ "Finished fetching all builds from Hydra, saving report as " <> fileName
+      now <- getCurrentTime
+      encodeFile fileName (eval, now, buildReports)
+
+getEvalBuilds :: HydraSlownessWorkaroundFlag -> Int -> Req (Seq Build)
+getEvalBuilds NoHydraSlownessWorkaround id =
+  hydraJSONQuery mempty ["eval", showT id, "builds"]
+getEvalBuilds HydraSlownessWorkaround id = do
+  Eval{builds} <- hydraJSONQuery mempty [ "eval", showT id ]
+  forM builds $ \buildId -> do
+    liftIO $ putStrLn $ "Querying build " <> show buildId
+    hydraJSONQuery mempty [ "build", showT buildId ]
+
+hydraQuery :: HttpResponse a => Proxy a -> Option 'Https -> [Text] -> Req (HttpResponseBody a)
+hydraQuery responseType option query = do
+  let customHeaderOpt =
+        header
+          "User-Agent"
+          "hydra-report.hs/v1 (nixpkgs;maintainers/scripts/haskell) pls fix https://github.com/NixOS/nixos-org-configurations/issues/270"
+      customTimeoutOpt = responseTimeout 900_000_000 -- 15 minutes
+      opts = customHeaderOpt <> customTimeoutOpt <> option
+      url = foldl' (/:) (https "hydra.nixos.org") query
+  responseBody <$> req GET url NoReqBody responseType opts
+
+hydraJSONQuery :: FromJSON a => Option 'Https -> [Text] -> Req a
+hydraJSONQuery = hydraQuery jsonResponse
+
+hydraPlainQuery :: [Text] -> Req ByteString
+hydraPlainQuery = hydraQuery bsResponse mempty
+
+hydraEvalCommand :: FilePath
+hydraEvalCommand = "hydra-eval-jobs"
+
+hydraEvalParams :: [String]
+hydraEvalParams = ["-I", ".", "pkgs/top-level/release-haskell.nix"]
+
+nixExprCommand :: FilePath
+nixExprCommand = "nix-instantiate"
+
+nixExprParams :: [String]
+nixExprParams = ["--eval", "--strict", "--json"]
+
+-- | This newtype is used to parse a Hydra job output from @hydra-eval-jobs@.
+-- The only field we are interested in is @maintainers@, which is why this
+-- is just a newtype.
+--
+-- Note that there are occasionally jobs that don't have a maintainers
+-- field, which is why this has to be @Maybe Text@.
+newtype Maintainers = Maintainers { maintainers :: Maybe Text }
+  deriving stock (Generic, Show)
+  deriving anyclass (FromJSON, ToJSON)
+
+-- | This is a 'Map' from Hydra job name to maintainer email addresses.
+--
+-- It has values similar to the following:
+--
+-- @@
+--  fromList
+--    [ ("arion.aarch64-linux", Maintainers (Just "robert@example.com"))
+--    , ("bench.x86_64-linux", Maintainers (Just ""))
+--    , ("conduit.x86_64-linux", Maintainers (Just "snoy@man.com, web@ber.com"))
+--    , ("lens.x86_64-darwin", Maintainers (Just "ek@category.com"))
+--    ]
+-- @@
+--
+-- Note that Hydra jobs without maintainers will have an empty string for the
+-- maintainer list.
+type HydraJobs = Map JobName Maintainers
+
+-- | Map of email addresses to GitHub handles.
+-- This is built from the file @../../maintainer-list.nix@.
+--
+-- It has values similar to the following:
+--
+-- @@
+--  fromList
+--    [ ("robert@example.com", "rob22")
+--    , ("ek@category.com", "edkm")
+--    ]
+-- @@
+type EmailToGitHubHandles = Map Text Text
+
+-- | Map of Hydra jobs to maintainer GitHub handles.
+--
+-- It has values similar to the following:
+--
+-- @@
+--  fromList
+--    [ ("arion.aarch64-linux", ["rob22"])
+--    , ("conduit.x86_64-darwin", ["snoyb", "webber"])
+--    ]
+-- @@
+type MaintainerMap = Map JobName (NonEmpty Text)
+
+-- | Information about a package which lists its dependencies and whether the
+-- package is marked broken.
+data DepInfo = DepInfo {
+   deps :: Set PkgName,
+   broken :: Bool
+}
+   deriving stock (Generic, Show)
+   deriving anyclass (FromJSON, ToJSON)
+
+-- | Map from package names to their DepInfo. This is the data we get out of a
+-- nix call.
+type DependencyMap = Map PkgName DepInfo
+
+-- | Map from package names to its broken state, number of reverse dependencies (fst) and
+-- unbroken reverse dependencies (snd).
+type ReverseDependencyMap = Map PkgName (Int, Int)
+
+-- | Calculate the (unbroken) reverse dependencies of a package by transitively
+-- going through all packages if it’s a dependency of them.
+calculateReverseDependencies :: DependencyMap -> ReverseDependencyMap
+calculateReverseDependencies depMap =
+   Map.fromDistinctAscList $ zip keys (zip (rdepMap False) (rdepMap True))
+ where
+    -- This code tries to efficiently invert the dependency map and calculate
+    -- it’s transitive closure by internally identifying every pkg with it’s index
+    -- in the package list and then using memoization.
+    keys :: [PkgName]
+    keys = Map.keys depMap
+
+    pkgToIndexMap :: Map PkgName Int
+    pkgToIndexMap = Map.fromDistinctAscList (zip keys [0..])
+
+    depInfos :: [DepInfo]
+    depInfos = Map.elems depMap
+
+    depInfoToIdx :: DepInfo -> (Bool, [Int])
+    depInfoToIdx DepInfo{broken,deps} =
+       (broken, mapMaybe (`Map.lookup` pkgToIndexMap) $ Set.toList deps)
+
+    intDeps :: [(Int, (Bool, [Int]))]
+    intDeps = zip [0..] (fmap depInfoToIdx depInfos)
+
+    rdepMap onlyUnbroken = IntSet.size <$> resultList
+     where
+       resultList = go <$> [0..]
+       oneStepMap = IntMap.fromListWith IntSet.union $ (\(key,(_,deps)) -> (,IntSet.singleton key) <$> deps) <=< filter (\(_, (broken,_)) -> not (broken && onlyUnbroken)) $ intDeps
+       go pkg = IntSet.unions (oneStep:((resultList !!) <$> IntSet.toList oneStep))
+        where oneStep = IntMap.findWithDefault mempty pkg oneStepMap
+
+-- | Generate a mapping of Hydra job names to maintainer GitHub handles. Calls
+-- hydra-eval-jobs and the nix script ./maintainer-handles.nix.
+getMaintainerMap :: IO MaintainerMap
+getMaintainerMap = do
+   hydraJobs :: HydraJobs <-
+      readJSONProcess hydraEvalCommand hydraEvalParams "Failed to decode hydra-eval-jobs output: "
+   handlesMap :: EmailToGitHubHandles <-
+      readJSONProcess nixExprCommand ("maintainers/scripts/haskell/maintainer-handles.nix":nixExprParams) "Failed to decode nix output for lookup of github handles: "
+   pure $ Map.mapMaybe (splitMaintainersToGitHubHandles handlesMap) hydraJobs
+  where
+   -- Split a comma-spearated string of Maintainers into a NonEmpty list of
+   -- GitHub handles.
+   splitMaintainersToGitHubHandles
+      :: EmailToGitHubHandles -> Maintainers -> Maybe (NonEmpty Text)
+   splitMaintainersToGitHubHandles handlesMap (Maintainers maint) =
+      nonEmpty .  mapMaybe (`Map.lookup` handlesMap) .  Text.splitOn ", " $ fromMaybe "" maint
+
+-- | Get the a map of all dependencies of every package by calling the nix
+-- script ./dependencies.nix.
+getDependencyMap :: IO DependencyMap
+getDependencyMap =
+   readJSONProcess
+      nixExprCommand
+      ("maintainers/scripts/haskell/dependencies.nix" : nixExprParams)
+      "Failed to decode nix output for lookup of dependencies: "
+
+-- | Run a process that produces JSON on stdout and and decode the JSON to a
+-- data type.
+--
+-- If the JSON-decoding fails, throw the JSON-decoding error.
+readJSONProcess
+   :: FromJSON a
+   => FilePath -- ^ Filename of executable.
+   -> [String] -- ^ Arguments
+   -> String -- ^ String to prefix to JSON-decode error.
+   -> IO a
+readJSONProcess exe args err = do
+   output <- readProcess exe args ""
+   let eitherDecodedOutput = eitherDecodeStrict' . encodeUtf8 . Text.pack $ output
+   case eitherDecodedOutput of
+     Left decodeErr -> error $ err <> decodeErr <> "\nRaw: '" <> take 1000 output <> "'"
+     Right decodedOutput -> pure decodedOutput
+
+-- BuildStates are sorted by subjective importance/concerningness
+data BuildState
+  = Failed
+  | DependencyFailed
+  | OutputLimitExceeded
+  | Unknown (Maybe Int)
+  | TimedOut
+  | Canceled
+  | HydraFailure
+  | Unfinished
+  | Success
+  deriving stock (Show, Eq, Ord)
+
+icon :: BuildState -> Text
+icon = \case
+   Failed -> "❌"
+   DependencyFailed -> "❗"
+   OutputLimitExceeded -> "⚠️"
+   Unknown x -> "unknown code " <> showT x
+   TimedOut -> "⌛🚫"
+   Canceled -> "🚫"
+   Unfinished -> "⏳"
+   HydraFailure -> "🚧"
+   Success -> "✅"
+
+platformIcon :: Platform -> Text
+platformIcon (Platform x) = case x of
+   "x86_64-linux" -> "🐧"
+   "aarch64-linux" -> "📱"
+   "x86_64-darwin" -> "🍎"
+   "aarch64-darwin" -> "🍏"
+   _ -> x
+
+platformIsOS :: OS -> Platform -> Bool
+platformIsOS os (Platform x) = case (os, x) of
+   (Linux, "x86_64-linux") -> True
+   (Linux, "aarch64-linux") -> True
+   (Darwin, "x86_64-darwin") -> True
+   (Darwin, "aarch64-darwin") -> True
+   _ -> False
+
+
+-- | A package name.  This is parsed from a 'JobName'.
+--
+-- Examples:
+--
+-- - The 'JobName' @"haskellPackages.lens.x86_64-linux"@ produces the 'PkgName'
+--   @"lens"@.
+-- - The 'JobName' @"haskell.packages.ghc925.cabal-install.aarch64-darwin"@
+--   produces the 'PkgName' @"cabal-install"@.
+-- - The 'JobName' @"pkgsMusl.haskell.compiler.ghc90.x86_64-linux"@ produces
+--   the 'PkgName' @"ghc90"@.
+-- - The 'JobName' @"arion.aarch64-linux"@ produces the 'PkgName' @"arion"@.
+--
+-- 'PkgName' is also used as a key in 'DependencyMap' and 'ReverseDependencyMap'.
+-- In this case, 'PkgName' originally comes from attribute names in @haskellPackages@
+-- in Nixpkgs.
+newtype PkgName = PkgName Text
+   deriving stock (Generic, Show)
+   deriving newtype (Eq, FromJSON, FromJSONKey, Ord, ToJSON)
+
+-- | A package set name.  This is parsed from a 'JobName'.
+--
+-- Examples:
+--
+-- - The 'JobName' @"haskellPackages.lens.x86_64-linux"@ produces the 'PkgSet'
+--   @"haskellPackages"@.
+-- - The 'JobName' @"haskell.packages.ghc925.cabal-install.aarch64-darwin"@
+--   produces the 'PkgSet' @"haskell.packages.ghc925"@.
+-- - The 'JobName' @"pkgsMusl.haskell.compiler.ghc90.x86_64-linux"@ produces
+--   the 'PkgSet' @"pkgsMusl.haskell.compiler"@.
+-- - The 'JobName' @"arion.aarch64-linux"@ produces the 'PkgSet' @""@.
+--
+-- As you can see from the last example, 'PkgSet' can be empty (@""@) for
+-- top-level jobs.
+newtype PkgSet = PkgSet Text
+   deriving stock (Generic, Show)
+   deriving newtype (Eq, FromJSON, FromJSONKey, Ord, ToJSON)
+
+data BuildResult = BuildResult {state :: BuildState, id :: Int} deriving (Show, Eq, Ord)
+newtype Platform = Platform {platform :: Text} deriving (Show, Eq, Ord)
+data SummaryEntry = SummaryEntry {
+   summaryBuilds :: Table PkgSet Platform BuildResult,
+   summaryMaintainers :: Set Text,
+   summaryReverseDeps :: Int,
+   summaryUnbrokenReverseDeps :: Int
+}
+type StatusSummary = Map PkgName SummaryEntry
+
+data OS = Linux | Darwin
+
+newtype Table row col a = Table (Map (row, col) a)
+
+singletonTable :: row -> col -> a -> Table row col a
+singletonTable row col a = Table $ Map.singleton (row, col) a
+
+unionTable :: (Ord row, Ord col) => Table row col a -> Table row col a -> Table row col a
+unionTable (Table l) (Table r) = Table $ Map.union l r
+
+filterWithKeyTable :: (row -> col -> a -> Bool) -> Table row col a -> Table row col a
+filterWithKeyTable f (Table t) = Table $ Map.filterWithKey (\(r,c) a -> f r c a) t
+
+nullTable :: Table row col a -> Bool
+nullTable (Table t) = Map.null t
+
+instance (Ord row, Ord col, Semigroup a) => Semigroup (Table row col a) where
+   Table l <> Table r = Table (Map.unionWith (<>) l r)
+instance (Ord row, Ord col, Semigroup a) => Monoid (Table row col a) where
+   mempty = Table Map.empty
+instance Functor (Table row col) where
+   fmap f (Table a) = Table (fmap f a)
+instance Foldable (Table row col) where
+   foldMap f (Table a) = foldMap f a
+
+getBuildState :: Build -> BuildState
+getBuildState Build{finished, buildstatus} = case (finished, buildstatus) of
+   (0, _) -> Unfinished
+   (_, Just 0) -> Success
+   (_, Just 1) -> Failed
+   (_, Just 2) -> DependencyFailed
+   (_, Just 3) -> HydraFailure
+   (_, Just 4) -> Canceled
+   (_, Just 7) -> TimedOut
+   (_, Just 11) -> OutputLimitExceeded
+   (_, i) -> Unknown i
+
+combineStatusSummaries :: Seq StatusSummary -> StatusSummary
+combineStatusSummaries = foldl (Map.unionWith unionSummary) Map.empty
+  where
+   unionSummary :: SummaryEntry -> SummaryEntry -> SummaryEntry
+   unionSummary (SummaryEntry lb lm lr lu) (SummaryEntry rb rm rr ru) =
+      SummaryEntry (unionTable lb rb) (lm <> rm) (max lr rr) (max lu ru)
+
+buildToPkgNameAndSet :: Build -> (PkgName, PkgSet)
+buildToPkgNameAndSet Build{job = JobName jobName, system} = (name, set)
+  where
+   packageName :: Text
+   packageName = fromMaybe jobName (Text.stripSuffix ("." <> system) jobName)
+
+   splitted :: Maybe (NonEmpty Text)
+   splitted = nonEmpty $ Text.splitOn "." packageName
+
+   name :: PkgName
+   name = PkgName $ maybe packageName NonEmpty.last splitted
+
+   set :: PkgSet
+   set = PkgSet $ maybe "" (Text.intercalate "." . NonEmpty.init) splitted
+
+buildToStatusSummary :: MaintainerMap -> ReverseDependencyMap -> Build -> StatusSummary
+buildToStatusSummary maintainerMap reverseDependencyMap build@Build{job, id, system} =
+   Map.singleton pkgName summaryEntry
+  where
+   (pkgName, pkgSet) = buildToPkgNameAndSet build
+
+   maintainers :: Set Text
+   maintainers = maybe mempty (Set.fromList . toList) (Map.lookup job maintainerMap)
+
+   (reverseDeps, unbrokenReverseDeps) =
+      Map.findWithDefault (0,0) pkgName reverseDependencyMap
+
+   buildTable :: Table PkgSet Platform BuildResult
+   buildTable =
+      singletonTable pkgSet (Platform system) (BuildResult (getBuildState build) id)
+
+   summaryEntry = SummaryEntry buildTable maintainers reverseDeps unbrokenReverseDeps
+
+readBuildReports :: IO (Eval, UTCTime, Seq Build)
+readBuildReports = do
+   file <- reportFileName
+   fromMaybe (error $ "Could not decode " <> file) <$> decodeFileStrict' file
+
+sep :: Text
+sep = " | "
+joinTable :: [Text] -> Text
+joinTable t = sep <> Text.intercalate sep t <> sep
+
+type NumSummary = Table Platform BuildState Int
+
+printTable :: (Ord rows, Ord cols) => Text -> (rows -> Text) -> (cols -> Text) -> (entries -> Text) -> Table rows cols entries -> [Text]
+printTable name showR showC showE (Table mapping) = joinTable <$> (name : map showC cols) : replicate (length cols + sepsInName + 1) "---" : map printRow rows
+  where
+   sepsInName = Text.count "|" name
+   printRow row = showR row : map (\col -> maybe "" showE (Map.lookup (row, col) mapping)) cols
+   rows = toList $ Set.fromList (fst <$> Map.keys mapping)
+   cols = toList $ Set.fromList (snd <$> Map.keys mapping)
+
+printJob :: Int -> PkgName -> (Table PkgSet Platform BuildResult, Text) -> [Text]
+printJob evalId (PkgName name) (Table mapping, maintainers) =
+   if length sets <= 1
+      then map printSingleRow sets
+      else ["- [ ] " <> makeJobSearchLink (PkgSet "") name <> " " <> maintainers] <> map printRow sets
+  where
+   printRow :: PkgSet -> Text
+   printRow (PkgSet set) =
+      "  - " <> printState (PkgSet set) <> " " <>
+      makeJobSearchLink (PkgSet set) (if Text.null set then "toplevel" else set)
+
+   printSingleRow set =
+      "- [ ] " <> printState set <> " " <>
+      makeJobSearchLink set (makePkgName set) <> " " <> maintainers
+
+   makePkgName :: PkgSet -> Text
+   makePkgName (PkgSet set) = (if Text.null set then "" else set <> ".") <> name
+
+   printState set =
+      Text.intercalate " " $ map (\pf -> maybe "" (label pf) $ Map.lookup (set, pf) mapping) platforms
+
+   makeJobSearchLink :: PkgSet -> Text -> Text
+   makeJobSearchLink set linkLabel = makeSearchLink evalId linkLabel (makePkgName set)
+
+   sets :: [PkgSet]
+   sets = toList $ Set.fromList (fst <$> Map.keys mapping)
+
+   platforms :: [Platform]
+   platforms = toList $ Set.fromList (snd <$> Map.keys mapping)
+
+   label pf (BuildResult s i) = "[[" <> platformIcon pf <> icon s <> "]](https://hydra.nixos.org/build/" <> showT i <> ")"
+
+makeSearchLink :: Int -> Text -> Text -> Text
+makeSearchLink evalId linkLabel query = "[" <> linkLabel <> "](" <> "https://hydra.nixos.org/eval/" <> showT evalId <> "?filter=" <> query <> ")"
+
+statusToNumSummary :: StatusSummary -> NumSummary
+statusToNumSummary = fmap getSum . foldMap (fmap Sum . jobTotals)
+
+jobTotals :: SummaryEntry -> Table Platform BuildState Int
+jobTotals (summaryBuilds -> Table mapping) = getSum <$> Table (Map.foldMapWithKey (\(_, platform) (BuildResult buildstate _) -> Map.singleton (platform, buildstate) (Sum 1)) mapping)
+
+details :: Text -> [Text] -> [Text]
+details summary content = ["<details><summary>" <> summary <> " </summary>", ""] <> content <> ["</details>", ""]
+
+evalLine :: Eval -> UTCTime -> Text
+evalLine Eval{id, jobsetevalinputs = JobsetEvalInputs{nixpkgs = Nixpkgs{revision}}} fetchTime =
+   "*evaluation ["
+    <> showT id
+    <> "](https://hydra.nixos.org/eval/"
+    <> showT id
+    <> ") of nixpkgs commit ["
+    <> Text.take 7 revision
+    <> "](https://github.com/NixOS/nixpkgs/commits/"
+    <> revision
+    <> ") as of "
+    <> Text.pack (formatTime defaultTimeLocale "%Y-%m-%d %H:%M UTC" fetchTime)
+    <> "*"
+
+printBuildSummary :: Eval -> UTCTime -> StatusSummary -> [(PkgName, Int)] -> Text
+printBuildSummary eval@Eval{id} fetchTime summary topBrokenRdeps =
+   Text.unlines $
+      headline <> [""] <> tldr <> (("  * "<>) <$> (errors <> warnings)) <> [""]
+         <> totals
+         <> optionalList "#### Maintained Linux packages with build failure" (maintainedList (fails summaryLinux))
+         <> optionalList "#### Maintained Linux packages with failed dependency" (maintainedList (failedDeps summaryLinux))
+         <> optionalList "#### Maintained Linux packages with unknown error" (maintainedList (unknownErr summaryLinux))
+         <> optionalHideableList "#### Maintained Darwin packages with build failure" (maintainedList (fails summaryDarwin))
+         <> optionalHideableList "#### Maintained Darwin packages with failed dependency" (maintainedList (failedDeps summaryDarwin))
+         <> optionalHideableList "#### Maintained Darwin packages with unknown error" (maintainedList (unknownErr summaryDarwin))
+         <> optionalHideableList "#### Unmaintained packages with build failure" (unmaintainedList (fails summary))
+         <> optionalHideableList "#### Unmaintained packages with failed dependency" (unmaintainedList (failedDeps summary))
+         <> optionalHideableList "#### Unmaintained packages with unknown error" (unmaintainedList (unknownErr summary))
+         <> optionalHideableList "#### Top 50 broken packages, sorted by number of reverse dependencies" (brokenLine <$> topBrokenRdeps)
+         <> ["","*⤴️: The number of packages that depend (directly or indirectly) on this package (if any). If two numbers are shown the first (lower) number considers only packages which currently have enabled hydra jobs, i.e. are not marked broken. The second (higher) number considers all packages.*",""]
+         <> footer
+  where
+   footer = ["*Report generated with [maintainers/scripts/haskell/hydra-report.hs](https://github.com/NixOS/nixpkgs/blob/haskell-updates/maintainers/scripts/haskell/hydra-report.hs)*"]
+
+   headline =
+      [ "### [haskell-updates build report from hydra](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates)"
+      , evalLine eval fetchTime
+      ]
+
+   totals :: [Text]
+   totals =
+      [ "#### Build summary"
+      , ""
+      ] <>
+      printTable
+         "Platform"
+         (\x -> makeSearchLink id (platform x <> " " <> platformIcon x) ("." <> platform x))
+         (\x -> showT x <> " " <> icon x)
+         showT
+         numSummary
+
+   brokenLine :: (PkgName, Int) -> Text
+   brokenLine (PkgName name, rdeps) =
+      "[" <> name <> "](https://packdeps.haskellers.com/reverse/" <> name <>
+      ") ⤴️ " <> Text.pack (show rdeps) <> "  "
+
+   numSummary = statusToNumSummary summary
+
+   summaryLinux :: StatusSummary
+   summaryLinux = withOS Linux summary
+
+   summaryDarwin :: StatusSummary
+   summaryDarwin = withOS Darwin summary
+
+   -- Remove all BuildResult from the Table that have Platform that isn't for
+   -- the given OS.
+   tableForOS :: OS -> Table PkgSet Platform BuildResult -> Table PkgSet Platform BuildResult
+   tableForOS os = filterWithKeyTable (\_ platform _ -> platformIsOS os platform)
+
+   -- Remove all BuildResult from the StatusSummary that have a Platform that
+   -- isn't for the given OS.  Completely remove all PkgName from StatusSummary
+   -- that end up with no BuildResults.
+   withOS
+      :: OS
+      -> StatusSummary
+      -> StatusSummary
+   withOS os =
+      Map.mapMaybe
+         (\e@SummaryEntry{summaryBuilds} ->
+            let buildsForOS = tableForOS os summaryBuilds
+            in if nullTable buildsForOS then Nothing else Just e { summaryBuilds = buildsForOS }
+         )
+
+   jobsByState :: (BuildState -> Bool) -> StatusSummary -> StatusSummary
+   jobsByState predicate = Map.filter (predicate . worstState)
+
+   worstState :: SummaryEntry -> BuildState
+   worstState = foldl' min Success . fmap state . summaryBuilds
+
+   fails :: StatusSummary -> StatusSummary
+   fails = jobsByState (== Failed)
+
+   failedDeps :: StatusSummary -> StatusSummary
+   failedDeps = jobsByState (== DependencyFailed)
+
+   unknownErr :: StatusSummary -> StatusSummary
+   unknownErr = jobsByState (\x -> x > DependencyFailed && x < TimedOut)
+
+   withMaintainer :: StatusSummary -> Map PkgName (Table PkgSet Platform BuildResult, NonEmpty Text)
+   withMaintainer =
+      Map.mapMaybe
+         (\e -> (summaryBuilds e,) <$> nonEmpty (Set.toList (summaryMaintainers e)))
+
+   withoutMaintainer :: StatusSummary -> StatusSummary
+   withoutMaintainer = Map.mapMaybe (\e -> if Set.null (summaryMaintainers e) then Just e else Nothing)
+
+   optionalList :: Text -> [Text] -> [Text]
+   optionalList heading list = if null list then mempty else [heading] <> list
+
+   optionalHideableList :: Text -> [Text] -> [Text]
+   optionalHideableList heading list = if null list then mempty else [heading] <> details (showT (length list) <> " job(s)") list
+
+   maintainedList :: StatusSummary -> [Text]
+   maintainedList = showMaintainedBuild <=< Map.toList . withMaintainer
+
+   summaryEntryGetReverseDeps :: SummaryEntry -> (Int, Int)
+   summaryEntryGetReverseDeps sumEntry =
+      ( negate $ summaryUnbrokenReverseDeps sumEntry
+      , negate $ summaryReverseDeps sumEntry
+      )
+
+   sortOnReverseDeps :: [(PkgName, SummaryEntry)] -> [(PkgName, SummaryEntry)]
+   sortOnReverseDeps = sortOn (\(_, sumEntry) -> summaryEntryGetReverseDeps sumEntry)
+
+   unmaintainedList :: StatusSummary -> [Text]
+   unmaintainedList = showBuild <=< sortOnReverseDeps . Map.toList . withoutMaintainer
+
+   showBuild :: (PkgName, SummaryEntry) -> [Text]
+   showBuild (name, entry) =
+      printJob
+         id
+         name
+         ( summaryBuilds entry
+         , Text.pack
+            ( if summaryReverseDeps entry > 0
+               then
+                  " ⤴️ " <> show (summaryUnbrokenReverseDeps entry) <>
+                  " | " <> show (summaryReverseDeps entry)
+               else ""
+            )
+         )
+
+   showMaintainedBuild
+      :: (PkgName, (Table PkgSet Platform BuildResult, NonEmpty Text)) -> [Text]
+   showMaintainedBuild (name, (table, maintainers)) =
+      printJob
+         id
+         name
+         ( table
+         , Text.intercalate " " (fmap ("@" <>) (toList maintainers))
+         )
+
+   tldr = case (errors, warnings) of
+            ([],[]) -> ["🟢 **Ready to merge** (if there are no [evaluation errors](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates))"]
+            ([],_) -> ["🟡 **Potential issues** (and possibly [evaluation errors](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates))"]
+            _ -> ["🔴 **Branch not mergeable**"]
+   warnings =
+      if' (Unfinished > maybe Success worstState maintainedJob) "`maintained` jobset failed." <>
+      if' (Unfinished == maybe Success worstState mergeableJob) "`mergeable` jobset is not finished." <>
+      if' (Unfinished == maybe Success worstState maintainedJob) "`maintained` jobset is not finished."
+   errors =
+      if' (isNothing mergeableJob) "No `mergeable` job found." <>
+      if' (isNothing maintainedJob) "No `maintained` job found." <>
+      if' (Unfinished > maybe Success worstState mergeableJob) "`mergeable` jobset failed." <>
+      if' (outstandingJobs (Platform "x86_64-linux") > 100) "Too many outstanding jobs on x86_64-linux." <>
+      if' (outstandingJobs (Platform "aarch64-linux") > 100) "Too many outstanding jobs on aarch64-linux."
+
+   if' p e = if p then [e] else mempty
+
+   outstandingJobs platform | Table m <- numSummary = Map.findWithDefault 0 (platform, Unfinished) m
+
+   maintainedJob = Map.lookup (PkgName "maintained") summary
+   mergeableJob = Map.lookup (PkgName "mergeable") summary
+
+printEvalInfo :: IO ()
+printEvalInfo = do
+   (eval, fetchTime, _) <- readBuildReports
+   putStrLn (Text.unpack $ evalLine eval fetchTime)
+
+printMaintainerPing :: IO ()
+printMaintainerPing = do
+   (maintainerMap, (reverseDependencyMap, topBrokenRdeps)) <- concurrently getMaintainerMap do
+      depMap <- getDependencyMap
+      rdepMap <- evaluate . calculateReverseDependencies $ depMap
+      let tops = take 50 . sortOn (negate . snd) . fmap (second fst) . filter (\x -> maybe False broken $ Map.lookup (fst x) depMap) . Map.toList $ rdepMap
+      pure (rdepMap, tops)
+   (eval, fetchTime, buildReport) <- readBuildReports
+   let statusSummaries =
+          fmap (buildToStatusSummary maintainerMap reverseDependencyMap) buildReport
+       buildSum :: StatusSummary
+       buildSum = combineStatusSummaries statusSummaries
+       textBuildSummary = printBuildSummary eval fetchTime buildSum topBrokenRdeps
+   Text.putStrLn textBuildSummary
+
+printMarkBrokenList :: RequestLogsFlag -> IO ()
+printMarkBrokenList reqLogs = do
+   (_, fetchTime, buildReport) <- readBuildReports
+   runReq defaultHttpConfig $ forM_ buildReport \build@Build{job, id} ->
+      case (getBuildState build, Text.splitOn "." $ unJobName job) of
+         (Failed, ["haskellPackages", name, "x86_64-linux"]) -> do
+            -- We use the last probable error cause found in the build log file.
+            error_message <- fromMaybe "failure" <$>
+              case reqLogs of
+                NoRequestLogs -> pure Nothing
+                RequestLogs -> do
+                  -- Fetch build log from hydra to figure out the cause of the error.
+                  build_log <- ByteString.lines <$> hydraPlainQuery ["build", showT id, "nixlog", "1", "raw"]
+                  pure $ safeLast $ mapMaybe probableErrorCause build_log
+            liftIO $ putStrLn $ "  - " <> Text.unpack name <> " # " <> error_message <> " in job https://hydra.nixos.org/build/" <> show id <> " at " <> formatTime defaultTimeLocale "%Y-%m-%d" fetchTime
+         _ -> pure ()
+
+{- | This function receives a line from a Nix Haskell builder build log and returns a possible error cause.
+ | We might need to add other causes in the future if errors happen in unusual parts of the builder.
+-}
+probableErrorCause :: ByteString -> Maybe String
+probableErrorCause "Setup: Encountered missing or private dependencies:" = Just "dependency missing"
+probableErrorCause "running tests" = Just "test failure"
+probableErrorCause build_line | ByteString.isPrefixOf "Building" build_line = Just ("failure building " <> fromUTF8BS (fst $ ByteString.breakSubstring " for" $ ByteString.drop 9 build_line))
+probableErrorCause build_line | ByteString.isSuffixOf "Phase" build_line = Just ("failure in " <> fromUTF8BS build_line)
+probableErrorCause _ = Nothing
diff --git a/nixpkgs/maintainers/scripts/haskell/maintained-broken-pkgs.nix b/nixpkgs/maintainers/scripts/haskell/maintained-broken-pkgs.nix
new file mode 100644
index 000000000000..7416bfa46ee0
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/maintained-broken-pkgs.nix
@@ -0,0 +1,22 @@
+let
+  nixpkgs = import ../../..;
+  inherit (nixpkgs {}) haskellPackages lib;
+  maintainedPkgs = lib.filterAttrs (
+    _: v: builtins.length (v.meta.maintainers or []) > 0
+  ) haskellPackages;
+  brokenPkgs = lib.filterAttrs (_: v: v.meta.broken) maintainedPkgs;
+  transitiveBrokenPkgs = lib.filterAttrs
+    (_: v: !(builtins.tryEval (v.outPath or null)).success && !v.meta.broken)
+    maintainedPkgs;
+  infoList = pkgs: lib.concatStringsSep "\n" (lib.mapAttrsToList (name: drv: "${name} ${(builtins.elemAt drv.meta.maintainers 0).github}") pkgs);
+in {
+  report = ''
+    BROKEN:
+    ${infoList brokenPkgs}
+
+    TRANSITIVE BROKEN:
+    ${infoList transitiveBrokenPkgs}
+  '';
+  transitiveErrors =
+    builtins.attrValues transitiveBrokenPkgs;
+}
diff --git a/nixpkgs/maintainers/scripts/haskell/maintainer-handles.nix b/nixpkgs/maintainers/scripts/haskell/maintainer-handles.nix
new file mode 100644
index 000000000000..d650e82f8b0c
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/maintainer-handles.nix
@@ -0,0 +1,21 @@
+# Nix script to lookup maintainer github handles from their email address. Used by ./hydra-report.hs.
+#
+# This script produces an attr set mapping of email addresses to GitHub handles:
+#
+# ```nix
+# > import ./maintainer-handles.nix
+# { "cdep.illabout@gmail.com" = "cdepillabout"; "john@smith.com" = "johnsmith"; ... }
+# ```
+#
+# This mapping contains all maintainers in ../../mainatainer-list.nix, but it
+# ignores maintainers who don't have a GitHub account or an email address.
+let
+  pkgs = import ../../.. {};
+  maintainers = import ../../maintainer-list.nix;
+  inherit (pkgs) lib;
+  mkMailGithubPair = _: maintainer:
+    if (maintainer ? email) && (maintainer ? github) then
+      { "${maintainer.email}" = maintainer.github; }
+    else
+      {};
+in lib.zipAttrsWith (_: builtins.head) (lib.mapAttrsToList mkMailGithubPair maintainers)
diff --git a/nixpkgs/maintainers/scripts/haskell/mark-broken.sh b/nixpkgs/maintainers/scripts/haskell/mark-broken.sh
new file mode 100755
index 000000000000..9aa9433b8023
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/mark-broken.sh
@@ -0,0 +1,66 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p coreutils git -I nixpkgs=.
+
+# This script uses the data pulled with
+# maintainers/scripts/haskell/hydra-report.hs get-report to produce a list of
+# failing builds that get written to the hackage2nix config. Then
+# hackage-packages.nix gets regenerated and transitive-broken packages get
+# marked as dont-distribute in the config as well.
+# This should disable builds for most failing jobs in the haskell-updates jobset.
+
+set -euo pipefail
+
+do_commit=false
+mark_broken_list_flags=""
+
+for arg in "$@"; do
+    case "$arg" in
+        --do-commit)
+            do_commit=true
+            ;;
+        --no-request-logs)
+            mark_broken_list_flags="$mark_broken_list_flags $arg"
+            ;;
+        *)
+            echo "$0: unknown flag: $arg"
+            exit 100
+            ;;
+    esac
+done
+
+broken_config="pkgs/development/haskell-modules/configuration-hackage2nix/broken.yaml"
+
+tmpfile=$(mktemp)
+trap "rm ${tmpfile}" 0
+
+echo "Remember that you need to manually run 'maintainers/scripts/haskell/hydra-report.hs get-report' sometime before running this script."
+echo "Generating a list of broken builds and displaying for manual confirmation ..."
+maintainers/scripts/haskell/hydra-report.hs mark-broken-list $mark_broken_list_flags | sort -i > "$tmpfile"
+
+$EDITOR "$tmpfile"
+
+tail -n +3 "$broken_config" >> "$tmpfile"
+
+cat > "$broken_config" << EOF
+broken-packages:
+  # These packages don't compile.
+EOF
+
+# clear environment here to avoid things like allowing broken builds in
+sort -iu "$tmpfile" >> "$broken_config"
+clear="env -u HOME -u NIXPKGS_CONFIG"
+$clear maintainers/scripts/haskell/regenerate-hackage-packages.sh
+evalline=$(maintainers/scripts/haskell/hydra-report.hs eval-info)
+
+if $do_commit; then
+git add $broken_config
+git add pkgs/development/haskell-modules/configuration-hackage2nix/transitive-broken.yaml
+git add pkgs/development/haskell-modules/hackage-packages.nix
+git commit -F - << EOF
+haskellPackages: mark builds failing on hydra as broken
+
+This commit has been generated by maintainers/scripts/haskell/mark-broken.sh based on
+$evalline
+from the haskell-updates jobset on hydra under https://hydra.nixos.org/jobset/nixpkgs/haskell-updates
+EOF
+fi
diff --git a/nixpkgs/maintainers/scripts/haskell/merge-and-open-pr.sh b/nixpkgs/maintainers/scripts/haskell/merge-and-open-pr.sh
new file mode 100755
index 000000000000..62565d24d623
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/merge-and-open-pr.sh
@@ -0,0 +1,129 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p git gh -I nixpkgs=.
+#
+# Script to merge the currently open haskell-updates PR into master, bump the
+# Stackage version and Hackage versions, and open the next haskell-updates PR.
+
+set -eu -o pipefail
+
+# exit after printing first argument to this function
+function die {
+  # echo the first argument
+  echo "ERROR: $1"
+  echo "Aborting!"
+
+  exit 1
+}
+
+function help {
+  echo "Usage: $0 HASKELL_UPDATES_PR_NUM"
+  echo "Merge the currently open haskell-updates PR into master, and open the next one."
+  echo
+  echo "  -h, --help                print this help"
+  echo "  HASKELL_UPDATES_PR_NUM    number of the currently open PR on NixOS/nixpkgs"
+  echo "                            for the haskell-updates branch"
+  echo
+  echo "Example:"
+  echo "  \$ $0 137340"
+
+  exit 1
+}
+
+# Read in the current haskell-updates PR number from the command line.
+while [[ $# -gt 0 ]]; do
+  key="$1"
+
+  case $key in
+    -h|--help)
+      help
+      ;;
+    *)
+      curr_haskell_updates_pr_num="$1"
+      shift
+      ;;
+  esac
+done
+
+if [[ -z "${curr_haskell_updates_pr_num-}" ]] ; then
+  die "You must pass the current haskell-updates PR number as the first argument to this script."
+fi
+
+# Make sure you have gh authentication setup.
+if ! gh auth status 2>/dev/null ; then
+  die "You must setup the \`gh\` command.  Run \`gh auth login\`."
+fi
+
+# Make sure this is configured before we start doing anything
+push_remote="$(git config branch.haskell-updates.pushRemote)" \
+  || die 'Can'\''t determine pushRemote for haskell-updates. Please set using `git config branch.haskell-updates.pushremote <remote name>`.'
+
+# Fetch nixpkgs to get an up-to-date origin/haskell-updates branch.
+echo "Fetching origin..."
+git fetch origin >/dev/null
+
+# Make sure we are currently on a local haskell-updates branch.
+curr_branch="$(git rev-parse --abbrev-ref HEAD)"
+if [[ "$curr_branch" != "haskell-updates" ]]; then
+    die "Current branch is not called \"haskell-updates\"."
+fi
+
+# Make sure our local haskell-updates branch is on the same commit as
+# origin/haskell-updates.
+curr_branch_commit="$(git rev-parse haskell-updates)"
+origin_haskell_updates_commit="$(git rev-parse origin/haskell-updates)"
+if [[ "$curr_branch_commit" != "$origin_haskell_updates_commit" ]]; then
+    die "Current branch is not at the same commit as origin/haskell-updates"
+fi
+
+# Merge the current open haskell-updates PR.
+echo "Merging https://github.com/NixOS/nixpkgs/pull/${curr_haskell_updates_pr_num}..."
+gh pr merge --repo NixOS/nixpkgs --merge "$curr_haskell_updates_pr_num"
+
+# Update the list of Haskell package versions in NixOS on Hackage.
+echo "Updating list of Haskell package versions in NixOS on Hackage..."
+./maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh
+
+# Update stackage, Hackage hashes, and regenerate Haskell package set
+echo "Updating Stackage..."
+./maintainers/scripts/haskell/update-stackage.sh --do-commit
+echo "Updating Hackage hashes..."
+./maintainers/scripts/haskell/update-hackage.sh --do-commit
+echo "Regenerating Hackage packages..."
+# Using fast here because after the hackage-update eval errors will likely break the transitive dependencies check.
+./maintainers/scripts/haskell/regenerate-hackage-packages.sh --fast --do-commit
+
+# Push these new commits to the haskell-updates branch
+echo "Pushing commits just created to the remote $push_remote/haskell-updates branch..."
+git push "$push_remote" haskell-updates
+
+# Open new PR
+new_pr_body=$(cat <<EOF
+### This Merge
+
+This PR is the regular merge of the \`haskell-updates\` branch into \`master\`.
+
+This branch is being continually built and tested by hydra at https://hydra.nixos.org/jobset/nixpkgs/haskell-updates. You may be able to find an up-to-date Hydra build report at [cdepillabout/nix-haskell-updates-status](https://github.com/cdepillabout/nix-haskell-updates-status).
+
+We roughly aim to merge these \`haskell-updates\` PRs at least once every two weeks. See the @NixOS/haskell [team calendar](https://cloud.maralorn.de/apps/calendar/p/H6migHmKX7xHoTFa) for who is currently in charge of this branch.
+
+### haskellPackages Workflow Summary
+
+Our workflow is currently described in [\`pkgs/development/haskell-modules/HACKING.md\`](https://github.com/NixOS/nixpkgs/blob/haskell-updates/pkgs/development/haskell-modules/HACKING.md).
+
+The short version is this:
+* We regularly update the Stackage and Hackage pins on \`haskell-updates\` (normally at the beginning of a merge window).
+* The community fixes builds of Haskell packages on that branch.
+* We aim at at least one merge of \`haskell-updates\` into \`master\` every two weeks.
+* We only do the merge if the [\`mergeable\`](https://hydra.nixos.org/job/nixpkgs/haskell-updates/mergeable) job is succeeding on hydra.
+* If a [\`maintained\`](https://hydra.nixos.org/job/nixpkgs/haskell-updates/maintained) package is still broken at the time of merge, we will only merge if the maintainer has been pinged 7 days in advance. (If you care about a Haskell package, become a maintainer!)
+
+More information about Haskell packages in nixpkgs can be found [in the nixpkgs manual](https://nixos.org/manual/nixpkgs/unstable/#haskell).
+
+---
+
+This is the follow-up to #${curr_haskell_updates_pr_num}. Come to [#haskell:nixos.org](https://matrix.to/#/#haskell:nixos.org) if you have any questions.
+EOF
+)
+
+echo "Opening a PR for the next haskell-updates merge cycle..."
+gh pr create --repo NixOS/nixpkgs --base master --head haskell-updates --title "haskellPackages: update stackage and hackage" --body "$new_pr_body"
diff --git a/nixpkgs/maintainers/scripts/haskell/regenerate-hackage-packages.sh b/nixpkgs/maintainers/scripts/haskell/regenerate-hackage-packages.sh
new file mode 100755
index 000000000000..96a18aa8ed87
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/regenerate-hackage-packages.sh
@@ -0,0 +1,120 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p coreutils haskellPackages.cabal2nix-unstable git nix -I nixpkgs=.
+
+set -euo pipefail
+
+self=$0
+
+print_help () {
+cat <<END_HELP
+Usage: $self [options]
+
+Options:
+   --do-commit    Commit changes to this file.
+   -f | --fast    Do not update the transitive-broken.yaml file.
+   -h | --help    Show this help.
+
+This script is used to regenerate nixpkgs' Haskell package set, using the
+tool hackage2nix from the nixos/cabal2nix repo. hackage2nix looks at the
+config files in pkgs/development/haskell-modules/configuration-hackage2nix
+and generates a Nix expression for package version specified there, using the
+Cabal files from the Hackage database (available under all-cabal-hashes) and
+its companion tool cabal2nix.
+
+Unless --fast is used, it will then use the generated nix expression by
+running regenerate-transitive-broken-packages.sh which updates the transitive-broken.yaml
+file. Then it re-runs hackage2nix.
+
+Related scripts are update-hackage.sh, for updating the snapshot of the
+Hackage database used by hackage2nix, and update-cabal2nix-unstable.sh,
+for updating the version of hackage2nix used to perform this task.
+
+Note that this script doesn't gcroot anything, so it may be broken by an
+unfortunately timed nix-store --gc.
+
+END_HELP
+}
+
+DO_COMMIT=0
+REGENERATE_TRANSITIVE=1
+
+options=$(getopt -o "fh" -l "help,fast,do-commit" -- "$@")
+
+eval set -- "$options"
+
+while true; do
+   case "$1" in
+      --do-commit)
+         DO_COMMIT=1
+         ;;
+      -f|--fast)
+         REGENERATE_TRANSITIVE=0
+         ;;
+      -h|--help)
+         print_help
+         exit 0
+         ;;
+      --)
+         break;;
+      *)
+         print_help
+         exit 1
+         ;;
+   esac
+   shift
+done
+
+HACKAGE2NIX="${HACKAGE2NIX:-hackage2nix}"
+
+# To prevent hackage2nix fails because of encoding.
+# See: https://github.com/NixOS/nixpkgs/pull/122023
+export LC_ALL=C.UTF-8
+
+config_dir=pkgs/development/haskell-modules/configuration-hackage2nix
+
+run_hackage2nix() {
+"$HACKAGE2NIX" \
+   --hackage "$unpacked_hackage" \
+   --preferred-versions <(for n in "$unpacked_hackage"/*/preferred-versions; do cat "$n"; echo; done) \
+   --nixpkgs "$PWD" \
+   --config "$compiler_config" \
+   --config "$config_dir/main.yaml" \
+   --config "$config_dir/stackage.yaml" \
+   --config "$config_dir/broken.yaml" \
+   --config "$config_dir/transitive-broken.yaml"
+}
+
+echo "Obtaining Hackage data …"
+extraction_derivation='with import ./. {}; runCommandLocal "unpacked-cabal-hashes" { } "tar xf ${all-cabal-hashes} --strip-components=1 --one-top-level=$out"'
+unpacked_hackage="$(nix-build -E "$extraction_derivation" --no-out-link)"
+
+echo "Generating compiler configuration …"
+compiler_config="$(nix-build -A haskellPackages.cabal2nix-unstable.compilerConfig --no-out-link)"
+
+echo "Running hackage2nix to regenerate pkgs/development/haskell-modules/hackage-packages.nix …"
+run_hackage2nix
+
+if [[ "$REGENERATE_TRANSITIVE" -eq 1 ]]; then
+
+echo "Regenerating transitive-broken.yaml … (pass --fast to $self to skip this step)"
+
+maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh
+
+echo "Running hackage2nix again to reflect changes in transitive-broken.yaml …"
+
+run_hackage2nix
+
+fi
+
+
+if [[ "$DO_COMMIT" -eq 1 ]]; then
+git add pkgs/development/haskell-modules/configuration-hackage2nix/transitive-broken.yaml
+git add pkgs/development/haskell-modules/hackage-packages.nix
+git commit -F - << EOF
+haskellPackages: regenerate package set based on current config
+
+This commit has been generated by maintainers/scripts/haskell/regenerate-hackage-packages.sh
+EOF
+fi
+
+echo "Regeneration of hackage-packages.nix finished."
diff --git a/nixpkgs/maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh b/nixpkgs/maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh
new file mode 100755
index 000000000000..a317dba4d4e7
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh
@@ -0,0 +1,25 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p coreutils jq nix -I nixpkgs=.
+
+set -euo pipefail
+
+TMP_TEMPLATE=transitive-broken.XXXXXXX
+readonly TMP_TEMPLATE
+
+tmpfile=$(mktemp "$TMP_TEMPLATE")
+
+trap 'rm -f "${tmpfile}"' 0
+
+config_file=pkgs/development/haskell-modules/configuration-hackage2nix/transitive-broken.yaml
+
+cat > $tmpfile << EOF
+# This file is automatically generated by
+# maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh
+# It is supposed to list all haskellPackages that cannot evaluate because they
+# depend on a dependency marked as broken.
+dont-distribute-packages:
+EOF
+
+nix-instantiate --eval --option restrict-eval true -I . --strict --json maintainers/scripts/haskell/transitive-broken-packages.nix | jq -r . | LC_ALL=C.UTF-8 sort -i >> $tmpfile
+
+mv $tmpfile $config_file
diff --git a/nixpkgs/maintainers/scripts/haskell/test-configurations.nix b/nixpkgs/maintainers/scripts/haskell/test-configurations.nix
new file mode 100644
index 000000000000..8473ed4db8a2
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/test-configurations.nix
@@ -0,0 +1,158 @@
+/* Nix expression to test for regressions in the Haskell configuration overlays.
+
+   test-configurations.nix determines all attributes touched by given Haskell
+   configuration overlays (i. e. pkgs/development/haskell-modules/configuration-*.nix)
+   and builds all derivations (or at least a reasonable subset) affected by
+   these overrides.
+
+   By default, it checks `configuration-{common,nix,ghc-8.10.x}.nix`. You can
+   invoke it like this:
+
+     nix-build maintainers/scripts/haskell/test-configurations.nix --keep-going
+
+   It is possible to specify other configurations:
+
+     nix-build maintainers/scripts/haskell/test-configurations.nix \
+       --arg files '[ "configuration-ghc-9.0.x.nix" "configuration-ghc-9.2.x.nix" ]' \
+       --keep-going
+
+   You can also just supply a single string:
+
+     nix-build maintainers/scripts/haskell/test-configurations.nix \
+       --argstr files "configuration-arm.nix" --keep-going
+
+   You can even supply full paths which is handy, as it allows for tab-completing
+   the configurations:
+
+     nix-build maintainers/scripts/haskell/test-configurations.nix \
+       --argstr files pkgs/development/haskell-modules/configuration-arm.nix \
+       --keep-going
+
+   By default, derivation that fail to evaluate are skipped, unless they are
+   “just” marked as broken. You can check for other eval errors like this:
+
+     nix-build maintainers/scripts/haskell/test-configurations.nix \
+       --arg skipEvalErrors false --keep-going
+
+   You can also disable checking broken packages by passing a nixpkgs config:
+
+     nix-build maintainers/scripts/haskell/test-configurations.nix \
+       --arg config '{ allowBroken = false; }' --keep-going
+
+   By default the haskell.packages.ghc*Binary sets used for bootstrapping GHC
+   are _not_ tested. You can change this using:
+
+     nix-build maintainers/scripts/haskell/test-configurations.nix \
+       --arg skipBinaryGHCs false --keep-going
+
+*/
+{ files ? [
+    "configuration-common.nix"
+    "configuration-nix.nix"
+    "configuration-ghc-8.10.x.nix"
+  ]
+, nixpkgsPath ? ../../..
+, config ? { allowBroken = true; }
+, skipEvalErrors ? true
+, skipBinaryGHCs ? true
+}:
+
+let
+  pkgs = import nixpkgsPath { inherit config; };
+  inherit (pkgs) lib;
+
+  # see usage explanation for the input format `files` allows
+  files' = builtins.map builtins.baseNameOf (
+    if !builtins.isList files then [ files ] else files
+  );
+
+  packageSetsWithVersionedHead = pkgs.haskell.packages // (
+    let
+      headSet = pkgs.haskell.packages.ghcHEAD;
+      # Determine the next GHC release version following GHC HEAD.
+      # GHC HEAD always has an uneven, tentative version number, e.g. 9.7.
+      # GHC releases always have even numbers, i.e. GHC 9.8 is branched off from
+      # GHC HEAD 9.7. Since we use the to be release number for GHC HEAD's
+      # configuration file, we need to calculate this here.
+      headVersion = lib.pipe headSet.ghc.version [
+        lib.versions.splitVersion
+        (lib.take 2)
+        lib.concatStrings
+        lib.strings.toInt
+        (builtins.add 1)
+        toString
+      ];
+    in
+    {
+      "ghc${headVersion}" = headSet;
+    }
+  );
+
+  setsForFile = fileName:
+    let
+      # extract the unique part of the config's file name
+      configName = builtins.head (
+        builtins.match "configuration-(.+).nix" fileName
+      );
+      # match the major and minor version of the GHC the config is intended for, if any
+      configVersion = lib.concatStrings (
+        builtins.match "ghc-([0-9]+).([0-9]+).x" configName
+      );
+      # return all package sets under haskell.packages matching the version components
+      setsForVersion =  builtins.map (name: packageSetsWithVersionedHead.${name}) (
+        builtins.filter (setName:
+          lib.hasPrefix "ghc${configVersion}" setName
+          && (skipBinaryGHCs -> !(lib.hasInfix "Binary" setName))
+        ) (
+          builtins.attrNames packageSetsWithVersionedHead
+        )
+      );
+
+      defaultSets = [ pkgs.haskellPackages ];
+    in {
+      # use plain haskellPackages for the version-agnostic files
+      # TODO(@sternenseemann): also consider currently selected versioned sets
+      "common" = defaultSets;
+      "nix" = defaultSets;
+      "arm" = defaultSets;
+      "darwin" = defaultSets;
+    }.${configName} or setsForVersion;
+
+  # attribute set that has all the attributes of haskellPackages set to null
+  availableHaskellPackages = builtins.listToAttrs (
+    builtins.map (attr: lib.nameValuePair attr null) (
+      builtins.attrNames pkgs.haskellPackages
+    )
+  );
+
+  # evaluate a configuration and only return the attributes changed by it,
+  # pass availableHaskellPackages as super in case intersectAttrs is used
+  overriddenAttrs = fileName: builtins.attrNames (
+    lib.fix (self:
+      import (nixpkgsPath + "/pkgs/development/haskell-modules/${fileName}") {
+        haskellLib = pkgs.haskell.lib.compose;
+        inherit pkgs;
+      } self availableHaskellPackages
+    )
+  );
+
+  # list of derivations that are affected by overrides in the given configuration
+  # overlays. For common, nix, darwin etc. only the derivation from the default
+  # package set will be emitted.
+  packages = builtins.filter (v:
+    lib.warnIf (v.meta.broken or false) "${v.pname} is marked as broken" (
+      v != null
+      && (skipEvalErrors -> (builtins.tryEval (v.outPath or v)).success)
+    )
+  ) (
+    lib.concatMap (fileName:
+      let
+        sets = setsForFile fileName;
+        attrs = overriddenAttrs fileName;
+      in
+        lib.concatMap (set: builtins.map (attr: set.${attr}) attrs) sets
+    ) files'
+  );
+in
+
+packages
diff --git a/nixpkgs/maintainers/scripts/haskell/transitive-broken-packages.nix b/nixpkgs/maintainers/scripts/haskell/transitive-broken-packages.nix
new file mode 100644
index 000000000000..50ccb14577bc
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/transitive-broken-packages.nix
@@ -0,0 +1,16 @@
+let
+  nixpkgs = import ../../..;
+  inherit (nixpkgs {}) pkgs lib;
+  getEvaluating = x:
+    builtins.attrNames (
+      lib.filterAttrs (
+        _: v: (builtins.tryEval (v.outPath or null)).success && lib.isDerivation v && !v.meta.broken
+      ) x
+    );
+  brokenDeps = lib.subtractLists
+    (getEvaluating pkgs.haskellPackages)
+    (getEvaluating (nixpkgs { config.allowBroken = true; }).haskellPackages);
+in
+''
+  ${lib.concatMapStringsSep "\n" (x: " - ${x}") brokenDeps}
+''
diff --git a/nixpkgs/maintainers/scripts/haskell/update-cabal2nix-unstable.sh b/nixpkgs/maintainers/scripts/haskell/update-cabal2nix-unstable.sh
new file mode 100755
index 000000000000..545c5773ff48
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/update-cabal2nix-unstable.sh
@@ -0,0 +1,17 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p coreutils curl jq gnused haskellPackages.cabal2nix-unstable -I nixpkgs=.
+
+# Updates cabal2nix-unstable to the latest master of the nixos/cabal2nix repository.
+# See regenerate-hackage-packages.sh for details on the purpose of this script.
+
+set -euo pipefail
+
+# fetch current master HEAD from Github
+head_info="$(curl -H "Accept: application/vnd.github.v3+json" https://api.github.com/repos/NixOS/cabal2nix/branches/master)"
+# extract commit hash
+commit="$(jq -r .commit.sha <<< "$head_info")"
+# extract commit timestamp and convert to date
+date="$(date "--date=$(jq -r .commit.commit.committer.date <<< "$head_info")" +%F)"
+# generate nix expression from cabal file, replacing the version with the commit date
+echo '# This file defines cabal2nix-unstable, used by maintainers/scripts/haskell/regenerate-hackage-packages.sh.' > pkgs/development/haskell-modules/cabal2nix-unstable.nix
+cabal2nix --subpath cabal2nix "https://github.com/NixOS/cabal2nix/archive/$commit.tar.gz" | sed -e 's/version = ".*"/version = "'"unstable-$date"'"/' >> pkgs/development/haskell-modules/cabal2nix-unstable.nix
diff --git a/nixpkgs/maintainers/scripts/haskell/update-hackage.sh b/nixpkgs/maintainers/scripts/haskell/update-hackage.sh
new file mode 100755
index 000000000000..5aa644a3d0fa
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/update-hackage.sh
@@ -0,0 +1,35 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p nix curl jq git gnused -I nixpkgs=.
+
+# See regenerate-hackage-packages.sh for details on the purpose of this script.
+
+set -euo pipefail
+
+pin_file=pkgs/data/misc/hackage/pin.json
+current_commit="$(jq -r .commit $pin_file)"
+old_date="$(jq -r .msg $pin_file | sed 's/Update from Hackage at //')"
+git_info="$(curl -H "Accept: application/vnd.github.v3+json" https://api.github.com/repos/commercialhaskell/all-cabal-hashes/branches/hackage)"
+head_commit="$(echo "$git_info" | jq -r .commit.sha)"
+commit_msg="$(echo "$git_info" | jq -r .commit.commit.message)"
+new_date="$(echo "$commit_msg" | sed 's/Update from Hackage at //')"
+
+if [ "$current_commit" != "$head_commit" ]; then
+   url="https://github.com/commercialhaskell/all-cabal-hashes/archive/$head_commit.tar.gz"
+   hash="$(nix-prefetch-url "$url")"
+   jq -n \
+     --arg commit "$head_commit" \
+     --arg hash "$hash" \
+     --arg url "$url" \
+     --arg commit_msg "$commit_msg" \
+     '{commit: $commit, url: $url, sha256: $hash, msg: $commit_msg}' \
+     > $pin_file
+fi
+
+if [[ "${1:-}" == "--do-commit" ]]; then
+git add pkgs/data/misc/hackage/pin.json
+git commit -F - << EOF
+all-cabal-hashes: $old_date -> $new_date
+
+This commit has been generated by maintainers/scripts/haskell/update-hackage.sh
+EOF
+fi
diff --git a/nixpkgs/maintainers/scripts/haskell/update-stackage.sh b/nixpkgs/maintainers/scripts/haskell/update-stackage.sh
new file mode 100755
index 000000000000..5dc52abdd668
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/update-stackage.sh
@@ -0,0 +1,87 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p nix curl jq git gnused gnugrep -I nixpkgs=.
+# shellcheck shell=bash
+
+set -eu -o pipefail
+
+# Stackage solver to use, LTS or Nightly
+# (should be capitalized like the display name)
+SOLVER=LTS
+# Stackage solver verson, if any. Use latest if empty
+VERSION=21
+TMP_TEMPLATE=update-stackage.XXXXXXX
+readonly SOLVER
+readonly VERSION
+readonly TMP_TEMPLATE
+
+toLower() {
+    printf "%s" "$1" | tr '[:upper:]' '[:lower:]'
+}
+
+tmpfile=$(mktemp "$TMP_TEMPLATE")
+tmpfile_new=$(mktemp "$TMP_TEMPLATE")
+
+stackage_config="pkgs/development/haskell-modules/configuration-hackage2nix/stackage.yaml"
+
+trap 'rm "${tmpfile}" "${tmpfile_new}"' 0
+touch "$tmpfile" "$tmpfile_new" # Creating files here so that trap creates no errors.
+
+curl -L -s "https://stackage.org/$(toLower "$SOLVER")${VERSION:+-$VERSION}/cabal.config" >"$tmpfile"
+old_version=$(grep '^# Stackage' $stackage_config | sed -e 's/.\+ \([A-Za-z]\+ [0-9.-]\+\)$/\1/g')
+version="$SOLVER $(sed -rn "s/^--.*http:..(www.)?stackage.org.snapshot.$(toLower "$SOLVER")-//p" "$tmpfile")"
+
+if [[ "$old_version" == "$version" ]]; then
+   echo "No new stackage version"
+   exit 0 # Nothing to do
+fi
+
+echo "Updating Stackage from $old_version to $version."
+
+# Create a simple yaml version of the file.
+sed -r \
+    -e '/^--/d' \
+    -e 's|^constraints:||' \
+    -e 's|^ +|  - |' \
+    -e 's|,$||' \
+    -e '/^with-compiler:/d' \
+    -e '/installed$/d' \
+    -e '/^$/d' \
+    < "${tmpfile}" | sort --ignore-case >"${tmpfile_new}"
+
+cat > $stackage_config << EOF
+# Stackage $version
+# This file is auto-generated by
+# maintainers/scripts/haskell/update-stackage.sh
+default-package-overrides:
+EOF
+
+# Drop restrictions on some tools where we always want the latest version.
+sed -r \
+    -e '/ cabal2nix /d' \
+    -e '/ distribution-nixpkgs /d' \
+    -e '/ jailbreak-cabal /d' \
+    -e '/ language-nix /d' \
+    -e '/ hackage-db /d' \
+    -e '/ cabal-install /d' \
+    -e '/ lsp /d' \
+    -e '/ lsp-types /d' \
+    -e '/ lsp-test /d' \
+    -e '/ hie-bios /d' \
+    -e '/ ShellCheck /d' \
+    -e '/ Agda /d' \
+    -e '/ stack /d' \
+    < "${tmpfile_new}" >> $stackage_config
+# Explanations:
+# cabal2nix, distribution-nixpkgs, jailbreak-cabal, language-nix: These are our packages and we know what we are doing.
+# lsp, lsp-types, lsp-test, hie-bios: These are tightly coupled to hls which is not in stackage. They have no rdeps in stackage.
+# ShellCheck: latest version of command-line dev tool.
+# Agda: The Agda community is fast-moving; we strive to always include the newest versions of Agda and the Agda packages in nixpkgs.
+
+if [[ "${1:-}" == "--do-commit" ]]; then
+git add $stackage_config
+git commit -F - << EOF
+haskellPackages: stackage $old_version -> $version
+
+This commit has been generated by maintainers/scripts/haskell/update-stackage.sh
+EOF
+fi
diff --git a/nixpkgs/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh b/nixpkgs/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh
new file mode 100755
index 000000000000..9130941a5366
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh
@@ -0,0 +1,43 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i bash -p nix curl gnused -I nixpkgs=.
+
+# On Hackage every package description shows a category "Distributions" which
+# lists a "NixOS" version.
+# This script uploads a csv to hackage which will update the displayed versions
+# based on the current versions in nixpkgs. This happens with a simple http
+# request.
+
+# For authorization you just need to have any valid hackage account. This
+# script uses the `username` and `password-command` field from your
+# ~/.cabal/config file.
+
+# e.g. username: maralorn
+#      password-command: pass hackage.haskell.org (this can be any command, but not an arbitrary shell expression. Like cabal we only read the first output line and ignore the rest.)
+# Those fields are specified under `upload` on the `cabal` man page.
+
+if test -z "$CABAL_DIR"; then
+  dirs=(
+    "$HOME/.cabal"
+    "${XDG_CONFIG_HOME:-$HOME/.config}/cabal"
+  )
+  missing=true
+
+  for dir in "${dirs[@]}"; do
+    if test -d "$dir"; then
+      export CABAL_DIR="$dir"
+      missing=false
+      break
+    fi
+  done
+
+  if $missing; then
+    echo "Could not find the cabal configuration directory in any of: ${dirs[@]}" >&2
+    exit 101
+  fi
+fi
+
+package_list="$(nix-build -A haskell.package-list)/nixos-hackage-packages.csv"
+username=$(grep "^username:" "$CABAL_DIR/config" | sed "s/^username: //")
+password_command=$(grep "^password-command:" "$CABAL_DIR/config" | sed "s/^password-command: //")
+curl -u "$username:$($password_command | head -n1)" --digest -H "Content-type: text/csv" -T "$package_list" https://hackage.haskell.org/distro/NixOS/packages.csv
+echo
diff --git a/nixpkgs/maintainers/scripts/hydra-eval-failures.py b/nixpkgs/maintainers/scripts/hydra-eval-failures.py
new file mode 100755
index 000000000000..b7518b128574
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/hydra-eval-failures.py
@@ -0,0 +1,112 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -i python3 -p "python3.withPackages(ps: with ps; [ requests pyquery click ])"
+
+# To use, just execute this script with --help to display help.
+
+import subprocess
+import json
+import sys
+
+import click
+import requests
+from pyquery import PyQuery as pq
+
+def map_dict (f, d):
+    for k,v in d.items():
+        d[k] = f(v)
+
+maintainers_json = subprocess.check_output([
+    'nix-instantiate', '-A', 'lib.maintainers', '--eval', '--strict', '--json'
+])
+maintainers = json.loads(maintainers_json)
+MAINTAINERS = map_dict(lambda v: v.get('github', None), maintainers)
+
+def get_response_text(url):
+    return pq(requests.get(url).text)  # IO
+
+EVAL_FILE = {
+    'nixos': 'nixos/release.nix',
+    'nixpkgs': 'pkgs/top-level/release.nix',
+}
+
+
+def get_maintainers(attr_name):
+    try:
+        nixname = attr_name.split('.')
+        meta_json = subprocess.check_output([
+            'nix-instantiate',
+            '--eval',
+            '--strict',
+            '-A',
+            '.'.join(nixname[1:]) + '.meta',
+            EVAL_FILE[nixname[0]],
+            '--arg',
+            'nixpkgs',
+            './.',
+            '--json'])
+        meta = json.loads(meta_json)
+        return meta.get('maintainers', [])
+    except:
+       return []
+
+def filter_github_users(maintainers):
+    github_only = []
+    for i in maintainers:
+        if i.get('github'):
+            github_only.append(i)
+    return github_only
+
+def print_build(table_row):
+    a = pq(table_row)('a')[1]
+    print("- [ ] [{}]({})".format(a.text, a.get('href')), flush=True)
+
+    job_maintainers = filter_github_users(get_maintainers(a.text))
+    if job_maintainers:
+        print("  - maintainers: {}".format(" ".join(map(lambda u: '@' + u.get('github'), job_maintainers))))
+    # TODO: print last three persons that touched this file
+    # TODO: pinpoint the diff that broke this build, or maybe it's transient or maybe it never worked?
+
+    sys.stdout.flush()
+
+@click.command()
+@click.option(
+    '--jobset',
+    default="nixos/release-19.09",
+    help='Hydra project like nixos/release-19.09')
+def cli(jobset):
+    """
+    Given a Hydra project, inspect latest evaluation
+    and print a summary of failed builds
+    """
+
+    url = "https://hydra.nixos.org/jobset/{}".format(jobset)
+
+    # get the last evaluation
+    click.echo(click.style(
+        'Getting latest evaluation for {}'.format(url), fg='green'))
+    d = get_response_text(url)
+    evaluations = d('#tabs-evaluations').find('a[class="row-link"]')
+    latest_eval_url = evaluations[0].get('href')
+
+    # parse last evaluation page
+    click.echo(click.style(
+        'Parsing evaluation {}'.format(latest_eval_url), fg='green'))
+    d = get_response_text(latest_eval_url + '?full=1')
+
+    # TODO: aborted evaluations
+    # TODO: dependency failed without propagated builds
+    print('\nFailures:')
+    for tr in d('img[alt="Failed"]').parents('tr'):
+        print_build(tr)
+
+    print('\nDependency failures:')
+    for tr in d('img[alt="Dependency failed"]').parents('tr'):
+        print_build(tr)
+
+
+
+if __name__ == "__main__":
+    try:
+        cli()
+    except Exception as e:
+        import pdb;pdb.post_mortem()
diff --git a/nixpkgs/maintainers/scripts/hydra_eval_check b/nixpkgs/maintainers/scripts/hydra_eval_check
new file mode 100755
index 000000000000..c8e03424f320
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/hydra_eval_check
@@ -0,0 +1,13 @@
+#! /bin/sh
+
+# give absolute path of release.nix as argument
+hydra_eval_jobs \
+  --argstr system x86_64-linux \
+  --argstr system i686-linux \
+  --argstr system x86_64-darwin \
+  --argstr system i686-cygwin \
+  --argstr system x86_64-cygwin \
+  --argstr system i686-freebsd \
+  --arg officialRelease false \
+  --arg nixpkgs "{ outPath = builtins.storePath ./. ; rev = 1234; }" \
+  $@
diff --git a/nixpkgs/maintainers/scripts/luarocks-config.lua b/nixpkgs/maintainers/scripts/luarocks-config.lua
new file mode 100644
index 000000000000..f7ac9f9e4ba6
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/luarocks-config.lua
@@ -0,0 +1,8 @@
+
+-- default of luarocks listed at src/luarocks/core/cfg.lua
+-- keep this list synced with pkgs/build-support/fetchurl/mirrors.nix
+rocks_servers = {
+	"https://luarocks.org",
+	"https://raw.githubusercontent.com/rocks-moonscript-org/moonrocks-mirror/master/"
+}
+version_check_on_fail = false
diff --git a/nixpkgs/maintainers/scripts/luarocks-packages.csv b/nixpkgs/maintainers/scripts/luarocks-packages.csv
new file mode 100644
index 000000000000..939905ab81d9
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/luarocks-packages.csv
@@ -0,0 +1,124 @@
+name,src,ref,server,version,luaversion,maintainers
+alt-getopt,,,,,,arobyn
+bit32,,,,5.3.0-1,5.1,lblasc
+argparse,,,,,,
+basexx,,,,,,
+binaryheap,,,,,,vcunat
+busted,,,,,,
+cassowary,,,,,,marsam alerque
+cldr,,,,,,alerque
+compat53,,,,,,vcunat
+cosmo,,,,,,marsam
+coxpcall,,,,1.17.0-1,,
+cqueues,,,,,,vcunat
+cyan,,,,,,
+digestif,https://github.com/astoff/digestif.git,,,,5.3,
+dkjson,,,,,,
+fennel,,,,,,misterio77
+fidget.nvim,,,,,,mrcjkb
+fifo,,,,,,
+fluent,,,,,,alerque
+fzy,,,,,,mrcjkb
+gitsigns.nvim,https://github.com/lewis6991/gitsigns.nvim.git,,,,5.1,
+haskell-tools.nvim,,,,,,
+http,,,,0.3-0,,vcunat
+image.nvim,,,,,,teto
+inspect,,,,,,
+jsregexp,,,,,,
+ldbus,,,http://luarocks.org/dev,,,
+ldoc,,,,,,
+lgi,,,,,,
+linenoise,https://github.com/hoelzro/lua-linenoise.git,,,,,
+ljsyscall,,,,,5.1,lblasc
+lmathx,,,,,5.3,alexshpilkin
+lmpfrlib,,,,,5.3,alexshpilkin
+loadkit,,,,,,alerque
+lpeg,,,,,,vyp
+lpeg_patterns,,,,,,
+lpeglabel,,,,1.6.0,,
+lrexlib-gnu,,,,,,
+lrexlib-pcre,,,,,,vyp
+lrexlib-posix,,,,,,
+lua-cjson,,,,,,
+lua-cmsgpack,,,,,,
+lua-curl,,,,,,
+lua-ffi-zlib,,,,,,
+lua-lsp,,,,,,
+lua-messagepack,,,,,,
+lua-protobuf,,,,,,lockejan
+lua-resty-http,,,,,,
+lua-resty-jwt,,,,,,
+lua-resty-openidc,,,,,,
+lua-resty-openssl,,,,,,
+lua-resty-session,,,,,,
+lua-rtoml,https://github.com/lblasc/lua-rtoml,,,,,lblasc
+lua-subprocess,https://github.com/0x0ade/lua-subprocess,,,,5.1,scoder12
+lua-term,,,,,,
+lua-toml,,,,,,
+lua-zlib,,,,,,koral
+lua_cliargs,,,,,,
+luabitop,https://github.com/teto/luabitop.git,,,,,
+luacheck,,,,,,
+luacov,,,,,,
+luadbi,,,,,,
+luadbi-mysql,,,,,,
+luadbi-postgresql,,,,,,
+luadbi-sqlite3,,,,,,
+luaepnf,,,,,,
+luaevent,,,,,,
+luaexpat,,,,1.4.1-1,,arobyn flosse
+luaffi,,,http://luarocks.org/dev,,,
+luafilesystem,,,,1.8.0-1,,flosse
+lualdap,,,,,,aanderse
+lualogging,,,,,,
+luaossl,,,,,5.1,
+luaposix,,,,34.1.1-1,,vyp lblasc
+luarepl,,,,,,
+luarocks-build-rust-mlua,,,,,,mrcjkb
+luasec,,,,,,flosse
+luasnip,,,,,,
+luasocket,,,,,,
+luasql-sqlite3,,,,,,vyp
+luassert,,,,,,
+luasystem,,,,,,
+luaunbound,,,,,,
+luaunit,,,,,,lockejan
+luautf8,,,,,,pstn
+luazip,,,,,,
+lua-yajl,,,,,,pstn
+lua-iconv,,,,7.0.0,,
+luuid,,,,20120509-2,,
+luv,,,,1.44.2-1,,
+lush.nvim,https://github.com/rktjmp/lush.nvim,,,,,teto
+lyaml,,,,,,lblasc
+magick,,,,,5.1,donovanglover
+markdown,,,,,,
+mediator_lua,,,,,,
+middleclass,,,,,,
+mpack,,,,,,
+moonscript,https://github.com/leafo/moonscript.git,dev-1,,,,arobyn
+nlua,,,,,,teto
+nui.nvim,,,,,,mrcjkb
+nvim-cmp,https://github.com/hrsh7th/nvim-cmp,,,,,
+nvim-nio,,,,,,mrcjkb
+penlight,https://github.com/lunarmodules/Penlight.git,,,,,alerque
+plenary.nvim,https://github.com/nvim-lua/plenary.nvim.git,,,,5.1,
+rapidjson,https://github.com/xpol/lua-rapidjson.git,,,,,
+rocks.nvim,,,,,5.1,teto mrcjkb
+rest.nvim,,,,,5.1,teto
+rustaceanvim,,,,,,mrcjkb
+say,https://github.com/Olivine-Labs/say.git,,,,,
+serpent,,,,,,lockejan
+sqlite,,,,,,
+std._debug,https://github.com/lua-stdlib/_debug.git,,,,,
+std.normalize,,,,,,
+stdlib,,,,41.2.2,,vyp
+teal-language-server,,,http://luarocks.org/dev,,,
+telescope.nvim,,,,,5.1,
+telescope-manix,,,,,,
+tl,,,,,,mephistophiles
+toml,,,,,,mrcjkb
+toml-edit,,,,,5.1,mrcjkb
+vstruct,https://github.com/ToxicFrog/vstruct.git,,,,,
+vusted,,,,,,figsoda
+xml2lua,,,,,,teto
diff --git a/nixpkgs/maintainers/scripts/mdize-module.sh b/nixpkgs/maintainers/scripts/mdize-module.sh
new file mode 100755
index 000000000000..e2d2e5467aa9
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/mdize-module.sh
@@ -0,0 +1,83 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -I nixpkgs=. -i bash -p delta jq perl
+
+set -euo pipefail
+shopt -s inherit_errexit
+
+cat <<'EOF'
+This script attempts to automatically convert option descriptions from
+DocBook syntax to markdown. Naturally this process is incomplete and
+imperfect, so any changes generated by this script MUST be reviewed.
+
+Possible problems include: incorrectly replaced tags, badly formatted
+markdown, DocBook tags this script doesn't recognize remaining in the
+output and crashing the docs build, incorrect escaping of markdown
+metacharacters, incorrect unescaping of XML entities—and the list goes on.
+
+Always review the generated changes!
+
+Some known limitations:
+  - Does not transform literalDocBook items
+  - Replacements can occur in non-option code, such as string literals
+
+
+EOF
+
+
+
+build-options-json() {
+    nix-build --no-out-link --expr '
+        let
+            sys = import ./nixos/default.nix {
+                configuration = {};
+            };
+        in
+        [
+            sys.config.system.build.manual.optionsJSON
+        ]
+    '
+}
+
+
+
+git diff --quiet || {
+    echo "Worktree is dirty. Please stash or commit first."
+    exit 1
+}
+
+echo "Building options.json ..."
+old_options=$(build-options-json)
+
+echo "Applying replacements ..."
+perl -pi -e '
+    BEGIN {
+        undef $/;
+    }
+
+    s,<literal>([^`]*?)</literal>,`$1`,smg;
+    s,<replaceable>([^»]*?)</replaceable>,«$1»,smg;
+    s,<filename>([^`]*?)</filename>,{file}`$1`,smg;
+    s,<option>([^`]*?)</option>,{option}`$1`,smg;
+    s,<code>([^`]*?)</code>,`$1`,smg;
+    s,<command>([^`]*?)</command>,{command}`$1`,smg;
+    s,<link xlink:href="(.+?)" ?/>,<$1>,smg;
+    s,<link xlink:href="(.+?)">(.*?)</link>,[$2]($1),smg;
+    s,<package>([^`]*?)</package>,`$1`,smg;
+    s,<emphasis>([^*]*?)</emphasis>,*$1*,smg;
+    s,<citerefentry>\s*
+        <refentrytitle>\s*(.*?)\s*</refentrytitle>\s*
+        <manvolnum>\s*(.*?)\s*</manvolnum>\s*
+      </citerefentry>,{manpage}`$1($2)`,smgx;
+    s,^( +description =),\1 lib.mdDoc,smg;
+' "$@"
+
+echo "Building options.json again ..."
+new_options=$(build-options-json)
+
+
+! cmp -s {$old_options,$new_options}/share/doc/nixos/options.json && {
+    diff -U10 \
+        <(jq . <$old_options/share/doc/nixos/options.json) \
+        <(jq . <$new_options/share/doc/nixos/options.json) \
+        | delta
+}
diff --git a/nixpkgs/maintainers/scripts/nix-call-package b/nixpkgs/maintainers/scripts/nix-call-package
new file mode 100755
index 000000000000..be478fca2b75
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/nix-call-package
@@ -0,0 +1,5 @@
+#! /bin/sh
+
+echo "let pkgs = import <nixpkgs$2> {}; x = pkgs.callPackage $1 { $3 }; in ${4:-x}" |
+nix-instantiate --show-trace - |
+xargs nix-store -r -K
diff --git a/nixpkgs/maintainers/scripts/nix-diff.sh b/nixpkgs/maintainers/scripts/nix-diff.sh
new file mode 100755
index 000000000000..0c65e29cf435
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/nix-diff.sh
@@ -0,0 +1,277 @@
+#!/usr/bin/env nix-shell
+#! nix-shell -i bash -p coreutils gnugrep gnused
+
+################################################################################
+# nix-diff.sh                                                                  #
+################################################################################
+# This script "diffs" Nix profile generations.                                 #
+#                                                                              #
+# Example:                                                                     #
+################################################################################
+# > nix-diff.sh 90 92                                                          #
+# + gnumake-4.2.1                                                              #
+# + gnumake-4.2.1-doc                                                          #
+# - htmldoc-1.8.29                                                             #
+################################################################################
+# The example shows that as of generation 92 and since generation 90,          #
+# gnumake-4.2.1 and gnumake-4.2.1-doc have been installed, while               #
+# htmldoc-1.8.29 has been removed.                                             #
+#                                                                              #
+# The example above shows the default, minimal output mode of this script.     #
+# For more features, run `nix-diff.sh -h` for usage instructions.              #
+################################################################################
+
+usage() {
+    cat <<EOF
+usage: nix-diff.sh [-h | [-p profile | -s] [-q] [-l] [range]]
+-h:         print this message before exiting
+-q:         list the derivations installed in the parent generation
+-l:         diff every available intermediate generation between parent and
+            child
+-p profile: specify the Nix profile to use
+            * defaults to ~/.nix-profile
+-s:         use the system profile
+            * equivalent to: -p /nix/var/nix/profiles/system
+profile:    * should be something like /nix/var/nix/profiles/default, not a
+              generation link like /nix/var/nix/profiles/default-2-link
+range:      the range of generations to diff
+            * the following patterns are allowed, where A, B, and N are positive
+              integers, and G is the currently active generation:
+                A..B => diffs from generation A to generation B
+                ~N   => diffs from the Nth newest generation (older than G) to G
+                A    => diffs from generation A to G
+            * defaults to ~1
+EOF
+}
+
+usage_tip() {
+    echo 'run `nix-diff.sh -h` for usage instructions' >&2
+    exit 1
+}
+
+while getopts :hqlp:s opt; do
+    case $opt in
+        h)
+            usage
+            exit
+            ;;
+        q)
+            opt_query=1
+            ;;
+        l)
+            opt_log=1
+            ;;
+        p)
+            opt_profile=$OPTARG
+            ;;
+        s)
+            opt_profile=/nix/var/nix/profiles/system
+            ;;
+        \?)
+            echo "error: invalid option -$OPTARG" >&2
+            usage_tip
+            ;;
+    esac
+done
+shift $((OPTIND-1))
+
+if [ -n "$opt_profile" ]; then
+    if ! [ -L "$opt_profile" ]; then
+        echo "error: expecting \`$opt_profile\` to be a symbolic link" >&2
+        usage_tip
+    fi
+else
+    opt_profile=$(readlink ~/.nix-profile)
+    if (( $? != 0 )); then
+        echo 'error: unable to dereference `~/.nix-profile`' >&2
+        echo 'specify the profile manually with the `-p` flag' >&2
+        usage_tip
+    fi
+fi
+
+list_gens() {
+    nix-env -p "$opt_profile" --list-generations \
+        | sed -r 's:^\s*::' \
+        | cut -d' ' -f1
+}
+
+current_gen() {
+    nix-env -p "$opt_profile" --list-generations \
+        | grep -E '\(current\)\s*$' \
+        | sed -r 's:^\s*::' \
+        | cut -d' ' -f1
+}
+
+neg_gen() {
+    local i=0 from=$1 n=$2 tmp
+    for gen in $(list_gens | sort -rn); do
+        if ((gen < from)); then
+            tmp=$gen
+            ((i++))
+            ((i == n)) && break
+        fi
+    done
+    if ((i < n)); then
+        echo -n "error: there aren't $n generation(s) older than" >&2
+        echo " generation $from" >&2
+        return 1
+    fi
+    echo $tmp
+}
+
+match() {
+    argv=("$@")
+    for i in $(seq $(($#-1))); do
+        if grep -E "^${argv[$i]}\$" <(echo "$1") >/dev/null; then
+            echo $i
+            return
+        fi
+    done
+    echo 0
+}
+
+case $(match "$1" '' '[0-9]+' '[0-9]+\.\.[0-9]+' '~[0-9]+') in
+    1)
+        diffTo=$(current_gen)
+        diffFrom=$(neg_gen $diffTo 1)
+        (($? == 1)) && usage_tip
+        ;;
+    2)
+        diffFrom=$1
+        diffTo=$(current_gen)
+        ;;
+    3)
+        diffFrom=${1%%.*}
+        diffTo=${1##*.}
+        ;;
+    4)
+        diffTo=$(current_gen)
+        diffFrom=$(neg_gen $diffTo ${1#*~})
+        (($? == 1)) && usage_tip
+        ;;
+    0)
+        echo 'error: invalid invocation' >&2
+        usage_tip
+        ;;
+esac
+
+dirA="${opt_profile}-${diffFrom}-link"
+dirB="${opt_profile}-${diffTo}-link"
+
+declare -a temp_files
+temp_length() {
+    echo -n ${#temp_files[@]}
+}
+temp_make() {
+    temp_files[$(temp_length)]=$(mktemp)
+}
+temp_clean() {
+    rm -f ${temp_files[@]}
+}
+temp_name() {
+    echo -n "${temp_files[$(($(temp_length)-1))]}"
+}
+trap 'temp_clean' EXIT
+
+temp_make
+versA=$(temp_name)
+refs=$(nix-store -q --references "$dirA")
+(( $? != 0 )) && exit 1
+echo "$refs" \
+    | grep -v env-manifest.nix \
+    | sort \
+          > "$versA"
+
+print_tag() {
+    local gen=$1
+    nix-env -p "$opt_profile" --list-generations \
+        | grep -E "^\s*${gen}" \
+        | sed -r 's:^\s*::' \
+        | sed -r 's:\s*$::'
+}
+
+if [ -n "$opt_query" ]; then
+    print_tag $diffFrom
+    cat "$versA" \
+        | sed -r 's:^[^-]+-(.*)$:    \1:'
+
+    print_line=1
+fi
+
+if [ -n "$opt_log" ]; then
+    gens=$(for gen in $(list_gens); do
+               ((diffFrom < gen && gen < diffTo)) && echo $gen
+           done)
+    # Force the $diffTo generation to be included in this list, instead of using
+    # `gen <= diffTo` in the preceding loop, so we encounter an error upon the
+    # event of its nonexistence.
+    gens=$(echo "$gens"
+           echo $diffTo)
+else
+    gens=$diffTo
+fi
+
+temp_make
+add=$(temp_name)
+temp_make
+rem=$(temp_name)
+temp_make
+out=$(temp_name)
+
+for gen in $gens; do
+
+    [ -n "$print_line" ] && echo
+
+    temp_make
+    versB=$(temp_name)
+
+    dirB="${opt_profile}-${gen}-link"
+    refs=$(nix-store -q --references "$dirB")
+    (( $? != 0 )) && exit 1
+    echo "$refs" \
+        | grep -v env-manifest.nix \
+        | sort \
+              > "$versB"
+
+    in=$(comm -3 -1 "$versA" "$versB")
+    sed -r 's:^[^-]*-(.*)$:\1+:' <(echo "$in") \
+        | sort -f \
+               > "$add"
+
+    un=$(comm -3 -2 "$versA" "$versB")
+    sed -r 's:^[^-]*-(.*)$:\1-:' <(echo "$un") \
+        | sort -f \
+               > "$rem"
+
+    cat "$rem" "$add" \
+        | sort -f \
+        | sed -r 's:(.*)-$:- \1:' \
+        | sed -r 's:(.*)\+$:\+ \1:' \
+        | grep -v '^$' \
+              > "$out"
+
+    if [ -n "$opt_query" -o -n "$opt_log" ]; then
+
+        lines=$(wc -l "$out" | cut -d' ' -f1)
+        tag=$(print_tag "$gen")
+        (( $? != 0 )) && exit 1
+        if [ $lines -eq 0 ]; then
+            echo "$tag   (no change)"
+        else
+            echo "$tag"
+        fi
+        cat "$out" \
+            | sed 's:^:    :'
+
+        print_line=1
+
+    else
+        echo "diffing from generation $diffFrom to $diffTo"
+        cat "$out"
+    fi
+
+    versA=$versB
+
+done
+
+exit 0
diff --git a/nixpkgs/maintainers/scripts/nix-generate-from-cpan.nix b/nixpkgs/maintainers/scripts/nix-generate-from-cpan.nix
new file mode 100644
index 000000000000..bf48a5318611
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/nix-generate-from-cpan.nix
@@ -0,0 +1,26 @@
+{ stdenv, lib, makeWrapper, perl, perlPackages }:
+
+stdenv.mkDerivation {
+  name = "nix-generate-from-cpan-3";
+
+  nativeBuildInputs = [ makeWrapper ];
+
+  buildInputs = with perlPackages; [
+    perl GetoptLongDescriptive CPANPLUS Readonly LogLog4perl
+  ];
+
+  dontUnpack = true;
+
+  installPhase = ''
+    mkdir -p $out/bin
+    cp ${./nix-generate-from-cpan.pl} $out/bin/nix-generate-from-cpan
+    patchShebangs $out/bin/nix-generate-from-cpan
+    wrapProgram $out/bin/nix-generate-from-cpan --set PERL5LIB $PERL5LIB
+  '';
+
+  meta = {
+    maintainers = with lib.maintainers; [ eelco ];
+    description = "Utility to generate a Nix expression for a Perl package from CPAN";
+    platforms = lib.platforms.unix;
+  };
+}
diff --git a/nixpkgs/maintainers/scripts/nix-generate-from-cpan.pl b/nixpkgs/maintainers/scripts/nix-generate-from-cpan.pl
new file mode 100755
index 000000000000..6754f79009ec
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/nix-generate-from-cpan.pl
@@ -0,0 +1,473 @@
+#!/usr/bin/env perl
+
+use utf8;
+use strict;
+use warnings;
+
+use CPAN::Meta();
+use CPANPLUS::Backend();
+use MIME::Base64;
+use Module::CoreList;
+use Getopt::Long::Descriptive qw( describe_options );
+use JSON::PP qw( encode_json );
+use Log::Log4perl qw(:easy);
+use Readonly();
+
+# Readonly hash that maps CPAN style license strings to information
+# necessary to generate a Nixpkgs style license attribute.
+Readonly::Hash my %LICENSE_MAP => (
+
+    # The Perl 5 License (Artistic 1 & GPL 1 or later).
+    perl_5 => {
+        licenses => [qw( artistic1 gpl1Plus )]
+    },
+
+    # GNU Affero General Public License, Version 3.
+    agpl_3 => {
+        licenses => [qw( agpl3Plus )],
+        amb      => 1
+    },
+
+    # Apache Software License, Version 1.1.
+    apache_1_1 => {
+        licenses => ["Apache License 1.1"],
+        in_set   => 0
+    },
+
+    # Apache License, Version 2.0.
+    apache_2_0 => {
+        licenses => [qw( asl20 )]
+    },
+
+    # Artistic License, (Version 1).
+    artistic_1 => {
+        licenses => [qw( artistic1 )]
+    },
+
+    # Artistic License, Version 2.0.
+    artistic_2 => {
+        licenses => [qw( artistic2 )]
+    },
+
+    # BSD License (three-clause).
+    bsd => {
+        licenses => [qw( bsd3 )],
+        amb      => 1
+    },
+
+    # FreeBSD License (two-clause).
+    freebsd => {
+        licenses => [qw( bsd2 )]
+    },
+
+    # GNU Free Documentation License, Version 1.2.
+    gfdl_1_2 => {
+        licenses => [qw( fdl12Plus )]
+    },
+
+    # GNU Free Documentation License, Version 1.3.
+    gfdl_1_3 => {
+        licenses => [qw( fdl13Plus )]
+    },
+
+    # GNU General Public License, Version 1.
+    gpl_1 => {
+        licenses => [qw( gpl1Plus )],
+        amb      => 1
+    },
+
+    # GNU General Public License, Version 2. Note, we will interpret
+    # "gpl" alone as GPL v2+.
+    gpl_2 => {
+        licenses => [qw( gpl2Plus )],
+        amb      => 1
+    },
+
+    # GNU General Public License, Version 3.
+    gpl_3 => {
+        licenses => [qw( gpl3Plus )],
+        amb      => 1
+    },
+
+    # GNU Lesser General Public License, Version 2.1. Note, we will
+    # interpret "gpl" alone as LGPL v2.1+.
+    lgpl_2_1 => {
+        licenses => [qw( lgpl21Plus )],
+        amb      => 1
+    },
+
+    # GNU Lesser General Public License, Version 3.0.
+    lgpl_3_0 => {
+        licenses => [qw( lgpl3Plus )],
+        amb      => 1
+    },
+
+    # MIT (aka X11) License.
+    mit => {
+        licenses => [qw( mit )]
+    },
+
+    # Mozilla Public License, Version 1.0.
+    mozilla_1_0 => {
+        licenses => [qw( mpl10 )]
+    },
+
+    # Mozilla Public License, Version 1.1.
+    mozilla_1_1 => {
+        licenses => [qw( mpl11 )]
+    },
+
+    # OpenSSL License.
+    openssl => {
+        licenses => [qw( openssl )]
+    },
+
+    # Q Public License, Version 1.0.
+    qpl_1_0 => {
+        licenses => [qw( qpl )]
+    },
+
+    # Original SSLeay License.
+    ssleay => {
+        licenses => ["Original SSLeay License"],
+        in_set   => 0
+    },
+
+    # Sun Internet Standards Source License (SISSL).
+    sun => {
+        licenses => ["Sun Industry Standards Source License v1.1"],
+        in_set   => 0
+    },
+
+    # zlib License.
+    zlib => {
+        licenses => [qw( zlib )]
+    },
+
+    # Other Open Source Initiative (OSI) approved license.
+    open_source => {
+        licenses => [qw( free )],
+        amb      => 1
+    },
+
+    # Requires special permission from copyright holder.
+    restricted => {
+        licenses => [qw( unfree )],
+        amb      => 1
+    },
+
+    # Not an OSI approved license, but not restricted. Note, we
+    # currently map this to unfreeRedistributable, which is a
+    # conservative choice.
+    unrestricted => {
+        licenses => [qw( unfreeRedistributable )],
+        amb      => 1
+    },
+
+    # License not provided in metadata.
+    unknown => {
+        licenses => [],
+        amb      => 1
+    }
+);
+
+sub handle_opts {
+    my ( $opt, $usage ) = describe_options(
+        'usage: $0 %o MODULE',
+        [ 'maintainer|m=s', 'the package maintainer' ],
+        [ 'debug|d',        'enable debug output' ],
+        [ 'help',           'print usage message and exit' ]
+    );
+
+    if ( $opt->help ) {
+        print $usage->text;
+        exit;
+    }
+
+    my $module_name = $ARGV[0];
+
+    if ( !defined $module_name ) {
+        print STDERR "Missing module name\n";
+        print STDERR $usage->text;
+        exit 1;
+    }
+
+    return ( $opt, $module_name );
+}
+
+# Takes a Perl package attribute name and returns 1 if the name cannot
+# be referred to as a bareword. This typically happens if the package
+# name is a reserved Nix keyword.
+sub is_reserved {
+    my ($pkg) = @_;
+
+    return $pkg =~ /^(?: assert    |
+                         else      |
+                         if        |
+                         import    |
+                         in        |
+                         inherit   |
+                         let       |
+                         rec       |
+                         then      |
+                         while     |
+                         with      )$/x;
+}
+
+sub pkg_to_attr {
+    my ($module) = @_;
+    my $attr_name = $module->package_name;
+    if ( $attr_name eq "libwww-perl" ) {
+        return "LWP";
+    }
+    else {
+        $attr_name =~ s/-//g;
+        return $attr_name;
+    }
+}
+
+sub get_pkg_name {
+    my ($module) = @_;
+    return ( $module->package_name, $module->package_version =~ s/^v(\d)/$1/r );
+}
+
+sub read_meta {
+    my ($pkg_path) = @_;
+
+    my $yaml_path = "$pkg_path/META.yml";
+    my $json_path = "$pkg_path/META.json";
+    my $meta;
+
+    if ( -r $json_path ) {
+        $meta = CPAN::Meta->load_file($json_path);
+    }
+    elsif ( -r $yaml_path ) {
+        $meta = CPAN::Meta->load_file($yaml_path);
+    }
+    else {
+        WARN("package has no META.yml or META.json");
+    }
+
+    return $meta;
+}
+
+# Map a module to the attribute corresponding to its package
+# (e.g. HTML::HeadParser will be mapped to HTMLParser, because that
+# module is in the HTML-Parser package).
+sub module_to_pkg {
+    my ( $cb, $module_name ) = @_;
+    my @modules = $cb->search( type => "name", allow => [$module_name] );
+    if ( scalar @modules == 0 ) {
+
+        # Fallback.
+        $module_name =~ s/:://g;
+        return $module_name;
+    }
+    my $module    = $modules[0];
+    my $attr_name = pkg_to_attr($module);
+    DEBUG("mapped dep $module_name to $attr_name");
+    return $attr_name;
+}
+
+sub get_deps {
+    my ( $cb, $meta, $type ) = @_;
+
+    return if !defined $meta;
+
+    my $prereqs = $meta->effective_prereqs;
+    my $deps = $prereqs->requirements_for( $type, "requires" );
+    my @res;
+    foreach my $n ( $deps->required_modules ) {
+        next if $n eq "perl";
+
+        my @core = Module::CoreList->find_modules(qr/^$n$/);
+        next if (@core);
+
+        my $pkg = module_to_pkg( $cb, $n );
+
+        # If the package name is reserved then we need to refer to it
+        # through the "self" variable.
+        $pkg = "self.\"$pkg\"" if is_reserved($pkg);
+
+        push @res, $pkg;
+    }
+    return @res;
+}
+
+sub uniq {
+    return keys %{ { map { $_ => 1 } @_ } };
+}
+
+sub render_license {
+    my ($cpan_license) = @_;
+
+    return if !defined $cpan_license;
+
+    my $licenses;
+
+    # If the license is ambiguous then we'll print an extra warning.
+    # For example, "gpl_2" is ambiguous since it may refer to exactly
+    # "GPL v2" or to "GPL v2 or later".
+    my $amb = 0;
+
+    # Whether the license is available inside `lib.licenses`.
+    my $in_set = 1;
+
+    my $nix_license = $LICENSE_MAP{$cpan_license};
+    if ( !$nix_license ) {
+        WARN("Unknown license: $cpan_license");
+        $licenses = [$cpan_license];
+        $in_set   = 0;
+    }
+    else {
+        $licenses = $nix_license->{licenses};
+        $amb      = $nix_license->{amb};
+        $in_set   = !$nix_license->{in_set};
+    }
+
+    my $license_line;
+
+    if ( @$licenses == 0 ) {
+
+        # Avoid defining the license line.
+    }
+    elsif ($in_set) {
+        my $lic = 'lib.licenses';
+        if ( @$licenses == 1 ) {
+            $license_line = "$lic.$licenses->[0]";
+        }
+        else {
+            $license_line = "with $lic; [ " . join( ' ', @$licenses ) . " ]";
+        }
+    }
+    else {
+        if ( @$licenses == 1 ) {
+            $license_line = $licenses->[0];
+        }
+        else {
+            $license_line = '[ ' . join( ' ', @$licenses ) . ' ]';
+        }
+    }
+
+    INFO("license: $cpan_license");
+    WARN("License '$cpan_license' is ambiguous, please verify") if $amb;
+
+    return $license_line;
+}
+
+sub sha256_to_sri {
+    my ($sha256) = @_;
+    return "sha256-" . encode_base64(pack("H*", $sha256), '');
+}
+
+my ( $opt, $module_name ) = handle_opts();
+
+Log::Log4perl->easy_init(
+    {
+        level => $opt->debug ? $DEBUG : $INFO,
+        layout => '%m%n'
+    }
+);
+
+my $cb = CPANPLUS::Backend->new;
+
+my @modules = $cb->search( type => "name", allow => [$module_name] );
+die "module $module_name not found\n" if scalar @modules == 0;
+die "multiple packages that match module $module_name\n" if scalar @modules > 1;
+my $module = $modules[0];
+
+my ($pkg_name, $pkg_version) = get_pkg_name $module;
+my $attr_name = pkg_to_attr $module;
+
+INFO( "attribute name: ", $attr_name );
+INFO( "module: ",         $module->module );
+INFO( "version: ",        $module->version );
+INFO( "package: ", $module->package, " (", "$pkg_name-$pkg_version", ", ", $attr_name, ")" );
+INFO( "path: ",    $module->path );
+
+my $tar_path = $module->fetch();
+my $sri_hash = sha256_to_sri($module->status->checksum_value);
+INFO( "downloaded to: ", $tar_path );
+INFO( "hash: ", $sri_hash );
+
+my $pkg_path = $module->extract();
+INFO( "unpacked to: ", $pkg_path );
+
+my $meta = read_meta($pkg_path);
+
+DEBUG( "metadata: ", encode_json( $meta->as_struct ) ) if defined $meta;
+
+my @runtime_deps = sort( uniq( get_deps( $cb, $meta, "runtime" ) ) );
+INFO("runtime deps: @runtime_deps");
+
+my @build_deps = sort( uniq(
+        get_deps( $cb, $meta, "configure" ),
+        get_deps( $cb, $meta, "build" ),
+        get_deps( $cb, $meta, "test" )
+) );
+
+# Filter out runtime dependencies since those are already handled.
+my %in_runtime_deps = map { $_ => 1 } @runtime_deps;
+@build_deps = grep { not $in_runtime_deps{$_} } @build_deps;
+
+INFO("build deps: @build_deps");
+
+my $homepage = $meta ? $meta->resources->{homepage} : undef;
+INFO("homepage: $homepage") if defined $homepage;
+
+my $description = $meta ? $meta->abstract : undef;
+if ( defined $description ) {
+    $description = uc( substr( $description, 0, 1 ) )
+      . substr( $description, 1 );    # capitalise first letter
+    $description =~ s/\.$//;          # remove period at the end
+    $description =~ s/\s*$//;
+    $description =~ s/^\s*//;
+    $description =~ s/\n+/ /;         # Replace new lines by space.
+    INFO("description: $description");
+}
+
+#print(Data::Dumper::Dumper($meta->licenses) . "\n");
+my $license = $meta ? render_license( $meta->licenses ) : undef;
+
+INFO( "RSS feed: https://metacpan.org/feed/distribution/",
+    $module->package_name );
+
+my $build_fun = -e "$pkg_path/Build.PL"
+  && !-e "$pkg_path/Makefile.PL" ? "buildPerlModule" : "buildPerlPackage";
+
+print STDERR "===\n";
+
+print <<EOF;
+  ${\(is_reserved($attr_name) ? "\"$attr_name\"" : $attr_name)} = $build_fun {
+    pname = "$pkg_name";
+    version = "$pkg_version";
+    src = fetchurl {
+      url = "mirror://cpan/${\$module->path}/${\$module->package}";
+      hash = "$sri_hash";
+    };
+EOF
+print <<EOF if scalar @build_deps > 0;
+    buildInputs = [ @build_deps ];
+EOF
+print <<EOF if scalar @runtime_deps > 0;
+    propagatedBuildInputs = [ @runtime_deps ];
+EOF
+print <<EOF;
+    meta = {
+EOF
+print <<EOF if defined $homepage;
+      homepage = "$homepage";
+EOF
+print <<EOF if defined $description && $description ne "Unknown";
+      description = "$description";
+EOF
+print <<EOF if defined $license;
+      license = $license;
+EOF
+print <<EOF if $opt->maintainer;
+      maintainers = [ maintainers.${\$opt->maintainer} ];
+EOF
+print <<EOF;
+    };
+  };
+EOF
diff --git a/nixpkgs/maintainers/scripts/nixpkgs-lint.nix b/nixpkgs/maintainers/scripts/nixpkgs-lint.nix
new file mode 100644
index 000000000000..873905373af0
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/nixpkgs-lint.nix
@@ -0,0 +1,24 @@
+{ stdenv, lib, makeWrapper, perl, perlPackages }:
+
+stdenv.mkDerivation {
+  name = "nixpkgs-lint-1";
+
+  nativeBuildInputs = [ makeWrapper ];
+  buildInputs = [ perl perlPackages.XMLSimple ];
+
+  dontUnpack = true;
+  buildPhase = "true";
+
+  installPhase =
+    ''
+      mkdir -p $out/bin
+      cp ${./nixpkgs-lint.pl} $out/bin/nixpkgs-lint
+      wrapProgram $out/bin/nixpkgs-lint --set PERL5LIB $PERL5LIB
+    '';
+
+  meta = with lib; {
+    maintainers = [ maintainers.eelco ];
+    description = "A utility for Nixpkgs contributors to check Nixpkgs for common errors";
+    platforms = platforms.unix;
+  };
+}
diff --git a/nixpkgs/maintainers/scripts/nixpkgs-lint.pl b/nixpkgs/maintainers/scripts/nixpkgs-lint.pl
new file mode 100755
index 000000000000..43fb39413613
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/nixpkgs-lint.pl
@@ -0,0 +1,173 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -i perl -p perl perlPackages.XMLSimple
+
+use strict;
+use List::Util qw(min);
+use XML::Simple qw(:strict);
+use Getopt::Long qw(:config gnu_getopt);
+
+# Parse the command line.
+my $path = "<nixpkgs>";
+my $filter = "*";
+my $maintainer;
+
+sub showHelp {
+    print <<EOF;
+Usage: $0 [--package=NAME] [--maintainer=REGEXP] [--file=PATH]
+
+Check Nixpkgs for common errors/problems.
+
+  -p, --package        filter packages by name (default is ‘*’)
+  -m, --maintainer     filter packages by maintainer (case-insensitive regexp)
+  -f, --file           path to Nixpkgs (default is ‘<nixpkgs>’)
+
+Examples:
+  \$ nixpkgs-lint -f /my/nixpkgs -p firefox
+  \$ nixpkgs-lint -f /my/nixpkgs -m eelco
+EOF
+    exit 0;
+}
+
+GetOptions("package|p=s" => \$filter,
+           "maintainer|m=s" => \$maintainer,
+           "file|f=s" => \$path,
+           "help" => sub { showHelp() }
+    ) or exit 1;
+
+# Evaluate Nixpkgs into an XML representation.
+my $xml = `nix-env -f '$path' --arg overlays '[]' -qa '$filter' --xml --meta --drv-path`;
+die "$0: evaluation of ‘$path’ failed\n" if $? != 0;
+
+my $info = XMLin($xml, KeyAttr => { 'item' => '+attrPath', 'meta' => 'name' }, ForceArray => 1, SuppressEmpty => '' ) or die "cannot parse XML output";
+
+# Check meta information.
+print "=== Package meta information ===\n\n";
+my $nrBadNames = 0;
+my $nrMissingMaintainers = 0;
+my $nrMissingPlatforms = 0;
+my $nrMissingDescriptions = 0;
+my $nrBadDescriptions = 0;
+my $nrMissingLicenses = 0;
+
+foreach my $attr (sort keys %{$info->{item}}) {
+    my $pkg = $info->{item}->{$attr};
+
+    my $pkgName = $pkg->{name};
+    my $pkgVersion = "";
+    if ($pkgName =~ /(.*)(-[0-9].*)$/) {
+        $pkgName = $1;
+        $pkgVersion = $2;
+    }
+
+    # Check the maintainers.
+    my @maintainers;
+    my $x = $pkg->{meta}->{maintainers};
+    if (defined $x && $x->{type} eq "strings") {
+        @maintainers = map { $_->{value} } @{$x->{string}};
+    } elsif (defined $x->{value}) {
+        @maintainers = ($x->{value});
+    }
+
+    if (defined $maintainer && scalar(grep { $_ =~ /$maintainer/i } @maintainers) == 0) {
+        delete $info->{item}->{$attr};
+        next;
+    }
+
+    if (scalar @maintainers == 0) {
+        print "$attr: Lacks a maintainer\n";
+        $nrMissingMaintainers++;
+    }
+
+    # Check the platforms.
+    if (!defined $pkg->{meta}->{platforms}) {
+        print "$attr: Lacks a platform\n";
+        $nrMissingPlatforms++;
+    }
+
+    # Package names should not be capitalised.
+    if ($pkgName =~ /^[A-Z]/) {
+        print "$attr: package name ‘$pkgName’ should not be capitalised\n";
+        $nrBadNames++;
+    }
+
+    if ($pkgVersion eq "") {
+        print "$attr: package has no version\n";
+        $nrBadNames++;
+    }
+
+    # Check the license.
+    if (!defined $pkg->{meta}->{license}) {
+        print "$attr: Lacks a license\n";
+        $nrMissingLicenses++;
+    }
+
+    # Check the description.
+    my $description = $pkg->{meta}->{description}->{value};
+    if (!$description) {
+        print "$attr: Lacks a description\n";
+        $nrMissingDescriptions++;
+    } else {
+        my $bad = 0;
+        if ($description =~ /^\s/) {
+            print "$attr: Description starts with whitespace\n";
+            $bad = 1;
+        }
+        if ($description =~ /\s$/) {
+            print "$attr: Description ends with whitespace\n";
+            $bad = 1;
+        }
+        if ($description =~ /\.$/) {
+            print "$attr: Description ends with a period\n";
+            $bad = 1;
+        }
+        if (index(lc($description), lc($attr)) != -1) {
+            print "$attr: Description contains package name\n";
+            $bad = 1;
+        }
+        $nrBadDescriptions++ if $bad;
+    }
+}
+
+print "\n";
+
+# Find packages that have the same name.
+print "=== Package name collisions ===\n\n";
+
+my %pkgsByName;
+
+foreach my $attr (sort keys %{$info->{item}}) {
+    my $pkg = $info->{item}->{$attr};
+    #print STDERR "attr = $attr, name = $pkg->{name}\n";
+    $pkgsByName{$pkg->{name}} //= [];
+    push @{$pkgsByName{$pkg->{name}}}, $pkg;
+}
+
+my $nrCollisions = 0;
+foreach my $name (sort keys %pkgsByName) {
+    my @pkgs = @{$pkgsByName{$name}};
+
+    # Filter attributes that are aliases of each other (e.g. yield the
+    # same derivation path).
+    my %drvsSeen;
+    @pkgs = grep { my $x = $drvsSeen{$_->{drvPath}}; $drvsSeen{$_->{drvPath}} = 1; !defined $x } @pkgs;
+
+    # Filter packages that have a lower priority.
+    my $highest = min (map { $_->{meta}->{priority}->{value} // 0 } @pkgs);
+    @pkgs = grep { ($_->{meta}->{priority}->{value} // 0) == $highest } @pkgs;
+
+    next if scalar @pkgs == 1;
+
+    $nrCollisions++;
+    print "The following attributes evaluate to a package named ‘$name’:\n";
+    print "  ", join(", ", map { $_->{attrPath} } @pkgs), "\n\n";
+}
+
+print "=== Bottom line ===\n";
+print "Number of packages: ", scalar(keys %{$info->{item}}), "\n";
+print "Number of bad names: $nrBadNames\n";
+print "Number of missing maintainers: $nrMissingMaintainers\n";
+print "Number of missing platforms: $nrMissingPlatforms\n";
+print "Number of missing licenses: $nrMissingLicenses\n";
+print "Number of missing descriptions: $nrMissingDescriptions\n";
+print "Number of bad descriptions: $nrBadDescriptions\n";
+print "Number of name collisions: $nrCollisions\n";
diff --git a/nixpkgs/maintainers/scripts/patchelf-hints.sh b/nixpkgs/maintainers/scripts/patchelf-hints.sh
new file mode 100755
index 000000000000..802ecab0f0a1
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/patchelf-hints.sh
@@ -0,0 +1,84 @@
+
+usage() {
+    echo "
+$0 <path to unpacked binary distribution directory>
+
+This program return the list of libraries and where to find them based on
+your currently installed programs.
+";
+    exit 1
+}
+
+if test $# -ne 1; then
+  usage
+fi
+
+binaryDist=$1
+
+hasBinaries=false
+for bin in $(find $binaryDist -executable -type f) :; do
+    if test $bin = ":"; then
+        $hasBinaries || \
+            echo "No patchable found in this directory."
+        break
+    fi
+    hasBinaries=true
+
+    echo ""
+    echo "$bin:"
+    hasLibraries=false
+    unset interpreter
+    unset addRPath
+    for lib in $(strings $bin | grep '^\(/\|\)lib.*\.so' | sort | uniq) :; do
+        if test $lib = ":"; then
+            $hasLibraries || \
+                echo "  This program is a script or it is statically linked."
+            break
+        fi
+        hasLibraries=true
+
+        echo "  $lib:";
+
+        libPath=$lib
+        lib=$(basename $lib)
+
+        #versionLessLib=$(echo $lib | sed 's,[.][.0-9]*$,,')
+
+        libs="$(
+            find /nix/store/*/lib* \( -type f -or -type l \) -name $lib |
+            grep -v '\(bootstrap-tools\|system-path\|user-environment\|extra-utils\)'
+        )"
+
+        echo "$libs" |
+        sed 's,^/nix/store/[a-z0-9]*-\([^/]*\)/.*/\([^/]*\)$,    \1 -> \2,' |
+        sort |
+        uniq;
+
+        names=$(
+            echo "$libs" |
+            sed 's,^/nix/store/[a-z0-9]*-\([^/]*\)-[.0-9]*/.*$,\1,' |
+            sort |
+            uniq;
+        )
+
+        if test "$names" = "glibc"; then names="glibc"; fi
+        if echo $names | grep -c "gcc" &> /dev/null; then names="stdenv.cc.cc"; fi
+
+        if test $lib != $libPath; then
+            interpreter="--interpreter \${$names}/lib/$lib"
+        elif echo $addRPath | grep -c "$names" &> /dev/null; then
+            :
+        else
+            addRPath=${addRPath+$addRPath:}"\${$names}/lib"
+        fi
+    done;
+    $hasLibraries && \
+        echo "
+  Patchelf command:
+
+    patchelf $interpreter \\
+      ${addRPath+--set-rpath $addRPath \\
+}      \$out/$bin
+
+"
+done;
diff --git a/nixpkgs/maintainers/scripts/pluginupdate.py b/nixpkgs/maintainers/scripts/pluginupdate.py
new file mode 100644
index 000000000000..056abda85bfd
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/pluginupdate.py
@@ -0,0 +1,815 @@
+# python library used to update plugins:
+# - pkgs/applications/editors/vim/plugins/update.py
+# - pkgs/applications/editors/kakoune/plugins/update.py
+# - maintainers/scripts/update-luarocks-packages
+
+# format:
+# $ nix run nixpkgs#black maintainers/scripts/pluginupdate.py
+# type-check:
+# $ nix run nixpkgs#python3.pkgs.mypy maintainers/scripts/pluginupdate.py
+# linted:
+# $ nix run nixpkgs#python3.pkgs.flake8 -- --ignore E501,E265 maintainers/scripts/pluginupdate.py
+
+import argparse
+import csv
+import functools
+import http
+import json
+import logging
+import os
+import re
+import subprocess
+import sys
+import time
+import traceback
+import urllib.error
+import urllib.parse
+import urllib.request
+import xml.etree.ElementTree as ET
+from dataclasses import asdict, dataclass
+from datetime import UTC, datetime
+from functools import wraps
+from multiprocessing.dummy import Pool
+from pathlib import Path
+from tempfile import NamedTemporaryFile
+from typing import Any, Callable, Dict, List, Optional, Tuple, Union
+from urllib.parse import urljoin, urlparse
+
+import git
+
+ATOM_ENTRY = "{http://www.w3.org/2005/Atom}entry"  # " vim gets confused here
+ATOM_LINK = "{http://www.w3.org/2005/Atom}link"  # "
+ATOM_UPDATED = "{http://www.w3.org/2005/Atom}updated"  # "
+
+LOG_LEVELS = {
+    logging.getLevelName(level): level
+    for level in [logging.DEBUG, logging.INFO, logging.WARN, logging.ERROR]
+}
+
+log = logging.getLogger()
+
+
+def retry(ExceptionToCheck: Any, tries: int = 4, delay: float = 3, backoff: float = 2):
+    """Retry calling the decorated function using an exponential backoff.
+    http://www.saltycrane.com/blog/2009/11/trying-out-retry-decorator-python/
+    original from: http://wiki.python.org/moin/PythonDecoratorLibrary#Retry
+    (BSD licensed)
+    :param ExceptionToCheck: the exception on which to retry
+    :param tries: number of times to try (not retry) before giving up
+    :param delay: initial delay between retries in seconds
+    :param backoff: backoff multiplier e.g. value of 2 will double the delay
+        each retry
+    """
+
+    def deco_retry(f: Callable) -> Callable:
+        @wraps(f)
+        def f_retry(*args: Any, **kwargs: Any) -> Any:
+            mtries, mdelay = tries, delay
+            while mtries > 1:
+                try:
+                    return f(*args, **kwargs)
+                except ExceptionToCheck as e:
+                    print(f"{str(e)}, Retrying in {mdelay} seconds...")
+                    time.sleep(mdelay)
+                    mtries -= 1
+                    mdelay *= backoff
+            return f(*args, **kwargs)
+
+        return f_retry  # true decorator
+
+    return deco_retry
+
+
+@dataclass
+class FetchConfig:
+    proc: int
+    github_token: str
+
+
+def make_request(url: str, token=None) -> urllib.request.Request:
+    headers = {}
+    if token is not None:
+        headers["Authorization"] = f"token {token}"
+    return urllib.request.Request(url, headers=headers)
+
+
+# a dictionary of plugins and their new repositories
+Redirects = Dict["PluginDesc", "Repo"]
+
+
+class Repo:
+    def __init__(self, uri: str, branch: str) -> None:
+        self.uri = uri
+        """Url to the repo"""
+        self._branch = branch
+        # Redirect is the new Repo to use
+        self.redirect: Optional["Repo"] = None
+        self.token = "dummy_token"
+
+    @property
+    def name(self):
+        return self.uri.split("/")[-1]
+
+    @property
+    def branch(self):
+        return self._branch or "HEAD"
+
+    def __str__(self) -> str:
+        return f"{self.uri}"
+
+    def __repr__(self) -> str:
+        return f"Repo({self.name}, {self.uri})"
+
+    @retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
+    def has_submodules(self) -> bool:
+        return True
+
+    @retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
+    def latest_commit(self) -> Tuple[str, datetime]:
+        log.debug("Latest commit")
+        loaded = self._prefetch(None)
+        updated = datetime.strptime(loaded["date"], "%Y-%m-%dT%H:%M:%S%z")
+
+        return loaded["rev"], updated
+
+    def _prefetch(self, ref: Optional[str]):
+        cmd = ["nix-prefetch-git", "--quiet", "--fetch-submodules", self.uri]
+        if ref is not None:
+            cmd.append(ref)
+        log.debug(cmd)
+        data = subprocess.check_output(cmd)
+        loaded = json.loads(data)
+        return loaded
+
+    def prefetch(self, ref: Optional[str]) -> str:
+        print("Prefetching")
+        loaded = self._prefetch(ref)
+        return loaded["sha256"]
+
+    def as_nix(self, plugin: "Plugin") -> str:
+        return f"""fetchgit {{
+      url = "{self.uri}";
+      rev = "{plugin.commit}";
+      sha256 = "{plugin.sha256}";
+    }}"""
+
+
+class RepoGitHub(Repo):
+    def __init__(self, owner: str, repo: str, branch: str) -> None:
+        self.owner = owner
+        self.repo = repo
+        self.token = None
+        """Url to the repo"""
+        super().__init__(self.url(""), branch)
+        log.debug(
+            "Instantiating github repo owner=%s and repo=%s", self.owner, self.repo
+        )
+
+    @property
+    def name(self):
+        return self.repo
+
+    def url(self, path: str) -> str:
+        res = urljoin(f"https://github.com/{self.owner}/{self.repo}/", path)
+        return res
+
+    @retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
+    def has_submodules(self) -> bool:
+        try:
+            req = make_request(self.url(f"blob/{self.branch}/.gitmodules"), self.token)
+            urllib.request.urlopen(req, timeout=10).close()
+        except urllib.error.HTTPError as e:
+            if e.code == 404:
+                return False
+            else:
+                raise
+        return True
+
+    @retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
+    def latest_commit(self) -> Tuple[str, datetime]:
+        commit_url = self.url(f"commits/{self.branch}.atom")
+        log.debug("Sending request to %s", commit_url)
+        commit_req = make_request(commit_url, self.token)
+        with urllib.request.urlopen(commit_req, timeout=10) as req:
+            self._check_for_redirect(commit_url, req)
+            xml = req.read()
+
+            # Filter out illegal XML characters
+            illegal_xml_regex = re.compile(b"[\x00-\x08\x0B-\x0C\x0E-\x1F\x7F]")
+            xml = illegal_xml_regex.sub(b"", xml)
+
+            root = ET.fromstring(xml)
+            latest_entry = root.find(ATOM_ENTRY)
+            assert latest_entry is not None, f"No commits found in repository {self}"
+            commit_link = latest_entry.find(ATOM_LINK)
+            assert commit_link is not None, f"No link tag found feed entry {xml}"
+            url = urlparse(commit_link.get("href"))
+            updated_tag = latest_entry.find(ATOM_UPDATED)
+            assert (
+                updated_tag is not None and updated_tag.text is not None
+            ), f"No updated tag found feed entry {xml}"
+            updated = datetime.strptime(updated_tag.text, "%Y-%m-%dT%H:%M:%SZ")
+            return Path(str(url.path)).name, updated
+
+    def _check_for_redirect(self, url: str, req: http.client.HTTPResponse):
+        response_url = req.geturl()
+        if url != response_url:
+            new_owner, new_name = (
+                urllib.parse.urlsplit(response_url).path.strip("/").split("/")[:2]
+            )
+
+            new_repo = RepoGitHub(owner=new_owner, repo=new_name, branch=self.branch)
+            self.redirect = new_repo
+
+    def prefetch(self, commit: str) -> str:
+        if self.has_submodules():
+            sha256 = super().prefetch(commit)
+        else:
+            sha256 = self.prefetch_github(commit)
+        return sha256
+
+    def prefetch_github(self, ref: str) -> str:
+        cmd = ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")]
+        log.debug("Running %s", cmd)
+        data = subprocess.check_output(cmd)
+        return data.strip().decode("utf-8")
+
+    def as_nix(self, plugin: "Plugin") -> str:
+        if plugin.has_submodules:
+            submodule_attr = "\n      fetchSubmodules = true;"
+        else:
+            submodule_attr = ""
+
+        return f"""fetchFromGitHub {{
+      owner = "{self.owner}";
+      repo = "{self.repo}";
+      rev = "{plugin.commit}";
+      sha256 = "{plugin.sha256}";{submodule_attr}
+    }}"""
+
+
+@dataclass(frozen=True)
+class PluginDesc:
+    repo: Repo
+    branch: str
+    alias: Optional[str]
+
+    @property
+    def name(self):
+        if self.alias is None:
+            return self.repo.name
+        else:
+            return self.alias
+
+    def __lt__(self, other):
+        return self.repo.name < other.repo.name
+
+    @staticmethod
+    def load_from_csv(config: FetchConfig, row: Dict[str, str]) -> "PluginDesc":
+        branch = row["branch"]
+        repo = make_repo(row["repo"], branch.strip())
+        repo.token = config.github_token
+        return PluginDesc(repo, branch.strip(), row["alias"])
+
+    @staticmethod
+    def load_from_string(config: FetchConfig, line: str) -> "PluginDesc":
+        branch = "HEAD"
+        alias = None
+        uri = line
+        if " as " in uri:
+            uri, alias = uri.split(" as ")
+            alias = alias.strip()
+        if "@" in uri:
+            uri, branch = uri.split("@")
+        repo = make_repo(uri.strip(), branch.strip())
+        repo.token = config.github_token
+        return PluginDesc(repo, branch.strip(), alias)
+
+
+@dataclass
+class Plugin:
+    name: str
+    commit: str
+    has_submodules: bool
+    sha256: str
+    date: Optional[datetime] = None
+
+    @property
+    def normalized_name(self) -> str:
+        return self.name.replace(".", "-")
+
+    @property
+    def version(self) -> str:
+        assert self.date is not None
+        return self.date.strftime("%Y-%m-%d")
+
+    def as_json(self) -> Dict[str, str]:
+        copy = self.__dict__.copy()
+        del copy["date"]
+        return copy
+
+
+def load_plugins_from_csv(
+    config: FetchConfig,
+    input_file: Path,
+) -> List[PluginDesc]:
+    log.debug("Load plugins from csv %s", input_file)
+    plugins = []
+    with open(input_file, newline="") as csvfile:
+        log.debug("Writing into %s", input_file)
+        reader = csv.DictReader(
+            csvfile,
+        )
+        for line in reader:
+            plugin = PluginDesc.load_from_csv(config, line)
+            plugins.append(plugin)
+
+    return plugins
+
+
+
+def run_nix_expr(expr, nixpkgs: str):
+    '''
+    :param expr nix expression to fetch current plugins
+    :param nixpkgs Path towards a nixpkgs checkout
+    '''
+    with CleanEnvironment(nixpkgs) as nix_path:
+        cmd = [
+            "nix",
+            "eval",
+            "--extra-experimental-features",
+            "nix-command",
+            "--impure",
+            "--json",
+            "--expr",
+            expr,
+            "--nix-path",
+            nix_path,
+        ]
+        log.debug("Running command: %s", " ".join(cmd))
+        out = subprocess.check_output(cmd, timeout=90)
+        data = json.loads(out)
+        return data
+
+
+class Editor:
+    """The configuration of the update script."""
+
+    def __init__(
+        self,
+        name: str,
+        root: Path,
+        get_plugins: str,
+        default_in: Optional[Path] = None,
+        default_out: Optional[Path] = None,
+        deprecated: Optional[Path] = None,
+        cache_file: Optional[str] = None,
+    ):
+        log.debug("get_plugins:", get_plugins)
+        self.name = name
+        self.root = root
+        self.get_plugins = get_plugins
+        self.default_in = default_in or root.joinpath(f"{name}-plugin-names")
+        self.default_out = default_out or root.joinpath("generated.nix")
+        self.deprecated = deprecated or root.joinpath("deprecated.json")
+        self.cache_file = cache_file or f"{name}-plugin-cache.json"
+        self.nixpkgs_repo = None
+
+    def add(self, args):
+        """CSV spec"""
+        log.debug("called the 'add' command")
+        fetch_config = FetchConfig(args.proc, args.github_token)
+        editor = self
+        for plugin_line in args.add_plugins:
+            log.debug("using plugin_line", plugin_line)
+            pdesc = PluginDesc.load_from_string(fetch_config, plugin_line)
+            log.debug("loaded as pdesc", pdesc)
+            append = [pdesc]
+            editor.rewrite_input(
+                fetch_config, args.input_file, editor.deprecated, append=append
+            )
+            plugin, _ = prefetch_plugin(
+                pdesc,
+            )
+            autocommit = not args.no_commit
+            if autocommit:
+                commit(
+                    editor.nixpkgs_repo,
+                    "{drv_name}: init at {version}".format(
+                        drv_name=editor.get_drv_name(plugin.normalized_name),
+                        version=plugin.version,
+                    ),
+                    [args.outfile, args.input_file],
+                )
+
+    # Expects arguments generated by 'update' subparser
+    def update(self, args):
+        """CSV spec"""
+        print("the update member function should be overriden in subclasses")
+
+    def get_current_plugins(self, nixpkgs) -> List[Plugin]:
+        """To fill the cache"""
+        data = run_nix_expr(self.get_plugins, nixpkgs)
+        plugins = []
+        for name, attr in data.items():
+            p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"])
+            plugins.append(p)
+        return plugins
+
+    def load_plugin_spec(self, config: FetchConfig, plugin_file) -> List[PluginDesc]:
+        """CSV spec"""
+        return load_plugins_from_csv(config, plugin_file)
+
+    def generate_nix(self, _plugins, _outfile: str):
+        """Returns nothing for now, writes directly to outfile"""
+        raise NotImplementedError()
+
+    def get_update(self, input_file: str, outfile: str, config: FetchConfig):
+        cache: Cache = Cache(self.get_current_plugins(self.nixpkgs), self.cache_file)
+        _prefetch = functools.partial(prefetch, cache=cache)
+
+        def update() -> dict:
+            plugins = self.load_plugin_spec(config, input_file)
+
+            try:
+                pool = Pool(processes=config.proc)
+                results = pool.map(_prefetch, plugins)
+            finally:
+                cache.store()
+
+            plugins, redirects = check_results(results)
+
+            self.generate_nix(plugins, outfile)
+
+            return redirects
+
+        return update
+
+    @property
+    def attr_path(self):
+        return self.name + "Plugins"
+
+    def get_drv_name(self, name: str):
+        return self.attr_path + "." + name
+
+    def rewrite_input(self, *args, **kwargs):
+        return rewrite_input(*args, **kwargs)
+
+    def create_parser(self):
+        common = argparse.ArgumentParser(
+            add_help=False,
+            description=(
+                f"""
+                Updates nix derivations for {self.name} plugins.\n
+                By default from {self.default_in} to {self.default_out}"""
+            ),
+        )
+        common.add_argument(
+            "--nixpkgs",
+            type=str,
+            default=os.getcwd(),
+            help="Adjust log level",
+        )
+        common.add_argument(
+            "--input-names",
+            "-i",
+            dest="input_file",
+            type=Path,
+            default=self.default_in,
+            help="A list of plugins in the form owner/repo",
+        )
+        common.add_argument(
+            "--out",
+            "-o",
+            dest="outfile",
+            default=self.default_out,
+            type=Path,
+            help="Filename to save generated nix code",
+        )
+        common.add_argument(
+            "--proc",
+            "-p",
+            dest="proc",
+            type=int,
+            default=30,
+            help="Number of concurrent processes to spawn. Setting --github-token allows higher values.",
+        )
+        common.add_argument(
+            "--github-token",
+            "-t",
+            type=str,
+            default=os.getenv("GITHUB_API_TOKEN"),
+            help="""Allows to set --proc to higher values.
+            Uses GITHUB_API_TOKEN environment variables as the default value.""",
+        )
+        common.add_argument(
+            "--no-commit",
+            "-n",
+            action="store_true",
+            default=False,
+            help="Whether to autocommit changes",
+        )
+        common.add_argument(
+            "--debug",
+            "-d",
+            choices=LOG_LEVELS.keys(),
+            default=logging.getLevelName(logging.WARN),
+            help="Adjust log level",
+        )
+
+        main = argparse.ArgumentParser(
+            parents=[common],
+            description=(
+                f"""
+                Updates nix derivations for {self.name} plugins.\n
+                By default from {self.default_in} to {self.default_out}"""
+            ),
+        )
+
+        subparsers = main.add_subparsers(dest="command", required=False)
+        padd = subparsers.add_parser(
+            "add",
+            parents=[],
+            description="Add new plugin",
+            add_help=False,
+        )
+        padd.set_defaults(func=self.add)
+        padd.add_argument(
+            "add_plugins",
+            default=None,
+            nargs="+",
+            help=f"Plugin to add to {self.attr_path} from Github in the form owner/repo",
+        )
+
+        pupdate = subparsers.add_parser(
+            "update",
+            description="Update all or a subset of existing plugins",
+            add_help=False,
+        )
+        pupdate.set_defaults(func=self.update)
+        return main
+
+    def run(
+        self,
+    ):
+        """
+        Convenience function
+        """
+        parser = self.create_parser()
+        args = parser.parse_args()
+        command = args.command or "update"
+        log.setLevel(LOG_LEVELS[args.debug])
+        log.info("Chose to run command: %s", command)
+        self.nixpkgs = args.nixpkgs
+
+        self.nixpkgs_repo = git.Repo(args.nixpkgs, search_parent_directories=True)
+
+        getattr(self, command)(args)
+
+
+class CleanEnvironment(object):
+    def __init__(self, nixpkgs):
+        self.local_pkgs = nixpkgs
+
+    def __enter__(self) -> str:
+        """
+        local_pkgs = str(Path(__file__).parent.parent.parent)
+        """
+        self.old_environ = os.environ.copy()
+        self.empty_config = NamedTemporaryFile()
+        self.empty_config.write(b"{}")
+        self.empty_config.flush()
+        return f"localpkgs={self.local_pkgs}"
+
+    def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None:
+        os.environ.update(self.old_environ)
+        self.empty_config.close()
+
+
+def prefetch_plugin(
+    p: PluginDesc,
+    cache: "Optional[Cache]" = None,
+) -> Tuple[Plugin, Optional[Repo]]:
+    repo, branch, alias = p.repo, p.branch, p.alias
+    name = alias or p.repo.name
+    commit = None
+    log.info(f"Fetching last commit for plugin {name} from {repo.uri}@{branch}")
+    commit, date = repo.latest_commit()
+    cached_plugin = cache[commit] if cache else None
+    if cached_plugin is not None:
+        log.debug("Cache hit !")
+        cached_plugin.name = name
+        cached_plugin.date = date
+        return cached_plugin, repo.redirect
+
+    has_submodules = repo.has_submodules()
+    log.debug(f"prefetch {name}")
+    sha256 = repo.prefetch(commit)
+
+    return (
+        Plugin(name, commit, has_submodules, sha256, date=date),
+        repo.redirect,
+    )
+
+
+def print_download_error(plugin: PluginDesc, ex: Exception):
+    print(f"{plugin}: {ex}", file=sys.stderr)
+    ex_traceback = ex.__traceback__
+    tb_lines = [
+        line.rstrip("\n")
+        for line in traceback.format_exception(ex.__class__, ex, ex_traceback)
+    ]
+    print("\n".join(tb_lines))
+
+
+def check_results(
+    results: List[Tuple[PluginDesc, Union[Exception, Plugin], Optional[Repo]]]
+) -> Tuple[List[Tuple[PluginDesc, Plugin]], Redirects]:
+    """ """
+    failures: List[Tuple[PluginDesc, Exception]] = []
+    plugins = []
+    redirects: Redirects = {}
+    for pdesc, result, redirect in results:
+        if isinstance(result, Exception):
+            failures.append((pdesc, result))
+        else:
+            new_pdesc = pdesc
+            if redirect is not None:
+                redirects.update({pdesc: redirect})
+                new_pdesc = PluginDesc(redirect, pdesc.branch, pdesc.alias)
+            plugins.append((new_pdesc, result))
+
+    print(f"{len(results) - len(failures)} plugins were checked", end="")
+    if len(failures) == 0:
+        print()
+        return plugins, redirects
+    else:
+        print(f", {len(failures)} plugin(s) could not be downloaded:\n")
+
+        for plugin, exception in failures:
+            print_download_error(plugin, exception)
+
+        sys.exit(1)
+
+
+def make_repo(uri: str, branch) -> Repo:
+    """Instantiate a Repo with the correct specialization depending on server (gitub spec)"""
+    # dumb check to see if it's of the form owner/repo (=> github) or https://...
+    res = urlparse(uri)
+    if res.netloc in ["github.com", ""]:
+        res = res.path.strip("/").split("/")
+        repo = RepoGitHub(res[0], res[1], branch)
+    else:
+        repo = Repo(uri.strip(), branch)
+    return repo
+
+
+def get_cache_path(cache_file_name: str) -> Optional[Path]:
+    xdg_cache = os.environ.get("XDG_CACHE_HOME", None)
+    if xdg_cache is None:
+        home = os.environ.get("HOME", None)
+        if home is None:
+            return None
+        xdg_cache = str(Path(home, ".cache"))
+
+    return Path(xdg_cache, cache_file_name)
+
+
+class Cache:
+    def __init__(self, initial_plugins: List[Plugin], cache_file_name: str) -> None:
+        self.cache_file = get_cache_path(cache_file_name)
+
+        downloads = {}
+        for plugin in initial_plugins:
+            downloads[plugin.commit] = plugin
+        downloads.update(self.load())
+        self.downloads = downloads
+
+    def load(self) -> Dict[str, Plugin]:
+        if self.cache_file is None or not self.cache_file.exists():
+            return {}
+
+        downloads: Dict[str, Plugin] = {}
+        with open(self.cache_file) as f:
+            data = json.load(f)
+            for attr in data.values():
+                p = Plugin(
+                    attr["name"], attr["commit"], attr["has_submodules"], attr["sha256"]
+                )
+                downloads[attr["commit"]] = p
+        return downloads
+
+    def store(self) -> None:
+        if self.cache_file is None:
+            return
+
+        os.makedirs(self.cache_file.parent, exist_ok=True)
+        with open(self.cache_file, "w+") as f:
+            data = {}
+            for name, attr in self.downloads.items():
+                data[name] = attr.as_json()
+            json.dump(data, f, indent=4, sort_keys=True)
+
+    def __getitem__(self, key: str) -> Optional[Plugin]:
+        return self.downloads.get(key, None)
+
+    def __setitem__(self, key: str, value: Plugin) -> None:
+        self.downloads[key] = value
+
+
+def prefetch(
+    pluginDesc: PluginDesc, cache: Cache
+) -> Tuple[PluginDesc, Union[Exception, Plugin], Optional[Repo]]:
+    try:
+        plugin, redirect = prefetch_plugin(pluginDesc, cache)
+        cache[plugin.commit] = plugin
+        return (pluginDesc, plugin, redirect)
+    except Exception as e:
+        return (pluginDesc, e, None)
+
+
+def rewrite_input(
+    config: FetchConfig,
+    input_file: Path,
+    deprecated: Path,
+    # old pluginDesc and the new
+    redirects: Redirects = {},
+    append: List[PluginDesc] = [],
+):
+    plugins = load_plugins_from_csv(
+        config,
+        input_file,
+    )
+
+    plugins.extend(append)
+
+    if redirects:
+        cur_date_iso = datetime.now().strftime("%Y-%m-%d")
+        with open(deprecated, "r") as f:
+            deprecations = json.load(f)
+        for pdesc, new_repo in redirects.items():
+            new_pdesc = PluginDesc(new_repo, pdesc.branch, pdesc.alias)
+            old_plugin, _ = prefetch_plugin(pdesc)
+            new_plugin, _ = prefetch_plugin(new_pdesc)
+            if old_plugin.normalized_name != new_plugin.normalized_name:
+                deprecations[old_plugin.normalized_name] = {
+                    "new": new_plugin.normalized_name,
+                    "date": cur_date_iso,
+                }
+        with open(deprecated, "w") as f:
+            json.dump(deprecations, f, indent=4, sort_keys=True)
+            f.write("\n")
+
+    with open(input_file, "w") as f:
+        log.debug("Writing into %s", input_file)
+        # fields = dataclasses.fields(PluginDesc)
+        fieldnames = ["repo", "branch", "alias"]
+        writer = csv.DictWriter(f, fieldnames, dialect="unix", quoting=csv.QUOTE_NONE)
+        writer.writeheader()
+        for plugin in sorted(plugins):
+            writer.writerow(asdict(plugin))
+
+
+def commit(repo: git.Repo, message: str, files: List[Path]) -> None:
+    repo.index.add([str(f.resolve()) for f in files])
+
+    if repo.index.diff("HEAD"):
+        print(f'committing to nixpkgs "{message}"')
+        repo.index.commit(message)
+    else:
+        print("no changes in working tree to commit")
+
+
+def update_plugins(editor: Editor, args):
+    """The main entry function of this module.
+    All input arguments are grouped in the `Editor`."""
+
+    log.info("Start updating plugins")
+    fetch_config = FetchConfig(args.proc, args.github_token)
+    update = editor.get_update(args.input_file, args.outfile, fetch_config)
+
+    redirects = update()
+    editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, redirects)
+
+    autocommit = not args.no_commit
+
+    if autocommit:
+        try:
+            repo = git.Repo(os.getcwd())
+            updated = datetime.now(tz=UTC).strftime('%Y-%m-%d')
+            print(args.outfile)
+            commit(repo,
+                   f"{editor.attr_path}: update on {updated}", [args.outfile]
+                   )
+        except git.InvalidGitRepositoryError as e:
+            print(f"Not in a git repository: {e}", file=sys.stderr)
+            sys.exit(1)
+
+    if redirects:
+        update()
+        if autocommit:
+            commit(
+                editor.nixpkgs_repo,
+                f"{editor.attr_path}: resolve github repository redirects",
+                [args.outfile, args.input_file, editor.deprecated],
+            )
diff --git a/nixpkgs/maintainers/scripts/rebuild-amount.sh b/nixpkgs/maintainers/scripts/rebuild-amount.sh
new file mode 100755
index 000000000000..32810f6b98c0
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/rebuild-amount.sh
@@ -0,0 +1,133 @@
+#!/usr/bin/env bash
+set -e
+
+# --print: avoid dependency on environment
+optPrint=
+if [ "$1" == "--print" ]; then
+    optPrint=true
+    shift
+fi
+
+if [ "$#" != 1 ] && [ "$#" != 2 ]; then
+    cat <<EOF
+    Usage: $0 [--print] from-commit-spec [to-commit-spec]
+        You need to be in a git-controlled nixpkgs tree.
+        The current state of the tree will be used if the second commit is missing.
+
+        Examples:
+          effect of latest commit:
+              $ $0 HEAD^
+              $ $0 --print HEAD^
+          effect of the whole patch series for 'staging' branch:
+              $ $0 origin/staging staging
+EOF
+    exit 1
+fi
+
+# A slightly hacky way to get the config.
+parallel="$(echo 'config.rebuild-amount.parallel or false' | nix-repl . 2>/dev/null \
+            | grep -v '^\(nix-repl.*\)\?$' | tail -n 1 || true)"
+
+echo "Estimating rebuild amount by counting changed Hydra jobs (parallel=${parallel:-unset})."
+
+toRemove=()
+
+cleanup() {
+    rm -rf "${toRemove[@]}"
+}
+trap cleanup EXIT
+
+MKTEMP='mktemp --tmpdir nix-rebuild-amount-XXXXXXXX'
+
+nixexpr() {
+    cat <<EONIX
+        let
+          lib = import $1/lib;
+          hydraJobs = import $1/pkgs/top-level/release.nix
+            # Compromise: accuracy vs. resources needed for evaluation.
+            { supportedSystems = cfg.systems or [ "x86_64-linux" "x86_64-darwin" ]; };
+          cfg = (import $1 {}).config.rebuild-amount or {};
+
+          recurseIntoAttrs = attrs: attrs // { recurseForDerivations = true; };
+
+          # hydraJobs leaves recurseForDerivations as empty attrmaps;
+          # that would break nix-env and we also need to recurse everywhere.
+          tweak = lib.mapAttrs
+            (name: val:
+              if name == "recurseForDerivations" then true
+              else if lib.isAttrs val && val.type or null != "derivation"
+                      then recurseIntoAttrs (tweak val)
+              else val
+            );
+
+          # Some of these contain explicit references to platform(s) we want to avoid;
+          # some even (transitively) depend on ~/.nixpkgs/config.nix (!)
+          blacklist = [
+            "tarball" "metrics" "manual"
+            "darwin-tested" "unstable" "stdenvBootstrapTools"
+            "moduleSystem" "lib-tests" # these just confuse the output
+          ];
+
+        in
+          tweak (builtins.removeAttrs hydraJobs blacklist)
+EONIX
+}
+
+# Output packages in tree $2 that weren't in $1.
+# Changing the output hash or name is taken as a change.
+# Extra nix-env parameters can be in $3
+newPkgs() {
+    # We use files instead of pipes, as running multiple nix-env processes
+    # could eat too much memory for a standard 4GiB machine.
+    local -a list
+    for i in 1 2; do
+        local l="$($MKTEMP)"
+        list[$i]="$l"
+        toRemove+=("$l")
+
+        local expr="$($MKTEMP)"
+        toRemove+=("$expr")
+        nixexpr "${!i}" > "$expr"
+
+        nix-env -f "$expr" -qaP --no-name --out-path --show-trace $3 \
+            | sort > "${list[$i]}" &
+
+        if [ "$parallel" != "true" ]; then
+            wait
+        fi
+    done
+
+    wait
+    comm -13 "${list[@]}"
+}
+
+# Prepare nixpkgs trees.
+declare -a tree
+for i in 1 2; do
+    if [ -n "${!i}" ]; then # use the given commit
+        dir="$($MKTEMP -d)"
+        tree[$i]="$dir"
+        toRemove+=("$dir")
+
+        git clone --shared --no-checkout --quiet . "${tree[$i]}"
+        (cd "${tree[$i]}" && git checkout --quiet "${!i}")
+    else #use the current tree
+        tree[$i]="$(pwd)"
+    fi
+done
+
+newlist="$($MKTEMP)"
+toRemove+=("$newlist")
+# Notes:
+#    - the evaluation is done on x86_64-linux, like on Hydra.
+#    - using $newlist file so that newPkgs() isn't in a sub-shell (because of toRemove)
+newPkgs "${tree[1]}" "${tree[2]}" '--argstr system "x86_64-linux"' > "$newlist"
+
+# Hacky: keep only the last word of each attribute path and sort.
+sed -n 's/\([^. ]*\.\)*\([^. ]*\) .*$/\2/p' < "$newlist" \
+    | sort | uniq -c
+
+if [ -n "$optPrint" ]; then
+    echo
+    cat "$newlist"
+fi
diff --git a/nixpkgs/maintainers/scripts/remove-old-aliases.py b/nixpkgs/maintainers/scripts/remove-old-aliases.py
new file mode 100755
index 000000000000..3c5f8edc50ad
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/remove-old-aliases.py
@@ -0,0 +1,213 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -i python3 -p "python3.withPackages(ps: with ps; [ ])" nix
+"""
+A program to remove old aliases or convert old aliases to throws
+Example usage:
+./maintainers/scripts/remove-old-aliases.py --year 2018 --file ./pkgs/top-level/aliases.nix
+
+Check this file with mypy after every change!
+$ mypy --strict maintainers/scripts/remove-old-aliases.py
+"""
+import argparse
+import shutil
+import subprocess
+from datetime import date as datetimedate
+from datetime import datetime
+from pathlib import Path
+
+
+def process_args() -> argparse.Namespace:
+    """process args"""
+    arg_parser = argparse.ArgumentParser()
+    arg_parser.add_argument(
+        "--year", required=True, type=int, help="operate on aliases older than $year"
+    )
+    arg_parser.add_argument(
+        "--month",
+        type=int,
+        default=1,
+        help="operate on aliases older than $year-$month",
+    )
+    arg_parser.add_argument(
+        "--only-throws",
+        action="store_true",
+        help="only operate on throws. e.g remove throws older than $date",
+    )
+    arg_parser.add_argument("--file", required=True, type=Path, help="alias file")
+    arg_parser.add_argument(
+        "--dry-run", action="store_true", help="don't modify files, only print results"
+    )
+    return arg_parser.parse_args()
+
+
+def get_date_lists(
+    txt: list[str], cutoffdate: datetimedate, only_throws: bool
+) -> tuple[list[str], list[str], list[str]]:
+    """get a list of lines in which the date is older than $cutoffdate"""
+    date_older_list: list[str] = []
+    date_older_throw_list: list[str] = []
+    date_sep_line_list: list[str] = []
+
+    for lineno, line in enumerate(txt, start=1):
+        line = line.rstrip()
+        my_date = None
+        for string in line.split():
+            string = string.strip(":")
+            try:
+                # strip ':' incase there is a string like 2019-11-01:
+                my_date = datetime.strptime(string, "%Y-%m-%d").date()
+            except ValueError:
+                try:
+                    my_date = datetime.strptime(string, "%Y-%m").date()
+                except ValueError:
+                    continue
+
+        if (
+            my_date is None
+            or my_date > cutoffdate
+            or "preserve, reason:" in line.lower()
+        ):
+            continue
+
+        if "=" not in line:
+            date_sep_line_list.append(f"{lineno} {line}")
+        # 'if' lines could be complicated
+        elif "if " in line and "if =" not in line:
+            print(f"RESOLVE MANUALLY {line}")
+        elif "throw" in line:
+            date_older_throw_list.append(line)
+        elif not only_throws:
+            date_older_list.append(line)
+
+    return (
+        date_older_list,
+        date_sep_line_list,
+        date_older_throw_list,
+    )
+
+
+def convert_to_throw(date_older_list: list[str]) -> list[tuple[str, str]]:
+    """convert a list of lines to throws"""
+    converted_list = []
+    for line in date_older_list.copy():
+        indent: str = " " * (len(line) - len(line.lstrip()))
+        before_equal = ""
+        after_equal = ""
+        try:
+            before_equal, after_equal = (x.strip() for x in line.split("=", maxsplit=2))
+        except ValueError as err:
+            print(err, line, "\n")
+            date_older_list.remove(line)
+            continue
+
+        alias = before_equal
+        alias_unquoted = before_equal.strip('"')
+        replacement = next(x.strip(";:") for x in after_equal.split())
+        replacement = replacement.removeprefix("pkgs.")
+
+        converted = (
+            f"{indent}{alias} = throw \"'{alias_unquoted}' has been"
+            f" renamed to/replaced by '{replacement}'\";"
+            f" # Converted to throw {datetime.today().strftime('%Y-%m-%d')}"
+        )
+        converted_list.append((line, converted))
+
+    return converted_list
+
+
+def generate_text_to_write(
+    txt: list[str],
+    date_older_list: list[str],
+    converted_to_throw: list[tuple[str, str]],
+    date_older_throw_list: list[str],
+) -> list[str]:
+    """generate a list of text to be written to the aliasfile"""
+    text_to_write: list[str] = []
+    for line in txt:
+        text_to_append: str = ""
+        if converted_to_throw:
+            for tupl in converted_to_throw:
+                if line == tupl[0]:
+                    text_to_append = f"{tupl[1]}\n"
+        if line not in date_older_list and line not in date_older_throw_list:
+            text_to_append = f"{line}\n"
+        if text_to_append:
+            text_to_write.append(text_to_append)
+
+    return text_to_write
+
+
+def write_file(
+    aliasfile: Path,
+    text_to_write: list[str],
+) -> None:
+    """write file"""
+    temp_aliasfile = Path(f"{aliasfile}.raliases")
+    with open(temp_aliasfile, "w", encoding="utf-8") as far:
+        for line in text_to_write:
+            far.write(line)
+    print("\nChecking the syntax of the new aliasfile")
+    try:
+        subprocess.run(
+            ["nix-instantiate", "--eval", temp_aliasfile],
+            check=True,
+            stdout=subprocess.DEVNULL,
+        )
+    except subprocess.CalledProcessError:
+        print(
+            "\nSyntax check failed,",
+            "there may have been a line which only has\n"
+            'aliasname = "reason why";\n'
+            "when it should have been\n"
+            'aliasname = throw "reason why";',
+        )
+        temp_aliasfile.unlink()
+        return
+    shutil.move(f"{aliasfile}.raliases", aliasfile)
+    print(f"{aliasfile} modified! please verify with 'git diff'.")
+
+
+def main() -> None:
+    """main"""
+    args = process_args()
+
+    only_throws = args.only_throws
+    aliasfile = Path(args.file).absolute()
+    cutoffdate = (datetime.strptime(f"{args.year}-{args.month}-01", "%Y-%m-%d")).date()
+
+    txt: list[str] = (aliasfile.read_text(encoding="utf-8")).splitlines()
+
+    date_older_list: list[str] = []
+    date_sep_line_list: list[str] = []
+    date_older_throw_list: list[str] = []
+
+    date_older_list, date_sep_line_list, date_older_throw_list = get_date_lists(
+        txt, cutoffdate, only_throws
+    )
+
+    converted_to_throw: list[tuple[str, str]] = []
+    if date_older_list:
+        converted_to_throw = convert_to_throw(date_older_list)
+        print(" Will be converted to throws. ".center(100, "-"))
+        for l_n in date_older_list:
+            print(l_n)
+
+    if date_older_throw_list:
+        print(" Will be removed. ".center(100, "-"))
+        for l_n in date_older_throw_list:
+            print(l_n)
+
+    if date_sep_line_list:
+        print(" On separate line, resolve manually. ".center(100, "-"))
+        for l_n in date_sep_line_list:
+            print(l_n)
+
+    if not args.dry_run:
+        text_to_write = generate_text_to_write(
+            txt, date_older_list, converted_to_throw, date_older_throw_list
+        )
+        write_file(aliasfile, text_to_write)
+
+
+if __name__ == "__main__":
+    main()
diff --git a/nixpkgs/maintainers/scripts/sha-to-sri.py b/nixpkgs/maintainers/scripts/sha-to-sri.py
new file mode 100755
index 000000000000..1af7ff215ad3
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/sha-to-sri.py
@@ -0,0 +1,228 @@
+#!/usr/bin/env nix-shell
+#! nix-shell -i "python3 -I" -p "python3.withPackages(p: with p; [ rich structlog ])"
+
+from abc import ABC, abstractclassmethod, abstractmethod
+from contextlib import contextmanager
+from pathlib import Path
+from structlog.contextvars import bound_contextvars as log_context
+from typing import ClassVar, List, Tuple
+
+import hashlib, re, structlog
+
+
+logger = structlog.getLogger("sha-to-SRI")
+
+
+class Encoding(ABC):
+    alphabet: ClassVar[str]
+
+    @classmethod
+    @property
+    def name(cls) -> str:
+        return cls.__name__.lower()
+
+    def toSRI(self, s: str) -> str:
+        digest = self.decode(s)
+        assert len(digest) == self.n
+
+        from base64 import b64encode
+        return f"{self.hashName}-{b64encode(digest).decode()}"
+
+    @classmethod
+    def all(cls, h) -> 'List[Encoding]':
+        return [ c(h) for c in cls.__subclasses__() ]
+
+    def __init__(self, h):
+        self.n = h.digest_size
+        self.hashName = h.name
+
+    @property
+    @abstractmethod
+    def length(self) -> int:
+        ...
+
+    @property
+    def regex(self) -> str:
+        return f"[{self.alphabet}]{{{self.length}}}"
+
+    @abstractmethod
+    def decode(self, s: str) -> bytes:
+        ...
+
+
+class Nix32(Encoding):
+    alphabet = "0123456789abcdfghijklmnpqrsvwxyz"
+    inverted  = { c: i for i, c in enumerate(alphabet) }
+
+    @property
+    def length(self):
+        return 1 + (8 * self.n) // 5
+    def decode(self, s: str):
+        assert len(s) == self.length
+        out = [ 0 for _ in range(self.n) ]
+        # TODO: Do better than a list of byte-sized ints
+
+        for n, c in enumerate(reversed(s)):
+            digit = self.inverted[c]
+            i, j = divmod(5 * n, 8)
+            out[i] = out[i] | (digit << j) & 0xff
+            rem = digit >> (8 - j)
+            if rem == 0:
+                continue
+            elif i < self.n:
+                out[i+1] = rem
+            else:
+                raise ValueError(f"Invalid nix32 hash: '{s}'")
+
+        return bytes(out)
+
+class Hex(Encoding):
+    alphabet = "0-9A-Fa-f"
+
+    @property
+    def length(self):
+        return 2 * self.n
+    def decode(self, s: str):
+        from binascii import unhexlify
+        return unhexlify(s)
+
+class Base64(Encoding):
+    alphabet = "A-Za-z0-9+/"
+
+    @property
+    def format(self) -> Tuple[int, int]:
+        """Number of characters in data and padding."""
+        i, k = divmod(self.n, 3)
+        return 4 * i + (0 if k == 0 else k + 1), (3 - k) % 3
+    @property
+    def length(self):
+        return sum(self.format)
+    @property
+    def regex(self):
+        data, padding = self.format
+        return f"[{self.alphabet}]{{{data}}}={{{padding}}}"
+    def decode(self, s):
+        from base64 import b64decode
+        return b64decode(s, validate = True)
+
+
+_HASHES = (hashlib.new(n) for n in ('SHA-256', 'SHA-512'))
+ENCODINGS = {
+    h.name: Encoding.all(h)
+    for h in _HASHES
+}
+
+RE = {
+    h: "|".join(
+        (f"({h}-)?" if e.name == 'base64' else '') +
+        f"(?P<{h}_{e.name}>{e.regex})"
+        for e in encodings
+    ) for h, encodings in ENCODINGS.items()
+}
+
+_DEF_RE = re.compile("|".join(
+    f"(?P<{h}>{h} = (?P<{h}_quote>['\"])({re})(?P={h}_quote);)"
+    for h, re in RE.items()
+))
+
+
+def defToSRI(s: str) -> str:
+    def f(m: re.Match[str]) -> str:
+        try:
+            for h, encodings in ENCODINGS.items():
+                if m.group(h) is None:
+                    continue
+
+                for e in encodings:
+                    s = m.group(f"{h}_{e.name}")
+                    if s is not None:
+                        return f'hash = "{e.toSRI(s)}";'
+
+                raise ValueError(f"Match with '{h}' but no subgroup")
+            raise ValueError("Match with no hash")
+
+        except ValueError as exn:
+            logger.error(
+                "Skipping",
+                exc_info = exn,
+            )
+            return m.group()
+
+    return _DEF_RE.sub(f, s)
+
+
+@contextmanager
+def atomicFileUpdate(target: Path):
+    '''Atomically replace the contents of a file.
+
+    Guarantees that no temporary files are left behind, and `target` is either
+    left untouched, or overwritten with new content if no exception was raised.
+
+    Yields a pair `(original, new)` of open files.
+    `original` is the pre-existing file at `target`, open for reading;
+    `new` is an empty, temporary file in the same filder, open for writing.
+
+    Upon exiting the context, the files are closed; if no exception was
+    raised, `new` (atomically) replaces the `target`, otherwise it is deleted.
+    '''
+    # That's mostly copied from noto-emoji.py, should DRY it out
+    from tempfile import mkstemp
+    fd, _p = mkstemp(
+        dir = target.parent,
+        prefix = target.name,
+    )
+    tmpPath = Path(_p)
+
+    try:
+        with target.open() as original:
+            with tmpPath.open('w') as new:
+                yield (original, new)
+
+        tmpPath.replace(target)
+
+    except Exception:
+        tmpPath.unlink(missing_ok = True)
+        raise
+
+
+def fileToSRI(p: Path):
+    with atomicFileUpdate(p) as (og, new):
+        for i, line in enumerate(og):
+            with log_context(line=i):
+                new.write(defToSRI(line))
+
+
+_SKIP_RE = re.compile(
+    "(generated by)|(do not edit)",
+    re.IGNORECASE
+)
+
+if __name__ == "__main__":
+    from sys import argv, stderr
+    logger.info("Starting!")
+
+    for arg in argv[1:]:
+        p = Path(arg)
+        with log_context(path=str(p)):
+            try:
+                if p.name == "yarn.nix" or p.name.find("generated") != -1:
+                    logger.warning("File looks autogenerated, skipping!")
+                    continue
+
+                with p.open() as f:
+                    for line in f:
+                        if line.strip():
+                            break
+
+                    if _SKIP_RE.search(line):
+                        logger.warning("File looks autogenerated, skipping!")
+                        continue
+
+                fileToSRI(p)
+            except Exception as exn:
+                logger.error(
+                    "Unhandled exception, skipping file!",
+                    exc_info = exn,
+                )
+            else:
+                logger.info("Finished processing file")
diff --git a/nixpkgs/maintainers/scripts/update-channel-branches.sh b/nixpkgs/maintainers/scripts/update-channel-branches.sh
new file mode 100755
index 000000000000..eaa731adccce
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update-channel-branches.sh
@@ -0,0 +1,112 @@
+#!/usr/bin/env bash
+set -e
+
+: ${NIXOS_CHANNELS:=https://nixos.org/channels/}
+: ${CHANNELS_NAMESPACE:=refs/heads/channels/}
+
+# List all channels which are currently in the repository which we would
+# have to remove if they are not found again.
+deadChannels=$(git for-each-ref --format="%(refname)" "$CHANNELS_NAMESPACE")
+
+updateRef() {
+    local channelName=$1
+    local newRev=$2
+
+    # if the inputs are not valid, then we do not update any branch.
+    test -z "$newRev" -o -z "$channelName" && return;
+
+    # Update the local refs/heads/channels/* branches to be in-sync with the
+    # channel references.
+    local branch=$CHANNELS_NAMESPACE$channelName
+    oldRev=$(git rev-parse --short "$branch" 2>/dev/null || true)
+    if test "$oldRev" != "$newRev"; then
+        if git update-ref "$branch" "$newRev" 2>/dev/null; then
+            if test -z "$oldRev"; then
+                echo " * [new branch]      $newRev           -> ${branch#refs/heads/}"
+            else
+                echo "                     $oldRev..$newRev  -> ${branch#refs/heads/}"
+            fi
+        else
+            if test -z "$oldRev"; then
+                echo " * [missing rev]     $newRev           -> ${branch#refs/heads/}"
+            else
+                echo "   [missing rev]     $oldRev..$newRev  -> ${branch#refs/heads/}"
+            fi
+        fi
+    fi
+
+    # Filter out the current channel from the list of dead channels.
+    deadChannels=$(grep -v "$CHANNELS_NAMESPACE$channelName" <<EOF
+$deadChannels
+EOF
+) ||true
+}
+
+# Find the name of all channels which are listed in the directory.
+echo "Fetching channels from $NIXOS_CHANNELS:"
+for channelName in : $(curl -s "$NIXOS_CHANNELS" | sed -n '/folder/ { s,.*href=",,; s,/".*,,; p }'); do
+    test "$channelName" = : && continue;
+
+    # Do not follow redirections, such that we can extract the
+    # short-changeset from the name of the directory where we are
+    # redirected to.
+    sha1=$(curl -sI "$NIXOS_CHANNELS$channelName" | sed -n '/Location/ { s,.*\.\([a-f0-9]*\)[ \r]*$,\1,; p; }')
+
+    updateRef "remotes/$channelName" "$sha1"
+done
+
+echo "Fetching channels from nixos-version:"
+if currentSystem=$(nixos-version 2>/dev/null); then
+    # If the system is entirely build from a custom nixpkgs version,
+    # then the version is not annotated in git version. This sed
+    # expression is basically matching that the expressions end with
+    # ".<sha1> (Name)" to extract the sha1.
+    sha1=$(echo "$currentSystem" | sed -n 's,^.*\.\([a-f0-9]*\) *(.*)$,\1,; T skip; p; :skip;')
+
+    updateRef current-system "$sha1"
+fi
+
+echo "Fetching channels from $HOME/.nix-defexpr:"
+for revFile in : $(find -L "$HOME/.nix-defexpr/" -maxdepth 4 -name svn-revision); do
+    test "$revFile" = : && continue;
+
+    # Deconstruct a path such as, into:
+    #
+    #   /home/luke/.nix-defexpr/channels_root/nixos/nixpkgs/svn-revision
+    #     channelName = root/nixos
+    #
+    #   /home/luke/.nix-defexpr/channels/nixpkgs/svn-revision
+    #     channelName = nixpkgs
+    #
+    user=${revFile#*.nix-defexpr/channels}
+    repo=${user#*/}
+    repo=${repo%%/*}
+    user=${user%%/*}
+    user=${user#_}
+    test -z "$user" && user=$USER
+    channelName="$user${user:+/}$repo"
+
+    sha1=$(sed -n 's,^.*\.\([a-f0-9]*\)$,\1,; T skip; p; :skip;' "$revFile")
+
+    updateRef "$channelName" "$sha1"
+done
+
+# Suggest to remove channel branches which are no longer found by this
+# script. This is to handle the cases where a local/remote channel
+# disappear. We should not attempt to remove manually any branches, as they
+# might be user branches.
+if test -n "$deadChannels"; then
+
+    echo "
+Some old channel branches are still in your repository, if you
+want to remove them, run the following command(s):
+"
+
+    while read branch; do
+        echo "    git update-ref -d $branch"
+    done <<EOF
+$deadChannels
+EOF
+
+    echo
+fi
diff --git a/nixpkgs/maintainers/scripts/update-dotnet-lockfiles.nix b/nixpkgs/maintainers/scripts/update-dotnet-lockfiles.nix
new file mode 100644
index 000000000000..22ceff1ffa99
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update-dotnet-lockfiles.nix
@@ -0,0 +1,72 @@
+/*
+  To run:
+
+      nix-shell maintainers/scripts/update-dotnet-lockfiles.nix
+
+  This script finds all the derivations in nixpkgs that have a 'fetch-deps'
+  attribute, and runs all of them sequentially. This is useful to test changes
+  to 'fetch-deps', 'nuget-to-nix', or other changes to the dotnet build
+  infrastructure. Regular updates should be done through the individual packages
+  update scripts.
+ */
+let
+  pkgs = import ../.. {};
+
+  inherit (pkgs) lib;
+
+  packagesWith = cond: pkgs:
+    let
+      packagesWithInner = attrs:
+        lib.unique (
+          lib.concatLists (
+            lib.mapAttrsToList (name: elem:
+              let
+                result = builtins.tryEval elem;
+              in
+                if result.success then
+                  let
+                    value = result.value;
+                  in
+                    if lib.isDerivation value then
+                      lib.optional (cond value) value
+                    else
+                      if lib.isAttrs value && (value.recurseForDerivations or false || value.recurseForRelease or false) then
+                        packagesWithInner value
+                      else []
+                else []) attrs));
+    in
+      packagesWithInner pkgs;
+
+  packages =
+    packagesWith (pkgs: pkgs ? fetch-deps) pkgs;
+
+  helpText = ''
+    Please run:
+
+        % nix-shell maintainers/scripts/update-dotnet-lockfiles.nix
+  '';
+
+  fetchScripts = map (p: p.fetch-deps) packages;
+
+in pkgs.stdenv.mkDerivation {
+  name = "nixpkgs-update-dotnet-lockfiles";
+  buildCommand = ''
+    echo ""
+    echo "----------------------------------------------------------------"
+    echo ""
+    echo "Not possible to update packages using \`nix-build\`"
+    echo ""
+    echo "${helpText}"
+    echo "----------------------------------------------------------------"
+    exit 1
+  '';
+  shellHook = ''
+    unset shellHook # do not contaminate nested shells
+    set -e
+    for x in $fetchScripts; do
+      $x
+    done
+    exit
+  '';
+  inherit fetchScripts;
+}
diff --git a/nixpkgs/maintainers/scripts/update-octave-packages b/nixpkgs/maintainers/scripts/update-octave-packages
new file mode 100755
index 000000000000..00a1646184d5
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update-octave-packages
@@ -0,0 +1,468 @@
+#!/usr/bin/env nix-shell
+#!nix-shell update-octave-shell.nix -i python3
+
+"""
+Update a Octave package expression by passing in the `.nix` file, or the directory containing it.
+You can pass in multiple files or paths.
+
+You'll likely want to use
+``
+  $ ./update-octave-libraries ../../pkgs/development/octave-modules/**/default.nix
+``
+to update all non-pinned libraries in that folder.
+"""
+
+import argparse
+import os
+import pathlib
+import re
+import requests
+import yaml
+from concurrent.futures import ThreadPoolExecutor as Pool
+from packaging.version import Version as _Version
+from packaging.version import InvalidVersion
+from packaging.specifiers import SpecifierSet
+import collections
+import subprocess
+import tempfile
+
+INDEX = "https://raw.githubusercontent.com/gnu-octave/packages/main/packages"
+"""url of Octave packages' source on GitHub"""
+
+EXTENSIONS = ['tar.gz', 'tar.bz2', 'tar', 'zip']
+"""Permitted file extensions. These are evaluated from left to right and the first occurance is returned."""
+
+PRERELEASES = False
+
+GIT = "git"
+
+NIXPGKS_ROOT = subprocess.check_output(["git", "rev-parse", "--show-toplevel"]).decode('utf-8').strip()
+
+import logging
+logging.basicConfig(level=logging.INFO)
+
+
+class Version(_Version, collections.abc.Sequence):
+
+    def __init__(self, version):
+        super().__init__(version)
+        # We cannot use `str(Version(0.04.21))` because that becomes `0.4.21`
+        # https://github.com/avian2/unidecode/issues/13#issuecomment-354538882
+        self.raw_version = version
+
+    def __getitem__(self, i):
+        return self._version.release[i]
+
+    def __len__(self):
+        return len(self._version.release)
+
+    def __iter__(self):
+        yield from self._version.release
+
+
+def _get_values(attribute, text):
+    """Match attribute in text and return all matches.
+
+    :returns: List of matches.
+    """
+    regex = '{}\s+=\s+"(.*)";'.format(attribute)
+    regex = re.compile(regex)
+    values = regex.findall(text)
+    return values
+
+def _get_unique_value(attribute, text):
+    """Match attribute in text and return unique match.
+
+    :returns: Single match.
+    """
+    values = _get_values(attribute, text)
+    n = len(values)
+    if n > 1:
+        raise ValueError("found too many values for {}".format(attribute))
+    elif n == 1:
+        return values[0]
+    else:
+        raise ValueError("no value found for {}".format(attribute))
+
+def _get_line_and_value(attribute, text):
+    """Match attribute in text. Return the line and the value of the attribute."""
+    regex = '({}\s+=\s+"(.*)";)'.format(attribute)
+    regex = re.compile(regex)
+    value = regex.findall(text)
+    n = len(value)
+    if n > 1:
+        raise ValueError("found too many values for {}".format(attribute))
+    elif n == 1:
+        return value[0]
+    else:
+        raise ValueError("no value found for {}".format(attribute))
+
+
+def _replace_value(attribute, value, text):
+    """Search and replace value of attribute in text."""
+    old_line, old_value = _get_line_and_value(attribute, text)
+    new_line = old_line.replace(old_value, value)
+    new_text = text.replace(old_line, new_line)
+    return new_text
+
+
+def _fetch_page(url):
+    r = requests.get(url)
+    if r.status_code == requests.codes.ok:
+        return list(yaml.safe_load_all(r.content))[0]
+    else:
+        raise ValueError("request for {} failed".format(url))
+
+
+def _fetch_github(url):
+    headers = {}
+    token = os.environ.get('GITHUB_API_TOKEN')
+    if token:
+        headers["Authorization"] = f"token {token}"
+    r = requests.get(url, headers=headers)
+
+    if r.status_code == requests.codes.ok:
+        return r.json()
+    else:
+        raise ValueError("request for {} failed".format(url))
+
+
+SEMVER = {
+    'major' : 0,
+    'minor' : 1,
+    'patch' : 2,
+}
+
+
+def _determine_latest_version(current_version, target, versions):
+    """Determine latest version, given `target`, returning the more recent version.
+    """
+    current_version = Version(current_version)
+
+    def _parse_versions(versions):
+        for v in versions:
+            try:
+                yield Version(v)
+            except InvalidVersion:
+                pass
+
+    versions = _parse_versions(versions)
+
+    index = SEMVER[target]
+
+    ceiling = list(current_version[0:index])
+    if len(ceiling) == 0:
+        ceiling = None
+    else:
+        ceiling[-1]+=1
+        ceiling = Version(".".join(map(str, ceiling)))
+
+    # We do not want prereleases
+    versions = SpecifierSet(prereleases=PRERELEASES).filter(versions)
+
+    if ceiling is not None:
+        versions = SpecifierSet(f"<{ceiling}").filter(versions)
+
+    return (max(sorted(versions))).raw_version
+
+
+def _get_latest_version_octave_packages(package, extension, current_version, target):
+    """Get latest version and hash from Octave Packages."""
+    url = "{}/{}.yaml".format(INDEX, package)
+    yaml = _fetch_page(url)
+
+    versions = list(map(lambda pv: pv['id'], yaml['versions']))
+    version = _determine_latest_version(current_version, target, versions)
+
+    try:
+        releases = [v if v['id'] == version else None for v in yaml['versions']]
+    except KeyError as e:
+        raise KeyError('Could not find version {} for {}'.format(version, package)) from e
+    for release in releases:
+        if release['url'].endswith(extension):
+            sha256 = release['sha256']
+            break
+    else:
+        sha256 = None
+    return version, sha256, None
+
+
+def _get_latest_version_github(package, extension, current_version, target):
+    def strip_prefix(tag):
+        return re.sub("^[^0-9]*", "", tag)
+
+    def get_prefix(string):
+        matches = re.findall(r"^([^0-9]*)", string)
+        return next(iter(matches), "")
+
+    # when invoked as an updateScript, UPDATE_NIX_ATTR_PATH will be set
+    # this allows us to work with packages which live outside of octave-modules
+    attr_path = os.environ.get("UPDATE_NIX_ATTR_PATH", f"octavePackages.{package}")
+    try:
+        homepage = subprocess.check_output(
+            ["nix", "eval", "-f", f"{NIXPGKS_ROOT}/default.nix", "--raw", f"{attr_path}.src.meta.homepage"])\
+            .decode('utf-8')
+    except Exception as e:
+        raise ValueError(f"Unable to determine homepage: {e}")
+    owner_repo = homepage[len("https://github.com/"):]  # remove prefix
+    owner, repo = owner_repo.split("/")
+
+    url = f"https://api.github.com/repos/{owner}/{repo}/releases"
+    all_releases = _fetch_github(url)
+    releases = list(filter(lambda x: not x['prerelease'], all_releases))
+
+    if len(releases) == 0:
+        raise ValueError(f"{homepage} does not contain any stable releases")
+
+    versions = map(lambda x: strip_prefix(x['tag_name']), releases)
+    version = _determine_latest_version(current_version, target, versions)
+
+    release = next(filter(lambda x: strip_prefix(x['tag_name']) == version, releases))
+    prefix = get_prefix(release['tag_name'])
+    try:
+        sha256 = subprocess.check_output(["nix-prefetch-url", "--type", "sha256", "--unpack", f"{release['tarball_url']}"], stderr=subprocess.DEVNULL)\
+            .decode('utf-8').strip()
+    except:
+        # this may fail if they have both a branch and a tag of the same name, attempt tag name
+        tag_url = str(release['tarball_url']).replace("tarball","tarball/refs/tags")
+        sha256 = subprocess.check_output(["nix-prefetch-url", "--type", "sha256", "--unpack", tag_url], stderr=subprocess.DEVNULL)\
+            .decode('utf-8').strip()
+
+
+    return version, sha256, prefix
+
+def _get_latest_version_git(package, extension, current_version, target):
+    """NOTE: Unimplemented!"""
+    # attr_path = os.environ.get("UPDATE_NIX_ATTR_PATH", f"octavePackages.{package}")
+    # try:
+    #     download_url = subprocess.check_output(
+    #         ["nix", "--extra-experimental-features", "nix-command", "eval", "-f", f"{NIXPGKS_ROOT}/default.nix", "--raw", f"{attr_path}.src.url"])\
+    #         .decode('utf-8')
+    # except Exception as e:
+    #     raise ValueError(f"Unable to determine download link: {e}")
+
+    # with tempfile.TemporaryDirectory(prefix=attr_path) as new_clone_location:
+    #     subprocess.run(["git", "clone", download_url, new_clone_location])
+    #     newest_commit = subprocess.check_output(
+    #         ["git" "rev-parse" "$(git branch -r)" "|" "tail" "-n" "1"]).decode('utf-8')
+    pass
+
+
+FETCHERS = {
+    'fetchFromGitHub'   :   _get_latest_version_github,
+    'fetchurl'          :   _get_latest_version_octave_packages,
+    'fetchgit'          :   _get_latest_version_git,
+}
+
+
+DEFAULT_SETUPTOOLS_EXTENSION = 'tar.gz'
+
+
+FORMATS = {
+    'setuptools'        :   DEFAULT_SETUPTOOLS_EXTENSION,
+}
+
+def _determine_fetcher(text):
+    # Count occurrences of fetchers.
+    nfetchers = sum(text.count('src = {}'.format(fetcher)) for fetcher in FETCHERS.keys())
+    if nfetchers == 0:
+        raise ValueError("no fetcher.")
+    elif nfetchers > 1:
+        raise ValueError("multiple fetchers.")
+    else:
+        # Then we check which fetcher to use.
+        for fetcher in FETCHERS.keys():
+            if 'src = {}'.format(fetcher) in text:
+                return fetcher
+
+
+def _determine_extension(text, fetcher):
+    """Determine what extension is used in the expression.
+
+    If we use:
+    - fetchPypi, we check if format is specified.
+    - fetchurl, we determine the extension from the url.
+    - fetchFromGitHub we simply use `.tar.gz`.
+    """
+    if fetcher == 'fetchurl':
+        url = _get_unique_value('url', text)
+        extension = os.path.splitext(url)[1]
+
+    elif fetcher == 'fetchFromGitHub' or fetcher == 'fetchgit':
+        if "fetchSubmodules" in text:
+            raise ValueError("fetchFromGitHub fetcher doesn't support submodules")
+        extension = "tar.gz"
+
+    return extension
+
+
+def _update_package(path, target):
+
+    # Read the expression
+    with open(path, 'r') as f:
+        text = f.read()
+
+    # Determine pname. Many files have more than one pname
+    pnames = _get_values('pname', text)
+
+    # Determine version.
+    version = _get_unique_value('version', text)
+
+    # First we check how many fetchers are mentioned.
+    fetcher = _determine_fetcher(text)
+
+    extension = _determine_extension(text, fetcher)
+
+    # Attempt a fetch using each pname, e.g. backports-zoneinfo vs backports.zoneinfo
+    successful_fetch = False
+    for pname in pnames:
+        if fetcher == "fetchgit":
+            logging.warning(f"You must update {pname} MANUALLY!")
+            return { 'path': path, 'target': target, 'pname': pname,
+                     'old_version': version, 'new_version': version }
+        try:
+            new_version, new_sha256, prefix = FETCHERS[fetcher](pname, extension, version, target)
+            successful_fetch = True
+            break
+        except ValueError:
+            continue
+
+    if not successful_fetch:
+        raise ValueError(f"Unable to find correct package using these pnames: {pnames}")
+
+    if new_version == version:
+        logging.info("Path {}: no update available for {}.".format(path, pname))
+        return False
+    elif Version(new_version) <= Version(version):
+        raise ValueError("downgrade for {}.".format(pname))
+    if not new_sha256:
+        raise ValueError("no file available for {}.".format(pname))
+
+    text = _replace_value('version', new_version, text)
+    # hashes from pypi are 16-bit encoded sha256's, normalize it to sri to avoid merge conflicts
+    # sri hashes have been the default format since nix 2.4+
+    sri_hash = subprocess.check_output(["nix", "--extra-experimental-features", "nix-command", "hash", "to-sri", "--type", "sha256", new_sha256]).decode('utf-8').strip()
+
+
+    # fetchers can specify a sha256, or a sri hash
+    try:
+        text = _replace_value('sha256', sri_hash, text)
+    except ValueError:
+        text = _replace_value('hash', sri_hash, text)
+
+    if fetcher == 'fetchFromGitHub':
+        # in the case of fetchFromGitHub, it's common to see `rev = version;` or `rev = "v${version}";`
+        # in which no string value is meant to be substituted. However, we can just overwrite the previous value.
+        regex = '(rev\s+=\s+[^;]*;)'
+        regex = re.compile(regex)
+        matches = regex.findall(text)
+        n = len(matches)
+
+        if n == 0:
+            raise ValueError("Unable to find rev value for {}.".format(pname))
+        else:
+            # forcefully rewrite rev, incase tagging conventions changed for a release
+            match = matches[0]
+            text = text.replace(match, f'rev = "refs/tags/{prefix}${{version}}";')
+            # incase there's no prefix, just rewrite without interpolation
+            text = text.replace('"${version}";', 'version;')
+
+    with open(path, 'w') as f:
+        f.write(text)
+
+        logging.info("Path {}: updated {} from {} to {}".format(path, pname, version, new_version))
+
+    result = {
+        'path'  : path,
+        'target': target,
+        'pname': pname,
+        'old_version'   : version,
+        'new_version'   : new_version,
+        #'fetcher'       : fetcher,
+        }
+
+    return result
+
+
+def _update(path, target):
+
+    # We need to read and modify a Nix expression.
+    if os.path.isdir(path):
+        path = os.path.join(path, 'default.nix')
+
+    # If a default.nix does not exist, we quit.
+    if not os.path.isfile(path):
+        logging.info("Path {}: does not exist.".format(path))
+        return False
+
+    # If file is not a Nix expression, we quit.
+    if not path.endswith(".nix"):
+        logging.info("Path {}: does not end with `.nix`.".format(path))
+        return False
+
+    try:
+        return _update_package(path, target)
+    except ValueError as e:
+        logging.warning("Path {}: {}".format(path, e))
+        return False
+
+
+def _commit(path, pname, old_version, new_version, pkgs_prefix="octave: ", **kwargs):
+    """Commit result.
+    """
+
+    msg = f'{pkgs_prefix}{pname}: {old_version} -> {new_version}'
+
+    try:
+        subprocess.check_call([GIT, 'add', path])
+        subprocess.check_call([GIT, 'commit', '-m', msg])
+    except subprocess.CalledProcessError as e:
+        subprocess.check_call([GIT, 'checkout', path])
+        raise subprocess.CalledProcessError(f'Could not commit {path}') from e
+
+    return True
+
+
+def main():
+
+    epilog = """
+environment variables:
+  GITHUB_API_TOKEN\tGitHub API token used when updating github packages
+    """
+    parser = argparse.ArgumentParser(formatter_class=argparse.RawDescriptionHelpFormatter, epilog=epilog)
+    parser.add_argument('package', type=str, nargs='+')
+    parser.add_argument('--target', type=str, choices=SEMVER.keys(), default='major')
+    parser.add_argument('--commit', action='store_true', help='Create a commit for each package update')
+    parser.add_argument('--use-pkgs-prefix', action='store_true', help='Use octavePackages.${pname}: instead of octave: ${pname}: when making commits')
+
+    args = parser.parse_args()
+    target = args.target
+
+    packages = list(map(os.path.abspath, args.package))
+
+    logging.info("Updating packages...")
+
+    # Use threads to update packages concurrently
+    with Pool() as p:
+        results = list(filter(bool, p.map(lambda pkg: _update(pkg, target), packages)))
+
+    logging.info("Finished updating packages.")
+
+    commit_options = {}
+    if args.use_pkgs_prefix:
+        logging.info("Using octavePackages. prefix for commits")
+        commit_options["pkgs_prefix"] = "octavePackages."
+
+    # Commits are created sequentially.
+    if args.commit:
+        logging.info("Committing updates...")
+        # list forces evaluation
+        list(map(lambda x: _commit(**x, **commit_options), results))
+        logging.info("Finished committing updates")
+
+    count = len(results)
+    logging.info("{} package(s) updated".format(count))
+
+
+if __name__ == '__main__':
+    main()
diff --git a/nixpkgs/maintainers/scripts/update-octave-shell.nix b/nixpkgs/maintainers/scripts/update-octave-shell.nix
new file mode 100644
index 000000000000..51d4844c79f3
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update-octave-shell.nix
@@ -0,0 +1,12 @@
+{ nixpkgs ? import ../.. { }
+}:
+with nixpkgs;
+let
+  pyEnv = python3.withPackages(ps: with ps; [ packaging requests toolz pyyaml ]);
+in
+mkShell {
+  packages = [
+    pyEnv
+    nix-prefetch-scripts
+  ];
+}
diff --git a/nixpkgs/maintainers/scripts/update-python-libraries b/nixpkgs/maintainers/scripts/update-python-libraries
new file mode 100755
index 000000000000..8717808daaf0
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update-python-libraries
@@ -0,0 +1,3 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -I nixpkgs=channel:nixpkgs-unstable -i bash -p "python3.withPackages (ps: with ps; [ packaging requests ])" -p nix-prefetch-git
+exec python3 pkgs/development/interpreters/python/update-python-libraries/update-python-libraries.py $@
diff --git a/nixpkgs/maintainers/scripts/update-redirected-urls.sh b/nixpkgs/maintainers/scripts/update-redirected-urls.sh
new file mode 100755
index 000000000000..5ffa9aca5f68
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update-redirected-urls.sh
@@ -0,0 +1,12 @@
+#! /usr/bin/env nix-shell
+#! nix-shell -p bash curl ripgrep jq -i bash
+
+set -euxo pipefail
+
+# Possibly also add non-https redirect, but there were non of those when I first
+# made this script to test that. Feel free to add it when it is relevant.
+curl https://repology.org/api/v1/repository/nix_unstable/problems \
+   | jq -r '.[] | select(.type == "homepage_permanent_https_redirect") | .data | "s@\(.url)@\(.target)@"' \
+   | sort | uniq | tee script.sed
+find -name '*.nix' | xargs -P4 -- sed -f script.sed -i
+rm script.sed
diff --git a/nixpkgs/maintainers/scripts/update-ruby-packages b/nixpkgs/maintainers/scripts/update-ruby-packages
new file mode 100755
index 000000000000..60da1a1b5938
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update-ruby-packages
@@ -0,0 +1,16 @@
+#!/usr/bin/env nix-shell
+#!nix-shell -i bash -p bundler bundix
+
+set -euf -o pipefail
+
+(
+  cd pkgs/development/ruby-modules/with-packages
+  rm -f gemset.nix Gemfile.lock
+  # Since bundler 2+, the lock command generates a platform-dependent
+  # Gemfile.lock, hence causing to bundix to generate a gemset tied to the
+  # platform from where it was executed.
+  BUNDLE_FORCE_RUBY_PLATFORM=1 bundle lock
+  bundix
+  mv gemset.nix ../../../top-level/ruby-packages.nix
+  rm -f Gemfile.lock
+)
diff --git a/nixpkgs/maintainers/scripts/update.nix b/nixpkgs/maintainers/scripts/update.nix
new file mode 100755
index 000000000000..3aff32caf581
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update.nix
@@ -0,0 +1,227 @@
+/*
+  To run:
+
+      nix-shell maintainers/scripts/update.nix
+
+  See https://nixos.org/manual/nixpkgs/unstable/#var-passthru-updateScript
+*/
+{ package ? null
+, maintainer ? null
+, predicate ? null
+, path ? null
+, max-workers ? null
+, include-overlays ? false
+, keep-going ? null
+, commit ? null
+}:
+
+let
+  pkgs = import ./../../default.nix (
+    if include-overlays == false then
+      { overlays = []; }
+    else if include-overlays == true then
+      { } # Let Nixpkgs include overlays impurely.
+    else { overlays = include-overlays; }
+  );
+
+  inherit (pkgs) lib;
+
+  /* Remove duplicate elements from the list based on some extracted value. O(n^2) complexity.
+   */
+  nubOn = f: list:
+    if list == [] then
+      []
+    else
+      let
+        x = lib.head list;
+        xs = lib.filter (p: f x != f p) (lib.drop 1 list);
+      in
+        [x] ++ nubOn f xs;
+
+  /* Recursively find all packages (derivations) in `pkgs` matching `cond` predicate.
+
+    Type: packagesWithPath :: AttrPath → (AttrPath → derivation → bool) → AttrSet → List<AttrSet{attrPath :: str; package :: derivation; }>
+          AttrPath :: [str]
+
+    The packages will be returned as a list of named pairs comprising of:
+      - attrPath: stringified attribute path (based on `rootPath`)
+      - package: corresponding derivation
+   */
+  packagesWithPath = rootPath: cond: pkgs:
+    let
+      packagesWithPathInner = path: pathContent:
+        let
+          result = builtins.tryEval pathContent;
+
+          somewhatUniqueRepresentant =
+            { package, attrPath }: {
+              inherit (package) updateScript;
+              # Some updaters use the same `updateScript` value for all packages.
+              # Also compare `meta.description`.
+              position = package.meta.position or null;
+              # We cannot always use `meta.position` since it might not be available
+              # or it might be shared among multiple packages.
+            };
+
+          dedupResults = lst: nubOn somewhatUniqueRepresentant (lib.concatLists lst);
+        in
+          if result.success then
+            let
+              evaluatedPathContent = result.value;
+            in
+              if lib.isDerivation evaluatedPathContent then
+                lib.optional (cond path evaluatedPathContent) { attrPath = lib.concatStringsSep "." path; package = evaluatedPathContent; }
+              else if lib.isAttrs evaluatedPathContent then
+                # If user explicitly points to an attrSet or it is marked for recursion, we recur.
+                if path == rootPath || evaluatedPathContent.recurseForDerivations or false || evaluatedPathContent.recurseForRelease or false then
+                  dedupResults (lib.mapAttrsToList (name: elem: packagesWithPathInner (path ++ [name]) elem) evaluatedPathContent)
+                else []
+              else []
+          else [];
+    in
+      packagesWithPathInner rootPath pkgs;
+
+  /* Recursively find all packages (derivations) in `pkgs` matching `cond` predicate.
+   */
+  packagesWith = packagesWithPath [];
+
+  /* Recursively find all packages in `pkgs` with updateScript matching given predicate.
+   */
+  packagesWithUpdateScriptMatchingPredicate = cond:
+    packagesWith (path: pkg: builtins.hasAttr "updateScript" pkg && cond path pkg);
+
+  /* Recursively find all packages in `pkgs` with updateScript by given maintainer.
+   */
+  packagesWithUpdateScriptAndMaintainer = maintainer':
+    let
+      maintainer =
+        if ! builtins.hasAttr maintainer' lib.maintainers then
+          builtins.throw "Maintainer with name `${maintainer'} does not exist in `maintainers/maintainer-list.nix`."
+        else
+          builtins.getAttr maintainer' lib.maintainers;
+    in
+      packagesWithUpdateScriptMatchingPredicate (path: pkg:
+                         (if builtins.hasAttr "maintainers" pkg.meta
+                           then (if builtins.isList pkg.meta.maintainers
+                                   then builtins.elem maintainer pkg.meta.maintainers
+                                   else maintainer == pkg.meta.maintainers
+                                )
+                           else false
+                         )
+                   );
+
+  /* Recursively find all packages under `path` in `pkgs` with updateScript.
+   */
+  packagesWithUpdateScript = path: pkgs:
+    let
+      prefix = lib.splitString "." path;
+      pathContent = lib.attrByPath prefix null pkgs;
+    in
+      if pathContent == null then
+        builtins.throw "Attribute path `${path}` does not exist."
+      else
+        packagesWithPath prefix (path: pkg: builtins.hasAttr "updateScript" pkg)
+                       pathContent;
+
+  /* Find a package under `path` in `pkgs` and require that it has an updateScript.
+   */
+  packageByName = path: pkgs:
+    let
+        package = lib.attrByPath (lib.splitString "." path) null pkgs;
+    in
+      if package == null then
+        builtins.throw "Package with an attribute name `${path}` does not exist."
+      else if ! builtins.hasAttr "updateScript" package then
+        builtins.throw "Package with an attribute name `${path}` does not have a `passthru.updateScript` attribute defined."
+      else
+        { attrPath = path; inherit package; };
+
+  /* List of packages matched based on the CLI arguments.
+   */
+  packages =
+    if package != null then
+      [ (packageByName package pkgs) ]
+    else if predicate != null then
+      packagesWithUpdateScriptMatchingPredicate predicate pkgs
+    else if maintainer != null then
+      packagesWithUpdateScriptAndMaintainer maintainer pkgs
+    else if path != null then
+      packagesWithUpdateScript path pkgs
+    else
+      builtins.throw "No arguments provided.\n\n${helpText}";
+
+  helpText = ''
+    Please run:
+
+        % nix-shell maintainers/scripts/update.nix --argstr maintainer garbas
+
+    to run all update scripts for all packages that lists \`garbas\` as a maintainer
+    and have \`updateScript\` defined, or:
+
+        % nix-shell maintainers/scripts/update.nix --argstr package gnome.nautilus
+
+    to run update script for specific package, or
+
+        % nix-shell maintainers/scripts/update.nix --arg predicate '(path: pkg: pkg.updateScript.name or null == "gnome-update-script")'
+
+    to run update script for all packages matching given predicate, or
+
+        % nix-shell maintainers/scripts/update.nix --argstr path gnome
+
+    to run update script for all package under an attribute path.
+
+    You can also add
+
+        --argstr max-workers 8
+
+    to increase the number of jobs in parallel, or
+
+        --argstr keep-going true
+
+    to continue running when a single update fails.
+
+    You can also make the updater automatically commit on your behalf from updateScripts
+    that support it by adding
+
+        --argstr commit true
+  '';
+
+  /* Transform a matched package into an object for update.py.
+   */
+  packageData = { package, attrPath }: {
+    name = package.name;
+    pname = lib.getName package;
+    oldVersion = lib.getVersion package;
+    updateScript = map builtins.toString (lib.toList (package.updateScript.command or package.updateScript));
+    supportedFeatures = package.updateScript.supportedFeatures or [];
+    attrPath = package.updateScript.attrPath or attrPath;
+  };
+
+  /* JSON file with data for update.py.
+   */
+  packagesJson = pkgs.writeText "packages.json" (builtins.toJSON (map packageData packages));
+
+  optionalArgs =
+    lib.optional (max-workers != null) "--max-workers=${max-workers}"
+    ++ lib.optional (keep-going == "true") "--keep-going"
+    ++ lib.optional (commit == "true") "--commit";
+
+  args = [ packagesJson ] ++ optionalArgs;
+
+in pkgs.stdenv.mkDerivation {
+  name = "nixpkgs-update-script";
+  buildCommand = ''
+    echo ""
+    echo "----------------------------------------------------------------"
+    echo ""
+    echo "Not possible to update packages using \`nix-build\`"
+    echo ""
+    echo "${helpText}"
+    echo "----------------------------------------------------------------"
+    exit 1
+  '';
+  shellHook = ''
+    unset shellHook # do not contaminate nested shells
+    exec ${pkgs.python3.interpreter} ${./update.py} ${builtins.concatStringsSep " " args}
+  '';
+}
diff --git a/nixpkgs/maintainers/scripts/update.py b/nixpkgs/maintainers/scripts/update.py
new file mode 100644
index 000000000000..bbed2bda5e03
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/update.py
@@ -0,0 +1,247 @@
+from __future__ import annotations
+from typing import Dict, Generator, List, Optional, Tuple
+import argparse
+import asyncio
+import contextlib
+import json
+import os
+import re
+import subprocess
+import sys
+import tempfile
+
+class CalledProcessError(Exception):
+    process: asyncio.subprocess.Process
+
+class UpdateFailedException(Exception):
+    pass
+
+def eprint(*args, **kwargs):
+    print(*args, file=sys.stderr, **kwargs)
+
+async def check_subprocess(*args, **kwargs):
+    """
+    Emulate check argument of subprocess.run function.
+    """
+    process = await asyncio.create_subprocess_exec(*args, **kwargs)
+    returncode = await process.wait()
+
+    if returncode != 0:
+        error = CalledProcessError()
+        error.process = process
+
+        raise error
+
+    return process
+
+async def run_update_script(nixpkgs_root: str, merge_lock: asyncio.Lock, temp_dir: Optional[Tuple[str, str]], package: Dict, keep_going: bool):
+    worktree: Optional[str] = None
+
+    update_script_command = package['updateScript']
+
+    if temp_dir is not None:
+        worktree, _branch = temp_dir
+
+        # Ensure the worktree is clean before update.
+        await check_subprocess('git', 'reset', '--hard', '--quiet', 'HEAD', cwd=worktree)
+
+        # Update scripts can use $(dirname $0) to get their location but we want to run
+        # their clones in the git worktree, not in the main nixpkgs repo.
+        update_script_command = map(lambda arg: re.sub(r'^{0}'.format(re.escape(nixpkgs_root)), worktree, arg), update_script_command)
+
+    eprint(f" - {package['name']}: UPDATING ...")
+
+    try:
+        update_process = await check_subprocess(
+            'env',
+            f"UPDATE_NIX_NAME={package['name']}",
+            f"UPDATE_NIX_PNAME={package['pname']}",
+            f"UPDATE_NIX_OLD_VERSION={package['oldVersion']}",
+            f"UPDATE_NIX_ATTR_PATH={package['attrPath']}",
+            *update_script_command,
+            stdout=asyncio.subprocess.PIPE,
+            stderr=asyncio.subprocess.PIPE,
+            cwd=worktree,
+        )
+        update_info = await update_process.stdout.read()
+
+        await merge_changes(merge_lock, package, update_info, temp_dir)
+    except KeyboardInterrupt as e:
+        eprint('Cancelling…')
+        raise asyncio.exceptions.CancelledError()
+    except CalledProcessError as e:
+        eprint(f" - {package['name']}: ERROR")
+        eprint()
+        eprint(f"--- SHOWING ERROR LOG FOR {package['name']} ----------------------")
+        eprint()
+        stderr = await e.process.stderr.read()
+        eprint(stderr.decode('utf-8'))
+        with open(f"{package['pname']}.log", 'wb') as logfile:
+            logfile.write(stderr)
+        eprint()
+        eprint(f"--- SHOWING ERROR LOG FOR {package['name']} ----------------------")
+
+        if not keep_going:
+            raise UpdateFailedException(f"The update script for {package['name']} failed with exit code {e.process.returncode}")
+
+@contextlib.contextmanager
+def make_worktree() -> Generator[Tuple[str, str], None, None]:
+    with tempfile.TemporaryDirectory() as wt:
+        branch_name = f'update-{os.path.basename(wt)}'
+        target_directory = f'{wt}/nixpkgs'
+
+        subprocess.run(['git', 'worktree', 'add', '-b', branch_name, target_directory])
+        yield (target_directory, branch_name)
+        subprocess.run(['git', 'worktree', 'remove', '--force', target_directory])
+        subprocess.run(['git', 'branch', '-D', branch_name])
+
+async def commit_changes(name: str, merge_lock: asyncio.Lock, worktree: str, branch: str, changes: List[Dict]) -> None:
+    for change in changes:
+        # Git can only handle a single index operation at a time
+        async with merge_lock:
+            await check_subprocess('git', 'add', *change['files'], cwd=worktree)
+            commit_message = '{attrPath}: {oldVersion} -> {newVersion}'.format(**change)
+            if 'commitMessage' in change:
+                commit_message = change['commitMessage']
+            elif 'commitBody' in change:
+                commit_message = commit_message + '\n\n' + change['commitBody']
+            await check_subprocess('git', 'commit', '--quiet', '-m', commit_message, cwd=worktree)
+            await check_subprocess('git', 'cherry-pick', branch)
+
+async def check_changes(package: Dict, worktree: str, update_info: str):
+    if 'commit' in package['supportedFeatures']:
+        changes = json.loads(update_info)
+    else:
+        changes = [{}]
+
+    # Try to fill in missing attributes when there is just a single change.
+    if len(changes) == 1:
+        # Dynamic data from updater take precedence over static data from passthru.updateScript.
+        if 'attrPath' not in changes[0]:
+            # update.nix is always passing attrPath
+            changes[0]['attrPath'] = package['attrPath']
+
+        if 'oldVersion' not in changes[0]:
+            # update.nix is always passing oldVersion
+            changes[0]['oldVersion'] = package['oldVersion']
+
+        if 'newVersion' not in changes[0]:
+            attr_path = changes[0]['attrPath']
+            obtain_new_version_process = await check_subprocess('nix-instantiate', '--expr', f'with import ./. {{}}; lib.getVersion {attr_path}', '--eval', '--strict', '--json', stdout=asyncio.subprocess.PIPE, stderr=asyncio.subprocess.PIPE, cwd=worktree)
+            changes[0]['newVersion'] = json.loads((await obtain_new_version_process.stdout.read()).decode('utf-8'))
+
+        if 'files' not in changes[0]:
+            changed_files_process = await check_subprocess('git', 'diff', '--name-only', 'HEAD', stdout=asyncio.subprocess.PIPE, cwd=worktree)
+            changed_files = (await changed_files_process.stdout.read()).splitlines()
+            changes[0]['files'] = changed_files
+
+            if len(changed_files) == 0:
+                return []
+
+    return changes
+
+async def merge_changes(merge_lock: asyncio.Lock, package: Dict, update_info: str, temp_dir: Optional[Tuple[str, str]]) -> None:
+    if temp_dir is not None:
+        worktree, branch = temp_dir
+        changes = await check_changes(package, worktree, update_info)
+
+        if len(changes) > 0:
+            await commit_changes(package['name'], merge_lock, worktree, branch, changes)
+        else:
+            eprint(f" - {package['name']}: DONE, no changes.")
+    else:
+        eprint(f" - {package['name']}: DONE.")
+
+async def updater(nixpkgs_root: str, temp_dir: Optional[Tuple[str, str]], merge_lock: asyncio.Lock, packages_to_update: asyncio.Queue[Optional[Dict]], keep_going: bool, commit: bool):
+    while True:
+        package = await packages_to_update.get()
+        if package is None:
+            # A sentinel received, we are done.
+            return
+
+        if not ('commit' in package['supportedFeatures'] or 'attrPath' in package):
+            temp_dir = None
+
+        await run_update_script(nixpkgs_root, merge_lock, temp_dir, package, keep_going)
+
+async def start_updates(max_workers: int, keep_going: bool, commit: bool, packages: List[Dict]):
+    merge_lock = asyncio.Lock()
+    packages_to_update: asyncio.Queue[Optional[Dict]] = asyncio.Queue()
+
+    with contextlib.ExitStack() as stack:
+        temp_dirs: List[Optional[Tuple[str, str]]] = []
+
+        # Do not create more workers than there are packages.
+        num_workers = min(max_workers, len(packages))
+
+        nixpkgs_root_process = await check_subprocess('git', 'rev-parse', '--show-toplevel', stdout=asyncio.subprocess.PIPE)
+        nixpkgs_root = (await nixpkgs_root_process.stdout.read()).decode('utf-8').strip()
+
+        # Set up temporary directories when using auto-commit.
+        for i in range(num_workers):
+            temp_dir = stack.enter_context(make_worktree()) if commit else None
+            temp_dirs.append(temp_dir)
+
+        # Fill up an update queue,
+        for package in packages:
+            await packages_to_update.put(package)
+
+        # Add sentinels, one for each worker.
+        # A workers will terminate when it gets sentinel from the queue.
+        for i in range(num_workers):
+            await packages_to_update.put(None)
+
+        # Prepare updater workers for each temp_dir directory.
+        # At most `num_workers` instances of `run_update_script` will be running at one time.
+        updaters = asyncio.gather(*[updater(nixpkgs_root, temp_dir, merge_lock, packages_to_update, keep_going, commit) for temp_dir in temp_dirs])
+
+        try:
+            # Start updater workers.
+            await updaters
+        except asyncio.exceptions.CancelledError:
+            # When one worker is cancelled, cancel the others too.
+            updaters.cancel()
+        except UpdateFailedException as e:
+            # When one worker fails, cancel the others, as this exception is only thrown when keep_going is false.
+            updaters.cancel()
+            eprint(e)
+            sys.exit(1)
+
+def main(max_workers: int, keep_going: bool, commit: bool, packages_path: str) -> None:
+    with open(packages_path) as f:
+        packages = json.load(f)
+
+    eprint()
+    eprint('Going to be running update for following packages:')
+    for package in packages:
+        eprint(f" - {package['name']}")
+    eprint()
+
+    confirm = input('Press Enter key to continue...')
+    if confirm == '':
+        eprint()
+        eprint('Running update for:')
+
+        asyncio.run(start_updates(max_workers, keep_going, commit, packages))
+
+        eprint()
+        eprint('Packages updated!')
+        sys.exit()
+    else:
+        eprint('Aborting!')
+        sys.exit(130)
+
+parser = argparse.ArgumentParser(description='Update packages')
+parser.add_argument('--max-workers', '-j', dest='max_workers', type=int, help='Number of updates to run concurrently', nargs='?', default=4)
+parser.add_argument('--keep-going', '-k', dest='keep_going', action='store_true', help='Do not stop after first failure')
+parser.add_argument('--commit', '-c', dest='commit', action='store_true', help='Commit the changes')
+parser.add_argument('packages', help='JSON file containing the list of package names and their update scripts')
+
+if __name__ == '__main__':
+    args = parser.parse_args()
+
+    try:
+        main(args.max_workers, args.keep_going, args.commit, args.packages)
+    except KeyboardInterrupt as e:
+        # Let’s cancel outside of the main loop too.
+        sys.exit(130)
diff --git a/nixpkgs/maintainers/scripts/vanity-manual-equalities.txt b/nixpkgs/maintainers/scripts/vanity-manual-equalities.txt
new file mode 100644
index 000000000000..4a7bc3aea44e
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/vanity-manual-equalities.txt
@@ -0,0 +1,7 @@
+viric	viriketo@gmail.com
+Pjotr Prins	pjotr.public01@thebird.nl
+Pjotr Prins	pjotr.public05@thebird.nl
+Wouter den Breejen	wbreejen
+MarcWeber	marcweber
+Ricardo Correia	Ricardo M. Correia
+ertesx@gmx.de	ertes
diff --git a/nixpkgs/maintainers/scripts/vanity.sh b/nixpkgs/maintainers/scripts/vanity.sh
new file mode 100755
index 000000000000..b879488165df
--- /dev/null
+++ b/nixpkgs/maintainers/scripts/vanity.sh
@@ -0,0 +1,122 @@
+#! /bin/sh
+
+export LANG=C LC_ALL=C LC_COLLATE=C
+
+# Load git log
+raw_git_log="$(git log)"
+git_data="$(echo "$raw_git_log" | grep 'Author:' |
+  sed -e 's/^ *Author://; s/\\//g; s/^ *//; s/ *$//;
+  s/ @ .*//; s/ *[<]/\t/; s/[>]//')"
+
+# Name - nick - email correspondence from log and from maintainer list
+# Also there are a few manual entries
+maintainers="$(cat "$(dirname "$0")/../maintainer-list.nix" |
+  grep '=' | sed -re 's/\\"/''/g;
+  s/[ 	]*([^ 	=]*)[ 	]*=[ 	]*" *(.*[^ ]) *[<](.*)[>] *".*/\1\t\2\t\3/')"
+git_lines="$( ( echo "$git_data";
+    cat "$(dirname "$0")/vanity-manual-equalities.txt") | sort |uniq)"
+
+emails="$(
+    ( echo "$maintainers" | cut -f 3; echo "$git_data" | cut -f 2 ) |
+    sort | uniq | grep -E ".+@.+[.].+"
+    )"
+
+fetchGithubName () {
+    commitid="$(
+        echo "$raw_git_log" | grep -B3 "Author: .*[<]$1[>]" | head -n 3 |
+            grep '^commit ' | tail -n 1 | sed -e 's/^commit //'
+    )"
+    userid="$(
+        curl https://github.com/NixOS/nixpkgs/commit/"$commitid" 2>/dev/null |
+        grep committed -B10 | grep 'href="/' |
+        sed -re 's@.* href="/@@; s@".*@@' |
+        grep -v "/commit/"
+    )";
+    echo "$userid"
+}
+
+[ -n "$NIXPKGS_GITHUB_NAME_CACHE" ] && {
+    echo "$emails" | while read email; do
+        line="$(grep "$email	" "$NIXPKGS_GITHUB_NAME_CACHE")"
+        [ -z "$line" ] && {
+            echo "$email	$(fetchGithubName "$email")" >> \
+                "$NIXPKGS_GITHUB_NAME_CACHE"
+        }
+    done
+}
+
+# For RDF
+normalize_name () {
+    sed -e 's/%/%25/g; s/ /%20/g; s/'\''/%27/g; s/"/%22/g; s/`/%60/g; s/\^/%5e/g; '
+}
+
+denormalize_name () {
+    sed -e 's/%20/ /g; s/%27/'\''/g; s/%22/"/g; s/%60/`/g; s/%5e/^/g; s/%25/%/g;';
+}
+
+n3="$(mktemp --suffix .n3)"
+
+# «The same person» relation and a sorting hint
+# Full name is something with a space
+(
+echo "$git_lines" | sed -re 's@(.*)\t(.*)@<my://name/\1>	<my://can-be>	<my://name/\2>.@'
+echo "$git_lines" | sed -re 's@(.*)\t(.*)@<my://name/\2>	<my://can-be>	<my://name/\1>.@'
+echo "$maintainers" | sed -re 's@(.*)\t(.*)\t(.*)@<my://name/\1>	<my://can-be>	<my://name/\2>.@'
+echo "$maintainers" | sed -re 's@(.*)\t(.*)\t(.*)@<my://name/\2>	<my://can-be>	<my://name/\3>.@'
+echo "$maintainers" | sed -re 's@(.*)\t(.*)\t(.*)@<my://name/\3>	<my://can-be>	<my://name/\1>.@'
+echo "$git_lines" | grep ' ' | cut -f 1 | sed -e 's@.*@<my://name/&>	<my://is-name>	<my://0>.@'
+echo "$git_lines" | grep -v ' ' | cut -f 1 | sed -e 's@.*@<my://name/&>	<my://is-name>	<my://1>.@'
+echo "$maintainers" | cut -f 2 | sed -e 's@.*@<my://name/&>	<my://is-name>	<my://0>.@'
+[ -n "$NIXPKGS_GITHUB_NAME_CACHE" ] && cat "$NIXPKGS_GITHUB_NAME_CACHE" |
+    grep -v "	$" |
+    sed -re 's@(.*)\t(.*)@<my://name/\1>	<my://at-github>	<my://github/\2>.@'
+) | normalize_name | grep -E '<my://[-a-z]+>' | sort | uniq > "$n3"
+
+# Get transitive closure
+sparql="$(nix-build '<nixpkgs>' -Q -A apache-jena --no-out-link)/bin/sparql"
+name_list="$(
+    "$sparql" --results=TSV --data="$n3" "
+    select ?x ?y ?g where {
+      ?x <my://can-be>+ ?y.
+      ?x <my://is-name> ?g.
+        }
+    " | tail -n +2 |
+    sed -re 's@<my://name/@@g; s@<my://@@g; s@>@@g;' |
+    sort -k 2,3 -t '	'
+)"
+github_name_list="$(
+    "$sparql" --results=TSV --data="$n3" "
+    select ?x ?y where {
+      ?x (<my://can-be>+ / <my://at-github>) ?y.
+        }
+    " | tail -n +2 |
+    sed -re 's@<my://(name|github)/@@g; s@<my://@@g; s@>@@g;'
+)"
+
+# Take first spelling option for every person
+name_list_canonical="$(echo "$name_list" | cut -f 1,2 | uniq -f1)"
+
+cleaner_script="$(echo "$name_list_canonical" | denormalize_name |
+  sed -re 's/(.*)\t(.*)/s#^\2$#\1#g/g')"
+
+# Add github usernames
+if [ -n "$NIXPKGS_GITHUB_NAME_CACHE" ]; then
+    github_adder_script="$(mktemp)"
+    echo "$github_name_list" |
+        grep -E "$(echo "$name_list_canonical" | cut -f 2 |
+        tr '\n' '|' )" |
+    sort | uniq |
+        sed -re 's/(.*)\t(.*)/s| \1$| \1\t\2|g;/' |
+    denormalize_name > "$github_adder_script"
+else
+    github_adder_script='/dev/null'
+fi
+
+echo "$name_list" | denormalize_name
+
+echo
+
+echo "$git_data" | cut -f 1 |
+    sed -e "$cleaner_script" |
+    sort | uniq -c | sort -k1n | sed -rf "$github_adder_script" |
+    sed -re 's/^ *([0-9]+) /\1\t/'
diff --git a/nixpkgs/maintainers/team-list.nix b/nixpkgs/maintainers/team-list.nix
new file mode 100644
index 000000000000..2296842d5092
--- /dev/null
+++ b/nixpkgs/maintainers/team-list.nix
@@ -0,0 +1,1001 @@
+/* List of maintainer teams.
+    name = {
+      # Required
+      members = [ maintainer1 maintainer2 ];
+      scope = "Maintain foo packages.";
+      shortName = "foo";
+      # Optional
+      enableFeatureFreezePing = true;
+      githubTeams = [ "my-subsystem" ];
+    };
+
+  where
+
+  - `members` is the list of maintainers belonging to the group,
+  - `scope` describes the scope of the group.
+  - `shortName` short human-readable name
+  - `enableFeatureFreezePing` will ping this team during the Feature Freeze announcements on releases
+    - There is limited mention capacity in a single post, so this should be reserved for critical components
+      or larger ecosystems within nixpkgs.
+  - `githubTeams` will ping specified GitHub teams as well
+
+  More fields may be added in the future.
+
+  When editing this file:
+   * keep the list alphabetically sorted
+   * test the validity of the format with:
+       nix-build lib/tests/teams.nix
+  */
+
+{ lib }:
+with lib.maintainers; {
+  acme = {
+    members = [
+      aanderse
+      andrew-d
+      arianvp
+      emily
+      flokli
+      m1cr0man
+    ];
+    scope = "Maintain ACME-related packages and modules.";
+    shortName = "ACME";
+    enableFeatureFreezePing = true;
+  };
+
+  bazel = {
+    members = [
+      mboes
+      marsam
+      uri-canva
+      cbley
+      olebedev
+      groodt
+      aherrmann
+      ylecornec
+    ];
+    scope = "Bazel build tool & related tools https://bazel.build/";
+    shortName = "Bazel";
+    enableFeatureFreezePing = true;
+  };
+
+  beam = {
+    members = [
+      ankhers
+      Br1ght0ne
+      DianaOlympos
+      gleber
+      happysalada
+      minijackson
+      yurrriq
+    ];
+    githubTeams = [
+      "beam"
+    ];
+    scope = "Maintain BEAM-related packages and modules.";
+    shortName = "BEAM";
+    enableFeatureFreezePing = true;
+  };
+
+  bitnomial = {
+    # Verify additions to this team with at least one already existing member of the team.
+    members = [
+      cdepillabout
+      wraithm
+    ];
+    scope = "Group registration for packages maintained by Bitnomial.";
+    shortName = "Bitnomial employees";
+  };
+
+  blockchains = {
+    members = [
+      mmahut
+      RaghavSood
+    ];
+    scope = "Maintain Blockchain packages and modules.";
+    shortName = "Blockchains";
+  };
+
+  buildbot = {
+    members = [
+      lopsided98
+      mic92
+      zowoq
+    ];
+    scope = "Maintain Buildbot CI framework";
+    shortName = "Buildbot";
+  };
+
+  c = {
+    members = [
+      matthewbauer
+      mic92
+    ];
+    scope = "Maintain C libraries and tooling.";
+    shortName = "C";
+    enableFeatureFreezePing = true;
+  };
+
+  c3d2 = {
+    members = [
+      astro
+      SuperSandro2000
+      revol-xut
+      oxapentane
+    ];
+    scope = "Maintain packages used in the C3D2 hackspace";
+    shortName = "c3d2";
+  };
+
+  cinnamon = {
+    members = [
+      bobby285271
+      mkg20001
+    ];
+    scope = "Maintain Cinnamon desktop environment and applications made by the Linux Mint team.";
+    shortName = "Cinnamon";
+    enableFeatureFreezePing = true;
+  };
+
+  coq = {
+    members = [
+      cohencyril
+      Zimmi48
+      # gares has no entry in the maintainers list
+      siraben
+      vbgl
+      alizter
+    ];
+    scope = "Maintain the Coq theorem prover and related packages.";
+    shortName = "Coq";
+    enableFeatureFreezePing = true;
+  };
+
+  cuda = {
+    members = [
+      connorbaker
+      samuela
+      SomeoneSerge
+    ];
+    scope = "Maintain CUDA-enabled packages";
+    shortName = "Cuda";
+    githubTeams = [ "cuda-maintainers" ];
+  };
+
+  darwin = {
+    members = [
+      toonn
+    ];
+    githubTeams = [
+      "darwin-maintainers"
+    ];
+    scope = "Maintain Darwin compatibility of packages and Darwin-only packages.";
+    shortName = "Darwin";
+    enableFeatureFreezePing = true;
+  };
+
+  cosmopolitan = {
+    members = [
+      bbjubjub
+      tomberek
+    ];
+    scope = "Maintain the Cosmopolitan LibC and related programs.";
+    shortName = "Cosmopolitan";
+  };
+
+  dotnet = {
+    members = [
+      ivar
+      mdarocha
+      corngood
+      raphaelr
+      jamiemagee
+      anpin
+    ];
+    scope = "Maintainers of the .NET build tools and packages";
+    shortName = "dotnet";
+  };
+
+  deepin = {
+    members = [
+      rewine
+    ];
+    scope = "Maintain deepin desktop environment and related packages.";
+    shortName = "DDE";
+    enableFeatureFreezePing = true;
+  };
+
+  deshaw = {
+    # Verify additions to this team with at least one already existing member of the team.
+    members = [
+      de11n
+      invokes-su
+    ];
+    scope = "Group registration for D. E. Shaw employees who collectively maintain packages.";
+    shortName = "D. E. Shaw employees";
+  };
+
+  determinatesystems = {
+    # Verify additions to this team with at least one already existing member of the team.
+    members = [
+      cole-h
+      grahamc
+      hoverbear
+    ];
+    scope = "Group registration for packages maintained by Determinate Systems.";
+    shortName = "Determinate Systems employees";
+  };
+
+  dhall = {
+    members = [
+      Gabriella439
+      ehmry
+    ];
+    scope = "Maintain Dhall and related packages.";
+    shortName = "Dhall";
+    enableFeatureFreezePing = true;
+  };
+
+  docker = {
+    members = [
+      roberth
+      utdemir
+    ];
+    scope = "Maintain Docker and related tools.";
+    shortName = "DockerTools";
+  };
+
+  docs = {
+    members = [
+      asymmetric
+      ryantm
+    ];
+    scope = "Maintain nixpkgs/NixOS documentation and tools for building it.";
+    shortName = "Docs";
+    enableFeatureFreezePing = true;
+  };
+
+  emacs = {
+    members = [
+      adisbladis
+    ];
+    scope = "Maintain the Emacs editor and packages.";
+    shortName = "Emacs";
+  };
+
+  enlightenment = {
+    members = [
+      romildo
+    ];
+    githubTeams = [
+      "enlightenment"
+    ];
+    scope = "Maintain Enlightenment desktop environment and related packages.";
+    shortName = "Enlightenment";
+    enableFeatureFreezePing = true;
+  };
+
+  # Dummy group for the "everyone else" section
+  feature-freeze-everyone-else = {
+    members = [ ];
+    githubTeams = [
+      "nixpkgs-committers"
+      "release-engineers"
+    ];
+    scope = "Dummy team for the #everyone else' section during feture freezes, not to be used as package maintainers!";
+    shortName = "Everyone else";
+    enableFeatureFreezePing = true;
+  };
+
+  flutter = {
+    members = [ mkg20001 RossComputerGuy FlafyDev hacker1024 ];
+    scope = "Maintain Flutter and Dart-related packages and build tools";
+    shortName = "flutter";
+    enableFeatureFreezePing = false;
+    githubTeams = [ "flutter" ];
+  };
+
+  flyingcircus = {
+    # Verify additions by approval of an already existing member of the team.
+    members = [
+      theuni
+      dpausp
+      frlan
+      leona
+    ];
+    scope = "Team for Flying Circus employees who collectively maintain packages.";
+    shortName = "Flying Circus employees";
+  };
+
+  formatter = {
+    members = [
+      piegames
+      infinisil
+      das_j
+      tomberek
+      _0x4A6F
+      # Not in the maintainer list
+      # Sereja313
+    ];
+    scope = "Tentative Nix formatter team to be established in https://github.com/NixOS/rfcs/pull/166";
+    shortName = "Nix formatter team";
+  };
+
+  freedesktop = {
+    members = [ jtojnar ];
+    scope = "Maintain Freedesktop.org packages for graphical desktop.";
+    shortName = "freedesktop.org packaging";
+  };
+
+  gcc = {
+    members = [
+      synthetica
+      vcunat
+      ericson2314
+    ];
+    scope = "Maintain GCC (GNU Compiler Collection) compilers";
+    shortName = "GCC";
+  };
+
+  geospatial = {
+    members = [
+      imincik
+      nh2
+      nialov
+      r-burns
+      sikmir
+      willcohen
+    ];
+    githubTeams = [
+      "geospatial"
+    ];
+    scope = "Maintain geospatial packages.";
+    shortName = "Geospatial";
+    enableFeatureFreezePing = true;
+  };
+
+  gitlab = {
+    members = [
+      globin
+      krav
+      talyz
+      yayayayaka
+      yuka
+    ];
+    scope = "Maintain gitlab packages.";
+    shortName = "gitlab";
+  };
+
+  golang = {
+    members = [
+      kalbasit
+      mic92
+      zowoq
+      qbit
+      mfrw
+    ];
+    githubTeams = [
+      "golang"
+    ];
+    scope = "Maintain Golang compilers.";
+    shortName = "Go";
+    enableFeatureFreezePing = true;
+  };
+
+  gnome = {
+    members = [
+      bobby285271
+      hedning
+      jtojnar
+      dasj19
+      amaxine
+    ];
+    githubTeams = [
+      "gnome"
+    ];
+    scope = "Maintain GNOME desktop environment and platform.";
+    shortName = "GNOME";
+    enableFeatureFreezePing = true;
+  };
+
+  graalvm-ce = {
+    members = [
+      bandresen
+      hlolli
+      glittershark
+      babariviere
+      ericdallo
+      thiagokokada
+    ];
+    scope = "Maintain GraalVM Community Edition packages.";
+    shortName = "GraalVM-CE";
+  };
+
+  haskell = {
+    members = [
+      cdepillabout
+      expipiplus1
+      maralorn
+      ncfavier
+      sternenseemann
+    ];
+    githubTeams = [
+      "haskell"
+    ];
+    scope = "Maintain Haskell packages and infrastructure.";
+    shortName = "Haskell";
+    enableFeatureFreezePing = true;
+  };
+
+  helsinki-systems = {
+    # Verify additions to this team with at least one already existing member of the team.
+    members = [
+      ajs124
+      das_j
+    ];
+    scope = "Group registration for packages maintained by Helsinki Systems";
+    shortName = "Helsinki Systems employees";
+  };
+
+  home-assistant = {
+    members = [
+      fab
+      hexa
+      mic92
+    ];
+    scope = "Maintain the Home Assistant ecosystem";
+    shortName = "Home Assistant";
+  };
+
+  iog = {
+    members = [
+      cleverca22
+      disassembler
+      jonringer
+      manveru
+      nrdxp
+    ];
+    scope = "Input-Output Global employees, which maintain critical software";
+    shortName = "Input-Output Global employees";
+  };
+
+  jitsi = {
+    members = [
+      cleeyv
+      ryantm
+      lassulus
+      yayayayaka
+    ];
+    scope = "Maintain Jitsi.";
+    shortName = "Jitsi";
+  };
+
+  jupyter = {
+    members = [
+      GaetanLepage
+      natsukium
+      thomasjm
+    ];
+    scope = "Maintain Jupyter and related packages.";
+    shortName = "Jupyter";
+  };
+
+  kubernetes = {
+    members = [
+      johanot
+      offline
+      saschagrunert
+      srhb
+    ];
+    scope = "Maintain the Kubernetes package and module";
+    shortName = "Kubernetes";
+  };
+
+  kodi = {
+    members = [
+      aanderse
+      cpages
+      edwtjo
+      minijackson
+      peterhoeg
+      sephalon
+    ];
+    scope = "Maintain Kodi and related packages.";
+    shortName = "Kodi";
+  };
+
+  libretro = {
+    members = [
+      aanderse
+      edwtjo
+      MP2E
+      thiagokokada
+    ];
+    scope = "Maintain Libretro, RetroArch and related packages.";
+    shortName = "Libretro";
+  };
+
+  linux-kernel = {
+    members = [
+      TredwellGit
+      ma27
+      nequissimus
+      qyliss
+    ];
+    scope = "Maintain the Linux kernel.";
+    shortName = "Linux Kernel";
+  };
+
+  lisp = {
+    members = [
+      raskin
+      lukego
+      nagy
+      uthar
+      hraban
+    ];
+    githubTeams = [
+      "lisp"
+    ];
+    scope = "Maintain the Lisp ecosystem.";
+    shortName = "lisp";
+    enableFeatureFreezePing = true;
+  };
+
+  llvm = {
+    members = [
+      dtzWill
+      ericson2314
+      lovek323
+      qyliss
+      raitobezarius
+      rrbutani
+      sternenseemann
+    ];
+    scope = "Maintain LLVM package sets and related packages";
+    shortName = "LLVM";
+    enableFeatureFreezePing = true;
+  };
+
+  lomiri = {
+    members = [
+      OPNA2608
+    ];
+    scope = "Maintain Lomiri desktop environment and related packages.";
+    shortName = "Lomiri";
+    enableFeatureFreezePing = true;
+  };
+
+  lumiguide = {
+    # Verify additions by approval of an already existing member of the team.
+    members = [
+      roelvandijk
+      lucus16
+    ];
+    scope = "Group registration for LumiGuide employees who collectively maintain packages.";
+    shortName = "Lumiguide employees";
+  };
+
+  lua = {
+    githubTeams = [
+      "lua"
+    ];
+    scope = "Maintain the lua ecosystem.";
+    shortName = "lua";
+    enableFeatureFreezePing = true;
+  };
+
+  lumina = {
+    members = [
+      romildo
+    ];
+    githubTeams = [
+      "lumina"
+    ];
+    scope = "Maintain lumina desktop environment and related packages.";
+    shortName = "Lumina";
+    enableFeatureFreezePing = true;
+  };
+
+  lxc = {
+    members = [
+      aanderse
+      adamcstephens
+      jnsgruk
+      megheaiulian
+      mkg20001
+    ];
+    scope = "All things linuxcontainers. LXC, Incus, LXD and related packages.";
+    shortName = "lxc";
+  };
+
+  lxqt = {
+    members = [
+      romildo
+    ];
+    githubTeams = [
+      "lxqt"
+    ];
+    scope = "Maintain LXQt desktop environment and related packages.";
+    shortName = "LXQt";
+    enableFeatureFreezePing = true;
+  };
+
+  marketing = {
+    members = [
+      garbas
+      tomberek
+    ];
+    scope = "Marketing of Nix/NixOS/nixpkgs.";
+    shortName = "Marketing";
+    enableFeatureFreezePing = true;
+  };
+
+  mate = {
+    members = [
+      bobby285271
+      j03
+      romildo
+    ];
+    scope = "Maintain Mate desktop environment and related packages.";
+    shortName = "MATE";
+    enableFeatureFreezePing = true;
+  };
+
+  matrix = {
+    members = [
+      ma27
+      fadenb
+      mguentner
+      ralith
+      dandellion
+      sumnerevans
+      nickcao
+    ];
+    scope = "Maintain the ecosystem around Matrix, a decentralized messenger.";
+    shortName = "Matrix";
+  };
+
+  minimal-bootstrap = {
+    members = [
+      alejandrosame
+      artturin
+      emilytrau
+      ericson2314
+      jk
+      siraben
+    ];
+    scope = "Maintain the minimal-bootstrap toolchain and related packages.";
+    shortName = "Minimal Bootstrap";
+  };
+
+  mercury = {
+    members = [
+      _9999years
+      Gabriella439
+    ];
+    scope = "Group registry for packages maintained by Mercury";
+    shortName = "Mercury Employees";
+  };
+
+  mobile = {
+    members = [
+      samueldr
+    ];
+    scope = "Maintain Mobile NixOS.";
+    shortName = "Mobile";
+  };
+
+  nix = {
+    members = [
+      eelco
+      grahamc
+      pierron
+    ];
+    scope = "Maintain the Nix package manager.";
+    shortName = "Nix/nix-cli ecosystem";
+    enableFeatureFreezePing = true;
+  };
+
+  module-system = {
+    members = [
+      infinisil
+      roberth
+    ];
+    scope = "Maintain the Nixpkgs module system.";
+    shortName = "Module system";
+    enableFeatureFreezePing = true;
+  };
+
+  node = {
+    members = [
+      lilyinstarlight
+      marsam
+      winter
+    ];
+    scope = "Maintain Node.js runtimes and build tooling.";
+    shortName = "Node.js";
+    enableFeatureFreezePing = true;
+  };
+
+  ocaml = {
+    members = [
+      alizter
+    ];
+    githubTeams = [
+      "ocaml"
+    ];
+    scope = "Maintain the OCaml compiler and package set.";
+    shortName = "OCaml";
+    enableFeatureFreezePing = true;
+  };
+
+  openstack = {
+    members = [
+      SuperSandro2000
+    ];
+    scope = "Maintain the ecosystem around OpenStack";
+    shortName = "OpenStack";
+  };
+
+  ororatech = {
+    # email: nixdevs@ororatech.com
+    shortName = "OroraTech GmbH. employees";
+    scope = "Team for packages maintained by employees of OroraTech GmbH.";
+    # Edits to this list should only be done by an already existing member.
+    members = [
+      kip93
+      victormeriqui
+    ];
+  };
+
+  pantheon = {
+    members = [
+      davidak
+      bobby285271
+    ];
+    githubTeams = [
+      "pantheon"
+    ];
+    scope = "Maintain Pantheon desktop environment and platform.";
+    shortName = "Pantheon";
+    enableFeatureFreezePing = true;
+  };
+
+  perl = {
+    members = [
+      sgo
+    ];
+    scope = "Maintain the Perl interpreter and Perl packages.";
+    shortName = "Perl";
+    enableFeatureFreezePing = true;
+  };
+
+  php = {
+    members = [
+      aanderse
+      drupol
+      etu
+      ma27
+      talyz
+    ];
+    githubTeams = [
+      "php"
+    ];
+    scope = "Maintain PHP related packages and extensions.";
+    shortName = "PHP";
+    enableFeatureFreezePing = true;
+  };
+
+  podman = {
+    members = [
+      saschagrunert
+      vdemeester
+    ];
+    githubTeams = [
+      "podman"
+    ];
+    scope = "Maintain Podman and CRI-O related packages and modules.";
+    shortName = "Podman";
+  };
+
+  postgres = {
+    members = [
+      thoughtpolice
+    ];
+    scope = "Maintain the PostgreSQL package and plugins along with the NixOS module.";
+    shortName = "PostgreSQL";
+  };
+
+  python = {
+    members = [
+      fridh
+      hexa
+      jonringer
+      tjni
+    ];
+    scope = "Maintain the Python interpreter and related packages.";
+    shortName = "Python";
+    enableFeatureFreezePing = true;
+  };
+
+  qt-kde = {
+    members = [
+      ilya-fedin
+      k900
+      LunNova
+      mjm
+      nickcao
+      SuperSandro2000
+      ttuegel
+    ];
+    githubTeams = [
+      "qt-kde"
+    ];
+    scope = "Maintain the Qt framework, KDE application suite, Plasma desktop environment and related projects.";
+    shortName = "Qt / KDE";
+    enableFeatureFreezePing = true;
+  };
+
+  r = {
+    members = [
+      bcdarwin
+      jbedo
+    ];
+    scope = "Maintain the R programming language and related packages.";
+    shortName = "R";
+    enableFeatureFreezePing = true;
+  };
+
+  redcodelabs = {
+    members = [
+      unrooted
+      wr0belj
+      wintrmvte
+    ];
+    scope = "Maintain Red Code Labs related packages and modules.";
+    shortName = "Red Code Labs";
+  };
+
+  release = {
+    members = [ ];
+    githubTeams = [
+      "nixos-release-managers"
+    ];
+    scope = "Manage the current nixpkgs/NixOS release.";
+    shortName = "Release";
+  };
+
+  rocm = {
+    members = [
+      Madouura
+      Flakebi
+    ];
+    githubTeams = [
+      "rocm-maintainers"
+    ];
+    scope = "Maintain ROCm and related packages.";
+    shortName = "ROCm";
+  };
+
+  ruby = {
+    members = [
+      marsam
+    ];
+    scope = "Maintain the Ruby interpreter and related packages.";
+    shortName = "Ruby";
+    enableFeatureFreezePing = true;
+  };
+
+  rust = {
+    members = [
+      figsoda
+      mic92
+      tjni
+      winter
+      zowoq
+    ];
+    githubTeams = [
+      "rust"
+    ];
+    scope = "Maintain the Rust compiler toolchain and nixpkgs integration.";
+    shortName = "Rust";
+    enableFeatureFreezePing = true;
+  };
+
+  sage = {
+    members = [
+      timokau
+      omasanori
+      raskin
+      collares
+    ];
+    scope = "Maintain SageMath and the dependencies that are likely to break it.";
+    shortName = "SageMath";
+  };
+
+  sphinx = {
+    members = [ ];
+    scope = "Maintain Sphinx related packages.";
+    shortName = "Sphinx";
+  };
+
+  serokell = {
+    # Verify additions by approval of an already existing member of the team.
+    members = [
+      balsoft
+    ];
+    scope = "Group registration for Serokell employees who collectively maintain packages.";
+    shortName = "Serokell employees";
+  };
+
+  systemd = {
+    members = [ ];
+    githubTeams = [
+      "systemd"
+    ];
+    scope = "Maintain systemd for NixOS.";
+    shortName = "systemd";
+    enableFeatureFreezePing = true;
+  };
+
+  tests = {
+    members = [
+      tfc
+    ];
+    scope = "Maintain the NixOS VM test runner.";
+    shortName = "NixOS tests";
+    enableFeatureFreezePing = true;
+  };
+
+  tts = {
+    members = [
+      mic92
+    ];
+    scope = "coqui-ai TTS (formerly Mozilla TTS) and leaf packages";
+    shortName = "coqui-ai TTS";
+  };
+
+  vim = {
+    members = [
+      figsoda
+      jonringer
+      softinio
+      teto
+    ];
+    scope = "Maintain the vim and neovim text editors and related packages.";
+    shortName = "Vim/Neovim";
+  };
+
+  wdz = {
+    members = [
+      n0emis
+      vidister
+      johannwagner
+      yuka
+    ];
+    scope = "Group registration for WDZ GmbH team members who collectively maintain packages.";
+    shortName = "WDZ GmbH";
+  };
+
+  xfce = {
+    members = [
+      bobby285271
+      romildo
+      muscaln
+    ];
+    scope = "Maintain Xfce desktop environment and related packages.";
+    shortName = "Xfce";
+    enableFeatureFreezePing = true;
+  };
+
+  zig = {
+    members = [
+      AndersonTorres
+      figsoda
+    ];
+    scope = "Maintain the Zig compiler toolchain and nixpkgs integration.";
+    shortName = "Zig";
+    enableFeatureFreezePing = true;
+  };
+}